- Name
- Proline
- InChI
- InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1
- InChI Key
- ONIBWKKTOPOVIA-SCSAIBSYSA-N
- Formula
- C5H9NO2
- SMILES
- O=C(O)C1CCCN1
- Mol. Weight (g/mol)
- 115.13
- CAS
- 147-85-3
- Name
- Pentanoic acid, 4-oxo-
- InChI
- InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)
- InChI Key
- JOOXCMJARBKPKM-UHFFFAOYSA-N
- Formula
- C5H8O3
- SMILES
- CC(=O)CCC(=O)O
- Mol. Weight (g/mol)
- 116.12
- CAS
- 123-76-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 303.15 | 0.9550 |
| 308.15 | 0.6361 |
| 313.15 | 0.4325 |
| 318.15 | 0.3010 |
| 323.15 | 0.2196 |
| 328.15 | 0.1609 |
| 333.15 | 0.1243 |
| 338.15 | 0.0945 |
| 343.15 | 0.0734 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 303.15 | 0.9550 |
| 308.15 | 0.6361 |
| 313.15 | 0.4325 |
| 318.15 | 0.3010 |
| 323.15 | 0.2196 |
| 328.15 | 0.1609 |
| 333.15 | 0.1243 |
| 338.15 | 0.0945 |
| 343.15 | 0.0734 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.476 |
| 298.15 | 1.4747 |
| 303.15 | 1.4734 |
| 308.15 | 1.4719 |
| 313.15 | 1.4704 |
| 318.15 | 1.4689 |
| 323.15 | 1.4675 |
| 328.15 | 1.466 |
| 333.15 | 1.4645 |
| 338.15 | 1.463 |
| 343.15 | 1.4615 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.476 |
| 298.15 | 1.4747 |
| 303.15 | 1.4734 |
| 308.15 | 1.4719 |
| 313.15 | 1.4704 |
| 318.15 | 1.4689 |
| 323.15 | 1.4675 |
| 328.15 | 1.466 |
| 333.15 | 1.4645 |
| 338.15 | 1.463 |
| 343.15 | 1.4615 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1201.0 |
| 298.15 | 1197.25 |
| 303.15 | 1193.51 |
| 308.15 | 1189.76 |
| 313.15 | 1186.04 |
| 318.15 | 1182.36 |
| 323.15 | 1178.69 |
| 328.15 | 1175.01 |
| 333.15 | 1171.34 |
| 338.15 | 1167.68 |
| 343.15 | 1164.03 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1201.0 |
| 298.15 | 1197.25 |
| 303.15 | 1193.51 |
| 308.15 | 1189.76 |
| 313.15 | 1186.04 |
| 318.15 | 1182.36 |
| 323.15 | 1178.69 |
| 328.15 | 1175.01 |
| 333.15 | 1171.34 |
| 338.15 | 1167.68 |
| 343.15 | 1164.03 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 293.15 | 1690.5 |
| 298.15 | 1667.3 |
| 303.15 | 1646.8 |
| 308.15 | 1628.3 |
| 313.15 | 1611.3 |
| 318.15 | 1595.4 |
| 323.15 | 1580.1 |
| 328.15 | 1565.3 |
| 333.15 | 1550.6 |
| 338.15 | 1535.7 |
| 343.15 | 1521.8 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 293.15 | 1690.5 |
| 298.15 | 1667.3 |
| 303.15 | 1646.8 |
| 308.15 | 1628.3 |
| 313.15 | 1611.3 |
| 318.15 | 1595.4 |
| 323.15 | 1580.1 |
| 328.15 | 1565.3 |
| 333.15 | 1550.6 |
| 338.15 | 1535.7 |
| 343.15 | 1521.8 |