- Name
- Proline
- InChI
- InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1
- InChI Key
- ONIBWKKTOPOVIA-SCSAIBSYSA-N
- Formula
- C5H9NO2
- SMILES
- O=C(O)C1CCCN1
- Mol. Weight (g/mol)
- 115.13
- CAS
- 147-85-3
- Name
- Lactic acid
- InChI
- InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)
- InChI Key
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N
- Formula
- C3H6O3
- SMILES
- CC(O)C(=O)O
- Mol. Weight (g/mol)
- 90.08
- CAS
- 50-21-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 323.15 | 0.9974 |
| 328.15 | 0.6751 |
| 333.15 | 0.4724 |
| 338.15 | 0.3389 |
| 343.15 | 0.2461 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 323.15 | 0.9974 |
| 328.15 | 0.6751 |
| 333.15 | 0.4724 |
| 338.15 | 0.3389 |
| 343.15 | 0.2461 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4889 |
| 298.15 | 1.4876 |
| 303.15 | 1.4862 |
| 308.15 | 1.4847 |
| 313.15 | 1.4833 |
| 318.15 | 1.4819 |
| 323.15 | 1.4805 |
| 328.15 | 1.479 |
| 333.15 | 1.4776 |
| 338.15 | 1.4762 |
| 343.15 | 1.4747 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4889 |
| 298.15 | 1.4876 |
| 303.15 | 1.4862 |
| 308.15 | 1.4847 |
| 313.15 | 1.4833 |
| 318.15 | 1.4819 |
| 323.15 | 1.4805 |
| 328.15 | 1.479 |
| 333.15 | 1.4776 |
| 338.15 | 1.4762 |
| 343.15 | 1.4747 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1265.11 |
| 298.15 | 1262.58 |
| 303.15 | 1258.07 |
| 308.15 | 1254.56 |
| 313.15 | 1251.05 |
| 318.15 | 1247.55 |
| 323.15 | 1244.03 |
| 328.15 | 1240.49 |
| 333.15 | 1237.01 |
| 338.15 | 1233.56 |
| 343.15 | 1230.14 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1265.11 |
| 298.15 | 1262.58 |
| 303.15 | 1258.07 |
| 308.15 | 1254.56 |
| 313.15 | 1251.05 |
| 318.15 | 1247.55 |
| 323.15 | 1244.03 |
| 328.15 | 1240.49 |
| 333.15 | 1237.01 |
| 338.15 | 1233.56 |
| 343.15 | 1230.14 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 298.15 | 1850.0 |
| 303.15 | 1805.8 |
| 308.15 | 1773.1 |
| 313.15 | 1748.1 |
| 318.15 | 1727.6 |
| 323.15 | 1709.9 |
| 328.15 | 1693.9 |
| 333.15 | 1679.2 |
| 338.15 | 1665.2 |
| 343.15 | 1651.9 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 298.15 | 1850.0 |
| 303.15 | 1805.8 |
| 308.15 | 1773.1 |
| 313.15 | 1748.1 |
| 318.15 | 1727.6 |
| 323.15 | 1709.9 |
| 328.15 | 1693.9 |
| 333.15 | 1679.2 |
| 338.15 | 1665.2 |
| 343.15 | 1651.9 |