- Name
- Ammonia
- InChI
- InChI=1S/H3N/h1H3
- InChI Key
- QGZKDVFQNNGYKY-UHFFFAOYSA-N
- Formula
- H3N
- SMILES
- N
- Mol. Weight (g/mol)
- 17.03
- CAS
- 7664-41-7
- Name
- Choline chloride
- InChI
- InChI=1S/C5H14NO.ClH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1
- InChI Key
- SGMZJAMFUVOLNK-UHFFFAOYSA-M
- Formula
- C5H14ClNO
- SMILES
- C[N+](C)(C)CCO.[Cl-]
- Mol. Weight (g/mol)
- 139.62
- CAS
- 67-48-1
- Name
- Glycerin
- InChI
- InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2
- InChI Key
- PEDCQBHIVMGVHV-UHFFFAOYSA-N
- Formula
- C3H8O3
- SMILES
- OCC(O)CO
- Mol. Weight (g/mol)
- 92.09
- CAS
- 56-81-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Ammonia (1) [ref]
Operational condition: Solvent: Mole fraction = 0.333 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Ammonia (1) - Liquid |
| 303.15 | 23.10 | 1.288 |
| 303.15 | 70.10 | 3.095 |
| 303.15 | 162.10 | 5.916 |
| 303.15 | 231.10 | 7.764 |
| 303.15 | 305.40 | 9.606 |
| 303.15 | 336.50 | 10.51 |
| 303.15 | 372.60 | 11.34 |
| 303.15 | 433.40 | 12.98 |
| 303.15 | 523.80 | 15.38 |
| 313.15 | 23.00 | 0.5750 |
| 313.15 | 57.50 | 1.395 |
| 313.15 | 90.00 | 2.119 |
| 313.15 | 132.30 | 3.024 |
| 313.15 | 184.00 | 4.105 |
| 313.15 | 249.80 | 5.452 |
| 313.15 | 357.40 | 7.849 |
| 313.15 | 453.80 | 9.639 |
| 313.15 | 568.40 | 11.61 |
| 323.15 | 9.90 | 0.2900 |
| 323.15 | 27.90 | 0.6420 |
| 323.15 | 67.30 | 1.356 |
| 323.15 | 105.70 | 2.014 |
| 323.15 | 172.70 | 2.858 |
| 323.15 | 242.10 | 3.781 |
| 323.15 | 298.40 | 4.76 |
| 323.15 | 393.90 | 6.185 |
| 323.15 | 517.10 | 7.935 |
| 333.15 | 30.50 | 0.3880 |
| 333.15 | 68.10 | 0.8440 |
| 333.15 | 109.30 | 1.341 |
| 333.15 | 152.40 | 1.856 |
| 333.15 | 220.60 | 2.662 |
| 333.15 | 276.90 | 3.311 |
| 333.15 | 327.60 | 3.879 |
| 333.15 | 405.30 | 4.649 |
| 333.15 | 511.30 | 5.737 |
Molality, mol/kg of Ammonia (1) [ref]
Operational condition: Solvent: Mole fraction = 0.333 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Ammonia (1) - Liquid |
| 303.15 | 23.10 | 1.288 |
| 303.15 | 70.10 | 3.095 |
| 303.15 | 162.10 | 5.916 |
| 303.15 | 231.10 | 7.764 |
| 303.15 | 305.40 | 9.606 |
| 303.15 | 336.50 | 10.51 |
| 303.15 | 372.60 | 11.34 |
| 303.15 | 433.40 | 12.98 |
| 303.15 | 523.80 | 15.38 |
| 313.15 | 23.00 | 0.5750 |
| 313.15 | 57.50 | 1.395 |
| 313.15 | 90.00 | 2.119 |
| 313.15 | 132.30 | 3.024 |
| 313.15 | 184.00 | 4.105 |
| 313.15 | 249.80 | 5.452 |
| 313.15 | 357.40 | 7.849 |
| 313.15 | 453.80 | 9.639 |
| 313.15 | 568.40 | 11.61 |
| 323.15 | 9.90 | 0.2900 |
| 323.15 | 27.90 | 0.6420 |
| 323.15 | 67.30 | 1.356 |
| 323.15 | 105.70 | 2.014 |
| 323.15 | 172.70 | 2.858 |
| 323.15 | 242.10 | 3.781 |
| 323.15 | 298.40 | 4.76 |
| 323.15 | 393.90 | 6.185 |
| 323.15 | 517.10 | 7.935 |
| 333.15 | 30.50 | 0.3880 |
| 333.15 | 68.10 | 0.8440 |
| 333.15 | 109.30 | 1.341 |
| 333.15 | 152.40 | 1.856 |
| 333.15 | 220.60 | 2.662 |
| 333.15 | 276.90 | 3.311 |
| 333.15 | 327.60 | 3.879 |
| 333.15 | 405.30 | 4.649 |
| 333.15 | 511.30 | 5.737 |