- Name
- Toluene
- InChI
- InChI=1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- YXFVVABEGXRONW-UHFFFAOYSA-N
- Formula
- C7H8
- SMILES
- Cc1ccccc1
- Mol. Weight (g/mol)
- 92.14
- CAS
- 108-88-3
- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Pyrene
- InChI
- InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H
- InChI Key
- BBEAQIROQSPTKN-UHFFFAOYSA-N
- Formula
- C16H10
- SMILES
- c1cc2ccc3cccc4ccc(c1)c2c34
- Mol. Weight (g/mol)
- 202.25
- CAS
- 129-00-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Amount ratio of component to other component of binary solvent of Isopropyl Alcohol (2) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 283.15 | 0.1429 | 0.0397 |
| 283.25 | 0.5000 | 0.0287 |
| 283.35 | 1.0000 | 0.0200 |
| 283.35 | 2.0 | 0.0106 |
| 283.35 | 7.0 | 0.0040 |
| 289.95 | 1.0000 | 0.0233 |
| 290.05 | 7.0 | 0.0049 |
| 290.15 | 0.1429 | 0.0456 |
| 290.15 | 0.5000 | 0.0346 |
| 290.15 | 2.0 | 0.0136 |
| 296.35 | 0.5000 | 0.0411 |
| 297.15 | 0.1429 | 0.0584 |
| 297.15 | 1.0000 | 0.0300 |
| 297.15 | 2.0 | 0.0171 |
| 297.25 | 7.0 | 0.0065 |
| 304.15 | 0.1429 | 0.0704 |
| 304.15 | 1.0000 | 0.0353 |
| 304.15 | 2.0 | 0.0208 |
| 304.15 | 7.0 | 0.0081 |
| 304.25 | 0.5000 | 0.0513 |
| 310.85 | 0.1429 | 0.0852 |
| 310.95 | 2.0 | 0.0260 |
| 310.95 | 7.0 | 0.0102 |
| 311.15 | 0.5000 | 0.0622 |
| 311.15 | 1.0000 | 0.0434 |
| 317.95 | 0.1429 | 0.1036 |
| 317.95 | 2.0 | 0.0327 |
| 318.05 | 7.0 | 0.0127 |
| 318.15 | 0.5000 | 0.0771 |
| 318.15 | 1.0000 | 0.0539 |
| 324.85 | 0.1429 | 0.1288 |
| 324.85 | 0.5000 | 0.0949 |
| 324.85 | 1.0000 | 0.0671 |
| 324.85 | 7.0 | 0.0161 |
| 324.95 | 2.0 | 0.0411 |
| 333.15 | 0.1429 | 0.1582 |
| 333.15 | 2.0 | 0.0564 |
| 333.35 | 0.5000 | 0.1239 |
| 333.35 | 1.0000 | 0.0893 |
| 333.35 | 7.0 | 0.0202 |
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Amount ratio of component to other component of binary solvent of Isopropyl Alcohol (2) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 283.15 | 0.1429 | 0.0397 |
| 283.25 | 0.5000 | 0.0287 |
| 283.35 | 1.0000 | 0.0200 |
| 283.35 | 2.0 | 0.0106 |
| 283.35 | 7.0 | 0.0040 |
| 289.95 | 1.0000 | 0.0233 |
| 290.05 | 7.0 | 0.0049 |
| 290.15 | 0.1429 | 0.0456 |
| 290.15 | 0.5000 | 0.0346 |
| 290.15 | 2.0 | 0.0136 |
| 296.35 | 0.5000 | 0.0411 |
| 297.15 | 0.1429 | 0.0584 |
| 297.15 | 1.0000 | 0.0300 |
| 297.15 | 2.0 | 0.0171 |
| 297.25 | 7.0 | 0.0065 |
| 304.15 | 0.1429 | 0.0704 |
| 304.15 | 1.0000 | 0.0353 |
| 304.15 | 2.0 | 0.0208 |
| 304.15 | 7.0 | 0.0081 |
| 304.25 | 0.5000 | 0.0513 |
| 310.85 | 0.1429 | 0.0852 |
| 310.95 | 2.0 | 0.0260 |
| 310.95 | 7.0 | 0.0102 |
| 311.15 | 0.5000 | 0.0622 |
| 311.15 | 1.0000 | 0.0434 |
| 317.95 | 0.1429 | 0.1036 |
| 317.95 | 2.0 | 0.0327 |
| 318.05 | 7.0 | 0.0127 |
| 318.15 | 0.5000 | 0.0771 |
| 318.15 | 1.0000 | 0.0539 |
| 324.85 | 0.1429 | 0.1288 |
| 324.85 | 0.5000 | 0.0949 |
| 324.85 | 1.0000 | 0.0671 |
| 324.85 | 7.0 | 0.0161 |
| 324.95 | 2.0 | 0.0411 |
| 333.15 | 0.1429 | 0.1582 |
| 333.15 | 2.0 | 0.0564 |
| 333.35 | 0.5000 | 0.1239 |
| 333.35 | 1.0000 | 0.0893 |
| 333.35 | 7.0 | 0.0202 |