- Name
- potassium chloride
- InChI
- InChI=1S/ClH.K/h1H;/q;+1/p-1
- InChI Key
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M
- Formula
- ClK
- SMILES
- [Cl-].[K+]
- Mol. Weight (g/mol)
- 74.55
- CAS
- 7447-40-7
- Name
- dl-Serine
- InChI
- InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)
- InChI Key
- MTCFGRXMJLQNBG-UHFFFAOYSA-N
- Formula
- C3H7NO3
- SMILES
- NC(CO)C(=O)O
- Mol. Weight (g/mol)
- 105.09
- CAS
- 302-84-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of dl-Serine (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Solvent: Molality, mol/kg of potassium chloride (1) - Liquid | Temperature, K - Liquid | Molality, mol/kg of dl-Serine (2) - Liquid |
| 0.0000 | 288.15 | 0.4600 |
| 0.0000 | 293.15 | 0.4960 |
| 0.0000 | 298.15 | 0.5290 |
| 0.0000 | 303.15 | 0.5590 |
| 0.0000 | 308.15 | 0.5860 |
| 0.5000 | 288.15 | 0.5830 |
| 0.5000 | 293.15 | 0.5920 |
| 0.5000 | 298.15 | 0.6090 |
| 0.5000 | 303.15 | 0.6500 |
| 0.5000 | 308.15 | 0.6700 |
| 1.0000 | 288.15 | 0.6580 |
| 1.0000 | 293.15 | 0.7040 |
| 1.0000 | 298.15 | 0.7260 |
| 1.0000 | 303.15 | 0.7540 |
| 1.0000 | 308.15 | 0.8280 |
| 1.5 | 288.15 | 0.7060 |
| 1.5 | 293.15 | 0.7680 |
| 1.5 | 298.15 | 0.8290 |
| 1.5 | 303.15 | 0.8660 |
| 1.5 | 308.15 | 0.9020 |
| 2.0 | 288.15 | 0.7420 |
| 2.0 | 293.15 | 0.8400 |
| 2.0 | 298.15 | 0.9250 |
| 2.0 | 303.15 | 0.9450 |
| 2.0 | 308.15 | 1.004 |
| 2.5 | 288.15 | 0.8240 |
| 2.5 | 293.15 | 0.8880 |
| 2.5 | 298.15 | 0.9780 |
| 2.5 | 303.15 | 1.044 |
| 2.5 | 308.15 | 1.122 |
| 3.0 | 288.15 | 0.8680 |
| 3.0 | 293.15 | 0.9600 |
| 3.0 | 298.15 | 1.056 |
| 3.0 | 303.15 | 1.17 |
| 3.0 | 308.15 | 1.234 |
| 3.5 | 288.15 | 0.9300 |
| 3.5 | 293.15 | 1.07 |
| 3.5 | 298.15 | 1.138 |
| 3.5 | 303.15 | 1.26 |
| 3.5 | 308.15 | 1.364 |
Molality, mol/kg of dl-Serine (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Solvent: Molality, mol/kg of potassium chloride (1) - Liquid | Temperature, K - Liquid | Molality, mol/kg of dl-Serine (2) - Liquid |
| 0.0000 | 288.15 | 0.4600 |
| 0.0000 | 293.15 | 0.4960 |
| 0.0000 | 298.15 | 0.5290 |
| 0.0000 | 303.15 | 0.5590 |
| 0.0000 | 308.15 | 0.5860 |
| 0.5000 | 288.15 | 0.5830 |
| 0.5000 | 293.15 | 0.5920 |
| 0.5000 | 298.15 | 0.6090 |
| 0.5000 | 303.15 | 0.6500 |
| 0.5000 | 308.15 | 0.6700 |
| 1.0000 | 288.15 | 0.6580 |
| 1.0000 | 293.15 | 0.7040 |
| 1.0000 | 298.15 | 0.7260 |
| 1.0000 | 303.15 | 0.7540 |
| 1.0000 | 308.15 | 0.8280 |
| 1.5 | 288.15 | 0.7060 |
| 1.5 | 293.15 | 0.7680 |
| 1.5 | 298.15 | 0.8290 |
| 1.5 | 303.15 | 0.8660 |
| 1.5 | 308.15 | 0.9020 |
| 2.0 | 288.15 | 0.7420 |
| 2.0 | 293.15 | 0.8400 |
| 2.0 | 298.15 | 0.9250 |
| 2.0 | 303.15 | 0.9450 |
| 2.0 | 308.15 | 1.004 |
| 2.5 | 288.15 | 0.8240 |
| 2.5 | 293.15 | 0.8880 |
| 2.5 | 298.15 | 0.9780 |
| 2.5 | 303.15 | 1.044 |
| 2.5 | 308.15 | 1.122 |
| 3.0 | 288.15 | 0.8680 |
| 3.0 | 293.15 | 0.9600 |
| 3.0 | 298.15 | 1.056 |
| 3.0 | 303.15 | 1.17 |
| 3.0 | 308.15 | 1.234 |
| 3.5 | 288.15 | 0.9300 |
| 3.5 | 293.15 | 1.07 |
| 3.5 | 298.15 | 1.138 |
| 3.5 | 303.15 | 1.26 |
| 3.5 | 308.15 | 1.364 |