- Name
- Tetra-N-butylammonium chloride
- InChI
- InChI=1S/C16H36N.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- NHGXDBSUJJNIRV-UHFFFAOYSA-M
- Formula
- C16H36ClN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Cl-]
- Mol. Weight (g/mol)
- 277.92
- CAS
- 1112-67-0
- Name
- Glycerin
- InChI
- InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2
- InChI Key
- PEDCQBHIVMGVHV-UHFFFAOYSA-N
- Formula
- C3H8O3
- SMILES
- OCC(O)CO
- Mol. Weight (g/mol)
- 92.09
- CAS
- 56-81-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- η - Viscosity, Pa*s (2)
- σcond - Electrical conductivity, S/m (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.17 (Liquid)
| Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 298.20 | 281.20 |
| 300.70 | 282.50 |
| 303.20 | 283.90 |
| 305.70 | 285.40 |
| 308.20 | 286.90 |
| 310.70 | 288.10 |
| 313.20 | 289.40 |
| 315.70 | 290.70 |
| 318.20 | 292.00 |
| 320.70 | 293.40 |
| 323.20 | 294.50 |
| 325.70 | 296.10 |
| 328.20 | 297.40 |
| 330.70 | 298.90 |
| 333.20 | 300.40 |
| 335.70 | 301.90 |
| 338.20 | 303.20 |
| 340.70 | 304.60 |
| 343.20 | 305.70 |
| 345.70 | 306.90 |
| 348.20 | 307.80 |
| 350.70 | 308.60 |
| 353.20 | 310.90 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.17 (Liquid)
| Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 298.20 | 281.20 |
| 300.70 | 282.50 |
| 303.20 | 283.90 |
| 305.70 | 285.40 |
| 308.20 | 286.90 |
| 310.70 | 288.10 |
| 313.20 | 289.40 |
| 315.70 | 290.70 |
| 318.20 | 292.00 |
| 320.70 | 293.40 |
| 323.20 | 294.50 |
| 325.70 | 296.10 |
| 328.20 | 297.40 |
| 330.70 | 298.90 |
| 333.20 | 300.40 |
| 335.70 | 301.90 |
| 338.20 | 303.20 |
| 340.70 | 304.60 |
| 343.20 | 305.70 |
| 345.70 | 306.90 |
| 348.20 | 307.80 |
| 350.70 | 308.60 |
| 353.20 | 310.90 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.2500 | 1.17 |
| 303.15 | 0.2500 | 0.5800 |
| 313.15 | 0.2500 | 0.2933 |
| 323.15 | 0.2500 | 0.1570 |
| 333.15 | 0.2500 | 0.0907 |
| 343.15 | 0.2500 | 0.0567 |
| 353.15 | 0.2500 | 0.0367 |
| 293.15 | 0.2000 | 0.9500 |
| 303.15 | 0.2000 | 0.4761 |
| 313.15 | 0.2000 | 0.2250 |
| 323.15 | 0.2000 | 0.1157 |
| 333.15 | 0.2000 | 0.0647 |
| 343.15 | 0.2000 | 0.0419 |
| 353.15 | 0.2000 | 0.0250 |
| 293.15 | 0.1670 | 1.1 |
| 303.15 | 0.1670 | 0.5413 |
| 313.15 | 0.1670 | 0.2610 |
| 323.15 | 0.1670 | 0.1373 |
| 333.15 | 0.1670 | 0.0784 |
| 343.15 | 0.1670 | 0.0476 |
| 353.15 | 0.1670 | 0.0320 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.2500 | 1.17 |
| 303.15 | 0.2500 | 0.5800 |
| 313.15 | 0.2500 | 0.2933 |
| 323.15 | 0.2500 | 0.1570 |
| 333.15 | 0.2500 | 0.0907 |
| 343.15 | 0.2500 | 0.0567 |
| 353.15 | 0.2500 | 0.0367 |
| 293.15 | 0.2000 | 0.9500 |
| 303.15 | 0.2000 | 0.4761 |
| 313.15 | 0.2000 | 0.2250 |
| 323.15 | 0.2000 | 0.1157 |
| 333.15 | 0.2000 | 0.0647 |
| 343.15 | 0.2000 | 0.0419 |
| 353.15 | 0.2000 | 0.0250 |
| 293.15 | 0.1670 | 1.1 |
| 303.15 | 0.1670 | 0.5413 |
| 313.15 | 0.1670 | 0.2610 |
| 323.15 | 0.1670 | 0.1373 |
| 333.15 | 0.1670 | 0.0784 |
| 343.15 | 0.1670 | 0.0476 |
| 353.15 | 0.1670 | 0.0320 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Electrical conductivity, S/m - Liquid |
| 293.15 | 0.2500 | 0.0170 |
| 303.15 | 0.2500 | 0.0309 |
| 313.15 | 0.2500 | 0.0485 |
| 323.15 | 0.2500 | 0.0781 |
| 333.15 | 0.2500 | 0.1172 |
| 343.15 | 0.2500 | 0.1510 |
| 353.15 | 0.2500 | 0.2400 |
| 293.15 | 0.2000 | 0.0192 |
| 303.15 | 0.2000 | 0.0358 |
| 313.15 | 0.2000 | 0.0525 |
| 323.15 | 0.2000 | 0.0863 |
| 333.15 | 0.2000 | 0.1310 |
| 343.15 | 0.2000 | 0.1820 |
| 353.15 | 0.2000 | 0.2640 |
| 293.15 | 0.1670 | 0.0162 |
| 303.15 | 0.1670 | 0.0307 |
| 313.15 | 0.1670 | 0.0492 |
| 323.15 | 0.1670 | 0.0788 |
| 333.15 | 0.1670 | 0.1135 |
| 343.15 | 0.1670 | 0.1410 |
| 353.15 | 0.1670 | 0.2220 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Electrical conductivity, S/m - Liquid |
| 293.15 | 0.2500 | 0.0170 |
| 303.15 | 0.2500 | 0.0309 |
| 313.15 | 0.2500 | 0.0485 |
| 323.15 | 0.2500 | 0.0781 |
| 333.15 | 0.2500 | 0.1172 |
| 343.15 | 0.2500 | 0.1510 |
| 353.15 | 0.2500 | 0.2400 |
| 293.15 | 0.2000 | 0.0192 |
| 303.15 | 0.2000 | 0.0358 |
| 313.15 | 0.2000 | 0.0525 |
| 323.15 | 0.2000 | 0.0863 |
| 333.15 | 0.2000 | 0.1310 |
| 343.15 | 0.2000 | 0.1820 |
| 353.15 | 0.2000 | 0.2640 |
| 293.15 | 0.1670 | 0.0162 |
| 303.15 | 0.1670 | 0.0307 |
| 313.15 | 0.1670 | 0.0492 |
| 323.15 | 0.1670 | 0.0788 |
| 333.15 | 0.1670 | 0.1135 |
| 343.15 | 0.1670 | 0.1410 |
| 353.15 | 0.1670 | 0.2220 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.2500 | 1.4802 |
| 303.15 | 0.2500 | 1.4774 |
| 313.15 | 0.2500 | 1.4745 |
| 323.15 | 0.2500 | 1.4716 |
| 333.15 | 0.2500 | 1.4685 |
| 343.15 | 0.2500 | 1.4652 |
| 353.15 | 0.2500 | 1.462 |
| 293.15 | 0.2000 | 1.4776 |
| 303.15 | 0.2000 | 1.4747 |
| 313.15 | 0.2000 | 1.4718 |
| 323.15 | 0.2000 | 1.4687 |
| 333.15 | 0.2000 | 1.4658 |
| 343.15 | 0.2000 | 1.4626 |
| 353.15 | 0.2000 | 1.4603 |
| 293.15 | 0.1670 | 1.4781 |
| 303.15 | 0.1670 | 1.4754 |
| 313.15 | 0.1670 | 1.4726 |
| 323.15 | 0.1670 | 1.4697 |
| 333.15 | 0.1670 | 1.4668 |
| 343.15 | 0.1670 | 1.4638 |
| 353.15 | 0.1670 | 1.4607 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.2500 | 1.4802 |
| 303.15 | 0.2500 | 1.4774 |
| 313.15 | 0.2500 | 1.4745 |
| 323.15 | 0.2500 | 1.4716 |
| 333.15 | 0.2500 | 1.4685 |
| 343.15 | 0.2500 | 1.4652 |
| 353.15 | 0.2500 | 1.462 |
| 293.15 | 0.2000 | 1.4776 |
| 303.15 | 0.2000 | 1.4747 |
| 313.15 | 0.2000 | 1.4718 |
| 323.15 | 0.2000 | 1.4687 |
| 333.15 | 0.2000 | 1.4658 |
| 343.15 | 0.2000 | 1.4626 |
| 353.15 | 0.2000 | 1.4603 |
| 293.15 | 0.1670 | 1.4781 |
| 303.15 | 0.1670 | 1.4754 |
| 313.15 | 0.1670 | 1.4726 |
| 323.15 | 0.1670 | 1.4697 |
| 333.15 | 0.1670 | 1.4668 |
| 343.15 | 0.1670 | 1.4638 |
| 353.15 | 0.1670 | 1.4607 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.2500 | 1014.0 |
| 303.15 | 0.2500 | 1008.0 |
| 313.15 | 0.2500 | 1001.0 |
| 323.15 | 0.2500 | 995.0 |
| 333.15 | 0.2500 | 988.0 |
| 343.15 | 0.2500 | 982.0 |
| 353.15 | 0.2500 | 976.0 |
| 293.15 | 0.2000 | 1029.0 |
| 303.15 | 0.2000 | 1023.0 |
| 313.15 | 0.2000 | 1017.0 |
| 323.15 | 0.2000 | 1010.0 |
| 333.15 | 0.2000 | 1004.0 |
| 343.15 | 0.2000 | 997.0 |
| 353.15 | 0.2000 | 991.0 |
| 293.15 | 0.1670 | 1040.0 |
| 303.15 | 0.1670 | 1034.0 |
| 313.15 | 0.1670 | 1027.0 |
| 323.15 | 0.1670 | 1020.0 |
| 333.15 | 0.1670 | 1014.0 |
| 343.15 | 0.1670 | 1007.0 |
| 353.15 | 0.1670 | 1000.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.2500 | 1014.0 |
| 303.15 | 0.2500 | 1008.0 |
| 313.15 | 0.2500 | 1001.0 |
| 323.15 | 0.2500 | 995.0 |
| 333.15 | 0.2500 | 988.0 |
| 343.15 | 0.2500 | 982.0 |
| 353.15 | 0.2500 | 976.0 |
| 293.15 | 0.2000 | 1029.0 |
| 303.15 | 0.2000 | 1023.0 |
| 313.15 | 0.2000 | 1017.0 |
| 323.15 | 0.2000 | 1010.0 |
| 333.15 | 0.2000 | 1004.0 |
| 343.15 | 0.2000 | 997.0 |
| 353.15 | 0.2000 | 991.0 |
| 293.15 | 0.1670 | 1040.0 |
| 303.15 | 0.1670 | 1034.0 |
| 313.15 | 0.1670 | 1027.0 |
| 323.15 | 0.1670 | 1020.0 |
| 333.15 | 0.1670 | 1014.0 |
| 343.15 | 0.1670 | 1007.0 |
| 353.15 | 0.1670 | 1000.0 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 303.15 | 0.2500 | 0.0460 |
| 313.15 | 0.2500 | 0.0449 |
| 323.15 | 0.2500 | 0.0441 |
| 333.15 | 0.2500 | 0.0434 |
| 343.15 | 0.2500 | 0.0427 |
| 353.15 | 0.2500 | 0.0419 |
| 303.15 | 0.2000 | 0.0467 |
| 313.15 | 0.2000 | 0.0459 |
| 323.15 | 0.2000 | 0.0449 |
| 333.15 | 0.2000 | 0.0441 |
| 343.15 | 0.2000 | 0.0435 |
| 353.15 | 0.2000 | 0.0429 |
| 303.15 | 0.1670 | 0.0471 |
| 313.15 | 0.1670 | 0.0462 |
| 323.15 | 0.1670 | 0.0455 |
| 333.15 | 0.1670 | 0.0450 |
| 343.15 | 0.1670 | 0.0442 |
| 353.15 | 0.1670 | 0.0435 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 303.15 | 0.2500 | 0.0460 |
| 313.15 | 0.2500 | 0.0449 |
| 323.15 | 0.2500 | 0.0441 |
| 333.15 | 0.2500 | 0.0434 |
| 343.15 | 0.2500 | 0.0427 |
| 353.15 | 0.2500 | 0.0419 |
| 303.15 | 0.2000 | 0.0467 |
| 313.15 | 0.2000 | 0.0459 |
| 323.15 | 0.2000 | 0.0449 |
| 333.15 | 0.2000 | 0.0441 |
| 343.15 | 0.2000 | 0.0435 |
| 353.15 | 0.2000 | 0.0429 |
| 303.15 | 0.1670 | 0.0471 |
| 313.15 | 0.1670 | 0.0462 |
| 323.15 | 0.1670 | 0.0455 |
| 333.15 | 0.1670 | 0.0450 |
| 343.15 | 0.1670 | 0.0442 |
| 353.15 | 0.1670 | 0.0435 |