- Name
- Tetra-N-butylammonium chloride
- InChI
- InChI=1S/C16H36N.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- NHGXDBSUJJNIRV-UHFFFAOYSA-M
- Formula
- C16H36ClN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Cl-]
- Mol. Weight (g/mol)
- 277.92
- CAS
- 1112-67-0
- Name
- 1,2-Ethanediol
- InChI
- InChI=1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2
- InChI Key
- LYCAIKOWRPUZTN-UHFFFAOYSA-N
- Formula
- C2H6O2
- SMILES
- OCCO
- Mol. Weight (g/mol)
- 62.07
- CAS
- 107-21-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- η - Viscosity, Pa*s (2)
- σcond - Electrical conductivity, S/m (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.25 (Liquid)
| Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 298.20 | 288.30 |
| 300.70 | 289.60 |
| 303.20 | 291.00 |
| 305.70 | 292.20 |
| 308.20 | 293.20 |
| 310.70 | 294.50 |
| 313.20 | 295.80 |
| 315.70 | 296.80 |
| 318.20 | 297.90 |
| 320.70 | 299.50 |
| 323.20 | 300.50 |
| 325.70 | 301.20 |
| 328.20 | 302.40 |
| 330.70 | 303.50 |
| 333.20 | 304.80 |
| 335.70 | 305.90 |
| 338.20 | 306.90 |
| 340.70 | 307.70 |
| 343.20 | 308.50 |
| 345.70 | 309.10 |
| 348.20 | 309.60 |
| 350.70 | 310.60 |
| 353.20 | 312.60 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.25 (Liquid)
| Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 298.20 | 288.30 |
| 300.70 | 289.60 |
| 303.20 | 291.00 |
| 305.70 | 292.20 |
| 308.20 | 293.20 |
| 310.70 | 294.50 |
| 313.20 | 295.80 |
| 315.70 | 296.80 |
| 318.20 | 297.90 |
| 320.70 | 299.50 |
| 323.20 | 300.50 |
| 325.70 | 301.20 |
| 328.20 | 302.40 |
| 330.70 | 303.50 |
| 333.20 | 304.80 |
| 335.70 | 305.90 |
| 338.20 | 306.90 |
| 340.70 | 307.70 |
| 343.20 | 308.50 |
| 345.70 | 309.10 |
| 348.20 | 309.60 |
| 350.70 | 310.60 |
| 353.20 | 312.60 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.3330 | 0.2120 |
| 303.15 | 0.3330 | 0.1270 |
| 313.15 | 0.3330 | 0.0764 |
| 323.15 | 0.3330 | 0.0493 |
| 333.15 | 0.3330 | 0.0336 |
| 343.15 | 0.3330 | 0.0235 |
| 353.15 | 0.3330 | 0.0160 |
| 293.15 | 0.2500 | 0.1050 |
| 303.15 | 0.2500 | 0.0719 |
| 313.15 | 0.2500 | 0.0452 |
| 323.15 | 0.2500 | 0.0294 |
| 333.15 | 0.2500 | 0.0202 |
| 343.15 | 0.2500 | 0.0145 |
| 353.15 | 0.2500 | 0.0107 |
| 293.15 | 0.2000 | 0.0853 |
| 303.15 | 0.2000 | 0.0569 |
| 313.15 | 0.2000 | 0.0372 |
| 323.15 | 0.2000 | 0.0263 |
| 333.15 | 0.2000 | 0.0197 |
| 343.15 | 0.2000 | 0.0149 |
| 353.15 | 0.2000 | 0.0105 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.3330 | 0.2120 |
| 303.15 | 0.3330 | 0.1270 |
| 313.15 | 0.3330 | 0.0764 |
| 323.15 | 0.3330 | 0.0493 |
| 333.15 | 0.3330 | 0.0336 |
| 343.15 | 0.3330 | 0.0235 |
| 353.15 | 0.3330 | 0.0160 |
| 293.15 | 0.2500 | 0.1050 |
| 303.15 | 0.2500 | 0.0719 |
| 313.15 | 0.2500 | 0.0452 |
| 323.15 | 0.2500 | 0.0294 |
| 333.15 | 0.2500 | 0.0202 |
| 343.15 | 0.2500 | 0.0145 |
| 353.15 | 0.2500 | 0.0107 |
| 293.15 | 0.2000 | 0.0853 |
| 303.15 | 0.2000 | 0.0569 |
| 313.15 | 0.2000 | 0.0372 |
| 323.15 | 0.2000 | 0.0263 |
| 333.15 | 0.2000 | 0.0197 |
| 343.15 | 0.2000 | 0.0149 |
| 353.15 | 0.2000 | 0.0105 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Electrical conductivity, S/m - Liquid |
| 293.15 | 0.3330 | 0.0001 |
| 303.15 | 0.3330 | 0.0001 |
| 313.15 | 0.3330 | 0.0002 |
| 323.15 | 0.3330 | 0.0003 |
| 333.15 | 0.3330 | 0.0004 |
| 343.15 | 0.3330 | 0.0004 |
| 353.15 | 0.3330 | 0.0005 |
| 293.15 | 0.2500 | 0.0002 |
| 303.15 | 0.2500 | 0.0002 |
| 313.15 | 0.2500 | 0.0003 |
| 323.15 | 0.2500 | 0.0004 |
| 333.15 | 0.2500 | 0.0005 |
| 343.15 | 0.2500 | 0.0006 |
| 353.15 | 0.2500 | 0.0006 |
| 293.15 | 0.2000 | 0.0002 |
| 303.15 | 0.2000 | 0.0003 |
| 313.15 | 0.2000 | 0.0004 |
| 323.15 | 0.2000 | 0.0004 |
| 333.15 | 0.2000 | 0.0005 |
| 343.15 | 0.2000 | 0.0006 |
| 353.15 | 0.2000 | 0.0007 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Electrical conductivity, S/m - Liquid |
| 293.15 | 0.3330 | 0.0001 |
| 303.15 | 0.3330 | 0.0001 |
| 313.15 | 0.3330 | 0.0002 |
| 323.15 | 0.3330 | 0.0003 |
| 333.15 | 0.3330 | 0.0004 |
| 343.15 | 0.3330 | 0.0004 |
| 353.15 | 0.3330 | 0.0005 |
| 293.15 | 0.2500 | 0.0002 |
| 303.15 | 0.2500 | 0.0002 |
| 313.15 | 0.2500 | 0.0003 |
| 323.15 | 0.2500 | 0.0004 |
| 333.15 | 0.2500 | 0.0005 |
| 343.15 | 0.2500 | 0.0006 |
| 353.15 | 0.2500 | 0.0006 |
| 293.15 | 0.2000 | 0.0002 |
| 303.15 | 0.2000 | 0.0003 |
| 313.15 | 0.2000 | 0.0004 |
| 323.15 | 0.2000 | 0.0004 |
| 333.15 | 0.2000 | 0.0005 |
| 343.15 | 0.2000 | 0.0006 |
| 353.15 | 0.2000 | 0.0007 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.3330 | 1.4703 |
| 303.15 | 0.3330 | 1.4672 |
| 313.15 | 0.3330 | 1.4641 |
| 323.15 | 0.3330 | 1.4609 |
| 333.15 | 0.3330 | 1.4578 |
| 343.15 | 0.3330 | 1.4545 |
| 353.15 | 0.3330 | 1.4509 |
| 293.15 | 0.2500 | 1.4653 |
| 303.15 | 0.2500 | 1.4619 |
| 313.15 | 0.2500 | 1.4587 |
| 323.15 | 0.2500 | 1.4556 |
| 333.15 | 0.2500 | 1.4525 |
| 343.15 | 0.2500 | 1.4495 |
| 353.15 | 0.2500 | 1.4469 |
| 293.15 | 0.2000 | 1.4615 |
| 303.15 | 0.2000 | 1.4585 |
| 313.15 | 0.2000 | 1.4554 |
| 323.15 | 0.2000 | 1.4523 |
| 333.15 | 0.2000 | 1.4491 |
| 343.15 | 0.2000 | 1.445 |
| 353.15 | 0.2000 | 1.4427 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.3330 | 1.4703 |
| 303.15 | 0.3330 | 1.4672 |
| 313.15 | 0.3330 | 1.4641 |
| 323.15 | 0.3330 | 1.4609 |
| 333.15 | 0.3330 | 1.4578 |
| 343.15 | 0.3330 | 1.4545 |
| 353.15 | 0.3330 | 1.4509 |
| 293.15 | 0.2500 | 1.4653 |
| 303.15 | 0.2500 | 1.4619 |
| 313.15 | 0.2500 | 1.4587 |
| 323.15 | 0.2500 | 1.4556 |
| 333.15 | 0.2500 | 1.4525 |
| 343.15 | 0.2500 | 1.4495 |
| 353.15 | 0.2500 | 1.4469 |
| 293.15 | 0.2000 | 1.4615 |
| 303.15 | 0.2000 | 1.4585 |
| 313.15 | 0.2000 | 1.4554 |
| 323.15 | 0.2000 | 1.4523 |
| 333.15 | 0.2000 | 1.4491 |
| 343.15 | 0.2000 | 1.445 |
| 353.15 | 0.2000 | 1.4427 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.3330 | 1105.0 |
| 303.15 | 0.3330 | 1099.0 |
| 313.15 | 0.3330 | 1092.0 |
| 323.15 | 0.3330 | 1086.0 |
| 333.15 | 0.3330 | 1079.0 |
| 343.15 | 0.3330 | 1073.0 |
| 353.15 | 0.3330 | 1067.0 |
| 293.15 | 0.2500 | 1130.0 |
| 303.15 | 0.2500 | 1123.0 |
| 313.15 | 0.2500 | 1117.0 |
| 323.15 | 0.2500 | 1110.0 |
| 333.15 | 0.2500 | 1104.0 |
| 343.15 | 0.2500 | 1097.0 |
| 353.15 | 0.2500 | 1091.0 |
| 293.15 | 0.2000 | 1145.0 |
| 303.15 | 0.2000 | 1138.0 |
| 313.15 | 0.2000 | 1132.0 |
| 323.15 | 0.2000 | 1125.0 |
| 333.15 | 0.2000 | 1119.0 |
| 343.15 | 0.2000 | 1112.0 |
| 353.15 | 0.2000 | 1106.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.3330 | 1105.0 |
| 303.15 | 0.3330 | 1099.0 |
| 313.15 | 0.3330 | 1092.0 |
| 323.15 | 0.3330 | 1086.0 |
| 333.15 | 0.3330 | 1079.0 |
| 343.15 | 0.3330 | 1073.0 |
| 353.15 | 0.3330 | 1067.0 |
| 293.15 | 0.2500 | 1130.0 |
| 303.15 | 0.2500 | 1123.0 |
| 313.15 | 0.2500 | 1117.0 |
| 323.15 | 0.2500 | 1110.0 |
| 333.15 | 0.2500 | 1104.0 |
| 343.15 | 0.2500 | 1097.0 |
| 353.15 | 0.2500 | 1091.0 |
| 293.15 | 0.2000 | 1145.0 |
| 303.15 | 0.2000 | 1138.0 |
| 313.15 | 0.2000 | 1132.0 |
| 323.15 | 0.2000 | 1125.0 |
| 333.15 | 0.2000 | 1119.0 |
| 343.15 | 0.2000 | 1112.0 |
| 353.15 | 0.2000 | 1106.0 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 303.15 | 0.3330 | 0.0393 |
| 313.15 | 0.3330 | 0.0383 |
| 323.15 | 0.3330 | 0.0372 |
| 333.15 | 0.3330 | 0.0366 |
| 343.15 | 0.3330 | 0.0357 |
| 353.15 | 0.3330 | 0.0349 |
| 303.15 | 0.2500 | 0.0401 |
| 313.15 | 0.2500 | 0.0394 |
| 323.15 | 0.2500 | 0.0383 |
| 333.15 | 0.2500 | 0.0375 |
| 343.15 | 0.2500 | 0.0368 |
| 353.15 | 0.2500 | 0.0361 |
| 303.15 | 0.2000 | 0.0407 |
| 313.15 | 0.2000 | 0.0399 |
| 323.15 | 0.2000 | 0.0391 |
| 333.15 | 0.2000 | 0.0383 |
| 343.15 | 0.2000 | 0.0375 |
| 353.15 | 0.2000 | 0.0368 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 303.15 | 0.3330 | 0.0393 |
| 313.15 | 0.3330 | 0.0383 |
| 323.15 | 0.3330 | 0.0372 |
| 333.15 | 0.3330 | 0.0366 |
| 343.15 | 0.3330 | 0.0357 |
| 353.15 | 0.3330 | 0.0349 |
| 303.15 | 0.2500 | 0.0401 |
| 313.15 | 0.2500 | 0.0394 |
| 323.15 | 0.2500 | 0.0383 |
| 333.15 | 0.2500 | 0.0375 |
| 343.15 | 0.2500 | 0.0368 |
| 353.15 | 0.2500 | 0.0361 |
| 303.15 | 0.2000 | 0.0407 |
| 313.15 | 0.2000 | 0.0399 |
| 323.15 | 0.2000 | 0.0391 |
| 333.15 | 0.2000 | 0.0383 |
| 343.15 | 0.2000 | 0.0375 |
| 353.15 | 0.2000 | 0.0368 |