- Name
- Tetra-N-butylammonium chloride
- InChI
- InChI=1S/C16H36N.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- NHGXDBSUJJNIRV-UHFFFAOYSA-M
- Formula
- C16H36ClN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Cl-]
- Mol. Weight (g/mol)
- 277.92
- CAS
- 1112-67-0
- Name
- Triethylene glycol
- InChI
- InChI=1S/C6H14O4/c7-1-3-9-5-6-10-4-2-8/h7-8H,1-6H2
- InChI Key
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N
- Formula
- C6H14O4
- SMILES
- OCCOCCOCCO
- Mol. Weight (g/mol)
- 150.17
- CAS
- 112-27-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- η - Viscosity, Pa*s (2)
- σcond - Electrical conductivity, S/m (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
| Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 298.20 | 445.00 |
| 300.70 | 447.80 |
| 303.20 | 448.90 |
| 305.70 | 450.60 |
| 308.20 | 452.30 |
| 310.70 | 454.20 |
| 313.20 | 456.10 |
| 315.70 | 457.40 |
| 318.20 | 458.70 |
| 320.70 | 460.20 |
| 323.20 | 461.90 |
| 325.70 | 463.00 |
| 328.20 | 464.50 |
| 330.70 | 466.20 |
| 333.20 | 467.70 |
| 335.70 | 469.20 |
| 338.20 | 471.10 |
| 340.70 | 472.60 |
| 343.20 | 473.70 |
| 345.70 | 475.20 |
| 348.20 | 475.60 |
| 350.70 | 476.00 |
| 353.20 | 479.70 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.5 (Liquid)
| Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 298.20 | 445.00 |
| 300.70 | 447.80 |
| 303.20 | 448.90 |
| 305.70 | 450.60 |
| 308.20 | 452.30 |
| 310.70 | 454.20 |
| 313.20 | 456.10 |
| 315.70 | 457.40 |
| 318.20 | 458.70 |
| 320.70 | 460.20 |
| 323.20 | 461.90 |
| 325.70 | 463.00 |
| 328.20 | 464.50 |
| 330.70 | 466.20 |
| 333.20 | 467.70 |
| 335.70 | 469.20 |
| 338.20 | 471.10 |
| 340.70 | 472.60 |
| 343.20 | 473.70 |
| 345.70 | 475.20 |
| 348.20 | 475.60 |
| 350.70 | 476.00 |
| 353.20 | 479.70 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.5000 | 0.8700 |
| 303.15 | 0.5000 | 0.5438 |
| 313.15 | 0.5000 | 0.2894 |
| 323.15 | 0.5000 | 0.1664 |
| 333.15 | 0.5000 | 0.1008 |
| 343.15 | 0.5000 | 0.0681 |
| 353.15 | 0.5000 | 0.0447 |
| 303.15 | 0.6670 | 1.399 |
| 313.15 | 0.6670 | 0.9522 |
| 323.15 | 0.6670 | 0.4930 |
| 333.15 | 0.6670 | 0.2641 |
| 343.15 | 0.6670 | 0.1540 |
| 353.15 | 0.6670 | 0.0913 |
| 313.15 | 0.7500 | 7.0317 |
| 323.15 | 0.7500 | 0.9091 |
| 333.15 | 0.7500 | 0.4521 |
| 343.15 | 0.7500 | 0.2447 |
| 353.15 | 0.7500 | 0.1556 |
| 303.15 | 0.8000 | 3.2653 |
| 313.15 | 0.8000 | 1.9004 |
| 323.15 | 0.8000 | 0.8629 |
| 333.15 | 0.8000 | 0.4112 |
| 343.15 | 0.8000 | 0.2045 |
| 353.15 | 0.8000 | 0.0999 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.5000 | 0.8700 |
| 303.15 | 0.5000 | 0.5438 |
| 313.15 | 0.5000 | 0.2894 |
| 323.15 | 0.5000 | 0.1664 |
| 333.15 | 0.5000 | 0.1008 |
| 343.15 | 0.5000 | 0.0681 |
| 353.15 | 0.5000 | 0.0447 |
| 303.15 | 0.6670 | 1.399 |
| 313.15 | 0.6670 | 0.9522 |
| 323.15 | 0.6670 | 0.4930 |
| 333.15 | 0.6670 | 0.2641 |
| 343.15 | 0.6670 | 0.1540 |
| 353.15 | 0.6670 | 0.0913 |
| 313.15 | 0.7500 | 7.0317 |
| 323.15 | 0.7500 | 0.9091 |
| 333.15 | 0.7500 | 0.4521 |
| 343.15 | 0.7500 | 0.2447 |
| 353.15 | 0.7500 | 0.1556 |
| 303.15 | 0.8000 | 3.2653 |
| 313.15 | 0.8000 | 1.9004 |
| 323.15 | 0.8000 | 0.8629 |
| 333.15 | 0.8000 | 0.4112 |
| 343.15 | 0.8000 | 0.2045 |
| 353.15 | 0.8000 | 0.0999 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Electrical conductivity, S/m - Liquid |
| 293.15 | 0.5000 | 0.0139 |
| 303.15 | 0.5000 | 0.0228 |
| 313.15 | 0.5000 | 0.0376 |
| 323.15 | 0.5000 | 0.0550 |
| 333.15 | 0.5000 | 0.0805 |
| 343.15 | 0.5000 | 0.1100 |
| 353.15 | 0.5000 | 0.1474 |
| 293.15 | 0.6670 | 0.0068 |
| 303.15 | 0.6670 | 0.0149 |
| 313.15 | 0.6670 | 0.0284 |
| 323.15 | 0.6670 | 0.0458 |
| 333.15 | 0.6670 | 0.0676 |
| 343.15 | 0.6670 | 0.0842 |
| 353.15 | 0.6670 | 0.0920 |
| 293.15 | 0.7500 | 0.0022 |
| 303.15 | 0.7500 | 0.0050 |
| 313.15 | 0.7500 | 0.0097 |
| 323.15 | 0.7500 | 0.0154 |
| 333.15 | 0.7500 | 0.0217 |
| 343.15 | 0.7500 | 0.0282 |
| 353.15 | 0.7500 | 0.0319 |
| 293.15 | 0.8000 | 0.0018 |
| 303.15 | 0.8000 | 0.0047 |
| 313.15 | 0.8000 | 0.0108 |
| 323.15 | 0.8000 | 0.0214 |
| 333.15 | 0.8000 | 0.0252 |
| 343.15 | 0.8000 | 0.0262 |
| 353.15 | 0.8000 | 0.0273 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Electrical conductivity, S/m - Liquid |
| 293.15 | 0.5000 | 0.0139 |
| 303.15 | 0.5000 | 0.0228 |
| 313.15 | 0.5000 | 0.0376 |
| 323.15 | 0.5000 | 0.0550 |
| 333.15 | 0.5000 | 0.0805 |
| 343.15 | 0.5000 | 0.1100 |
| 353.15 | 0.5000 | 0.1474 |
| 293.15 | 0.6670 | 0.0068 |
| 303.15 | 0.6670 | 0.0149 |
| 313.15 | 0.6670 | 0.0284 |
| 323.15 | 0.6670 | 0.0458 |
| 333.15 | 0.6670 | 0.0676 |
| 343.15 | 0.6670 | 0.0842 |
| 353.15 | 0.6670 | 0.0920 |
| 293.15 | 0.7500 | 0.0022 |
| 303.15 | 0.7500 | 0.0050 |
| 313.15 | 0.7500 | 0.0097 |
| 323.15 | 0.7500 | 0.0154 |
| 333.15 | 0.7500 | 0.0217 |
| 343.15 | 0.7500 | 0.0282 |
| 353.15 | 0.7500 | 0.0319 |
| 293.15 | 0.8000 | 0.0018 |
| 303.15 | 0.8000 | 0.0047 |
| 313.15 | 0.8000 | 0.0108 |
| 323.15 | 0.8000 | 0.0214 |
| 333.15 | 0.8000 | 0.0252 |
| 343.15 | 0.8000 | 0.0262 |
| 353.15 | 0.8000 | 0.0273 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.5000 | 1.48 |
| 303.15 | 0.5000 | 1.4772 |
| 313.15 | 0.5000 | 1.4742 |
| 323.15 | 0.5000 | 1.4711 |
| 333.15 | 0.5000 | 1.4678 |
| 343.15 | 0.5000 | 1.4646 |
| 353.15 | 0.5000 | 1.4614 |
| 293.15 | 0.6670 | 1.4851 |
| 303.15 | 0.6670 | 1.4821 |
| 313.15 | 0.6670 | 1.479 |
| 323.15 | 0.6670 | 1.476 |
| 333.15 | 0.6670 | 1.4731 |
| 343.15 | 0.6670 | 1.4701 |
| 353.15 | 0.6670 | 1.4673 |
| 293.15 | 0.7500 | 1.4858 |
| 303.15 | 0.7500 | 1.4836 |
| 313.15 | 0.7500 | 1.4806 |
| 323.15 | 0.7500 | 1.4777 |
| 333.15 | 0.7500 | 1.4747 |
| 343.15 | 0.7500 | 1.4717 |
| 353.15 | 0.7500 | 1.4686 |
| 293.15 | 0.8000 | 1.4871 |
| 303.15 | 0.8000 | 1.4841 |
| 313.15 | 0.8000 | 1.4811 |
| 323.15 | 0.8000 | 1.4781 |
| 333.15 | 0.8000 | 1.4752 |
| 343.15 | 0.8000 | 1.4722 |
| 353.15 | 0.8000 | 1.4692 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.5000 | 1.48 |
| 303.15 | 0.5000 | 1.4772 |
| 313.15 | 0.5000 | 1.4742 |
| 323.15 | 0.5000 | 1.4711 |
| 333.15 | 0.5000 | 1.4678 |
| 343.15 | 0.5000 | 1.4646 |
| 353.15 | 0.5000 | 1.4614 |
| 293.15 | 0.6670 | 1.4851 |
| 303.15 | 0.6670 | 1.4821 |
| 313.15 | 0.6670 | 1.479 |
| 323.15 | 0.6670 | 1.476 |
| 333.15 | 0.6670 | 1.4731 |
| 343.15 | 0.6670 | 1.4701 |
| 353.15 | 0.6670 | 1.4673 |
| 293.15 | 0.7500 | 1.4858 |
| 303.15 | 0.7500 | 1.4836 |
| 313.15 | 0.7500 | 1.4806 |
| 323.15 | 0.7500 | 1.4777 |
| 333.15 | 0.7500 | 1.4747 |
| 343.15 | 0.7500 | 1.4717 |
| 353.15 | 0.7500 | 1.4686 |
| 293.15 | 0.8000 | 1.4871 |
| 303.15 | 0.8000 | 1.4841 |
| 313.15 | 0.8000 | 1.4811 |
| 323.15 | 0.8000 | 1.4781 |
| 333.15 | 0.8000 | 1.4752 |
| 343.15 | 0.8000 | 1.4722 |
| 353.15 | 0.8000 | 1.4692 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.5000 | 1027.0 |
| 303.15 | 0.5000 | 1021.0 |
| 313.15 | 0.5000 | 1015.0 |
| 323.15 | 0.5000 | 1009.0 |
| 333.15 | 0.5000 | 1003.0 |
| 343.15 | 0.5000 | 997.0 |
| 353.15 | 0.5000 | 991.0 |
| 293.15 | 0.6670 | 1007.0 |
| 303.15 | 0.6670 | 1001.0 |
| 313.15 | 0.6670 | 995.0 |
| 323.15 | 0.6670 | 989.0 |
| 333.15 | 0.6670 | 983.0 |
| 343.15 | 0.6670 | 976.0 |
| 353.15 | 0.6670 | 970.0 |
| 293.15 | 0.7500 | 996.0 |
| 303.15 | 0.7500 | 990.0 |
| 313.15 | 0.7500 | 984.0 |
| 323.15 | 0.7500 | 978.0 |
| 333.15 | 0.7500 | 972.0 |
| 343.15 | 0.7500 | 966.0 |
| 353.15 | 0.7500 | 960.0 |
| 293.15 | 0.8000 | 990.0 |
| 303.15 | 0.8000 | 985.0 |
| 313.15 | 0.8000 | 980.0 |
| 323.15 | 0.8000 | 973.0 |
| 333.15 | 0.8000 | 968.0 |
| 343.15 | 0.8000 | 961.0 |
| 353.15 | 0.8000 | 955.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.5000 | 1027.0 |
| 303.15 | 0.5000 | 1021.0 |
| 313.15 | 0.5000 | 1015.0 |
| 323.15 | 0.5000 | 1009.0 |
| 333.15 | 0.5000 | 1003.0 |
| 343.15 | 0.5000 | 997.0 |
| 353.15 | 0.5000 | 991.0 |
| 293.15 | 0.6670 | 1007.0 |
| 303.15 | 0.6670 | 1001.0 |
| 313.15 | 0.6670 | 995.0 |
| 323.15 | 0.6670 | 989.0 |
| 333.15 | 0.6670 | 983.0 |
| 343.15 | 0.6670 | 976.0 |
| 353.15 | 0.6670 | 970.0 |
| 293.15 | 0.7500 | 996.0 |
| 303.15 | 0.7500 | 990.0 |
| 313.15 | 0.7500 | 984.0 |
| 323.15 | 0.7500 | 978.0 |
| 333.15 | 0.7500 | 972.0 |
| 343.15 | 0.7500 | 966.0 |
| 353.15 | 0.7500 | 960.0 |
| 293.15 | 0.8000 | 990.0 |
| 303.15 | 0.8000 | 985.0 |
| 313.15 | 0.8000 | 980.0 |
| 323.15 | 0.8000 | 973.0 |
| 333.15 | 0.8000 | 968.0 |
| 343.15 | 0.8000 | 961.0 |
| 353.15 | 0.8000 | 955.0 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 303.15 | 0.5000 | 0.0406 |
| 313.15 | 0.5000 | 0.0395 |
| 323.15 | 0.5000 | 0.0388 |
| 333.15 | 0.5000 | 0.0382 |
| 343.15 | 0.5000 | 0.0376 |
| 353.15 | 0.5000 | 0.0370 |
| 303.15 | 0.6670 | 0.0401 |
| 313.15 | 0.6670 | 0.0386 |
| 323.15 | 0.6670 | 0.0380 |
| 333.15 | 0.6670 | 0.0374 |
| 343.15 | 0.6670 | 0.0364 |
| 353.15 | 0.6670 | 0.0356 |
| 303.15 | 0.7500 | 0.0393 |
| 313.15 | 0.7500 | 0.0383 |
| 323.15 | 0.7500 | 0.0372 |
| 333.15 | 0.7500 | 0.0366 |
| 343.15 | 0.7500 | 0.0357 |
| 353.15 | 0.7500 | 0.0349 |
| 303.15 | 0.8000 | 0.0400 |
| 313.15 | 0.8000 | 0.0384 |
| 323.15 | 0.8000 | 0.0373 |
| 333.15 | 0.8000 | 0.0365 |
| 343.15 | 0.8000 | 0.0356 |
| 353.15 | 0.8000 | 0.0346 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium chloride (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 303.15 | 0.5000 | 0.0406 |
| 313.15 | 0.5000 | 0.0395 |
| 323.15 | 0.5000 | 0.0388 |
| 333.15 | 0.5000 | 0.0382 |
| 343.15 | 0.5000 | 0.0376 |
| 353.15 | 0.5000 | 0.0370 |
| 303.15 | 0.6670 | 0.0401 |
| 313.15 | 0.6670 | 0.0386 |
| 323.15 | 0.6670 | 0.0380 |
| 333.15 | 0.6670 | 0.0374 |
| 343.15 | 0.6670 | 0.0364 |
| 353.15 | 0.6670 | 0.0356 |
| 303.15 | 0.7500 | 0.0393 |
| 313.15 | 0.7500 | 0.0383 |
| 323.15 | 0.7500 | 0.0372 |
| 333.15 | 0.7500 | 0.0366 |
| 343.15 | 0.7500 | 0.0357 |
| 353.15 | 0.7500 | 0.0349 |
| 303.15 | 0.8000 | 0.0400 |
| 313.15 | 0.8000 | 0.0384 |
| 323.15 | 0.8000 | 0.0373 |
| 333.15 | 0.8000 | 0.0365 |
| 343.15 | 0.8000 | 0.0356 |
| 353.15 | 0.8000 | 0.0346 |