- Name
- 1,2-Benzenedicarboxylic acid
- InChI
- InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)
- InChI Key
- XNGIFLGASWRNHJ-UHFFFAOYSA-N
- Formula
- C8H6O4
- SMILES
- O=C(O)c1ccccc1C(=O)O
- Mol. Weight (g/mol)
- 166.13
- CAS
- 88-99-3
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 1,2-Benzenedicarboxylic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of 1,2-Benzenedicarboxylic acid (1) - Liquid |
|---|---|
| 306.95 | 0.0011 |
| 311.05 | 0.0013 |
| 314.15 | 0.0015 |
| 316.65 | 0.0016 |
| 319.35 | 0.0018 |
| 322.15 | 0.0020 |
| 325.55 | 0.0023 |
| 328.45 | 0.0025 |
| 331.25 | 0.0027 |
| 333.75 | 0.0030 |
| 335.85 | 0.0033 |
| 339.45 | 0.0038 |
Molality, mol/kg [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Molality, mol/kg - Liquid |
|---|
| 0.0482 |
| 0.0482 |
| 0.0423 |
| 0.0425 |
| 0.0427 |
| 0.0421 |
Mole fraction of 1,2-Benzenedicarboxylic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of 1,2-Benzenedicarboxylic acid (1) - Liquid |
|---|---|
| 295.87 | 0.0006 |
| 298.65 | 0.0007 |
| 301.17 | 0.0007 |
| 303.79 | 0.0008 |
| 306.55 | 0.0009 |
| 308.97 | 0.0011 |
| 311.96 | 0.0012 |
| 315.53 | 0.0014 |
| 319.27 | 0.0016 |
| 322.78 | 0.0018 |
| 325.43 | 0.0021 |
| 328.20 | 0.0023 |
| 332.07 | 0.0027 |
| 335.95 | 0.0031 |
| 339.21 | 0.0035 |
| 342.10 | 0.0040 |
| 344.37 | 0.0045 |
| 347.35 | 0.0052 |
| 350.23 | 0.0058 |
| 352.45 | 0.0064 |
Mole fraction of 1,2-Benzenedicarboxylic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of 1,2-Benzenedicarboxylic acid (1) - Liquid |
|---|---|
| 306.95 | 0.0011 |
| 311.05 | 0.0013 |
| 314.15 | 0.0015 |
| 316.65 | 0.0016 |
| 319.35 | 0.0018 |
| 322.15 | 0.0020 |
| 325.55 | 0.0023 |
| 328.45 | 0.0025 |
| 331.25 | 0.0027 |
| 333.75 | 0.0030 |
| 335.85 | 0.0033 |
| 339.45 | 0.0038 |
Molality, mol/kg [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Molality, mol/kg - Liquid |
|---|
| 0.0482 |
| 0.0482 |
| 0.0423 |
| 0.0425 |
| 0.0427 |
| 0.0421 |
Mole fraction of 1,2-Benzenedicarboxylic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of 1,2-Benzenedicarboxylic acid (1) - Liquid |
|---|---|
| 295.87 | 0.0006 |
| 298.65 | 0.0007 |
| 301.17 | 0.0007 |
| 303.79 | 0.0008 |
| 306.55 | 0.0009 |
| 308.97 | 0.0011 |
| 311.96 | 0.0012 |
| 315.53 | 0.0014 |
| 319.27 | 0.0016 |
| 322.78 | 0.0018 |
| 325.43 | 0.0021 |
| 328.20 | 0.0023 |
| 332.07 | 0.0027 |
| 335.95 | 0.0031 |
| 339.21 | 0.0035 |
| 342.10 | 0.0040 |
| 344.37 | 0.0045 |
| 347.35 | 0.0052 |
| 350.23 | 0.0058 |
| 352.45 | 0.0064 |
Sources
- Solubilities of Phthalic Acid and o-Toluic Acid in Binary Acetic Acid + Water and Acetic Acid + o-Xylene Solvent Mixtures
- Solubility and Activity Coefficients of Acidic and Basic Nonelectrolytes in Aqueous Salt Solutions. 1. Solubility and Activity Coefficients of o-Phthalic Acid and L-Cystine in NaCl(aq), (CH3)4NCl(aq), and (C2H5)4NI(aq) at Different Ionic Strengths and at t ) 25 deg C
- Solubility of o-Phthalic Acid in Methanol + Water and Methanol + Butyl Acetate from (295.87 to 359.75) K