- Name
- Cyclohexanone
- InChI
- InChI=1S/C6H10O/c7-6-4-2-1-3-5-6/h1-5H2
- InChI Key
- JHIVVAPYMSGYDF-UHFFFAOYSA-N
- Formula
- C6H10O
- SMILES
- O=C1CCCCC1
- Mol. Weight (g/mol)
- 98.14
- CAS
- 108-94-1
- Name
- Pentanedioic acid
- InChI
- InChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9)
- InChI Key
- JFCQEDHGNNZCLN-UHFFFAOYSA-N
- Formula
- C5H8O4
- SMILES
- O=C(O)CCCC(=O)O
- Mol. Weight (g/mol)
- 132.11
- CAS
- 110-94-1
Datasets
Mole fraction of Pentanedioic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Pentanedioic acid (2) - Liquid |
|---|---|
| 299.75 | 0.2130 |
| 303.95 | 0.2379 |
| 307.75 | 0.2618 |
| 312.55 | 0.2946 |
| 316.85 | 0.3244 |
| 321.95 | 0.3687 |
| 326.85 | 0.4077 |
| 332.25 | 0.4605 |
| 336.55 | 0.5048 |
| 340.65 | 0.5512 |
Mole fraction of Pentanedioic acid (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Pentanedioic acid (2) - Liquid |
|---|---|
| 303.55 | 0.2000 |
| 306.25 | 0.2213 |
| 309.35 | 0.2450 |
| 311.55 | 0.2611 |
| 314.35 | 0.2801 |
| 317.95 | 0.3067 |
| 320.65 | 0.3278 |
| 325.35 | 0.3678 |
| 329.15 | 0.4143 |
| 334.05 | 0.4692 |
Mole fraction of Pentanedioic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Pentanedioic acid (2) - Liquid |
|---|---|
| 303.55 | 0.2000 |
| 306.25 | 0.2213 |
| 309.35 | 0.2450 |
| 311.55 | 0.2611 |
| 314.35 | 0.2801 |
| 317.95 | 0.3067 |
| 320.65 | 0.3278 |
| 325.35 | 0.3678 |
| 329.15 | 0.4143 |
| 334.05 | 0.4692 |
Mole fraction of Pentanedioic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Pentanedioic acid (2) - Liquid |
|---|---|
| 300.25 | 0.1964 |
| 306.25 | 0.2213 |
| 310.05 | 0.2448 |
| 314.55 | 0.2788 |
| 317.45 | 0.3032 |
| 321.95 | 0.3438 |
| 327.05 | 0.3918 |
| 330.15 | 0.4211 |
| 334.35 | 0.4601 |
| 337.65 | 0.4898 |
Mole fraction of Pentanedioic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Pentanedioic acid (2) - Liquid |
|---|---|
| 299.75 | 0.2130 |
| 303.95 | 0.2379 |
| 307.75 | 0.2618 |
| 312.55 | 0.2946 |
| 316.85 | 0.3244 |
| 321.95 | 0.3687 |
| 326.85 | 0.4077 |
| 332.25 | 0.4605 |
| 336.55 | 0.5048 |
| 340.65 | 0.5512 |
Mole fraction of Pentanedioic acid (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Pentanedioic acid (2) - Liquid |
|---|---|
| 303.55 | 0.2000 |
| 306.25 | 0.2213 |
| 309.35 | 0.2450 |
| 311.55 | 0.2611 |
| 314.35 | 0.2801 |
| 317.95 | 0.3067 |
| 320.65 | 0.3278 |
| 325.35 | 0.3678 |
| 329.15 | 0.4143 |
| 334.05 | 0.4692 |
Mole fraction of Pentanedioic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Pentanedioic acid (2) - Liquid |
|---|---|
| 303.55 | 0.2000 |
| 306.25 | 0.2213 |
| 309.35 | 0.2450 |
| 311.55 | 0.2611 |
| 314.35 | 0.2801 |
| 317.95 | 0.3067 |
| 320.65 | 0.3278 |
| 325.35 | 0.3678 |
| 329.15 | 0.4143 |
| 334.05 | 0.4692 |
Mole fraction of Pentanedioic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Pentanedioic acid (2) - Liquid |
|---|---|
| 300.25 | 0.1964 |
| 306.25 | 0.2213 |
| 310.05 | 0.2448 |
| 314.55 | 0.2788 |
| 317.45 | 0.3032 |
| 321.95 | 0.3438 |
| 327.05 | 0.3918 |
| 330.15 | 0.4211 |
| 334.35 | 0.4601 |
| 337.65 | 0.4898 |
Sources
- Determination and Correlation for the Solubility of Glutaric Acid in Cyclohexane + Cyclohexanol + Cyclohexanone Solvent Mixtures
- Measurement and Correlation for Solubilities of Adipic Acid, Glutaric Acid and Succinic Acid in Acetic Acid + Cyclohexanone Mixtures
- Measurement and Correlation for Solubilities of Adipic Acid, Glutaric Acid, and Succinic Acid in Dimethyl Adipate + Methanol Mixtures
- Measurement and Correlation for Solubilities of Succinic Acid and Glutaric Acid in e-Caprolactone + Acetic Acid Mixtures and e-Caprolactone + Cyclohexanone Mixtures