- Name
- Sulfur dioxide
- InChI
- InChI=1S/O2S/c1-3-2
- InChI Key
- RAHZWNYVWXNFOC-UHFFFAOYSA-N
- Formula
- O2S
- SMILES
- O=S=O
- Mol. Weight (g/mol)
- 64.06
- CAS
- 7446-09-5
- Name
- 2-Propanol, 1-methoxy-
- InChI
- InChI=1S/C4H10O2/c1-4(5)3-6-2/h4-5H,3H2,1-2H3
- InChI Key
- ARXJGSRGQADJSQ-UHFFFAOYSA-N
- Formula
- C4H10O2
- SMILES
- COCC(C)O
- Mol. Weight (g/mol)
- 90.12
- CAS
- 107-98-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Partial pressure, kPa of Sulfur dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Sulfur dioxide (1) - Liquid | Partial pressure, kPa of Sulfur dioxide (1) - Gas |
| 298.15 | 0.0016 | 0.01 |
| 298.15 | 0.0034 | 0.02 |
| 298.15 | 0.0046 | 0.04 |
| 298.15 | 0.0057 | 0.05 |
| 298.15 | 0.0077 | 0.06 |
| 298.15 | 0.0087 | 0.07 |
| 298.15 | 0.0099 | 0.09 |
| 298.15 | 0.0129 | 0.11 |
| 298.15 | 0.0135 | 0.11 |
| 298.15 | 0.0161 | 0.13 |
| 303.15 | 0.0012 | 0.01 |
| 303.15 | 0.0017 | 0.01 |
| 303.15 | 0.0031 | 0.03 |
| 303.15 | 0.0045 | 0.04 |
| 303.15 | 0.0049 | 0.05 |
| 303.15 | 0.0059 | 0.06 |
| 303.15 | 0.0067 | 0.07 |
| 303.15 | 0.0075 | 0.08 |
| 303.15 | 0.0094 | 0.09 |
| 303.15 | 0.0110 | 0.11 |
| 303.15 | 0.0119 | 0.12 |
| 303.15 | 0.0130 | 0.12 |
| 308.15 | 0.0008 | 0.01 |
| 308.15 | 0.0014 | 0.02 |
| 308.15 | 0.0026 | 0.03 |
| 308.15 | 0.0032 | 0.04 |
| 308.15 | 0.0042 | 0.05 |
| 308.15 | 0.0053 | 0.06 |
| 308.15 | 0.0065 | 0.07 |
| 308.15 | 0.0080 | 0.09 |
| 308.15 | 0.0089 | 0.10 |
| 308.15 | 0.0104 | 0.12 |
Partial pressure, kPa of Sulfur dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Sulfur dioxide (1) - Liquid | Partial pressure, kPa of Sulfur dioxide (1) - Gas |
| 298.15 | 0.0016 | 0.01 |
| 298.15 | 0.0034 | 0.02 |
| 298.15 | 0.0046 | 0.04 |
| 298.15 | 0.0057 | 0.05 |
| 298.15 | 0.0077 | 0.06 |
| 298.15 | 0.0087 | 0.07 |
| 298.15 | 0.0099 | 0.09 |
| 298.15 | 0.0129 | 0.11 |
| 298.15 | 0.0135 | 0.11 |
| 298.15 | 0.0161 | 0.13 |
| 303.15 | 0.0012 | 0.01 |
| 303.15 | 0.0017 | 0.01 |
| 303.15 | 0.0031 | 0.03 |
| 303.15 | 0.0045 | 0.04 |
| 303.15 | 0.0049 | 0.05 |
| 303.15 | 0.0059 | 0.06 |
| 303.15 | 0.0067 | 0.07 |
| 303.15 | 0.0075 | 0.08 |
| 303.15 | 0.0094 | 0.09 |
| 303.15 | 0.0110 | 0.11 |
| 303.15 | 0.0119 | 0.12 |
| 303.15 | 0.0130 | 0.12 |
| 308.15 | 0.0008 | 0.01 |
| 308.15 | 0.0014 | 0.02 |
| 308.15 | 0.0026 | 0.03 |
| 308.15 | 0.0032 | 0.04 |
| 308.15 | 0.0042 | 0.05 |
| 308.15 | 0.0053 | 0.06 |
| 308.15 | 0.0065 | 0.07 |
| 308.15 | 0.0080 | 0.09 |
| 308.15 | 0.0089 | 0.10 |
| 308.15 | 0.0104 | 0.12 |