- Name
- Carbonyl sulfide
- InChI
- InChI=1S/COS/c2-1-3
- InChI Key
- JJWKPURADFRFRB-UHFFFAOYSA-N
- Formula
- COS
- SMILES
- O=C=S
- Mol. Weight (g/mol)
- 60.08
- CAS
- 463-58-1
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Carbonyl sulfide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Carbonyl sulfide (1) - Liquid |
| 303.15 | 88.00 | 0.0148 |
| 303.15 | 176.00 | 0.0304 |
| 303.15 | 261.00 | 0.0449 |
| 303.15 | 355.00 | 0.0592 |
| 303.15 | 487.00 | 0.0812 |
| 303.15 | 601.00 | 0.0996 |
| 303.15 | 746.00 | 0.1210 |
| 303.15 | 825.00 | 0.1338 |
| 313.15 | 96.00 | 0.0139 |
| 313.15 | 191.00 | 0.0288 |
| 313.15 | 290.00 | 0.0414 |
| 313.15 | 395.00 | 0.0544 |
| 313.15 | 543.00 | 0.0748 |
| 313.15 | 671.00 | 0.0916 |
| 313.15 | 827.00 | 0.1123 |
| 313.15 | 929.00 | 0.1252 |
| 323.15 | 107.00 | 0.0127 |
| 323.15 | 210.00 | 0.0265 |
| 323.15 | 317.00 | 0.0385 |
| 323.15 | 432.00 | 0.0504 |
| 323.15 | 596.00 | 0.0691 |
| 323.15 | 738.00 | 0.0845 |
| 323.15 | 910.00 | 0.1038 |
| 323.15 | 1027.00 | 0.1169 |
| 333.15 | 116.00 | 0.0116 |
| 333.15 | 230.00 | 0.0244 |
| 333.15 | 344.00 | 0.0357 |
| 333.15 | 470.00 | 0.0466 |
| 333.15 | 648.00 | 0.0639 |
| 333.15 | 804.00 | 0.0780 |
| 333.15 | 993.00 | 0.0956 |
| 333.15 | 1119.00 | 0.1083 |
| 343.15 | 123.00 | 0.0111 |
| 343.15 | 246.00 | 0.0230 |
| 343.15 | 371.00 | 0.0331 |
| 343.15 | 508.00 | 0.0429 |
| 343.15 | 699.00 | 0.0593 |
| 343.15 | 869.00 | 0.0720 |
| 343.15 | 1075.00 | 0.0886 |
| 343.15 | 1204.00 | 0.1004 |
| 353.15 | 131.00 | 0.0105 |
| 353.15 | 264.00 | 0.0214 |
| 353.15 | 398.00 | 0.0307 |
| 353.15 | 546.00 | 0.0395 |
| 353.15 | 748.00 | 0.0551 |
| 353.15 | 932.00 | 0.0667 |
| 353.15 | 1159.00 | 0.0808 |
Mole fraction of Carbonyl sulfide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Carbonyl sulfide (1) - Liquid |
| 303.15 | 88.00 | 0.0148 |
| 303.15 | 176.00 | 0.0304 |
| 303.15 | 261.00 | 0.0449 |
| 303.15 | 355.00 | 0.0592 |
| 303.15 | 487.00 | 0.0812 |
| 303.15 | 601.00 | 0.0996 |
| 303.15 | 746.00 | 0.1210 |
| 303.15 | 825.00 | 0.1338 |
| 313.15 | 96.00 | 0.0139 |
| 313.15 | 191.00 | 0.0288 |
| 313.15 | 290.00 | 0.0414 |
| 313.15 | 395.00 | 0.0544 |
| 313.15 | 543.00 | 0.0748 |
| 313.15 | 671.00 | 0.0916 |
| 313.15 | 827.00 | 0.1123 |
| 313.15 | 929.00 | 0.1252 |
| 323.15 | 107.00 | 0.0127 |
| 323.15 | 210.00 | 0.0265 |
| 323.15 | 317.00 | 0.0385 |
| 323.15 | 432.00 | 0.0504 |
| 323.15 | 596.00 | 0.0691 |
| 323.15 | 738.00 | 0.0845 |
| 323.15 | 910.00 | 0.1038 |
| 323.15 | 1027.00 | 0.1169 |
| 333.15 | 116.00 | 0.0116 |
| 333.15 | 230.00 | 0.0244 |
| 333.15 | 344.00 | 0.0357 |
| 333.15 | 470.00 | 0.0466 |
| 333.15 | 648.00 | 0.0639 |
| 333.15 | 804.00 | 0.0780 |
| 333.15 | 993.00 | 0.0956 |
| 333.15 | 1119.00 | 0.1083 |
| 343.15 | 123.00 | 0.0111 |
| 343.15 | 246.00 | 0.0230 |
| 343.15 | 371.00 | 0.0331 |
| 343.15 | 508.00 | 0.0429 |
| 343.15 | 699.00 | 0.0593 |
| 343.15 | 869.00 | 0.0720 |
| 343.15 | 1075.00 | 0.0886 |
| 343.15 | 1204.00 | 0.1004 |
| 353.15 | 131.00 | 0.0105 |
| 353.15 | 264.00 | 0.0214 |
| 353.15 | 398.00 | 0.0307 |
| 353.15 | 546.00 | 0.0395 |
| 353.15 | 748.00 | 0.0551 |
| 353.15 | 932.00 | 0.0667 |
| 353.15 | 1159.00 | 0.0808 |