- Name
- Squalene
- InChI
- InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3/b27-17+,28-18+,29-23+,30-24+
- InChI Key
- YYGNTYWPHWGJRM-AAJYLUCBSA-N
- Formula
- C30H50
- SMILES
-
CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C
)CCC=C(C)CCC=C(C)C - Mol. Weight (g/mol)
- 410.72
- CAS
- 111-02-4
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- n-Hexadecanoic acid
- InChI
- InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)
- InChI Key
- IPCSVZSSVZVIGE-UHFFFAOYSA-N
- Formula
- C16H32O2
- SMILES
- CCCCCCCCCCCCCCCC(=O)O
- Mol. Weight (g/mol)
- 256.42
- CAS
- 57-10-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Squalene (1) [ref]
Operational condition: Mole fraction = 0.4208 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Squalene (1) - Fluid (supercritical or subcritical phases) |
| 314.47 | 9980.00 | 0.0003 |
| 314.47 | 15100.00 | 0.0017 |
| 314.47 | 20250.00 | 0.0029 |
| 314.47 | 24990.00 | 0.0039 |
| 314.47 | 29990.00 | 0.0048 |
| 324.28 | 10020.00 | 0.0001 |
| 324.28 | 14970.00 | 0.0013 |
| 324.28 | 20000.00 | 0.0025 |
| 324.28 | 25290.00 | 0.0035 |
| 324.28 | 30010.00 | 0.0043 |
| 333.39 | 10000.00 | 1.0000e-06 |
| 333.39 | 14990.00 | 0.0010 |
| 333.39 | 20180.00 | 0.0019 |
| 333.39 | 25210.00 | 0.0029 |
| 333.39 | 30010.00 | 0.0037 |
Mole fraction of n-Hexadecanoic acid (3) [ref]
Operational condition: Mole fraction = 0.4208 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of n-Hexadecanoic acid (3) - Fluid (supercritical or subcritical phases) |
| 314.47 | 9980.00 | 0.0001 |
| 314.47 | 15100.00 | 0.0004 |
| 314.47 | 20250.00 | 0.0007 |
| 314.47 | 24990.00 | 0.0010 |
| 314.47 | 29990.00 | 0.0012 |
| 324.28 | 10020.00 | 0.0001 |
| 324.28 | 14970.00 | 0.0004 |
| 324.28 | 20000.00 | 0.0006 |
| 324.28 | 25290.00 | 0.0009 |
| 324.28 | 30010.00 | 0.0011 |
| 333.39 | 10000.00 | 6.0000e-07 |
| 333.39 | 14990.00 | 0.0003 |
| 333.39 | 20180.00 | 0.0005 |
| 333.39 | 25210.00 | 0.0007 |
| 333.39 | 30010.00 | 0.0008 |
Mole fraction of Squalene (1) [ref]
Operational condition: Mole fraction = 0.4208 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Squalene (1) - Fluid (supercritical or subcritical phases) |
| 314.47 | 9980.00 | 0.0003 |
| 314.47 | 15100.00 | 0.0017 |
| 314.47 | 20250.00 | 0.0029 |
| 314.47 | 24990.00 | 0.0039 |
| 314.47 | 29990.00 | 0.0048 |
| 324.28 | 10020.00 | 0.0001 |
| 324.28 | 14970.00 | 0.0013 |
| 324.28 | 20000.00 | 0.0025 |
| 324.28 | 25290.00 | 0.0035 |
| 324.28 | 30010.00 | 0.0043 |
| 333.39 | 10000.00 | 1.0000e-06 |
| 333.39 | 14990.00 | 0.0010 |
| 333.39 | 20180.00 | 0.0019 |
| 333.39 | 25210.00 | 0.0029 |
| 333.39 | 30010.00 | 0.0037 |
Mole fraction of n-Hexadecanoic acid (3) [ref]
Operational condition: Mole fraction = 0.4208 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of n-Hexadecanoic acid (3) - Fluid (supercritical or subcritical phases) |
| 314.47 | 9980.00 | 0.0001 |
| 314.47 | 15100.00 | 0.0004 |
| 314.47 | 20250.00 | 0.0007 |
| 314.47 | 24990.00 | 0.0010 |
| 314.47 | 29990.00 | 0.0012 |
| 324.28 | 10020.00 | 0.0001 |
| 324.28 | 14970.00 | 0.0004 |
| 324.28 | 20000.00 | 0.0006 |
| 324.28 | 25290.00 | 0.0009 |
| 324.28 | 30010.00 | 0.0011 |
| 333.39 | 10000.00 | 6.0000e-07 |
| 333.39 | 14990.00 | 0.0003 |
| 333.39 | 20180.00 | 0.0005 |
| 333.39 | 25210.00 | 0.0007 |
| 333.39 | 30010.00 | 0.0008 |