- Name
- Ammonium sulfate
- InChI
- InChI=1S/H8N2O4S/c1-5-7(3,4)6-2/h1-2H4
- InChI Key
- KTMPTTWZBSFVPI-UHFFFAOYSA-N
- Formula
- H8N2O4S
- SMILES
- NOS(=O)(=O)ON
- Mol. Weight (g/mol)
- 132.14
- CAS
- 7783-20-2
- Name
- Ammonium nitrate
- InChI
- InChI=1S/H4N2O3/c1-5-2(3)4/h1H4
- InChI Key
- ASFXIDPWCNUKTK-UHFFFAOYSA-N
- Formula
- H4N2O3
- SMILES
- NO[N+](=O)[O-]
- Mol. Weight (g/mol)
- 80.04
- CAS
- 6484-52-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (8)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (4)
- λ - Thermal conductivity, W/m/K (2)
Mole fraction of Ammonium sulfate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid |
| 303.15 | 0.2269 | 0.0366 |
| 323.15 | 0.2945 | 0.0303 |
Mole fraction of Ammonium sulfate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid |
| 303.15 | 0.2269 | 0.0366 |
| 303.15 | 0.2727 | 0.0234 |
| 323.15 | 0.2945 | 0.0303 |
| 323.15 | 0.3391 | 0.0210 |
Mole fraction of Ammonium sulfate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid |
| 303.15 | 0.2727 | 0.0234 |
| 303.15 | 0.3336 | 0.0104 |
| 323.15 | 0.3391 | 0.0210 |
| 323.15 | 0.4433 | 0.0105 |
Mole fraction of Ammonium sulfate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid |
| 303.15 | 0.3336 | 0.0104 |
| 323.15 | 0.4433 | 0.0105 |
Mole fraction of Ammonium sulfate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid |
| 303.15 | 0.2269 | 0.0366 |
| 323.15 | 0.2945 | 0.0303 |
Mole fraction of Ammonium sulfate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid |
| 303.15 | 0.2269 | 0.0366 |
| 303.15 | 0.2727 | 0.0234 |
| 323.15 | 0.2945 | 0.0303 |
| 323.15 | 0.3391 | 0.0210 |
Mole fraction of Ammonium sulfate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid |
| 303.15 | 0.2727 | 0.0234 |
| 303.15 | 0.3336 | 0.0104 |
| 323.15 | 0.3391 | 0.0210 |
| 323.15 | 0.4433 | 0.0105 |
Mole fraction of Ammonium sulfate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid |
| 303.15 | 0.3336 | 0.0104 |
| 323.15 | 0.4433 | 0.0105 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 303.15 | 0.2269 | 0.0366 | 1.4188 |
| 303.15 | 0.2727 | 0.0234 | 1.4224 |
| 303.15 | 0.3336 | 0.0104 | 1.4292 |
| 323.15 | 0.2945 | 0.0303 | 1.4267 |
| 323.15 | 0.3391 | 0.0210 | 1.4301 |
| 323.15 | 0.4433 | 0.0105 | 1.4374 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 303.15 | 0.2269 | 0.0366 | 1.4188 |
| 303.15 | 0.2727 | 0.0234 | 1.4224 |
| 303.15 | 0.3336 | 0.0104 | 1.4292 |
| 323.15 | 0.2945 | 0.0303 | 1.4267 |
| 323.15 | 0.3391 | 0.0210 | 1.4301 |
| 323.15 | 0.4433 | 0.0105 | 1.4374 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.2269 | 0.0366 | 1303.0 |
| 303.15 | 0.2727 | 0.0234 | 1315.0 |
| 303.15 | 0.3336 | 0.0104 | 1338.0 |
| 323.15 | 0.2945 | 0.0303 | 1333.0 |
| 323.15 | 0.3391 | 0.0210 | 1342.0 |
| 323.15 | 0.4433 | 0.0105 | 1370.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Ammonium sulfate (1) - Liquid | Mass fraction of Ammonium nitrate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 278.15 | 0.0500 | 0.0500 | 1052.06 |
| 278.15 | 0.0500 | 0.1000 | 1073.94 |
| 278.15 | 0.0500 | 0.1500 | 1095.89 |
| 278.15 | 0.0500 | 0.2000 | 1119.14 |
| 278.15 | 0.1000 | 0.0500 | 1081.74 |
| 278.15 | 0.1000 | 0.1000 | 1103.7 |
| 278.15 | 0.1500 | 0.0500 | 1111.33 |
| 278.15 | 0.2000 | 0.0500 | 1140.81 |
| 278.15 | 0.2000 | 0.2000 | 1209.61 |
| 283.15 | 0.0500 | 0.0500 | 1050.9 |
| 283.15 | 0.0500 | 0.1000 | 1072.41 |
| 283.15 | 0.0500 | 0.1500 | 1093.75 |
| 283.15 | 0.0500 | 0.2000 | 1117.02 |
| 283.15 | 0.1000 | 0.0500 | 1080.3 |
| 283.15 | 0.1000 | 0.1000 | 1101.99 |
| 283.15 | 0.1500 | 0.0500 | 1109.69 |
| 283.15 | 0.2000 | 0.0500 | 1139.02 |
| 283.15 | 0.2000 | 0.2000 | 1207.22 |
| 288.15 | 0.0500 | 0.0500 | 1049.56 |
| 288.15 | 0.0500 | 0.1000 | 1070.73 |
| 288.15 | 0.0500 | 0.1500 | 1091.33 |
| 288.15 | 0.0500 | 0.2000 | 1114.8 |
| 288.15 | 0.1000 | 0.0500 | 1078.73 |
| 288.15 | 0.1000 | 0.1000 | 1100.14 |
| 288.15 | 0.1500 | 0.0500 | 1107.95 |
| 288.15 | 0.2000 | 0.0500 | 1137.14 |
| 288.15 | 0.2000 | 0.2000 | 1204.8 |
| 293.15 | 0.0500 | 0.0500 | 1048.03 |
| 293.15 | 0.0500 | 0.1000 | 1068.91 |
| 293.15 | 0.0500 | 0.1500 | 1088.88 |
| 293.15 | 0.0500 | 0.2000 | 1112.5 |
| 293.15 | 0.1000 | 0.0500 | 1077.02 |
| 293.15 | 0.1000 | 0.1000 | 1098.17 |
| 293.15 | 0.1500 | 0.0500 | 1106.1 |
| 293.15 | 0.2000 | 0.0500 | 1135.19 |
| 293.15 | 0.2000 | 0.2000 | 1202.34 |
| 298.15 | 0.0500 | 0.0500 | 1046.35 |
| 298.15 | 0.0500 | 0.1000 | 1066.97 |
| 298.15 | 0.0500 | 0.1500 | 1086.3 |
| 298.15 | 0.0500 | 0.2000 | 1110.12 |
| 298.15 | 0.1000 | 0.0500 | 1075.19 |
| 298.15 | 0.1000 | 0.1000 | 1096.11 |
| 298.15 | 0.1500 | 0.0500 | 1104.16 |
| 298.15 | 0.2000 | 0.0500 | 1133.17 |
| 298.15 | 0.2000 | 0.2000 | 1199.83 |
| 303.15 | 0.0500 | 0.0500 | 1044.49 |
| 303.15 | 0.0500 | 0.1000 | 1064.91 |
| 303.15 | 0.0500 | 0.1500 | 1083.7 |
| 303.15 | 0.0500 | 0.2000 | 1107.67 |
| 303.15 | 0.1000 | 0.0500 | 1073.24 |
| 303.15 | 0.1000 | 0.1000 | 1093.95 |
| 303.15 | 0.1500 | 0.0500 | 1102.14 |
| 303.15 | 0.2000 | 0.0500 | 1131.06 |
| 303.15 | 0.2000 | 0.2000 | 1197.29 |
| 313.15 | 0.0500 | 0.0500 | 1040.43 |
| 313.15 | 0.0500 | 0.1000 | 1060.44 |
| 313.15 | 0.0500 | 0.1500 | 1080.08 |
| 313.15 | 0.0500 | 0.2000 | 1102.55 |
| 313.15 | 0.1000 | 0.0500 | 1069.01 |
| 313.15 | 0.1000 | 0.1000 | 1089.35 |
| 313.15 | 0.1500 | 0.0500 | 1097.81 |
| 313.15 | 0.2000 | 0.0500 | 1126.67 |
| 313.15 | 0.2000 | 0.2000 | 1192.1 |
| 323.15 | 0.0500 | 0.0500 | 1035.44 |
| 323.15 | 0.0500 | 0.1000 | 1055.52 |
| 323.15 | 0.0500 | 0.1500 | 1074.71 |
| 323.15 | 0.0500 | 0.2000 | 1097.15 |
| 323.15 | 0.1000 | 0.0500 | 1064.3 |
| 323.15 | 0.1000 | 0.1000 | 1084.34 |
| 323.15 | 0.1500 | 0.0500 | 1093.14 |
| 323.15 | 0.2000 | 0.0500 | 1122.06 |
| 323.15 | 0.2000 | 0.2000 | 1186.79 |
| 333.15 | 0.0500 | 0.0500 | 1029.92 |
| 333.15 | 0.0500 | 0.1000 | 1049.77 |
| 333.15 | 0.0500 | 0.1500 | 1070.05 |
| 333.15 | 0.0500 | 0.2000 | 1091.31 |
| 333.15 | 0.1000 | 0.0500 | 1058.16 |
| 333.15 | 0.1000 | 0.1000 | 1078.84 |
| 333.15 | 0.1500 | 0.0500 | 1087.9 |
| 333.15 | 0.2000 | 0.0500 | 1117.18 |
| 333.15 | 0.2000 | 0.2000 | 1181.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ammonium nitrate (2) - Liquid | Mole fraction of Ammonium sulfate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.2269 | 0.0366 | 1303.0 |
| 303.15 | 0.2727 | 0.0234 | 1315.0 |
| 303.15 | 0.3336 | 0.0104 | 1338.0 |
| 323.15 | 0.2945 | 0.0303 | 1333.0 |
| 323.15 | 0.3391 | 0.0210 | 1342.0 |
| 323.15 | 0.4433 | 0.0105 | 1370.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Ammonium sulfate (1) - Liquid | Mass fraction of Ammonium nitrate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 278.15 | 0.0500 | 0.0500 | 1052.06 |
| 278.15 | 0.0500 | 0.1000 | 1073.94 |
| 278.15 | 0.0500 | 0.1500 | 1095.89 |
| 278.15 | 0.0500 | 0.2000 | 1119.14 |
| 278.15 | 0.1000 | 0.0500 | 1081.74 |
| 278.15 | 0.1000 | 0.1000 | 1103.7 |
| 278.15 | 0.1500 | 0.0500 | 1111.33 |
| 278.15 | 0.2000 | 0.0500 | 1140.81 |
| 278.15 | 0.2000 | 0.2000 | 1209.61 |
| 283.15 | 0.0500 | 0.0500 | 1050.9 |
| 283.15 | 0.0500 | 0.1000 | 1072.41 |
| 283.15 | 0.0500 | 0.1500 | 1093.75 |
| 283.15 | 0.0500 | 0.2000 | 1117.02 |
| 283.15 | 0.1000 | 0.0500 | 1080.3 |
| 283.15 | 0.1000 | 0.1000 | 1101.99 |
| 283.15 | 0.1500 | 0.0500 | 1109.69 |
| 283.15 | 0.2000 | 0.0500 | 1139.02 |
| 283.15 | 0.2000 | 0.2000 | 1207.22 |
| 288.15 | 0.0500 | 0.0500 | 1049.56 |
| 288.15 | 0.0500 | 0.1000 | 1070.73 |
| 288.15 | 0.0500 | 0.1500 | 1091.33 |
| 288.15 | 0.0500 | 0.2000 | 1114.8 |
| 288.15 | 0.1000 | 0.0500 | 1078.73 |
| 288.15 | 0.1000 | 0.1000 | 1100.14 |
| 288.15 | 0.1500 | 0.0500 | 1107.95 |
| 288.15 | 0.2000 | 0.0500 | 1137.14 |
| 288.15 | 0.2000 | 0.2000 | 1204.8 |
| 293.15 | 0.0500 | 0.0500 | 1048.03 |
| 293.15 | 0.0500 | 0.1000 | 1068.91 |
| 293.15 | 0.0500 | 0.1500 | 1088.88 |
| 293.15 | 0.0500 | 0.2000 | 1112.5 |
| 293.15 | 0.1000 | 0.0500 | 1077.02 |
| 293.15 | 0.1000 | 0.1000 | 1098.17 |
| 293.15 | 0.1500 | 0.0500 | 1106.1 |
| 293.15 | 0.2000 | 0.0500 | 1135.19 |
| 293.15 | 0.2000 | 0.2000 | 1202.34 |
| 298.15 | 0.0500 | 0.0500 | 1046.35 |
| 298.15 | 0.0500 | 0.1000 | 1066.97 |
| 298.15 | 0.0500 | 0.1500 | 1086.3 |
| 298.15 | 0.0500 | 0.2000 | 1110.12 |
| 298.15 | 0.1000 | 0.0500 | 1075.19 |
| 298.15 | 0.1000 | 0.1000 | 1096.11 |
| 298.15 | 0.1500 | 0.0500 | 1104.16 |
| 298.15 | 0.2000 | 0.0500 | 1133.17 |
| 298.15 | 0.2000 | 0.2000 | 1199.83 |
| 303.15 | 0.0500 | 0.0500 | 1044.49 |
| 303.15 | 0.0500 | 0.1000 | 1064.91 |
| 303.15 | 0.0500 | 0.1500 | 1083.7 |
| 303.15 | 0.0500 | 0.2000 | 1107.67 |
| 303.15 | 0.1000 | 0.0500 | 1073.24 |
| 303.15 | 0.1000 | 0.1000 | 1093.95 |
| 303.15 | 0.1500 | 0.0500 | 1102.14 |
| 303.15 | 0.2000 | 0.0500 | 1131.06 |
| 303.15 | 0.2000 | 0.2000 | 1197.29 |
| 313.15 | 0.0500 | 0.0500 | 1040.43 |
| 313.15 | 0.0500 | 0.1000 | 1060.44 |
| 313.15 | 0.0500 | 0.1500 | 1080.08 |
| 313.15 | 0.0500 | 0.2000 | 1102.55 |
| 313.15 | 0.1000 | 0.0500 | 1069.01 |
| 313.15 | 0.1000 | 0.1000 | 1089.35 |
| 313.15 | 0.1500 | 0.0500 | 1097.81 |
| 313.15 | 0.2000 | 0.0500 | 1126.67 |
| 313.15 | 0.2000 | 0.2000 | 1192.1 |
| 323.15 | 0.0500 | 0.0500 | 1035.44 |
| 323.15 | 0.0500 | 0.1000 | 1055.52 |
| 323.15 | 0.0500 | 0.1500 | 1074.71 |
| 323.15 | 0.0500 | 0.2000 | 1097.15 |
| 323.15 | 0.1000 | 0.0500 | 1064.3 |
| 323.15 | 0.1000 | 0.1000 | 1084.34 |
| 323.15 | 0.1500 | 0.0500 | 1093.14 |
| 323.15 | 0.2000 | 0.0500 | 1122.06 |
| 323.15 | 0.2000 | 0.2000 | 1186.79 |
| 333.15 | 0.0500 | 0.0500 | 1029.92 |
| 333.15 | 0.0500 | 0.1000 | 1049.77 |
| 333.15 | 0.0500 | 0.1500 | 1070.05 |
| 333.15 | 0.0500 | 0.2000 | 1091.31 |
| 333.15 | 0.1000 | 0.0500 | 1058.16 |
| 333.15 | 0.1000 | 0.1000 | 1078.84 |
| 333.15 | 0.1500 | 0.0500 | 1087.9 |
| 333.15 | 0.2000 | 0.0500 | 1117.18 |
| 333.15 | 0.2000 | 0.2000 | 1181.37 |
Thermal conductivity, W/m/K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Ammonium sulfate (1) - Liquid | Mass fraction of Ammonium nitrate (2) - Liquid | Temperature, K - Liquid | Thermal conductivity, W/m/K - Liquid |
| 0.0500 | 0.0500 | 280.14 | 0.5654 |
| 0.0500 | 0.0500 | 285.48 | 0.5752 |
| 0.0500 | 0.0500 | 290.81 | 0.5878 |
| 0.0500 | 0.0500 | 296.10 | 0.5946 |
| 0.0500 | 0.0500 | 301.56 | 0.6032 |
| 0.0500 | 0.0500 | 306.75 | 0.6140 |
| 0.0500 | 0.0500 | 316.95 | 0.6243 |
| 0.0500 | 0.0500 | 327.23 | 0.6343 |
| 0.0500 | 0.0500 | 337.19 | 0.6428 |
| 0.0500 | 0.1000 | 279.96 | 0.5593 |
| 0.0500 | 0.1000 | 285.39 | 0.5708 |
| 0.0500 | 0.1000 | 290.56 | 0.5811 |
| 0.0500 | 0.1000 | 296.09 | 0.5925 |
| 0.0500 | 0.1000 | 301.41 | 0.6015 |
| 0.0500 | 0.1000 | 306.63 | 0.6111 |
| 0.0500 | 0.1000 | 316.79 | 0.6203 |
| 0.0500 | 0.1000 | 327.21 | 0.6292 |
| 0.0500 | 0.1000 | 337.27 | 0.6394 |
| 0.0500 | 0.1500 | 280.07 | 0.5531 |
| 0.0500 | 0.1500 | 285.40 | 0.5634 |
| 0.0500 | 0.1500 | 290.68 | 0.5739 |
| 0.0500 | 0.1500 | 295.98 | 0.5845 |
| 0.0500 | 0.1500 | 301.32 | 0.5941 |
| 0.0500 | 0.1500 | 306.41 | 0.6026 |
| 0.0500 | 0.1500 | 316.89 | 0.6149 |
| 0.0500 | 0.1500 | 326.92 | 0.6256 |
| 0.0500 | 0.1500 | 337.15 | 0.6358 |
| 0.0500 | 0.2000 | 279.87 | 0.5498 |
| 0.0500 | 0.2000 | 285.45 | 0.5619 |
| 0.0500 | 0.2000 | 290.70 | 0.5726 |
| 0.0500 | 0.2000 | 295.93 | 0.5802 |
| 0.0500 | 0.2000 | 301.53 | 0.5910 |
| 0.0500 | 0.2000 | 306.59 | 0.6004 |
| 0.0500 | 0.2000 | 316.69 | 0.6121 |
| 0.0500 | 0.2000 | 326.92 | 0.6214 |
| 0.0500 | 0.2000 | 337.14 | 0.6311 |
| 0.1000 | 0.0500 | 279.90 | 0.5519 |
| 0.1000 | 0.0500 | 285.20 | 0.5614 |
| 0.1000 | 0.0500 | 290.55 | 0.5735 |
| 0.1000 | 0.0500 | 295.97 | 0.5838 |
| 0.1000 | 0.0500 | 301.10 | 0.5933 |
| 0.1000 | 0.0500 | 306.35 | 0.6021 |
| 0.1000 | 0.0500 | 316.44 | 0.6147 |
| 0.1000 | 0.0500 | 327.04 | 0.6253 |
| 0.1000 | 0.0500 | 337.03 | 0.6353 |
| 0.1000 | 0.1000 | 280.26 | 0.5479 |
| 0.1000 | 0.1000 | 285.44 | 0.5594 |
| 0.1000 | 0.1000 | 290.59 | 0.5702 |
| 0.1000 | 0.1000 | 296.17 | 0.5812 |
| 0.1000 | 0.1000 | 301.29 | 0.5909 |
| 0.1000 | 0.1000 | 306.36 | 0.5989 |
| 0.1000 | 0.1000 | 316.77 | 0.6121 |
| 0.1000 | 0.1000 | 327.00 | 0.6227 |
| 0.1000 | 0.1000 | 337.41 | 0.6312 |
| 0.1500 | 0.0500 | 279.82 | 0.5447 |
| 0.1500 | 0.0500 | 285.56 | 0.5571 |
| 0.1500 | 0.0500 | 290.42 | 0.5672 |
| 0.1500 | 0.0500 | 296.07 | 0.5795 |
| 0.1500 | 0.0500 | 301.41 | 0.5895 |
| 0.1500 | 0.0500 | 306.46 | 0.5975 |
| 0.1500 | 0.0500 | 316.77 | 0.6106 |
| 0.1500 | 0.0500 | 327.21 | 0.6198 |
| 0.1500 | 0.0500 | 337.11 | 0.6286 |
| 0.2000 | 0.0500 | 280.13 | 0.5432 |
| 0.2000 | 0.0500 | 285.20 | 0.5512 |
| 0.2000 | 0.0500 | 290.68 | 0.5629 |
| 0.2000 | 0.0500 | 296.02 | 0.5729 |
| 0.2000 | 0.0500 | 301.25 | 0.5809 |
| 0.2000 | 0.0500 | 306.42 | 0.5900 |
| 0.2000 | 0.0500 | 316.83 | 0.6028 |
| 0.2000 | 0.0500 | 327.10 | 0.6138 |
| 0.2000 | 0.0500 | 337.05 | 0.6232 |
| 0.2000 | 0.2000 | 280.52 | 0.5330 |
| 0.2000 | 0.2000 | 285.92 | 0.5432 |
| 0.2000 | 0.2000 | 291.09 | 0.5540 |
| 0.2000 | 0.2000 | 296.43 | 0.5662 |
| 0.2000 | 0.2000 | 301.79 | 0.5754 |
| 0.2000 | 0.2000 | 307.10 | 0.5821 |
| 0.2000 | 0.2000 | 317.39 | 0.5946 |
| 0.2000 | 0.2000 | 327.50 | 0.6052 |
| 0.2000 | 0.2000 | 337.36 | 0.6140 |
Thermal conductivity, W/m/K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Ammonium sulfate (1) - Liquid | Mass fraction of Ammonium nitrate (2) - Liquid | Temperature, K - Liquid | Thermal conductivity, W/m/K - Liquid |
| 0.0500 | 0.0500 | 280.14 | 0.5654 |
| 0.0500 | 0.0500 | 285.48 | 0.5752 |
| 0.0500 | 0.0500 | 290.81 | 0.5878 |
| 0.0500 | 0.0500 | 296.10 | 0.5946 |
| 0.0500 | 0.0500 | 301.56 | 0.6032 |
| 0.0500 | 0.0500 | 306.75 | 0.6140 |
| 0.0500 | 0.0500 | 316.95 | 0.6243 |
| 0.0500 | 0.0500 | 327.23 | 0.6343 |
| 0.0500 | 0.0500 | 337.19 | 0.6428 |
| 0.0500 | 0.1000 | 279.96 | 0.5593 |
| 0.0500 | 0.1000 | 285.39 | 0.5708 |
| 0.0500 | 0.1000 | 290.56 | 0.5811 |
| 0.0500 | 0.1000 | 296.09 | 0.5925 |
| 0.0500 | 0.1000 | 301.41 | 0.6015 |
| 0.0500 | 0.1000 | 306.63 | 0.6111 |
| 0.0500 | 0.1000 | 316.79 | 0.6203 |
| 0.0500 | 0.1000 | 327.21 | 0.6292 |
| 0.0500 | 0.1000 | 337.27 | 0.6394 |
| 0.0500 | 0.1500 | 280.07 | 0.5531 |
| 0.0500 | 0.1500 | 285.40 | 0.5634 |
| 0.0500 | 0.1500 | 290.68 | 0.5739 |
| 0.0500 | 0.1500 | 295.98 | 0.5845 |
| 0.0500 | 0.1500 | 301.32 | 0.5941 |
| 0.0500 | 0.1500 | 306.41 | 0.6026 |
| 0.0500 | 0.1500 | 316.89 | 0.6149 |
| 0.0500 | 0.1500 | 326.92 | 0.6256 |
| 0.0500 | 0.1500 | 337.15 | 0.6358 |
| 0.0500 | 0.2000 | 279.87 | 0.5498 |
| 0.0500 | 0.2000 | 285.45 | 0.5619 |
| 0.0500 | 0.2000 | 290.70 | 0.5726 |
| 0.0500 | 0.2000 | 295.93 | 0.5802 |
| 0.0500 | 0.2000 | 301.53 | 0.5910 |
| 0.0500 | 0.2000 | 306.59 | 0.6004 |
| 0.0500 | 0.2000 | 316.69 | 0.6121 |
| 0.0500 | 0.2000 | 326.92 | 0.6214 |
| 0.0500 | 0.2000 | 337.14 | 0.6311 |
| 0.1000 | 0.0500 | 279.90 | 0.5519 |
| 0.1000 | 0.0500 | 285.20 | 0.5614 |
| 0.1000 | 0.0500 | 290.55 | 0.5735 |
| 0.1000 | 0.0500 | 295.97 | 0.5838 |
| 0.1000 | 0.0500 | 301.10 | 0.5933 |
| 0.1000 | 0.0500 | 306.35 | 0.6021 |
| 0.1000 | 0.0500 | 316.44 | 0.6147 |
| 0.1000 | 0.0500 | 327.04 | 0.6253 |
| 0.1000 | 0.0500 | 337.03 | 0.6353 |
| 0.1000 | 0.1000 | 280.26 | 0.5479 |
| 0.1000 | 0.1000 | 285.44 | 0.5594 |
| 0.1000 | 0.1000 | 290.59 | 0.5702 |
| 0.1000 | 0.1000 | 296.17 | 0.5812 |
| 0.1000 | 0.1000 | 301.29 | 0.5909 |
| 0.1000 | 0.1000 | 306.36 | 0.5989 |
| 0.1000 | 0.1000 | 316.77 | 0.6121 |
| 0.1000 | 0.1000 | 327.00 | 0.6227 |
| 0.1000 | 0.1000 | 337.41 | 0.6312 |
| 0.1500 | 0.0500 | 279.82 | 0.5447 |
| 0.1500 | 0.0500 | 285.56 | 0.5571 |
| 0.1500 | 0.0500 | 290.42 | 0.5672 |
| 0.1500 | 0.0500 | 296.07 | 0.5795 |
| 0.1500 | 0.0500 | 301.41 | 0.5895 |
| 0.1500 | 0.0500 | 306.46 | 0.5975 |
| 0.1500 | 0.0500 | 316.77 | 0.6106 |
| 0.1500 | 0.0500 | 327.21 | 0.6198 |
| 0.1500 | 0.0500 | 337.11 | 0.6286 |
| 0.2000 | 0.0500 | 280.13 | 0.5432 |
| 0.2000 | 0.0500 | 285.20 | 0.5512 |
| 0.2000 | 0.0500 | 290.68 | 0.5629 |
| 0.2000 | 0.0500 | 296.02 | 0.5729 |
| 0.2000 | 0.0500 | 301.25 | 0.5809 |
| 0.2000 | 0.0500 | 306.42 | 0.5900 |
| 0.2000 | 0.0500 | 316.83 | 0.6028 |
| 0.2000 | 0.0500 | 327.10 | 0.6138 |
| 0.2000 | 0.0500 | 337.05 | 0.6232 |
| 0.2000 | 0.2000 | 280.52 | 0.5330 |
| 0.2000 | 0.2000 | 285.92 | 0.5432 |
| 0.2000 | 0.2000 | 291.09 | 0.5540 |
| 0.2000 | 0.2000 | 296.43 | 0.5662 |
| 0.2000 | 0.2000 | 301.79 | 0.5754 |
| 0.2000 | 0.2000 | 307.10 | 0.5821 |
| 0.2000 | 0.2000 | 317.39 | 0.5946 |
| 0.2000 | 0.2000 | 327.50 | 0.6052 |
| 0.2000 | 0.2000 | 337.36 | 0.6140 |