- Name
- Formamide, N,N-dimethyl-
- InChI
- InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3
- InChI Key
- ZMXDDKWLCZADIW-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CN(C)C=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 68-12-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- 6-Aminohexanoic acid
- InChI
- InChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9)
- InChI Key
- SLXKOJJOQWFEFD-UHFFFAOYSA-N
- Formula
- C6H13NO2
- SMILES
- NCCCCCC(=O)O
- Mol. Weight (g/mol)
- 131.17
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 6-Aminohexanoic acid (3) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mole fraction of Water (2) - Liquid | Mole fraction of 6-Aminohexanoic acid (3) - Liquid |
| 283.15 | 0.5000 | 0.0001 |
| 283.15 | 0.6000 | 0.0006 |
| 283.15 | 0.7000 | 0.0028 |
| 283.15 | 0.8000 | 0.0168 |
| 283.15 | 0.9000 | 0.0562 |
| 293.15 | 0.5000 | 0.0002 |
| 293.15 | 0.6000 | 0.0009 |
| 293.15 | 0.7000 | 0.0039 |
| 293.15 | 0.8000 | 0.0216 |
| 293.15 | 0.9000 | 0.0602 |
| 303.15 | 0.5000 | 0.0003 |
| 303.15 | 0.6000 | 0.0012 |
| 303.15 | 0.7000 | 0.0055 |
| 303.15 | 0.8000 | 0.0283 |
| 303.15 | 0.9000 | 0.0688 |
| 313.15 | 0.5000 | 0.0004 |
| 313.15 | 0.6000 | 0.0016 |
| 313.15 | 0.7000 | 0.0079 |
| 313.15 | 0.8000 | 0.0365 |
| 313.15 | 0.9000 | 0.0794 |
| 323.15 | 0.5000 | 0.0006 |
| 323.15 | 0.6000 | 0.0020 |
| 323.15 | 0.7000 | 0.0111 |
| 323.15 | 0.8000 | 0.0460 |
| 323.15 | 0.9000 | 0.0915 |
| 288.15 | 0.5000 | 0.0001 |
| 288.15 | 0.6000 | 0.0008 |
| 288.15 | 0.7000 | 0.0036 |
| 288.15 | 0.8000 | 0.0194 |
| 288.15 | 0.9000 | 0.0583 |
| 298.15 | 0.5000 | 0.0002 |
| 298.15 | 0.6000 | 0.0011 |
| 298.15 | 0.7000 | 0.0049 |
| 298.15 | 0.8000 | 0.0245 |
| 298.15 | 0.9000 | 0.0635 |
| 308.15 | 0.5000 | 0.0003 |
| 308.15 | 0.6000 | 0.0014 |
| 308.15 | 0.7000 | 0.0069 |
| 308.15 | 0.8000 | 0.0330 |
| 308.15 | 0.9000 | 0.0736 |
| 318.15 | 0.5000 | 0.0005 |
| 318.15 | 0.6000 | 0.0018 |
| 318.15 | 0.7000 | 0.0096 |
| 318.15 | 0.8000 | 0.0409 |
| 318.15 | 0.9000 | 0.0853 |
Mole fraction of 6-Aminohexanoic acid (3) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mole fraction of Water (2) - Liquid | Mole fraction of 6-Aminohexanoic acid (3) - Liquid |
| 283.15 | 0.5000 | 0.0001 |
| 283.15 | 0.6000 | 0.0006 |
| 283.15 | 0.7000 | 0.0028 |
| 283.15 | 0.8000 | 0.0168 |
| 283.15 | 0.9000 | 0.0562 |
| 293.15 | 0.5000 | 0.0002 |
| 293.15 | 0.6000 | 0.0009 |
| 293.15 | 0.7000 | 0.0039 |
| 293.15 | 0.8000 | 0.0216 |
| 293.15 | 0.9000 | 0.0602 |
| 303.15 | 0.5000 | 0.0003 |
| 303.15 | 0.6000 | 0.0012 |
| 303.15 | 0.7000 | 0.0055 |
| 303.15 | 0.8000 | 0.0283 |
| 303.15 | 0.9000 | 0.0688 |
| 313.15 | 0.5000 | 0.0004 |
| 313.15 | 0.6000 | 0.0016 |
| 313.15 | 0.7000 | 0.0079 |
| 313.15 | 0.8000 | 0.0365 |
| 313.15 | 0.9000 | 0.0794 |
| 323.15 | 0.5000 | 0.0006 |
| 323.15 | 0.6000 | 0.0020 |
| 323.15 | 0.7000 | 0.0111 |
| 323.15 | 0.8000 | 0.0460 |
| 323.15 | 0.9000 | 0.0915 |
| 288.15 | 0.5000 | 0.0001 |
| 288.15 | 0.6000 | 0.0008 |
| 288.15 | 0.7000 | 0.0036 |
| 288.15 | 0.8000 | 0.0194 |
| 288.15 | 0.9000 | 0.0583 |
| 298.15 | 0.5000 | 0.0002 |
| 298.15 | 0.6000 | 0.0011 |
| 298.15 | 0.7000 | 0.0049 |
| 298.15 | 0.8000 | 0.0245 |
| 298.15 | 0.9000 | 0.0635 |
| 308.15 | 0.5000 | 0.0003 |
| 308.15 | 0.6000 | 0.0014 |
| 308.15 | 0.7000 | 0.0069 |
| 308.15 | 0.8000 | 0.0330 |
| 308.15 | 0.9000 | 0.0736 |
| 318.15 | 0.5000 | 0.0005 |
| 318.15 | 0.6000 | 0.0018 |
| 318.15 | 0.7000 | 0.0096 |
| 318.15 | 0.8000 | 0.0409 |
| 318.15 | 0.9000 | 0.0853 |