- Name
- Benzene
- InChI
- InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H
- InChI Key
- UHOVQNZJYSORNB-UHFFFAOYSA-N
- Formula
- C6H6
- SMILES
- c1ccccc1
- Mol. Weight (g/mol)
- 78.11
- CAS
- 71-43-2
- Name
- Ethane, 1,1-diethoxy-
- InChI
- InChI=1S/C6H14O2/c1-4-7-6(3)8-5-2/h6H,4-5H2,1-3H3
- InChI Key
- DHKHKXVYLBGOIT-UHFFFAOYSA-N
- Formula
- C6H14O2
- SMILES
- CCOC(C)OCC
- Mol. Weight (g/mol)
- 118.17
- CAS
- 105-57-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Activity coefficient of Benzene (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Benzene (1) - Liquid |
|---|---|
| 293.21 | 0.6400 |
| 303.16 | 0.5800 |
| 313.11 | 0.5600 |
| 323.13 | 0.6200 |
Activity coefficient of Benzene (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Benzene (1) - Liquid |
|---|---|
| 293.21 | 0.6400 |
| 303.16 | 0.5800 |
| 313.11 | 0.5600 |
| 323.13 | 0.6200 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 323.15 (Liquid)
- Pressure, kPa = 1308 (Liquid)
| Mole fraction of Benzene (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0778 | -0.0083 |
| 0.1511 | -0.0152 |
| 0.2204 | -0.0202 |
| 0.2860 | -0.0238 |
| 0.3481 | -0.0258 |
| 0.4071 | -0.0268 |
| 0.4631 | -0.0268 |
| 0.5165 | -0.0259 |
| 0.5672 | -0.0242 |
| 0.6157 | -0.0220 |
| 0.6619 | -0.0188 |
| 0.7061 | -0.0153 |
| 0.7484 | -0.0116 |
| 0.7889 | -0.0076 |
| 0.8278 | -0.0029 |
| 0.8650 | 0.0000 |
| 0.9008 | 0.0028 |
| 0.9351 | 0.0048 |
| 0.9682 | 0.0048 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 323.15 (Liquid)
- Pressure, kPa = 1308 (Liquid)
| Mole fraction of Benzene (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0778 | -0.0083 |
| 0.1511 | -0.0152 |
| 0.2204 | -0.0202 |
| 0.2860 | -0.0238 |
| 0.3481 | -0.0258 |
| 0.4071 | -0.0268 |
| 0.4631 | -0.0268 |
| 0.5165 | -0.0259 |
| 0.5672 | -0.0242 |
| 0.6157 | -0.0220 |
| 0.6619 | -0.0188 |
| 0.7061 | -0.0153 |
| 0.7484 | -0.0116 |
| 0.7889 | -0.0076 |
| 0.8278 | -0.0029 |
| 0.8650 | 0.0000 |
| 0.9008 | 0.0028 |
| 0.9351 | 0.0048 |
| 0.9682 | 0.0048 |