- Name
- Ethane, 1,1-diethoxy-
- InChI
- InChI=1S/C6H14O2/c1-4-7-6(3)8-5-2/h6H,4-5H2,1-3H3
- InChI Key
- DHKHKXVYLBGOIT-UHFFFAOYSA-N
- Formula
- C6H14O2
- SMILES
- CCOC(C)OCC
- Mol. Weight (g/mol)
- 118.17
- CAS
- 105-57-7
- Name
- Cyclohexane
- InChI
- InChI=1S/C6H12/c1-2-4-6-5-3-1/h1-6H2
- InChI Key
- XDTMQSROBMDMFD-UHFFFAOYSA-N
- Formula
- C6H12
- SMILES
- C1CCCCC1
- Mol. Weight (g/mol)
- 84.16
- CAS
- 110-82-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Activity coefficient of Cyclohexane (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Cyclohexane (2) - Liquid |
|---|---|
| 293.08 | 1.76 |
| 303.18 | 1.72 |
| 313.12 | 1.67 |
| 323.14 | 1.64 |
Activity coefficient of Cyclohexane (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Cyclohexane (2) - Liquid |
|---|---|
| 293.08 | 1.76 |
| 303.18 | 1.72 |
| 313.12 | 1.67 |
| 323.14 | 1.64 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 323.15 (Liquid)
- Pressure, kPa = 1308 (Liquid)
| Mole fraction of Cyclohexane (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0648 | 0.1134 |
| 0.1277 | 0.2116 |
| 0.1887 | 0.2981 |
| 0.2478 | 0.3692 |
| 0.3052 | 0.4292 |
| 0.3609 | 0.4773 |
| 0.4150 | 0.5135 |
| 0.4676 | 0.5379 |
| 0.5188 | 0.5511 |
| 0.5685 | 0.5562 |
| 0.6169 | 0.5449 |
| 0.6640 | 0.5280 |
| 0.7099 | 0.5013 |
| 0.7546 | 0.4625 |
| 0.7981 | 0.4127 |
| 0.8405 | 0.3553 |
| 0.8819 | 0.2849 |
| 0.9222 | 0.2012 |
| 0.9616 | 0.1094 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 323.15 (Liquid)
- Pressure, kPa = 1308 (Liquid)
| Mole fraction of Cyclohexane (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0648 | 0.1134 |
| 0.1277 | 0.2116 |
| 0.1887 | 0.2981 |
| 0.2478 | 0.3692 |
| 0.3052 | 0.4292 |
| 0.3609 | 0.4773 |
| 0.4150 | 0.5135 |
| 0.4676 | 0.5379 |
| 0.5188 | 0.5511 |
| 0.5685 | 0.5562 |
| 0.6169 | 0.5449 |
| 0.6640 | 0.5280 |
| 0.7099 | 0.5013 |
| 0.7546 | 0.4625 |
| 0.7981 | 0.4127 |
| 0.8405 | 0.3553 |
| 0.8819 | 0.2849 |
| 0.9222 | 0.2012 |
| 0.9616 | 0.1094 |