- Name
- Perfluorooctane
- InChI
- InChI=1S/C8F18/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26
- InChI Key
- YVBBRRALBYAZBM-UHFFFAOYSA-N
- Formula
- C8F18
- SMILES
-
FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C
(F)(F)C(F)(F)C(F)(F)C(F)(F)F - Mol. Weight (g/mol)
- 438.06
- CAS
- 307-34-6
- Name
- Pentane, 2,2,4-trimethyl-
- InChI
- InChI=1S/C8H18/c1-7(2)6-8(3,4)5/h7H,6H2,1-5H3
- InChI Key
- NHTMVDHEPJAVLT-UHFFFAOYSA-N
- Formula
- C8H18
- SMILES
- CC(C)CC(C)(C)C
- Mol. Weight (g/mol)
- 114.23
- CAS
- 540-84-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Liquid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Mole fraction of Perfluorooctane (1) - Liquid mixture 1 | Liquid-liquid equilibrium temperature, K - Liquid mixture 1 |
|---|---|
| 0.0776 | 280.80 |
| 0.0917 | 285.00 |
| 0.1126 | 289.80 |
| 0.1389 | 293.90 |
| 0.1805 | 297.70 |
| 0.2414 | 299.40 |
| 0.2975 | 299.90 |
| 0.4214 | 299.80 |
| 0.5014 | 298.50 |
| 0.5993 | 295.00 |
| 0.6500 | 292.50 |
| 0.6971 | 289.70 |
| 0.7472 | 284.90 |
| 0.8054 | 277.40 |
Liquid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Mole fraction of Perfluorooctane (1) - Liquid mixture 1 | Liquid-liquid equilibrium temperature, K - Liquid mixture 1 |
|---|---|
| 0.0776 | 280.80 |
| 0.0917 | 285.00 |
| 0.1126 | 289.80 |
| 0.1389 | 293.90 |
| 0.1805 | 297.70 |
| 0.2414 | 299.40 |
| 0.2975 | 299.90 |
| 0.4214 | 299.80 |
| 0.5014 | 298.50 |
| 0.5993 | 295.00 |
| 0.6500 | 292.50 |
| 0.6971 | 289.70 |
| 0.7472 | 284.90 |
| 0.8054 | 277.40 |