- Name
- 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-
- InChI
- InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)
- InChI Key
- KSEBMYQBYZTDHS-UHFFFAOYSA-N
- Formula
- C10H10O4
- SMILES
- COc1cc(C=CC(=O)O)ccc1O
- Mol. Weight (g/mol)
- 194.18
- CAS
- 1135-24-6
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)- (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)- (1) - Fluid (supercritical or subcritical phases) |
| 308.00 | 10000.00 | 6.9360e-07 |
| 308.00 | 15000.00 | 8.2990e-07 |
| 308.00 | 20000.00 | 9.2920e-07 |
| 308.00 | 25000.00 | 1.0279e-06 |
| 308.00 | 30000.00 | 1.1791e-06 |
| 308.00 | 35000.00 | 1.3617e-06 |
| 318.00 | 10000.00 | 4.5740e-07 |
| 318.00 | 15000.00 | 9.2450e-07 |
| 318.00 | 20000.00 | 1.1378e-06 |
| 318.00 | 25000.00 | 1.3781e-06 |
| 318.00 | 30000.00 | 1.6596e-06 |
| 318.00 | 35000.00 | 1.8299e-06 |
| 328.00 | 10000.00 | 2.5510e-07 |
| 328.00 | 15000.00 | 9.9660e-07 |
| 328.00 | 20000.00 | 1.2619e-06 |
| 328.00 | 25000.00 | 1.6014e-06 |
| 328.00 | 30000.00 | 1.8841e-06 |
| 328.00 | 35000.00 | 2.1323e-06 |
| 338.00 | 10000.00 | 2.1950e-07 |
| 338.00 | 15000.00 | 9.5090e-07 |
| 338.00 | 20000.00 | 1.3475e-06 |
| 338.00 | 25000.00 | 1.8046e-06 |
| 338.00 | 30000.00 | 2.2799e-06 |
| 338.00 | 35000.00 | 2.6527e-06 |
Mole fraction of 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)- (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)- (1) - Fluid (supercritical or subcritical phases) |
| 308.00 | 10000.00 | 6.9360e-07 |
| 308.00 | 15000.00 | 8.2990e-07 |
| 308.00 | 20000.00 | 9.2920e-07 |
| 308.00 | 25000.00 | 1.0279e-06 |
| 308.00 | 30000.00 | 1.1791e-06 |
| 308.00 | 35000.00 | 1.3617e-06 |
| 318.00 | 10000.00 | 4.5740e-07 |
| 318.00 | 15000.00 | 9.2450e-07 |
| 318.00 | 20000.00 | 1.1378e-06 |
| 318.00 | 25000.00 | 1.3781e-06 |
| 318.00 | 30000.00 | 1.6596e-06 |
| 318.00 | 35000.00 | 1.8299e-06 |
| 328.00 | 10000.00 | 2.5510e-07 |
| 328.00 | 15000.00 | 9.9660e-07 |
| 328.00 | 20000.00 | 1.2619e-06 |
| 328.00 | 25000.00 | 1.6014e-06 |
| 328.00 | 30000.00 | 1.8841e-06 |
| 328.00 | 35000.00 | 2.1323e-06 |
| 338.00 | 10000.00 | 2.1950e-07 |
| 338.00 | 15000.00 | 9.5090e-07 |
| 338.00 | 20000.00 | 1.3475e-06 |
| 338.00 | 25000.00 | 1.8046e-06 |
| 338.00 | 30000.00 | 2.2799e-06 |
| 338.00 | 35000.00 | 2.6527e-06 |