- Name
- Acetamide, 2,2,2-trifluoro-
- InChI
- InChI=1S/C2H2F3NO/c3-2(4,5)1(6)7/h(H2,6,7)
- InChI Key
- NRKYWOKHZRQRJR-UHFFFAOYSA-N
- Formula
- C2H2F3NO
- SMILES
- NC(=O)C(F)(F)F
- Mol. Weight (g/mol)
- 113.04
- CAS
- 354-38-1
- Name
- Methyltriphenylphosphonium bromide
- InChI
- InChI=1S/C19H18BrP/c1-21(20,17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3
- InChI Key
- BKRKYEFQSANYGA-UHFFFAOYSA-N
- Formula
- C19H18BrP
- SMILES
-
CP(Br)(c1ccccc1)(c1ccccc1)c1cc
ccc1 - Mol. Weight (g/mol)
- 357.22
- CAS
- 1779-49-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- σcond - Electrical conductivity, S/m (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Mole fraction = 0.111 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 278.10 | 0.6577 |
| 288.15 | 0.4059 |
| 298.15 | 0.1365 |
| 308.15 | 0.0713 |
| 318.15 | 0.0390 |
| 328.15 | 0.0241 |
| 338.15 | 0.0166 |
| 348.15 | 0.0111 |
| 358.15 | 0.0009 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Mole fraction = 0.111 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 278.10 | 0.6577 |
| 288.15 | 0.4059 |
| 298.15 | 0.1365 |
| 308.15 | 0.0713 |
| 318.15 | 0.0390 |
| 328.15 | 0.0241 |
| 338.15 | 0.0166 |
| 348.15 | 0.0111 |
| 358.15 | 0.0009 |
Electrical conductivity, S/m [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Mole fraction = 0.111 (Liquid)
| Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
|---|---|
| 278.10 | 0.0134 |
| 288.15 | 0.0351 |
| 298.15 | 0.0848 |
| 308.15 | 0.1821 |
| 318.15 | 0.2820 |
| 328.15 | 0.3490 |
| 338.15 | 0.4180 |
| 348.15 | 0.4820 |
| 358.15 | 0.5500 |
| 368.15 | 0.6090 |
Electrical conductivity, S/m [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Mole fraction = 0.111 (Liquid)
| Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
|---|---|
| 278.10 | 0.0134 |
| 288.15 | 0.0351 |
| 298.15 | 0.0848 |
| 308.15 | 0.1821 |
| 318.15 | 0.2820 |
| 328.15 | 0.3490 |
| 338.15 | 0.4180 |
| 348.15 | 0.4820 |
| 358.15 | 0.5500 |
| 368.15 | 0.6090 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Mole fraction = 0.111 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 288.15 | 1.4913 |
| 298.15 | 1.4849 |
| 308.15 | 1.4824 |
| 318.15 | 1.4782 |
| 328.15 | 1.4745 |
| 338.15 | 1.4737 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Mole fraction = 0.111 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 288.15 | 1.4913 |
| 298.15 | 1.4849 |
| 308.15 | 1.4824 |
| 318.15 | 1.4782 |
| 328.15 | 1.4745 |
| 338.15 | 1.4737 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.111 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 298.15 | 1394.7 |
| 308.15 | 1383.7 |
| 318.15 | 1372.7 |
| 328.15 | 1361.6 |
| 338.15 | 1350.4 |
| 348.15 | 1339.3 |
| 358.15 | 1328.2 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.111 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 298.15 | 1394.7 |
| 308.15 | 1383.7 |
| 318.15 | 1372.7 |
| 328.15 | 1361.6 |
| 338.15 | 1350.4 |
| 348.15 | 1339.3 |
| 358.15 | 1328.2 |