- Name
- o-Nitroaniline
- InChI
- InChI=1S/C6H6N2O2/c7-5-3-1-2-4-6(5)8(9)10/h1-4H,7H2
- InChI Key
- DPJCXCZTLWNFOH-UHFFFAOYSA-N
- Formula
- C6H6N2O2
- SMILES
- Nc1ccccc1[N+](=O)[O-]
- Mol. Weight (g/mol)
- 138.12
- CAS
- 88-74-4
- Name
- Ethanol
- InChI
- InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3
- InChI Key
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N
- Formula
- C2H6O
- SMILES
- CCO
- Mol. Weight (g/mol)
- 46.07
- CAS
- 64-17-5
- Name
- p-Nitroaniline
- InChI
- InChI=1S/C6H6N2O2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H,7H2
- InChI Key
- TYMLOMAKGOJONV-UHFFFAOYSA-N
- Formula
- C6H6N2O2
- SMILES
- Nc1ccc([N+](=O)[O-])cc1
- Mol. Weight (g/mol)
- 138.12
- CAS
- 100-01-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of o-Nitroaniline (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass fraction of o-Nitroaniline (1) - Liquid |
|---|---|
| 273.15 | 0.1286 |
| 298.15 | 0.2074 |
| 323.15 | 0.6573 |
Mass fraction of p-Nitroaniline (3) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass fraction of p-Nitroaniline (3) - Liquid |
|---|---|
| 273.15 | 0.0212 |
| 298.15 | 0.0317 |
| 323.15 | 0.0504 |
Mass fraction of o-Nitroaniline (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of p-Nitroaniline (3) - Liquid | Mass fraction of o-Nitroaniline (1) - Liquid |
| 273.15 | 0.0000 | 0.1405 |
| 273.15 | 0.0043 | 0.1389 |
| 273.15 | 0.0085 | 0.1356 |
| 273.15 | 0.0126 | 0.1338 |
| 273.15 | 0.0178 | 0.1307 |
| 273.15 | 0.0201 | 0.1288 |
| 298.15 | 0.0000 | 0.2181 |
| 298.15 | 0.0056 | 0.2163 |
| 298.15 | 0.0104 | 0.2136 |
| 298.15 | 0.0153 | 0.2117 |
| 298.15 | 0.0211 | 0.2105 |
| 298.15 | 0.0264 | 0.2087 |
| 323.15 | 0.0000 | 0.6696 |
| 323.15 | 0.0103 | 0.6654 |
| 323.15 | 0.0240 | 0.6627 |
| 323.15 | 0.0337 | 0.6595 |
| 323.15 | 0.0454 | 0.6579 |
Mass fraction of o-Nitroaniline (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of p-Nitroaniline (3) - Liquid | Mass fraction of o-Nitroaniline (1) - Liquid |
| 273.15 | 0.0216 | 0.1175 |
| 273.15 | 0.0225 | 0.1004 |
| 273.15 | 0.0240 | 0.0793 |
| 273.15 | 0.0254 | 0.0597 |
| 273.15 | 0.0269 | 0.0464 |
| 273.15 | 0.0282 | 0.0339 |
| 273.15 | 0.0297 | 0.0207 |
| 273.15 | 0.0313 | 0.0101 |
| 273.15 | 0.0327 | 0.0000 |
| 298.15 | 0.0321 | 0.1936 |
| 298.15 | 0.0339 | 0.1721 |
| 298.15 | 0.0361 | 0.1428 |
| 298.15 | 0.0389 | 0.1129 |
| 298.15 | 0.0425 | 0.0813 |
| 298.15 | 0.0459 | 0.0621 |
| 298.15 | 0.0498 | 0.0384 |
| 298.15 | 0.0533 | 0.0192 |
| 298.15 | 0.0577 | 0.0000 |
| 323.15 | 0.0518 | 0.6316 |
| 323.15 | 0.0535 | 0.5945 |
| 323.15 | 0.0563 | 0.5444 |
| 323.15 | 0.0601 | 0.4766 |
| 323.15 | 0.0664 | 0.3823 |
| 323.15 | 0.0723 | 0.3081 |
| 323.15 | 0.0809 | 0.2150 |
| 323.15 | 0.0871 | 0.1588 |
| 323.15 | 0.0942 | 0.1014 |
| 323.15 | 0.1031 | 0.0423 |
| 323.15 | 0.1086 | 0.0000 |
Mass fraction of o-Nitroaniline (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass fraction of o-Nitroaniline (1) - Liquid |
|---|---|
| 273.15 | 0.1286 |
| 298.15 | 0.2074 |
| 323.15 | 0.6573 |
Mass fraction of p-Nitroaniline (3) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass fraction of p-Nitroaniline (3) - Liquid |
|---|---|
| 273.15 | 0.0212 |
| 298.15 | 0.0317 |
| 323.15 | 0.0504 |
Mass fraction of o-Nitroaniline (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of p-Nitroaniline (3) - Liquid | Mass fraction of o-Nitroaniline (1) - Liquid |
| 273.15 | 0.0000 | 0.1405 |
| 273.15 | 0.0043 | 0.1389 |
| 273.15 | 0.0085 | 0.1356 |
| 273.15 | 0.0126 | 0.1338 |
| 273.15 | 0.0178 | 0.1307 |
| 273.15 | 0.0201 | 0.1288 |
| 298.15 | 0.0000 | 0.2181 |
| 298.15 | 0.0056 | 0.2163 |
| 298.15 | 0.0104 | 0.2136 |
| 298.15 | 0.0153 | 0.2117 |
| 298.15 | 0.0211 | 0.2105 |
| 298.15 | 0.0264 | 0.2087 |
| 323.15 | 0.0000 | 0.6696 |
| 323.15 | 0.0103 | 0.6654 |
| 323.15 | 0.0240 | 0.6627 |
| 323.15 | 0.0337 | 0.6595 |
| 323.15 | 0.0454 | 0.6579 |
Mass fraction of o-Nitroaniline (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of p-Nitroaniline (3) - Liquid | Mass fraction of o-Nitroaniline (1) - Liquid |
| 273.15 | 0.0216 | 0.1175 |
| 273.15 | 0.0225 | 0.1004 |
| 273.15 | 0.0240 | 0.0793 |
| 273.15 | 0.0254 | 0.0597 |
| 273.15 | 0.0269 | 0.0464 |
| 273.15 | 0.0282 | 0.0339 |
| 273.15 | 0.0297 | 0.0207 |
| 273.15 | 0.0313 | 0.0101 |
| 273.15 | 0.0327 | 0.0000 |
| 298.15 | 0.0321 | 0.1936 |
| 298.15 | 0.0339 | 0.1721 |
| 298.15 | 0.0361 | 0.1428 |
| 298.15 | 0.0389 | 0.1129 |
| 298.15 | 0.0425 | 0.0813 |
| 298.15 | 0.0459 | 0.0621 |
| 298.15 | 0.0498 | 0.0384 |
| 298.15 | 0.0533 | 0.0192 |
| 298.15 | 0.0577 | 0.0000 |
| 323.15 | 0.0518 | 0.6316 |
| 323.15 | 0.0535 | 0.5945 |
| 323.15 | 0.0563 | 0.5444 |
| 323.15 | 0.0601 | 0.4766 |
| 323.15 | 0.0664 | 0.3823 |
| 323.15 | 0.0723 | 0.3081 |
| 323.15 | 0.0809 | 0.2150 |
| 323.15 | 0.0871 | 0.1588 |
| 323.15 | 0.0942 | 0.1014 |
| 323.15 | 0.1031 | 0.0423 |
| 323.15 | 0.1086 | 0.0000 |