- Name
- Ibuprofen
- InChI
- InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)
- InChI Key
- HEFNNWSXXWATRW-UHFFFAOYSA-N
- Formula
- C13H18O2
- SMILES
- CC(C)Cc1ccc(C(C)C(=O)O)cc1
- Mol. Weight (g/mol)
- 206.28
- CAS
- 15687-27-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Datasets
Mass concentration, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass concentration, kg/m3 - Liquid |
|---|---|
| 298.15 | 0.1240 |
| 308.15 | 0.1790 |
| 318.15 | 0.2760 |
| 328.15 | 0.3760 |
| 338.15 | 0.5230 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 323.15 | 0.0343 |
| 333.25 | 0.0444 |
| 343.15 | 0.0572 |
| 353.15 | 0.0691 |
| 363.35 | 0.0857 |
Mass fraction of Ibuprofen (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Temperature, K - Liquid | Mass fraction of Ibuprofen (1) - Liquid |
|---|---|
| 288.15 | 0.0001 |
| 293.15 | 0.0001 |
| 298.15 | 0.0001 |
| 303.15 | 0.0001 |
| 308.15 | 0.0001 |
| 313.15 | 0.0002 |
| 318.15 | 0.0002 |
Mass fraction of Ibuprofen (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Ibuprofen (1) - Liquid mixture 1 |
|---|---|
| 321.85 | 0.0003 |
| 328.15 | 0.0003 |
| 332.25 | 0.0003 |
| 337.95 | 0.0003 |
| 345.05 | 0.0004 |
| 349.95 | 0.0005 |
| 354.45 | 0.0005 |
| 358.95 | 0.0006 |
| 363.25 | 0.0006 |
| 366.95 | 0.0007 |
| 370.65 | 0.0007 |
Mass concentration, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass concentration, kg/m3 - Liquid |
|---|---|
| 298.15 | 0.1240 |
| 308.15 | 0.1790 |
| 318.15 | 0.2760 |
| 328.15 | 0.3760 |
| 338.15 | 0.5230 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 323.15 | 0.0343 |
| 333.25 | 0.0444 |
| 343.15 | 0.0572 |
| 353.15 | 0.0691 |
| 363.35 | 0.0857 |
Mass fraction of Ibuprofen (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Temperature, K - Liquid | Mass fraction of Ibuprofen (1) - Liquid |
|---|---|
| 288.15 | 0.0001 |
| 293.15 | 0.0001 |
| 298.15 | 0.0001 |
| 303.15 | 0.0001 |
| 308.15 | 0.0001 |
| 313.15 | 0.0002 |
| 318.15 | 0.0002 |
Mass fraction of Ibuprofen (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Ibuprofen (1) - Liquid mixture 1 |
|---|---|
| 321.85 | 0.0003 |
| 328.15 | 0.0003 |
| 332.25 | 0.0003 |
| 337.95 | 0.0003 |
| 345.05 | 0.0004 |
| 349.95 | 0.0005 |
| 354.45 | 0.0005 |
| 358.95 | 0.0006 |
| 363.25 | 0.0006 |
| 366.95 | 0.0007 |
| 370.65 | 0.0007 |