- Name
- Diethanolamine
- InChI
- InChI=1S/C4H11NO2/c6-3-1-5-2-4-7/h5-7H,1-4H2
- InChI Key
- ZBCBWPMODOFKDW-UHFFFAOYSA-N
- Formula
- C4H11NO2
- SMILES
- OCCNCCO
- Mol. Weight (g/mol)
- 105.14
- CAS
- 111-42-2
- Name
- Isobutane
- InChI
- InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3
- InChI Key
- NNPPMTNAJDCUHE-UHFFFAOYSA-N
- Formula
- C4H10
- SMILES
- CC(C)C
- Mol. Weight (g/mol)
- 58.12
- CAS
- 75-28-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Isobutane (2) [ref]
Operational condition: Mass fraction = 0.35 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Isobutane (2) - Liquid mixture 1 |
|---|---|
| 298.28 | 0.0002 |
| 303.28 | 0.0002 |
| 313.26 | 0.0003 |
| 323.20 | 0.0003 |
| 333.28 | 0.0003 |
| 343.18 | 0.0004 |
Mole fraction of Isobutane (2) [ref]
Operational condition: Mass fraction = 0.35 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Isobutane (2) - Liquid mixture 1 |
|---|---|
| 298.28 | 0.0002 |
| 303.28 | 0.0002 |
| 313.26 | 0.0003 |
| 323.20 | 0.0003 |
| 333.28 | 0.0003 |
| 343.18 | 0.0004 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Mass fraction = 0.35 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
|---|---|
| 293.33 | 306.00 |
| 295.36 | 325.00 |
| 297.22 | 344.00 |
| 299.27 | 365.00 |
| 301.21 | 386.00 |
| 303.31 | 410.00 |
| 305.26 | 433.00 |
| 307.26 | 458.00 |
| 309.26 | 484.00 |
| 311.25 | 510.00 |
| 313.28 | 539.00 |
| 315.26 | 568.00 |
| 317.29 | 599.00 |
| 319.37 | 632.00 |
| 321.24 | 662.00 |
| 323.22 | 696.00 |
| 325.28 | 733.00 |
| 327.22 | 768.00 |
| 329.19 | 806.00 |
| 331.20 | 846.00 |
| 333.21 | 887.00 |
| 335.16 | 929.00 |
| 337.15 | 973.00 |
| 339.22 | 1020.00 |
| 341.14 | 1065.00 |
| 343.19 | 1116.00 |
| 345.16 | 1166.00 |
| 347.19 | 1220.00 |
| 349.11 | 1271.00 |
| 351.06 | 1326.00 |
| 353.16 | 1387.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Mass fraction = 0.35 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
|---|---|
| 298.28 | 354.00 |
| 303.28 | 409.00 |
| 313.26 | 539.00 |
| 323.20 | 696.00 |
| 333.28 | 889.00 |
| 343.18 | 1116.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Mass fraction = 0.35 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
|---|---|
| 293.33 | 306.00 |
| 295.36 | 325.00 |
| 297.22 | 344.00 |
| 299.27 | 365.00 |
| 301.21 | 386.00 |
| 303.31 | 410.00 |
| 305.26 | 433.00 |
| 307.26 | 458.00 |
| 309.26 | 484.00 |
| 311.25 | 510.00 |
| 313.28 | 539.00 |
| 315.26 | 568.00 |
| 317.29 | 599.00 |
| 319.37 | 632.00 |
| 321.24 | 662.00 |
| 323.22 | 696.00 |
| 325.28 | 733.00 |
| 327.22 | 768.00 |
| 329.19 | 806.00 |
| 331.20 | 846.00 |
| 333.21 | 887.00 |
| 335.16 | 929.00 |
| 337.15 | 973.00 |
| 339.22 | 1020.00 |
| 341.14 | 1065.00 |
| 343.19 | 1116.00 |
| 345.16 | 1166.00 |
| 347.19 | 1220.00 |
| 349.11 | 1271.00 |
| 351.06 | 1326.00 |
| 353.16 | 1387.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Mass fraction = 0.35 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
|---|---|
| 298.28 | 354.00 |
| 303.28 | 409.00 |
| 313.26 | 539.00 |
| 323.20 | 696.00 |
| 333.28 | 889.00 |
| 343.18 | 1116.00 |