- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Butanedioic acid, dibutyl ester
- InChI
- InChI=1S/C12H22O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h3-10H2,1-2H3
- InChI Key
- YUXIBTJKHLUKBD-UHFFFAOYSA-N
- Formula
- C12H22O4
- SMILES
- CCCCOC(=O)CCC(=O)OCCCC
- Mol. Weight (g/mol)
- 230.30
- CAS
- 141-03-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Carbon dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Carbon dioxide (1) - Liquid |
| 283.15 | 45.10 | 0.0739 |
| 283.15 | 99.50 | 0.1624 |
| 283.15 | 183.50 | 0.3007 |
| 283.15 | 271.20 | 0.4486 |
| 283.15 | 348.80 | 0.5911 |
| 283.15 | 411.90 | 0.6957 |
| 283.15 | 496.20 | 0.8416 |
| 283.15 | 546.70 | 0.9299 |
| 293.15 | 47.00 | 0.0641 |
| 293.15 | 102.70 | 0.1412 |
| 293.15 | 179.20 | 0.2483 |
| 293.15 | 265.10 | 0.3708 |
| 293.15 | 354.80 | 0.4961 |
| 293.15 | 436.60 | 0.6152 |
| 293.15 | 549.20 | 0.7808 |
| 303.15 | 52.50 | 0.0554 |
| 303.15 | 108.80 | 0.1151 |
| 303.15 | 181.40 | 0.1995 |
| 303.15 | 264.90 | 0.2929 |
| 303.15 | 359.40 | 0.3988 |
| 303.15 | 456.60 | 0.5091 |
| 303.15 | 513.40 | 0.5741 |
| 303.15 | 547.70 | 0.6139 |
| 313.15 | 58.00 | 0.0551 |
| 313.15 | 114.90 | 0.1100 |
| 313.15 | 185.80 | 0.1796 |
| 313.15 | 293.40 | 0.2838 |
| 313.15 | 375.60 | 0.3642 |
| 313.15 | 492.00 | 0.4783 |
| 313.15 | 550.00 | 0.5383 |
| 323.15 | 58.40 | 0.0499 |
| 323.15 | 115.40 | 0.0979 |
| 323.15 | 194.80 | 0.1638 |
| 323.15 | 279.70 | 0.2357 |
| 323.15 | 377.10 | 0.3173 |
| 323.15 | 455.60 | 0.3840 |
| 323.15 | 557.20 | 0.4711 |
Molality, mol/kg of Carbon dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Carbon dioxide (1) - Liquid |
| 283.15 | 45.10 | 0.0739 |
| 283.15 | 99.50 | 0.1624 |
| 283.15 | 183.50 | 0.3007 |
| 283.15 | 271.20 | 0.4486 |
| 283.15 | 348.80 | 0.5911 |
| 283.15 | 411.90 | 0.6957 |
| 283.15 | 496.20 | 0.8416 |
| 283.15 | 546.70 | 0.9299 |
| 293.15 | 47.00 | 0.0641 |
| 293.15 | 102.70 | 0.1412 |
| 293.15 | 179.20 | 0.2483 |
| 293.15 | 265.10 | 0.3708 |
| 293.15 | 354.80 | 0.4961 |
| 293.15 | 436.60 | 0.6152 |
| 293.15 | 549.20 | 0.7808 |
| 303.15 | 52.50 | 0.0554 |
| 303.15 | 108.80 | 0.1151 |
| 303.15 | 181.40 | 0.1995 |
| 303.15 | 264.90 | 0.2929 |
| 303.15 | 359.40 | 0.3988 |
| 303.15 | 456.60 | 0.5091 |
| 303.15 | 513.40 | 0.5741 |
| 303.15 | 547.70 | 0.6139 |
| 313.15 | 58.00 | 0.0551 |
| 313.15 | 114.90 | 0.1100 |
| 313.15 | 185.80 | 0.1796 |
| 313.15 | 293.40 | 0.2838 |
| 313.15 | 375.60 | 0.3642 |
| 313.15 | 492.00 | 0.4783 |
| 313.15 | 550.00 | 0.5383 |
| 323.15 | 58.40 | 0.0499 |
| 323.15 | 115.40 | 0.0979 |
| 323.15 | 194.80 | 0.1638 |
| 323.15 | 279.70 | 0.2357 |
| 323.15 | 377.10 | 0.3173 |
| 323.15 | 455.60 | 0.3840 |
| 323.15 | 557.20 | 0.4711 |