- Name
- Octane
- InChI
- InChI=1S/C8H18/c1-3-5-7-8-6-4-2/h3-8H2,1-2H3
- InChI Key
- TVMXDCGIABBOFY-UHFFFAOYSA-N
- Formula
- C8H18
- SMILES
- CCCCCCCC
- Mol. Weight (g/mol)
- 114.23
- CAS
- 111-65-9
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Activity coefficient of Octane (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Octane (1) - Liquid |
|---|---|
| 333.15 | 80.699 |
| 343.15 | 70.45 |
| 353.15 | 61.712 |
| 363.15 | 54.252 |
| 373.15 | 48.632 |
Activity coefficient of Octane (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Octane (1) - Liquid |
|---|---|
| 333.15 | 80.699 |
| 343.15 | 70.45 |
| 353.15 | 61.712 |
| 363.15 | 54.252 |
| 373.15 | 48.632 |
Mole fraction of Octane (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Octane (1) - Liquid mixture 1 |
|---|---|
| 298.15 | 0.9990 |
| 303.15 | 0.9986 |
| 308.34 | 0.9968 |
| 313.15 | 0.9981 |
| 318.25 | 0.9964 |
| 323.15 | 0.9958 |
| 328.15 | 0.9959 |
| 332.80 | 0.9957 |
| 339.15 | 0.9937 |
| 348.15 | 0.9925 |
| 352.65 | 0.9866 |
| 361.65 | 0.9838 |
| 373.15 | 0.9811 |
Mole fraction of Octane (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 2 | Mole fraction of Octane (1) - Liquid mixture 2 |
|---|---|
| 298.15 | 0.0092 |
| 303.15 | 0.0100 |
| 308.34 | 0.0110 |
| 313.15 | 0.0120 |
| 318.25 | 0.0134 |
| 323.15 | 0.0140 |
| 328.15 | 0.0143 |
| 332.80 | 0.0150 |
| 339.15 | 0.0178 |
| 348.15 | 0.0203 |
| 352.65 | 0.0233 |
| 361.65 | 0.0287 |
| 373.15 | 0.0322 |
Mole fraction of Octane (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Octane (1) - Liquid mixture 1 |
|---|---|
| 298.15 | 0.9990 |
| 303.15 | 0.9986 |
| 308.34 | 0.9968 |
| 313.15 | 0.9981 |
| 318.25 | 0.9964 |
| 323.15 | 0.9958 |
| 328.15 | 0.9959 |
| 332.80 | 0.9957 |
| 339.15 | 0.9937 |
| 348.15 | 0.9925 |
| 352.65 | 0.9866 |
| 361.65 | 0.9838 |
| 373.15 | 0.9811 |
Mole fraction of Octane (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 2 | Mole fraction of Octane (1) - Liquid mixture 2 |
|---|---|
| 298.15 | 0.0092 |
| 303.15 | 0.0100 |
| 308.34 | 0.0110 |
| 313.15 | 0.0120 |
| 318.25 | 0.0134 |
| 323.15 | 0.0140 |
| 328.15 | 0.0143 |
| 332.80 | 0.0150 |
| 339.15 | 0.0178 |
| 348.15 | 0.0203 |
| 352.65 | 0.0233 |
| 361.65 | 0.0287 |
| 373.15 | 0.0322 |