- Name
- Benzenemethanol, «alpha»-methyl-
- InChI
- InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3
- InChI Key
- WAPNOHKVXSQRPX-UHFFFAOYSA-N
- Formula
- C8H10O
- SMILES
- CC(O)c1ccccc1
- Mol. Weight (g/mol)
- 122.16
- CAS
- 98-85-1
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Acetic acid ethenyl ester
- InChI
- InChI=1S/C4H6O2/c1-3-6-4(2)5/h3H,1H2,2H3
- InChI Key
- XTXRWKRVRITETP-UHFFFAOYSA-N
- Formula
- C4H6O2
- SMILES
- C=COC(C)=O
- Mol. Weight (g/mol)
- 86.09
- CAS
- 108-05-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Temperature, K x Pressure, kPa x Mole fraction [ref]
| Fixed | Measured | ||||
|---|---|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Acetic acid ethenyl ester (3) - Gas | Mole fraction of Benzenemethanol, «alpha»-methyl- (1) - Gas | Mole fraction of Benzenemethanol, «alpha»-methyl- (1) - Liquid | Mole fraction of Acetic acid ethenyl ester (3) - Liquid |
| 323.00 | 7000.00 | 0.0051 | 0.0004 | 0.0818 | 0.3128 |
| 323.00 | 9000.00 | 0.0046 | 0.0008 | 0.0340 | 0.1149 |
| 323.00 | 7000.00 | 0.0040 | 0.0003 | 0.1166 | 0.3087 |
| 323.00 | 9000.00 | 0.0037 | 0.0009 | 0.0773 | 0.1260 |
| 323.00 | 9000.00 | 0.0011 | 0.0008 | 0.3753 | 0.1536 |
| 323.00 | 10000.00 | 0.0066 | 0.0066 | 0.3193 | 0.1999 |
| 323.00 | 9000.00 | 0.0005 | 0.0006 | 0.4141 | 0.1937 |
| 323.00 | 10000.00 | 0.0011 | 0.0018 | 0.4299 | 0.1221 |
| 323.00 | 12000.00 | 0.0048 | 0.0096 | 0.4188 | 0.1109 |
| 333.00 | 7000.00 | 0.0020 | 0.0002 | 0.0615 | 0.2842 |
| 333.00 | 9000.00 | 0.0014 | 0.0003 | 0.1074 | 0.1690 |
| 333.00 | 10000.00 | 0.0040 | 0.0013 | 0.0614 | 0.1459 |
| 333.00 | 7000.00 | 0.0010 | 0.0002 | 0.2404 | 0.2318 |
| 333.00 | 9000.00 | 0.0037 | 0.0007 | 0.1597 | 0.2753 |
| 333.00 | 10000.00 | 0.0034 | 0.0015 | 0.1124 | 0.1568 |
| 333.00 | 7000.00 | 0.0022 | 0.0003 | 0.4575 | 0.2979 |
| 333.00 | 9000.00 | 0.0007 | 0.0003 | 0.4498 | 0.1587 |
| 333.00 | 10000.00 | 0.0019 | 0.0014 | 0.3606 | 0.1702 |
| 333.00 | 12000.00 | 0.0043 | 0.0053 | 0.4130 | 0.1449 |
| 333.00 | 7000.00 | 0.0009 | 0.0001 | 0.5498 | 0.2250 |
| 333.00 | 9000.00 | 0.0003 | 0.0002 | 0.4951 | 0.1632 |
| 333.00 | 10000.00 | 0.0008 | 0.0014 | 0.4150 | 0.1641 |
| 333.00 | 12000.00 | 0.0015 | 0.0037 | 0.3533 | 0.1672 |
| 343.00 | 7000.00 | 0.0040 | 0.0003 | 0.1317 | 0.4827 |
| 343.00 | 9000.00 | 0.0024 | 0.0003 | 0.1375 | 0.2824 |
| 343.00 | 10000.00 | 0.0043 | 0.0005 | 0.0747 | 0.1874 |
| 343.00 | 7000.00 | 0.0027 | 0.0002 | 0.1562 | 0.3455 |
| 343.00 | 9000.00 | 0.0038 | 0.0005 | 0.1968 | 0.2778 |
| 343.00 | 10000.00 | 0.0100 | 0.0015 | 0.2575 | 0.2143 |
| 343.00 | 12000.00 | 0.0062 | 0.0051 | 0.1448 | 0.0875 |
| 343.00 | 7000.00 | 0.0013 | 0.0004 | 0.4217 | 0.2098 |
| 343.00 | 9000.00 | 0.0011 | 0.0002 | 0.4076 | 0.1967 |
| 343.00 | 10000.00 | 0.0008 | 0.0004 | 0.4091 | 0.1669 |
| 343.00 | 12000.00 | 0.0016 | 0.0029 | 0.4183 | 0.1868 |
| 343.00 | 9000.00 | 0.0011 | 0.0008 | 0.4668 | 0.2102 |
| 343.00 | 10000.00 | 0.0007 | 0.0007 | 0.4607 | 0.1700 |
| 343.00 | 12000.00 | 0.0012 | 0.0025 | 0.3930 | 0.1858 |
Temperature, K x Pressure, kPa x Mole fraction [ref]
| Fixed | Measured | ||||
|---|---|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Acetic acid ethenyl ester (3) - Gas | Mole fraction of Benzenemethanol, «alpha»-methyl- (1) - Gas | Mole fraction of Benzenemethanol, «alpha»-methyl- (1) - Liquid | Mole fraction of Acetic acid ethenyl ester (3) - Liquid |
| 323.00 | 7000.00 | 0.0051 | 0.0004 | 0.0818 | 0.3128 |
| 323.00 | 9000.00 | 0.0046 | 0.0008 | 0.0340 | 0.1149 |
| 323.00 | 7000.00 | 0.0040 | 0.0003 | 0.1166 | 0.3087 |
| 323.00 | 9000.00 | 0.0037 | 0.0009 | 0.0773 | 0.1260 |
| 323.00 | 9000.00 | 0.0011 | 0.0008 | 0.3753 | 0.1536 |
| 323.00 | 10000.00 | 0.0066 | 0.0066 | 0.3193 | 0.1999 |
| 323.00 | 9000.00 | 0.0005 | 0.0006 | 0.4141 | 0.1937 |
| 323.00 | 10000.00 | 0.0011 | 0.0018 | 0.4299 | 0.1221 |
| 323.00 | 12000.00 | 0.0048 | 0.0096 | 0.4188 | 0.1109 |
| 333.00 | 7000.00 | 0.0020 | 0.0002 | 0.0615 | 0.2842 |
| 333.00 | 9000.00 | 0.0014 | 0.0003 | 0.1074 | 0.1690 |
| 333.00 | 10000.00 | 0.0040 | 0.0013 | 0.0614 | 0.1459 |
| 333.00 | 7000.00 | 0.0010 | 0.0002 | 0.2404 | 0.2318 |
| 333.00 | 9000.00 | 0.0037 | 0.0007 | 0.1597 | 0.2753 |
| 333.00 | 10000.00 | 0.0034 | 0.0015 | 0.1124 | 0.1568 |
| 333.00 | 7000.00 | 0.0022 | 0.0003 | 0.4575 | 0.2979 |
| 333.00 | 9000.00 | 0.0007 | 0.0003 | 0.4498 | 0.1587 |
| 333.00 | 10000.00 | 0.0019 | 0.0014 | 0.3606 | 0.1702 |
| 333.00 | 12000.00 | 0.0043 | 0.0053 | 0.4130 | 0.1449 |
| 333.00 | 7000.00 | 0.0009 | 0.0001 | 0.5498 | 0.2250 |
| 333.00 | 9000.00 | 0.0003 | 0.0002 | 0.4951 | 0.1632 |
| 333.00 | 10000.00 | 0.0008 | 0.0014 | 0.4150 | 0.1641 |
| 333.00 | 12000.00 | 0.0015 | 0.0037 | 0.3533 | 0.1672 |
| 343.00 | 7000.00 | 0.0040 | 0.0003 | 0.1317 | 0.4827 |
| 343.00 | 9000.00 | 0.0024 | 0.0003 | 0.1375 | 0.2824 |
| 343.00 | 10000.00 | 0.0043 | 0.0005 | 0.0747 | 0.1874 |
| 343.00 | 7000.00 | 0.0027 | 0.0002 | 0.1562 | 0.3455 |
| 343.00 | 9000.00 | 0.0038 | 0.0005 | 0.1968 | 0.2778 |
| 343.00 | 10000.00 | 0.0100 | 0.0015 | 0.2575 | 0.2143 |
| 343.00 | 12000.00 | 0.0062 | 0.0051 | 0.1448 | 0.0875 |
| 343.00 | 7000.00 | 0.0013 | 0.0004 | 0.4217 | 0.2098 |
| 343.00 | 9000.00 | 0.0011 | 0.0002 | 0.4076 | 0.1967 |
| 343.00 | 10000.00 | 0.0008 | 0.0004 | 0.4091 | 0.1669 |
| 343.00 | 12000.00 | 0.0016 | 0.0029 | 0.4183 | 0.1868 |
| 343.00 | 9000.00 | 0.0011 | 0.0008 | 0.4668 | 0.2102 |
| 343.00 | 10000.00 | 0.0007 | 0.0007 | 0.4607 | 0.1700 |
| 343.00 | 12000.00 | 0.0012 | 0.0025 | 0.3930 | 0.1858 |