- Name
- 2-Propanol, 2-methyl-
- InChI
- InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3
- InChI Key
- DKGAVHZHDRPRBM-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CC(C)(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 75-65-0
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- Potassium oxalate
- InChI
- InChI=1S/C2H2O4.2K/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2
- InChI Key
- IRXRGVFLQOSHOH-UHFFFAOYSA-L
- Formula
- C2K2O4
- SMILES
- O=C([O-])C(=O)[O-].[K+].[K+]
- Mol. Weight (g/mol)
- 166.22
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Potassium oxalate (3) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid mixture 1)
- Pressure, kPa = 101 (Liquid mixture 1)
| Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 1 | Mass fraction of Potassium oxalate (3) - Liquid mixture 1 |
|---|---|
| 0.0348 | 0.2078 |
| 0.0457 | 0.1943 |
| 0.0634 | 0.1644 |
| 0.0893 | 0.1344 |
| 0.0957 | 0.1268 |
| 0.1035 | 0.1158 |
| 0.1099 | 0.1105 |
| 0.1158 | 0.1040 |
| 0.1221 | 0.0986 |
| 0.1271 | 0.0954 |
| 0.1384 | 0.0880 |
| 0.1476 | 0.0825 |
| 0.1597 | 0.0752 |
| 0.1760 | 0.0684 |
| 0.1873 | 0.0641 |
| 0.1965 | 0.0607 |
| 0.2044 | 0.0583 |
| 0.2151 | 0.0550 |
| 0.2257 | 0.0525 |
| 0.2343 | 0.0502 |
| 0.2505 | 0.0465 |
| 0.2662 | 0.0436 |
| 0.2747 | 0.0420 |
| 0.2845 | 0.0402 |
| 0.3021 | 0.0372 |
| 0.3159 | 0.0350 |
| 0.3286 | 0.0330 |
| 0.3452 | 0.0311 |
| 0.3767 | 0.0284 |
Mole fraction of 2-Propanol, 2-methyl- (1) [ref]
Operational conditions:
- Solvent: Amount ratio of component to other component of binary solvent = 0.00885 (Liquid mixture 1)
- Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 1 |
|---|---|
| 293.15 | 0.0690 |
| 298.15 | 0.0620 |
| 303.15 | 0.0550 |
| 308.15 | 0.0490 |
| 313.15 | 0.0440 |
| 318.15 | 0.0410 |
| 323.15 | 0.0380 |
| 328.15 | 0.0350 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid mixture 2)
- Pressure, kPa = 101.3 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Potassium oxalate (3) - Liquid mixture 2 | Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 2 | Mass fraction of Potassium oxalate (3) - Liquid mixture 1 | Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 1 |
| 0.0983 | 0.1259 | 0.0037 | 0.6186 |
| 0.1233 | 0.1027 | 0.0022 | 0.6480 |
| 0.1404 | 0.0894 | 0.0018 | 0.6665 |
| 0.1605 | 0.0806 | 0.0013 | 0.6794 |
| 0.1822 | 0.0755 | 0.0009 | 0.6955 |
Mass fraction of Potassium oxalate (3) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid mixture 1)
- Pressure, kPa = 101 (Liquid mixture 1)
| Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 1 | Mass fraction of Potassium oxalate (3) - Liquid mixture 1 |
|---|---|
| 0.0348 | 0.2078 |
| 0.0457 | 0.1943 |
| 0.0634 | 0.1644 |
| 0.0893 | 0.1344 |
| 0.0957 | 0.1268 |
| 0.1035 | 0.1158 |
| 0.1099 | 0.1105 |
| 0.1158 | 0.1040 |
| 0.1221 | 0.0986 |
| 0.1271 | 0.0954 |
| 0.1384 | 0.0880 |
| 0.1476 | 0.0825 |
| 0.1597 | 0.0752 |
| 0.1760 | 0.0684 |
| 0.1873 | 0.0641 |
| 0.1965 | 0.0607 |
| 0.2044 | 0.0583 |
| 0.2151 | 0.0550 |
| 0.2257 | 0.0525 |
| 0.2343 | 0.0502 |
| 0.2505 | 0.0465 |
| 0.2662 | 0.0436 |
| 0.2747 | 0.0420 |
| 0.2845 | 0.0402 |
| 0.3021 | 0.0372 |
| 0.3159 | 0.0350 |
| 0.3286 | 0.0330 |
| 0.3452 | 0.0311 |
| 0.3767 | 0.0284 |
Mole fraction of 2-Propanol, 2-methyl- (1) [ref]
Operational conditions:
- Solvent: Amount ratio of component to other component of binary solvent = 0.00885 (Liquid mixture 1)
- Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 1 |
|---|---|
| 293.15 | 0.0690 |
| 298.15 | 0.0620 |
| 303.15 | 0.0550 |
| 308.15 | 0.0490 |
| 313.15 | 0.0440 |
| 318.15 | 0.0410 |
| 323.15 | 0.0380 |
| 328.15 | 0.0350 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid mixture 2)
- Pressure, kPa = 101.3 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Potassium oxalate (3) - Liquid mixture 2 | Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 2 | Mass fraction of Potassium oxalate (3) - Liquid mixture 1 | Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 1 |
| 0.0983 | 0.1259 | 0.0037 | 0.6186 |
| 0.1233 | 0.1027 | 0.0022 | 0.6480 |
| 0.1404 | 0.0894 | 0.0018 | 0.6665 |
| 0.1605 | 0.0806 | 0.0013 | 0.6794 |
| 0.1822 | 0.0755 | 0.0009 | 0.6955 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 1)
- Temperature, K = 298.15 (Liquid mixture 1)
| Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
|---|---|
| 0.0132 | 1.3359 |
| 0.0134 | 1.3358 |
| 0.0159 | 1.3359 |
| 0.0178 | 1.336 |
| 0.0200 | 1.3362 |
| 0.0228 | 1.3365 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 2)
- Temperature, K = 298.15 (Liquid mixture 2)
| Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
|---|---|
| 0.0001 | 1.3413 |
| 0.0002 | 1.3413 |
| 0.0003 | 1.341 |
| 0.0003 | 1.3409 |
| 0.0005 | 1.3404 |
| 0.0005 | 1.3405 |
| 0.0132 | 1.3359 |
| 0.0134 | 1.3358 |
| 0.0159 | 1.3359 |
| 0.0178 | 1.336 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid | Mass fraction of Potassium oxalate (3) - Liquid | Refractive index (Na D-line) - Liquid |
| 0.0000 | 0.0446 | 1.3386 |
| 0.0064 | 0.0436 | 1.339 |
| 0.0122 | 0.0404 | 1.3391 |
| 0.0187 | 0.0382 | 1.3395 |
| 0.0250 | 0.0345 | 1.3398 |
| 0.0314 | 0.0314 | 1.3401 |
| 0.0374 | 0.0279 | 1.3402 |
| 0.0433 | 0.0243 | 1.3403 |
| 0.0495 | 0.0220 | 1.3405 |
| 0.0552 | 0.0182 | 1.3408 |
| 0.0615 | 0.0158 | 1.341 |
| 0.0673 | 0.0147 | 1.3416 |
| 0.0728 | 0.0112 | 1.3419 |
| 0.0852 | 0.0046 | 1.3424 |
| 0.0958 | 0.0000 | 1.3428 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 1)
- Temperature, K = 298.15 (Liquid mixture 1)
| Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
|---|---|
| 0.0132 | 1.3359 |
| 0.0134 | 1.3358 |
| 0.0159 | 1.3359 |
| 0.0178 | 1.336 |
| 0.0200 | 1.3362 |
| 0.0228 | 1.3365 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 2)
- Temperature, K = 298.15 (Liquid mixture 2)
| Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
|---|---|
| 0.0001 | 1.3413 |
| 0.0002 | 1.3413 |
| 0.0003 | 1.341 |
| 0.0003 | 1.3409 |
| 0.0005 | 1.3404 |
| 0.0005 | 1.3405 |
| 0.0132 | 1.3359 |
| 0.0134 | 1.3358 |
| 0.0159 | 1.3359 |
| 0.0178 | 1.336 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of 2-Propanol, 2-methyl- (1) - Liquid | Mass fraction of Potassium oxalate (3) - Liquid | Refractive index (Na D-line) - Liquid |
| 0.0000 | 0.0446 | 1.3386 |
| 0.0064 | 0.0436 | 1.339 |
| 0.0122 | 0.0404 | 1.3391 |
| 0.0187 | 0.0382 | 1.3395 |
| 0.0250 | 0.0345 | 1.3398 |
| 0.0314 | 0.0314 | 1.3401 |
| 0.0374 | 0.0279 | 1.3402 |
| 0.0433 | 0.0243 | 1.3403 |
| 0.0495 | 0.0220 | 1.3405 |
| 0.0552 | 0.0182 | 1.3408 |
| 0.0615 | 0.0158 | 1.341 |
| 0.0673 | 0.0147 | 1.3416 |
| 0.0728 | 0.0112 | 1.3419 |
| 0.0852 | 0.0046 | 1.3424 |
| 0.0958 | 0.0000 | 1.3428 |