- Name
- 1-Butanol
- InChI
- InChI=1S/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3
- InChI Key
- LRHPLDYGYMQRHN-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CCCCO
- Mol. Weight (g/mol)
- 74.12
- CAS
- 71-36-3
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 94.13 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of 1-Butanol (1) - Liquid | y1[mol/mol] of 1-Butanol (1) - Vapour |
| 388.95 | 0.0000 | 0.0000 |
| 388.85 | 0.0180 | 0.0090 |
| 389.45 | 0.0600 | 0.0390 |
| 390.05 | 0.1050 | 0.0780 |
| 390.15 | 0.1170 | 0.0950 |
| 390.85 | 0.1610 | 0.1240 |
| 391.75 | 0.2340 | 0.1880 |
| 392.05 | 0.2540 | 0.2090 |
| 392.65 | 0.3040 | 0.2590 |
| 392.95 | 0.3550 | 0.3110 |
| 393.45 | 0.4590 | 0.4390 |
| 393.45 | 0.4850 | 0.4750 |
| 393.45 | 0.5450 | 0.5550 |
| 393.25 | 0.5900 | 0.6140 |
| 392.95 | 0.6570 | 0.7020 |
| 392.55 | 0.7310 | 0.7900 |
| 391.35 | 0.8240 | 0.8890 |
| 390.35 | 0.9200 | 0.9600 |
| 389.75 | 0.9540 | 0.9800 |
| 388.95 | 1.0000 | 1.0000 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of 1-Butanol (1) - Liquid | y1[mol/mol] of 1-Butanol (1) - Vapour |
| 391.25 | 0.0280 | 0.0140 |
| 391.85 | 0.0910 | 0.0600 |
| 392.55 | 0.1540 | 0.1160 |
| 392.35 | 0.1700 | 0.1260 |
| 393.05 | 0.2270 | 0.1780 |
| 393.95 | 0.3150 | 0.2580 |
| 394.25 | 0.3370 | 0.2830 |
| 394.85 | 0.3920 | 0.3400 |
| 395.25 | 0.4450 | 0.3960 |
| 395.75 | 0.5440 | 0.5240 |
| 395.75 | 0.5670 | 0.5570 |
| 395.75 | 0.5960 | 0.5960 |
| 395.75 | 0.6190 | 0.6290 |
| 395.45 | 0.6570 | 0.6790 |
| 395.25 | 0.7110 | 0.7520 |
| 394.75 | 0.7700 | 0.8230 |
| 393.65 | 0.8440 | 0.9020 |
| 392.55 | 0.9240 | 0.9620 |
| 391.95 | 0.9550 | 0.9810 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 298.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of 1-Butanol (1) - Liquid |
|---|---|
| 2.067 | 0.0000 |
| 1.633 | 0.1030 |
| 1.393 | 0.2020 |
| 1.223 | 0.3000 |
| 1.093 | 0.4050 |
| 1.009 | 0.5000 |
| 0.9690 | 0.6000 |
| 0.9530 | 0.7000 |
| 1.004 | 0.7920 |
| 1.095 | 0.8920 |
| 1.137 | 0.9240 |
| 1.267 | 1.0000 |