- InChI
- InChI=1S/C6H10O/c1-5(2)4-6(3)7/h4H,1-3H3
- InChI Key
- SHOJXDKTYKFBRD-UHFFFAOYSA-N
- Formula
- C6H10O
- SMILES
- CC(=O)C=C(C)C
- Molecular Weight1
- 98.14
- CAS
- 141-79-7
- Other Names
-
- (CH3)2C=CHC(=O)CH3
- 2,2-Dimethylvinyl methyl ketone
- 2-Methyl-2-penten-4-one
- 2-Methyl-2-pentenone-4
- 2-Methyl-4-oxo-2-pentene
- 2-Methylpent-2-en-4-one
- 3-Isohexen-2-one
- 4-Methyl-3-penten-2-on
- 4-Methyl-3-pentene-2-one
- 4-Methylpent-3-en-2-one
- 4-Metil-3-penten-2-one
- 4-methyl-3-penten-2-one
- 4-methyl-3-penten-2-one (mesityl oxide)
- Acetone, isopropylidene-
- Isobutenyl methyl ketone
- Isopropylideneacetone
- MIBK
- Mesityloxid
- Mesityloxyde
- Methyl 2,2-dimethylvinyl ketone
- Methyl 2-methyl-1-propenyl ketone
- Methyl isobutenyl ketone
- NSC 38717
- Ossido di mesitile
- Oxyde de mesityle
- UN 1229
- mesityl oxide
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λ : Gas thermal conductivity (W/m×K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- UQi : UNIQUAC Qi Parameter.
- URi : UNIQUAC Ri Parameter.
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3254 | ChemSep v8.3 pure component data | |
| PAff | 878.70 | kJ/mol | NIST |
| BasG | 846.90 | kJ/mol | NIST |
| ΔcH°liquid | [-3571.00; -3540.00] | kJ/mol |
|
| ΔcH°liquid | -3569.23 ± 0.48 | kJ/mol | NIST |
| ΔcH°liquid | -3571.00 ± 0.80 | kJ/mol | NIST |
| ΔcH°liquid | -3540.00 | kJ/mol | NIST |
| ΔcH°liquid | -3549.00 | kJ/mol | NIST |
| μ | 3.21 | debye | ChemSep v8.3 pure component data |
| ΔfG° | -78.81 | kJ/mol | ChemSep v8.3 pure component data |
| ΔfH°gas | [-195.60; -178.28] | kJ/mol |
|
| ΔfH°gas | -195.60 | kJ/mol | ChemSep v8.3 pure component data |
| ΔfH°gas | -178.28 ± 0.64 | kJ/mol | NIST |
| ΔfH°gas | -184.50 ± 2.50 | kJ/mol | NIST |
| ΔfH°liquid | [-220.98; -219.00] | kJ/mol |
|
| ΔfH°liquid | -220.98 ± 0.58 | kJ/mol | NIST |
| ΔfH°liquid | -219.00 ± 0.80 | kJ/mol | NIST |
| ΔfusH° | 11.79 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [42.70; 44.80] | kJ/mol |
|
| ΔvapH° | 42.70 ± 0.28 | kJ/mol | NIST |
| ΔvapH° | 42.70 ± 0.30 | kJ/mol | NIST |
| ΔvapH° | 44.80 | kJ/mol | NIST |
| ΔvapH° | 43.30 | kJ/mol | NIST |
| ΔvapH° | 42.70 ± 0.28 | kJ/mol | NIST |
| IE | [8.89; 9.11] | eV |
|
| IE | 9.10 ± 0.02 | eV | NIST |
| IE | 9.11 | eV | NIST |
| IE | 9.08 ± 0.03 | eV | NIST |
| IE | 8.89 ± 0.05 | eV | NIST |
| logPoct/wat | 1.045 | NCMS SOLV-DB | |
| McVol | 92.670 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 3 | KDB | |
| NFPA Health | 3 | KDB | |
| Pc | [3410.00; 4000.00] | kPa |
|
| Pc | 3410.00 | kPa | ChemSep v8.3 pure component data |
| Pc | 4000.00 ± 150.00 | kPa | NIST |
| Pc | 4000.00 ± 150.00 | kPa | NIST |
| Ptriple | 2.51e-03 | kPa | ChemSep v8.3 pure component data |
| ρc | [277.74; 277.74] | kg/m3 |
|
| ρc | 277.74 ± 9.81 | kg/m3 | NIST |
| ρc | 277.74 ± 9.81 | kg/m3 | NIST |
| Inp | [771.00; 804.00] |
|
|
| Inp | Outlier 771.00 | NIST | |
| Inp | 782.00 | NIST | |
| Inp | 778.00 | NIST | |
| Inp | 792.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 801.10 | NIST | |
| Inp | 778.00 | NIST | |
| Inp | 792.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 780.00 | NIST | |
| Inp | 787.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 804.00 | NIST | |
| Inp | 782.00 | NIST | |
| Inp | 797.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 802.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 783.00 | NIST | |
| Inp | 804.00 | NIST | |
| Inp | 783.00 | NIST | |
| Inp | 778.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 804.00 | NIST | |
| I | [1110.00; 1159.00] |
|
|
| I | 1125.00 | NIST | |
| I | 1118.00 | NIST | |
| I | 1118.00 | NIST | |
| I | Outlier 1159.00 | NIST | |
| I | 1131.00 | NIST | |
| I | 1136.00 | NIST | |
| I | 1125.00 | NIST | |
| I | 1114.00 | NIST | |
| I | Outlier 1152.00 | NIST | |
| I | 1129.00 | NIST | |
| I | 1113.00 | NIST | |
| I | 1110.00 | NIST | |
| I | 1110.00 | NIST | |
| I | 1127.00 | NIST | |
| I | 1140.00 | NIST | |
| I | 1131.00 | NIST | |
| I | 1111.00 | NIST | |
| I | 1127.00 | NIST | |
| I | 1128.00 | NIST | |
| I | 1125.00 | NIST | |
| I | 1137.00 | NIST | |
| I | 1140.00 | NIST | |
| I | 1118.00 | NIST | |
| I | 1114.00 | NIST | |
| I | 1110.00 | NIST | |
| Tboil | [401.40; 403.15] | K |
|
| Tboil | 402.95 | K | ChemSep v8.3 pure component data |
| Tboil | 403.15 | K | NCMS SOLV-DB |
| Tboil | 402.90 | K | NIST |
| Tboil | 402.95 | K | NIST |
| Tboil | 402.05 ± 1.00 | K | NIST |
| Tboil | 403.15 ± 1.50 | K | NIST |
| Tboil | 401.40 ± 1.50 | K | NIST |
| Tboil | 402.60 ± 0.50 | K | NIST |
| Tboil | 402.60 ± 0.50 | K | NIST |
| Tboil | 401.54 ± 0.30 | K | NIST |
| Tboil | 403.15 ± 1.00 | K | NIST |
| Tc | [600.00; 605.00] | K |
|
| Tc | 600.00 | K | ChemSep v8.3 pure component data |
| Tc | 605.00 ± 2.00 | K | NIST |
| Tc | 605.00 ± 2.00 | K | NIST |
| Tfus | [216.15; 226.75] | K |
|
| Tfus | 226.75 | K | ChemSep v8.3 pure component data |
| Tfus | 216.15 | K | NCMS SOLV-DB |
| Tfus | 226.75 | K | NIST |
| Tfus | 220.30 ± 0.30 | K | NIST |
| Ttriple | 220.15 | K | ChemSep v8.3 pure component data |
| UQi | 3.86 | ChemSep v8.3 pure component data | |
| URi | 4.36 | ChemSep v8.3 pure component data | |
| Vc | 0.355 | m3/kmol | ChemSep v8.3 pure component data |
| Zc | 0.2430000 | ChemSep v8.3 pure component data | |
| Zra | 0.24 | ChemSep v8.3 pure component data |
Cheméo can also estimate Log10 of Water solubility in mol/l for this compound, but it falls outside the models' validated range, so it is not shown here. Open the prediction tool to compute it on demand.
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | 0.0005800 | Pa×s | 298.15 | NCMS SOLV-DB |
| ΔfusH | 12.10 | kJ/mol | 229.60 | NIST |
| ΔvapH | [33.50; 41.50] | kJ/mol | [359.00; 435.00] |
|
| ΔvapH | 41.50 | kJ/mol | 359.00 | NIST |
| ΔvapH | 41.40 ± 0.30 | kJ/mol | 372.50 | NIST |
| ΔvapH | 39.10 ± 0.30 | kJ/mol | 372.50 | NIST |
| ΔvapH | 36.50 ± 0.30 | kJ/mol | 372.50 | NIST |
| ΔvapH | 33.50 ± 0.60 | kJ/mol | 372.50 | NIST |
| ΔvapH | 35.20 | kJ/mol | 401.00 | NIST |
| ΔvapH | 37.80 | kJ/mol | 435.00 | NIST |
| Pvap | 1.09 | kPa | 298.15 | NCMS SOLV-DB |
| n0 | 1.44500 | 298.15 | NCMS SOLV-DB | |
| ρl | 857.60 | kg/m3 | 298.15 | Determination and Correlation of Liquid-Liquid Equilibria Data for Water + Cyclohexanol + (Mesityl Oxide, Toluene, and p-Xylene) Ternary Systems at Different Temperatures |
| γ | 0.03 | N/m | 298.15 | NCMS SOLV-DB |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [123.62; 334.50] | J/mol×K | [255.00; 1500.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 7.20686e+01 | |||
| Coefficient B | -5.00000e+02 | |||
| Coefficient C | 5.90331e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 16, IdealGasHeatCapacityCp | |||
| Temperature range, min. | 255.00 | |||
| Temperature range, max. | 1500.00 | |||
| Cp,gas | 123.62 | J/mol×K | 255.00 | Calculated Property |
| Cp,gas | 174.80 | J/mol×K | 393.33 | Calculated Property |
| Cp,gas | 215.07 | J/mol×K | 531.67 | Calculated Property |
| Cp,gas | 245.72 | J/mol×K | 670.00 | Calculated Property |
| Cp,gas | 269.38 | J/mol×K | 808.33 | Calculated Property |
| Cp,gas | 288.04 | J/mol×K | 946.67 | Calculated Property |
| Cp,gas | 303.08 | J/mol×K | 1085.00 | Calculated Property |
| Cp,gas | 315.44 | J/mol×K | 1223.33 | Calculated Property |
| Cp,gas | 325.76 | J/mol×K | 1361.67 | Calculated Property |
| Cp,gas | 334.50 | J/mol×K | 1500.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | [210.79; 240.20] | J/mol×K | [292.48; 402.95] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is Cp,liquid in J/mol×K, T in K | |||
| Coefficient A | 1.32950e+02 | |||
| Coefficient B | 2.66150e-01 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 100, LiquidHeatCapacityCp | |||
| Temperature range, min. | 292.48 | |||
| Temperature range, max. | 402.95 | |||
| Cp,liquid | 210.79 | J/mol×K | 292.48 | Calculated Property |
| Cp,liquid | 214.06 | J/mol×K | 304.75 | Calculated Property |
| Cp,liquid | 217.33 | J/mol×K | 317.03 | Calculated Property |
| Cp,liquid | 220.59 | J/mol×K | 329.30 | Calculated Property |
| Cp,liquid | 223.86 | J/mol×K | 341.58 | Calculated Property |
| Cp,liquid | 227.13 | J/mol×K | 353.85 | Calculated Property |
| Cp,liquid | 230.39 | J/mol×K | 366.13 | Calculated Property |
| Cp,liquid | 233.66 | J/mol×K | 378.40 | Calculated Property |
| Cp,liquid | 236.93 | J/mol×K | 390.68 | Calculated Property |
| Cp,liquid | 240.20 | J/mol×K | 402.95 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | [0.0025628; 0.0002072] | Pa×s | [220.15; 480.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is η in Pa×s, T in K | |||
| Coefficient A | -3.81070e+01 | |||
| Coefficient B | 3.38240e+03 | |||
| Coefficient C | 3.37060e+01 | |||
| Coefficient D | -7.34840e+01 | |||
| Coefficient E | 1.50000e-01 | |||
| Comment | ChemSep eq 101, LiquidViscosity | |||
| Temperature range, min. | 220.15 | |||
| Temperature range, max. | 480.00 | |||
| η | 0.0025628 | Pa×s | 220.15 | Calculated Property |
| η | 0.0012639 | Pa×s | 249.02 | Calculated Property |
| η | 0.0007643 | Pa×s | 277.89 | Calculated Property |
| η | 0.0005296 | Pa×s | 306.77 | Calculated Property |
| η | 0.0004031 | Pa×s | 335.64 | Calculated Property |
| η | 0.0003278 | Pa×s | 364.51 | Calculated Property |
| η | 0.0002797 | Pa×s | 393.38 | Calculated Property |
| η | 0.0002471 | Pa×s | 422.26 | Calculated Property |
| η | 0.0002241 | Pa×s | 451.13 | Calculated Property |
| η | 0.0002072 | Pa×s | 480.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [46.59; 0.00] | kJ/mol | [220.15; 600.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is ΔvapH in kJ/mol, T in K | |||
| Coefficient A | 5.58140e+01 | |||
| Coefficient B | 3.95240e-01 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Critical temperature, Tc (K) | 6.00000e+02 | |||
| Comment | ChemSep eq 106, HeatOfVaporization | |||
| Temperature range, min. | 220.15 | |||
| Temperature range, max. | 600.00 | |||
| ΔvapH | 46.59 | kJ/mol | 220.15 | Calculated Property |
| ΔvapH | 44.47 | kJ/mol | 262.36 | Calculated Property |
| ΔvapH | 42.18 | kJ/mol | 304.56 | Calculated Property |
| ΔvapH | 39.69 | kJ/mol | 346.77 | Calculated Property |
| ΔvapH | 36.93 | kJ/mol | 388.97 | Calculated Property |
| ΔvapH | 33.81 | kJ/mol | 431.18 | Calculated Property |
| ΔvapH | 30.18 | kJ/mol | 473.38 | Calculated Property |
| ΔvapH | 25.71 | kJ/mol | 515.59 | Calculated Property |
| ΔvapH | 19.55 | kJ/mol | 557.79 | Calculated Property |
| ΔvapH | 0.00 | kJ/mol | 600.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [295.47; 429.29] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.43990e+01 | |||
| Coefficient B | -3.41585e+03 | |||
| Coefficient C | -5.34050e+01 | |||
| Temperature range, min. | 295.47 | |||
| Temperature range, max. | 429.29 | |||
| Pvap | 1.33 | kPa | 295.47 | Calculated Property |
| Pvap | 3.02 | kPa | 310.34 | Calculated Property |
| Pvap | 6.24 | kPa | 325.21 | Calculated Property |
| Pvap | 11.98 | kPa | 340.08 | Calculated Property |
| Pvap | 21.56 | kPa | 354.95 | Calculated Property |
| Pvap | 36.72 | kPa | 369.81 | Calculated Property |
| Pvap | 59.61 | kPa | 384.68 | Calculated Property |
| Pvap | 92.83 | kPa | 399.55 | Calculated Property |
| Pvap | 139.38 | kPa | 414.42 | Calculated Property |
| Pvap | 202.66 | kPa | 429.29 | Calculated Property |
| Pvap | [2.51e-03; 3408.10] | kPa | [220.15; 600.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is Pvap in kPa, T in K | |||
| Coefficient A | 5.57712e+01 | |||
| Coefficient B | -6.81500e+03 | |||
| Coefficient C | -5.71030e+00 | |||
| Coefficient D | 5.34520e-18 | |||
| Coefficient E | 6.00000e+00 | |||
| Comment | ChemSep eq 101, VaporPressure | |||
| Temperature range, min. | 220.15 | |||
| Temperature range, max. | 600.00 | |||
| Pvap | 2.51e-03 | kPa | 220.15 | Calculated Property |
| Pvap | 0.13 | kPa | 262.36 | Calculated Property |
| Pvap | 2.10 | kPa | 304.56 | Calculated Property |
| Pvap | 15.33 | kPa | 346.77 | Calculated Property |
| Pvap | 67.75 | kPa | 388.97 | Calculated Property |
| Pvap | 212.38 | kPa | 431.18 | Calculated Property |
| Pvap | 523.28 | kPa | 473.38 | Calculated Property |
| Pvap | 1086.99 | kPa | 515.59 | Calculated Property |
| Pvap | 2003.38 | kPa | 557.79 | Calculated Property |
| Pvap | 3408.10 | kPa | 600.00 | Calculated Property |
| Pvap | [2.36e-03; 3355.54] | kPa | [220.15; 600.00] |
KDB Vapor Pressure Data
|
| Equation | ln(Y) = A + B/T + C·ln(T) + D·T² + E/T² Y is Pvap in kPa, T in K | |||
| Coefficient A | 6.11275e+01 | |||
| Coefficient B | -6.98731e+03 | |||
| Coefficient C | -6.58940e+00 | |||
| Coefficient D | 2.18991e-06 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 220.15 | |||
| Temperature range, max. | 600.00 | |||
| Pvap | 2.36e-03 | kPa | 220.15 | Calculated Property |
| Pvap | 0.13 | kPa | 262.36 | Calculated Property |
| Pvap | 2.02 | kPa | 304.56 | Calculated Property |
| Pvap | 14.91 | kPa | 346.77 | Calculated Property |
| Pvap | 66.64 | kPa | 388.97 | Calculated Property |
| Pvap | 211.60 | kPa | 431.18 | Calculated Property |
| Pvap | 527.29 | kPa | 473.38 | Calculated Property |
| Pvap | 1101.75 | kPa | 515.59 | Calculated Property |
| Pvap | 2019.94 | kPa | 557.79 | Calculated Property |
| Pvap | 3355.54 | kPa | 600.00 | Calculated Property |
| Pvap | [0.74; 102.58] | kPa | [287.00; 403.10] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.42611e+01 | |||
| Coefficient B | -3.30336e+03 | |||
| Coefficient C | -6.00880e+01 | |||
| Reference | Fuge, Bowden, et al., 1952 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 287.00 | |||
| Temperature range, max. | 403.10 | |||
| Pvap | 0.74 | kPa | 287.00 | Calculated Property |
| Pvap | 1.63 | kPa | 299.90 | Calculated Property |
| Pvap | 3.29 | kPa | 312.80 | Calculated Property |
| Pvap | 6.20 | kPa | 325.70 | Calculated Property |
| Pvap | 11.03 | kPa | 338.60 | Calculated Property |
| Pvap | 18.64 | kPa | 351.50 | Calculated Property |
| Pvap | 30.14 | kPa | 364.40 | Calculated Property |
| Pvap | 46.87 | kPa | 377.30 | Calculated Property |
| Pvap | 70.41 | kPa | 390.20 | Calculated Property |
| Pvap | 102.58 | kPa | 403.10 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ρl | [919.57; 276.47] | kg/m3 | [220.15; 600.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A / B^(1 + (1 − T/C)^D) Y is ρl in kg/m3, T in K | |||
| Coefficient A | 7.03293e+01 | |||
| Coefficient B | 2.54380e-01 | |||
| Coefficient C | 6.00000e+02 | |||
| Coefficient D | 2.84840e-01 | |||
| Comment | ChemSep eq 105, LiquidDensity | |||
| Temperature range, min. | 220.15 | |||
| Temperature range, max. | 600.00 | |||
| ρl | 919.57 | kg/m3 | 220.15 | Calculated Property |
| ρl | 883.82 | kg/m3 | 262.36 | Calculated Property |
| ρl | 846.31 | kg/m3 | 304.56 | Calculated Property |
| ρl | 806.59 | kg/m3 | 346.77 | Calculated Property |
| ρl | 764.05 | kg/m3 | 388.97 | Calculated Property |
| ρl | 717.69 | kg/m3 | 431.18 | Calculated Property |
| ρl | 665.80 | kg/m3 | 473.38 | Calculated Property |
| ρl | 604.94 | kg/m3 | 515.59 | Calculated Property |
| ρl | 525.75 | kg/m3 | 557.79 | Calculated Property |
| ρl | 276.47 | kg/m3 | 600.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| γ | [0.04; 0.00] | N/m | [220.15; 600.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is γ in N/m, T in K | |||
| Coefficient A | 6.61200e-02 | |||
| Coefficient B | 1.25600e+00 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Critical temperature, Tc (K) | 6.00000e+02 | |||
| Comment | ChemSep eq 106, SurfaceTension | |||
| Temperature range, min. | 220.15 | |||
| Temperature range, max. | 600.00 | |||
| γ | 0.04 | N/m | 220.15 | Calculated Property |
| γ | 0.03 | N/m | 262.36 | Calculated Property |
| γ | 0.03 | N/m | 304.56 | Calculated Property |
| γ | 0.02 | N/m | 346.77 | Calculated Property |
| γ | 0.02 | N/m | 388.97 | Calculated Property |
| γ | 0.01 | N/m | 431.18 | Calculated Property |
| γ | 0.01 | N/m | 473.38 | Calculated Property |
| γ | 0.01 | N/m | 515.59 | Calculated Property |
| γ | 0.00 | N/m | 557.79 | Calculated Property |
| γ | 0.00 | N/m | 600.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λ | [0.02; 0.08] | W/m×K | [402.95; 1000.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·T^B / (1 + C/T + D/T²) Y is λ in W/m×K, T in K | |||
| Coefficient A | 1.77700e-04 | |||
| Coefficient B | 9.62200e-01 | |||
| Coefficient C | 6.84700e+02 | |||
| Coefficient D | 0.00000e+00 | |||
| Comment | ChemSep eq 102, VaporThermalConductivity | |||
| Temperature range, min. | 402.95 | |||
| Temperature range, max. | 1000.00 | |||
| λ | 0.02 | W/m×K | 402.95 | Calculated Property |
| λ | 0.03 | W/m×K | 469.29 | Calculated Property |
| λ | 0.03 | W/m×K | 535.63 | Calculated Property |
| λ | 0.04 | W/m×K | 601.97 | Calculated Property |
| λ | 0.05 | W/m×K | 668.31 | Calculated Property |
| λ | 0.05 | W/m×K | 734.64 | Calculated Property |
| λ | 0.06 | W/m×K | 800.98 | Calculated Property |
| λ | 0.07 | W/m×K | 867.32 | Calculated Property |
| λ | 0.07 | W/m×K | 933.66 | Calculated Property |
| λ | 0.08 | W/m×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λ | [0.18; 0.13] | W/m×K | [220.15; 402.95] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is λ in W/m×K, T in K | |||
| Coefficient A | 2.40530e-01 | |||
| Coefficient B | -2.84300e-04 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 100, LiquidThermalConductivity | |||
| Temperature range, min. | 220.15 | |||
| Temperature range, max. | 402.95 | |||
| λ | 0.18 | W/m×K | 220.15 | Calculated Property |
| λ | 0.17 | W/m×K | 240.46 | Calculated Property |
| λ | 0.17 | W/m×K | 260.77 | Calculated Property |
| λ | 0.16 | W/m×K | 281.08 | Calculated Property |
| λ | 0.15 | W/m×K | 301.39 | Calculated Property |
| λ | 0.15 | W/m×K | 321.71 | Calculated Property |
| λ | 0.14 | W/m×K | 342.02 | Calculated Property |
| λ | 0.14 | W/m×K | 362.33 | Calculated Property |
| λ | 0.13 | W/m×K | 382.64 | Calculated Property |
| λ | 0.13 | W/m×K | 402.95 | Calculated Property |
Similar Compounds
Find more compounds similar to 3-Penten-2-one, 4-methyl-.
Mixtures
- 3-Penten-2-one, 4-methyl- + Phenol, 2-methyl- + Water
- 3-Penten-2-one, 4-methyl- + Phenol, 3-methyl- + Water
- 3-Penten-2-one, 4-methyl- + PHENOL, 4-METHYL- + Water
- 3-Penten-2-one, 4-methyl- + Phenol + Water
- 3-Penten-2-one, 4-methyl- + Propanoic acid + Water
- 3-Penten-2-one, 4-methyl- + Butanoic acid + Water
- 3-Penten-2-one, 4-methyl- + 1,2-Benzenediol + Water
- Cyclohexanol + 3-Penten-2-one, 4-methyl- + Water
- 3-Penten-2-one, 4-methyl- + Water
- 3-Penten-2-one, 4-methyl- + Cyclohexanone + Water
Sources
- KDB Vapor Pressure Data
- ChemSep v8.3 pure component data Converted from ChemSep v8.3 pure component data, H. Kooijman and R. Taylor (2021, 2022), Artistic License 2.0; see how the values differ.
- Crippen Method
- Measurement, correlation and COSMO-SAC prediction of liquid-liquid equilibrium for the ternary systems, mesityl oxide + o-, m-, p-cresol + water, at 333.2 K and 353.2 K
- Screening solvents to extract phenol from aqueous solutions by the COSMO-SAC model and extraction process simulation
- Liquid phase equilibrium of the ternary systems, water + propionic or butyric acid + mesityl oxide, at (298.2 and 323.2) K
- Liquid-Liquid Equilibria for the Ternary System Mesityl Oxide + Phenol + Water at 298.15, 313.15, and 323.15 K
- Determination and Correlation of Liquid-Liquid Equilibria Data for Water + Cyclohexanol + (Mesityl Oxide, Toluene, and p-Xylene) Ternary Systems at Different Temperatures
- Measurement and Correlation of Ternary (Liquid + Liquid) Equilibria for Separation of Cyclohexanone from Water via Isophorone or Mesityl Oxide
- Liquid-Liquid Equilibrium for Ternary Systems of 2-Pentanone/Mesityl Oxide + Catechol + Water at 298.2, 318.2, and 333.2 K
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
- NCMS SOLV-DB
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
These property values are available through the Cheméo API. A free account gives you an access key.