- InChI
- InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3
- InChI Key
- KWOLFJPFCHCOCG-UHFFFAOYSA-N
- Formula
- C8H8O
- SMILES
- CC(=O)c1ccccc1
- Molecular Weight1
- 120.15
- CAS
- 98-86-2
- Other Names
-
- 1-phenyl-1-ethanone
- 1-phenylethanone
- 1-phenylethanone (acetophenone)
- Acetofenon
- Acetophenon
- Acetylbenzene
- Acetylbenzol
- Benzene, acetyl-
- Benzoyl methide
- Dymex
- Ethanone, 1-phenyl-
- Hypnon
- Hypnone
- Ketone, methyl phenyl-
- NSC 7635
- Phenylethanone
- Rcra waste number U004
- USAF EK-496
- methyl phenyl ketone
- phenyl methyl ketone
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- Tig : Autoignition Temperature (K).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- EA : Electron affinity (eV).
- Tflash,cc : Flash Point (Closed Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- Ip : Polar retention indices.
- S°gas : Molar entropy at standard conditions (J/mol×K).
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Pressure Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | [0.3770; 0.4200] |
|
|
| ω | 0.3770 | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value | |
| ω | 0.4200 | KDB | |
| PAff | [861.10; 863.50] | kJ/mol |
|
| PAff | 861.10 | kJ/mol | NIST |
| PAff | 863.50 ± 0.50 | kJ/mol | NIST |
| Tig | 843.15 | K | KDB |
| BasG | 829.30 | kJ/mol | NIST |
| ΔcH°liquid | [-4148.90; -4136.00] | kJ/mol |
|
| ΔcH°liquid | -4140.00 | kJ/mol | NIST |
| ΔcH°liquid | -4148.90 ± 0.88 | kJ/mol | NIST |
| ΔcH°liquid | -4136.00 | kJ/mol | NIST |
| μ | 3.00 | debye | KDB |
| EA | [0.33; 2.55] | eV |
|
| EA | 0.33 ± 0.00 | eV | NIST |
| EA | 0.33 ± 0.00 | eV | NIST |
| EA | 2.55 ± 0.03 | eV | NIST |
| Tflash,cc | 355.37 | K | KDB |
| ΔfG° | 1.84 | kJ/mol | KDB |
| ΔfH°gas | [-86.92; -86.70] | kJ/mol |
|
| ΔfH°gas | -86.92 | kJ/mol | KDB |
| ΔfH°gas | -86.70 ± 1.70 | kJ/mol | NIST |
| ΔfH°liquid | -142.50 ± 1.00 | kJ/mol | NIST |
| ΔfusH° | 12.12 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [52.70; 57.90] | kJ/mol |
|
| ΔvapH° | 55.40 ± 0.40 | kJ/mol | NIST |
| ΔvapH° | 53.40 | kJ/mol | NIST |
| ΔvapH° | 52.70 | kJ/mol | NIST |
| ΔvapH° | 57.90 | kJ/mol | NIST |
| ΔvapH° | 55.90 ± 1.30 | kJ/mol | NIST |
| IE | [8.90; 9.60] | eV |
|
| IE | 9.28 ± 0.03 | eV | NIST |
| IE | 9.10 ± 0.10 | eV | NIST |
| IE | 9.28 | eV | NIST |
| IE | 9.45 | eV | NIST |
| IE | 9.10 ± 0.10 | eV | NIST |
| IE | 9.10 | eV | NIST |
| IE | 9.50 | eV | NIST |
| IE | 9.30 ± 0.20 | eV | NIST |
| IE | 9.15 ± 0.03 | eV | NIST |
| IE | 9.27 ± 0.03 | eV | NIST |
| IE | 9.60 | eV | NIST |
| IE | 9.38 | eV | NIST |
| IE | 9.51 | eV | NIST |
| IE | 9.51 | eV | NIST |
| IE | 9.45 | eV | NIST |
| IE | 9.45 | eV | NIST |
| IE | 9.35 | eV | NIST |
| IE | Outlier 8.90 | eV | NIST |
| IE | 9.37 | eV | NIST |
| log10WS | [-1.28; -1.28] |
|
|
| log10WS | -1.28 | Aq. Solubility Prediction | |
| log10WS | -1.28 | Estimated Solubility | |
| logPoct/wat | 1.889 | Crippen Calculated Property | |
| McVol | 101.390 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 1 | KDB | |
| Pc | [4010.00; 4400.00] | kPa |
|
| Pc | 4010.00 | kPa | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 7 Compiled value |
| Pc | 4010.44 | kPa | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Pc | 4060.00 | kPa | KDB |
| Pc | 4400.00 ± 150.00 | kPa | NIST |
| Pc | 4010.00 ± 30.00 | kPa | NIST |
| ρc | [311.18; 314.79] | kg/m3 |
|
| ρc | 314.79 ± 12.01 | kg/m3 | NIST |
| ρc | 311.18 ± 6.01 | kg/m3 | NIST |
| Inp | [173.00; 1094.00] |
|
|
| Inp | 1077.00 | NIST | |
| Inp | 1038.40 | NIST | |
| Inp | 1033.40 | NIST | |
| Inp | 1040.20 | NIST | |
| Inp | 1028.30 | NIST | |
| Inp | 1030.50 | NIST | |
| Inp | 1043.10 | NIST | |
| Inp | 1044.70 | NIST | |
| Inp | 1058.50 | NIST | |
| Inp | 1043.10 | NIST | |
| Inp | 1066.10 | NIST | |
| Inp | 1060.30 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1049.00 | NIST | |
| Inp | 1047.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1078.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1049.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1042.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1053.00 | NIST | |
| Inp | 1080.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1025.20 | NIST | |
| Inp | 1071.60 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1043.10 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1060.37 | NIST | |
| Inp | 1065.80 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1043.90 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1093.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1068.40 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1055.10 | NIST | |
| Inp | 1055.10 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1088.00 | NIST | |
| Inp | 1086.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1049.00 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1049.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1051.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1040.00 | NIST | |
| Inp | 1047.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1079.00 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1029.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1080.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1080.00 | NIST | |
| Inp | 1040.00 | NIST | |
| Inp | 1039.00 | NIST | |
| Inp | 1026.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1027.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1042.00 | NIST | |
| Inp | 1042.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1038.00 | NIST | |
| Inp | 1043.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1029.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1026.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1039.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1094.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1034.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1078.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1043.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1072.40 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1043.00 | NIST | |
| Inp | 1091.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1038.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1026.00 | NIST | |
| Inp | 1027.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | Outlier 175.06 | NIST | |
| Inp | Outlier 176.57 | NIST | |
| Inp | Outlier 173.90 | NIST | |
| Inp | Outlier 173.00 | NIST | |
| Inp | Outlier 176.26 | NIST | |
| Inp | 1078.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | Outlier 175.06 | NIST | |
| Inp | 1068.00 | NIST | |
| Ip | [1600.00; 1695.00] |
|
|
| Ip | 1655.00 | NIST | |
| Ip | Outlier 1600.00 | NIST | |
| Ip | 1606.00 | NIST | |
| Ip | 1636.00 | NIST | |
| Ip | 1645.00 | NIST | |
| Ip | 1628.00 | NIST | |
| Ip | 1636.00 | NIST | |
| Ip | 1627.00 | NIST | |
| Ip | 1652.00 | NIST | |
| Ip | 1652.00 | NIST | |
| Ip | 1609.00 | NIST | |
| Ip | 1621.00 | NIST | |
| Ip | 1624.00 | NIST | |
| Ip | 1609.00 | NIST | |
| Ip | 1607.00 | NIST | |
| Ip | 1657.00 | NIST | |
| Ip | 1643.00 | NIST | |
| Ip | 1657.00 | NIST | |
| Ip | 1638.00 | NIST | |
| Ip | 1643.00 | NIST | |
| Ip | 1621.00 | NIST | |
| Ip | 1629.00 | NIST | |
| Ip | 1669.00 | NIST | |
| Ip | 1647.00 | NIST | |
| Ip | 1651.00 | NIST | |
| Ip | 1651.00 | NIST | |
| Ip | 1632.00 | NIST | |
| Ip | 1632.00 | NIST | |
| Ip | 1655.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1655.00 | NIST | |
| Ip | 1623.00 | NIST | |
| Ip | 1656.00 | NIST | |
| Ip | 1661.00 | NIST | |
| Ip | 1628.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1661.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1664.00 | NIST | |
| Ip | 1656.00 | NIST | |
| Ip | 1639.00 | NIST | |
| Ip | 1619.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1645.00 | NIST | |
| Ip | 1645.00 | NIST | |
| Ip | 1630.00 | NIST | |
| Ip | Outlier 1689.00 | NIST | |
| Ip | Outlier 1690.00 | NIST | |
| Ip | 1655.00 | NIST | |
| Ip | 1654.00 | NIST | |
| Ip | 1662.00 | NIST | |
| Ip | 1627.00 | NIST | |
| Ip | 1671.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1670.00 | NIST | |
| Ip | 1671.00 | NIST | |
| Ip | Outlier 1694.00 | NIST | |
| Ip | 1647.00 | NIST | |
| Ip | 1667.00 | NIST | |
| Ip | 1680.00 | NIST | |
| Ip | 1654.00 | NIST | |
| Ip | 1644.00 | NIST | |
| Ip | 1638.00 | NIST | |
| Ip | 1679.00 | NIST | |
| Ip | Outlier 1693.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1640.00 | NIST | |
| Ip | 1659.00 | NIST | |
| Ip | 1650.00 | NIST | |
| Ip | 1645.00 | NIST | |
| Ip | 1667.00 | NIST | |
| Ip | 1650.00 | NIST | |
| Ip | 1671.00 | NIST | |
| Ip | 1624.00 | NIST | |
| Ip | 1644.00 | NIST | |
| Ip | 1671.00 | NIST | |
| Ip | 1656.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1609.00 | NIST | |
| Ip | 1627.00 | NIST | |
| Ip | 1609.00 | NIST | |
| Ip | 1615.00 | NIST | |
| Ip | Outlier 1600.00 | NIST | |
| Ip | 1615.00 | NIST | |
| Ip | 1650.00 | NIST | |
| Ip | 1649.00 | NIST | |
| Ip | 1665.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1660.00 | NIST | |
| Ip | 1657.00 | NIST | |
| Ip | 1628.00 | NIST | |
| Ip | 1650.00 | NIST | |
| Ip | 1620.00 | NIST | |
| Ip | 1667.00 | NIST | |
| Ip | 1625.00 | NIST | |
| Ip | 1611.00 | NIST | |
| Ip | 1637.00 | NIST | |
| Ip | 1637.00 | NIST | |
| Ip | 1669.00 | NIST | |
| Ip | 1668.00 | NIST | |
| Ip | 1668.00 | NIST | |
| Ip | 1621.00 | NIST | |
| Ip | 1634.00 | NIST | |
| Ip | 1645.00 | NIST | |
| Ip | 1646.00 | NIST | |
| Ip | 1627.00 | NIST | |
| Ip | 1637.00 | NIST | |
| Ip | 1667.00 | NIST | |
| Ip | 1627.00 | NIST | |
| Ip | 1627.00 | NIST | |
| Ip | 1657.00 | NIST | |
| Ip | Outlier 1695.00 | NIST | |
| Ip | 1667.00 | NIST | |
| Ip | 1643.00 | NIST | |
| Ip | 1643.00 | NIST | |
| Ip | 1627.00 | NIST | |
| Ip | 1636.00 | NIST | |
| S°gas | 372.88 | J/mol×K | NIST |
| Tboil | [474.00; 475.80] | K |
|
| Tboil | 475.10 | K | Ternary phase diagrams for aqueous mixtures of butyric acid with several solvents: experimental and correlated data |
| Tboil | 475.00 | K | KDB |
| Tboil | 475.80 | K | NIST |
| Tboil | 475.00 | K | NIST |
| Tboil | 474.85 | K | NIST |
| Tboil | 475.15 ± 0.35 | K | NIST |
| Tboil | 475.15 ± 0.30 | K | NIST |
| Tboil | Outlier 474.00 ± 1.50 | K | NIST |
| Tboil | Outlier 474.00 ± 3.00 | K | NIST |
| Tboil | 475.20 ± 0.50 | K | NIST |
| Tboil | 475.20 ± 0.50 | K | NIST |
| Tboil | 475.15 ± 0.50 | K | NIST |
| Tboil | 474.65 ± 1.00 | K | NIST |
| Tboil | 475.15 ± 1.00 | K | NIST |
| Tc | [709.50; 713.00] | K |
|
| Tc | 709.60 | K | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 7 Compiled value |
| Tc | 709.50 | K | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Tc | 709.50 | K | KDB |
| Tc | Outlier 713.00 ± 2.00 | K | NIST |
| Tc | 709.60 ± 1.00 | K | NIST |
| Tc | 709.50 ± 0.60 | K | NIST |
| Tfus | [292.65; 293.65] | K |
|
| Tfus | 293.15 | K | Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) Compiled value |
| Tfus | 293.00 | K | KDB |
| Tfus | 292.88 | K | Aq. Solubility Prediction |
| Tfus | 293.00 | K | NIST |
| Tfus | 292.85 | K | NIST |
| Tfus | 292.65 ± 1.50 | K | NIST |
| Tfus | 293.00 ± 2.00 | K | NIST |
| Tfus | 292.77 ± 0.06 | K | NIST |
| Tfus | 292.75 ± 0.30 | K | NIST |
| Tfus | 293.15 ± 1.50 | K | NIST |
| Tfus | Outlier 293.65 ± 0.60 | K | NIST |
| Vc | [0.386; 0.388] | m3/kmol |
|
| Vc | 0.388 | m3/kmol | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 7 Compiled value |
| Vc | 0.386 | m3/kmol | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Vc | 0.386 | m3/kmol | KDB |
| Zc | [0.2640000; 0.2656590] |
|
|
| Zc | 0.2640000 | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 7 Compiled value | |
| Zc | 0.2656590 | KDB |
Temperature Dependent Properties
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 340.00 | K | 0.70 | NIST |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 308.15 | 101.30 | 0.0014 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 100.00 | 1023.4 |
| 298.15 | 10000.00 | 1029.0 |
| 298.15 | 15000.00 | 1031.7 |
| 298.15 | 20000.00 | 1034.3 |
| 298.15 | 25000.00 | 1036.8 |
| 298.15 | 30000.00 | 1039.3 |
| 298.15 | 35000.00 | 1041.8 |
| 298.15 | 40000.00 | 1044.4 |
| 298.15 | 45000.00 | 1046.7 |
| 298.15 | 50000.00 | 1049.0 |
| 318.15 | 100.00 | 1005.9 |
| 318.15 | 10000.00 | 1012.2 |
| 318.15 | 15000.00 | 1015.2 |
| 318.15 | 20000.00 | 1018.1 |
| 318.15 | 25000.00 | 1020.9 |
| 318.15 | 30000.00 | 1023.6 |
| 318.15 | 35000.00 | 1026.4 |
| 318.15 | 40000.00 | 1028.8 |
| 318.15 | 45000.00 | 1031.5 |
| 318.15 | 50000.00 | 1034.0 |
| 348.15 | 100.00 | 979.6 |
| 348.15 | 10000.00 | 987.1 |
| 348.15 | 15000.00 | 990.5 |
| 348.15 | 20000.00 | 993.6 |
| 348.15 | 25000.00 | 996.9 |
| 348.15 | 30000.00 | 1000.1 |
| 348.15 | 35000.00 | 1003.1 |
| 348.15 | 40000.00 | 1006.1 |
| 348.15 | 45000.00 | 1009.0 |
| 348.15 | 50000.00 | 1011.7 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [118.86; 302.55] | J/mol×K | [273.00; 1000.00] |
Joback Predicted correlation
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | -3.09300e+01 | |||
| Coefficient B | 6.56920e-01 | |||
| Coefficient C | -4.23900e-04 | |||
| Coefficient D | 1.00460e-07 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 273.00 | |||
| Temperature range, max. | 1000.00 | |||
| Cp,gas | 118.86 | J/mol×K | 273.00 | Calculated Property |
| Cp,gas | 152.87 | J/mol×K | 353.78 | Calculated Property |
| Cp,gas | 182.73 | J/mol×K | 434.56 | Calculated Property |
| Cp,gas | 208.78 | J/mol×K | 515.33 | Calculated Property |
| Cp,gas | 231.32 | J/mol×K | 596.11 | Calculated Property |
| Cp,gas | 250.67 | J/mol×K | 676.89 | Calculated Property |
| Cp,gas | 267.15 | J/mol×K | 757.67 | Calculated Property |
| Cp,gas | 281.08 | J/mol×K | 838.44 | Calculated Property |
| Cp,gas | 292.77 | J/mol×K | 919.22 | Calculated Property |
| Cp,gas | 302.55 | J/mol×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [351.57; 505.30] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.50213e+01 | |||
| Coefficient B | -4.37766e+03 | |||
| Coefficient C | -5.44530e+01 | |||
| Temperature range, min. | 351.57 | |||
| Temperature range, max. | 505.30 | |||
| Pvap | 1.33 | kPa | 351.57 | Calculated Property |
| Pvap | 2.97 | kPa | 368.65 | Calculated Property |
| Pvap | 6.09 | kPa | 385.73 | Calculated Property |
| Pvap | 11.64 | kPa | 402.81 | Calculated Property |
| Pvap | 20.95 | kPa | 419.89 | Calculated Property |
| Pvap | 35.77 | kPa | 436.98 | Calculated Property |
| Pvap | 58.34 | kPa | 454.06 | Calculated Property |
| Pvap | 91.42 | kPa | 471.14 | Calculated Property |
| Pvap | 138.26 | kPa | 488.22 | Calculated Property |
| Pvap | 202.65 | kPa | 505.30 | Calculated Property |
| Pvap | [0.04; 3943.61] | kPa | [292.80; 705.68] |
KDB Vapor Pressure Data
|
| Equation | ln(Y) = A + B/T + C·ln(T) + D·T² + E/T² Y is Pvap in kPa, T in K | |||
| Coefficient A | 7.19273e+01 | |||
| Coefficient B | -8.64835e+03 | |||
| Coefficient C | -8.08769e+00 | |||
| Coefficient D | 3.32623e-06 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 292.80 | |||
| Temperature range, max. | 705.68 | |||
| Pvap | 0.04 | kPa | 292.80 | Calculated Property |
| Pvap | 0.71 | kPa | 338.68 | Calculated Property |
| Pvap | 6.00 | kPa | 384.55 | Calculated Property |
| Pvap | 29.99 | kPa | 430.43 | Calculated Property |
| Pvap | 105.16 | kPa | 476.30 | Calculated Property |
| Pvap | 286.95 | kPa | 522.18 | Calculated Property |
| Pvap | 653.38 | kPa | 568.05 | Calculated Property |
| Pvap | 1302.52 | kPa | 613.93 | Calculated Property |
| Pvap | 2352.02 | kPa | 659.80 | Calculated Property |
| Pvap | 3943.61 | kPa | 705.68 | Calculated Property |
| Pvap | [0.13; 101.37] | kPa | [310.30; 475.60] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.53098e+01 | |||
| Coefficient B | -4.61990e+03 | |||
| Coefficient C | -4.34720e+01 | |||
| Reference | Stull, 1947 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 310.30 | |||
| Temperature range, max. | 475.60 | |||
| Pvap | 0.13 | kPa | 310.30 | Calculated Property |
| Pvap | 0.41 | kPa | 328.67 | Calculated Property |
| Pvap | 1.10 | kPa | 347.03 | Calculated Property |
| Pvap | 2.61 | kPa | 365.40 | Calculated Property |
| Pvap | 5.66 | kPa | 383.77 | Calculated Property |
| Pvap | 11.35 | kPa | 402.13 | Calculated Property |
| Pvap | 21.25 | kPa | 420.50 | Calculated Property |
| Pvap | 37.54 | kPa | 438.87 | Calculated Property |
| Pvap | 63.07 | kPa | 457.23 | Calculated Property |
| Pvap | 101.37 | kPa | 475.60 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| γ | [0.04; 0.02] | N/m | [293.15; 475.15] |
Jasper (1972), surface tension of pure liquid compounds Compiled value
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is γ in N/m, T in K | |||
| Coefficient A | 7.34415e-02 | |||
| Coefficient B | -1.15400e-04 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 293.15 | |||
| Temperature range, max. | 475.15 | |||
| γ | 0.04 | N/m | 293.15 | Calculated Property |
| γ | 0.04 | N/m | 313.37 | Calculated Property |
| γ | 0.03 | N/m | 333.59 | Calculated Property |
| γ | 0.03 | N/m | 353.82 | Calculated Property |
| γ | 0.03 | N/m | 374.04 | Calculated Property |
| γ | 0.03 | N/m | 394.26 | Calculated Property |
| γ | 0.03 | N/m | 414.48 | Calculated Property |
| γ | 0.02 | N/m | 434.71 | Calculated Property |
| γ | 0.02 | N/m | 454.93 | Calculated Property |
| γ | 0.02 | N/m | 475.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Acetophenone.
Mixtures
- 1,2-Ethanediol + Acetophenone
- Furfural + Acetophenone + Water
- Decane + Acetophenone
- Dodecane + Acetophenone
- Acetophenone + Tetradecane
- Hexadecane + Acetophenone
- Benzene + Acetophenone
- Toluene + Acetophenone
- Benzene, 1,3-dimethyl- + Acetophenone
- Acetophenone + Mesitylene
- Formamide, N,N-dimethyl- + Acetophenone
- Acetophenone + 1-Pentanol
- 1-Butanol, 3-methyl- + Acetophenone
- Acetonitrile + Acetophenone
- Butanoic acid + Acetophenone + Water
- Benzene, ethyl- + Acetophenone
- n-Hexane + Benzenamine, N,N-dimethyl- + Acetophenone
- Methane, dibromo- + Acetophenone
- Diethyl carbonate + Acetophenone
- Acetophenone + 1-Hexanol
Find more mixtures with Acetophenone.
Sources
- KDB Vapor Pressure Data
- Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) ChEDL chemicals 1.5.2, from Bradley, J.-C.; Williams, A.; Lang, A. Jean-Claude Bradley Open Melting Point Dataset. Figshare, 2014 (CC0).
- IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 7 ChEDL chemicals 1.5.2, from Kudchadker, A. P.; Ambrose, D.; Tsonopoulos, C. Vapor-Liquid Critical Properties of Elements and Compounds. 7. Oxygen Compounds Other Than Alkanols and Cycloalkanols. J. Chem. Eng. Data 2001, 46, 457-479.
- Jasper (1972), surface tension of pure liquid compounds ChEDL chemicals 1.5.2, from Jasper, J. J. The Surface Tension of Pure Liquid Compounds. J. Phys. Chem. Ref. Data 1972, 1, 841-1010 (as transcribed in Lange's Handbook).
- PSRK revision IV (2005), critical constants and acentric factors of 1000 components ChEDL chemicals 1.5.2, from Horstmann, S.; Jabłoniec, A.; Krafczyk, J.; Fischer, K.; Gmehling, J. PSRK Group Contribution Equation of State: Comprehensive Revision and Extension IV, Including Critical Constants and α-Function Parameters for 1000 Components. Fluid Phase Equilib. 2005, 227, 157-164.
- Crippen Method
- Binary liquid liquid equilibrium in the systems containing monofunctional benzene derivates and 1,2-ethanediol
- Activity coefficients and excess Gibbs energy of binary mixtures of N,N-dimethyl formamide with selected compounds at 95.5 kPa
- Ionic liquid structural effects on solute partitioning in biphasic ionic liquid and supercritical carbon dioxide systems
- Ternary phase diagrams for aqueous mixtures of butyric acid with several solvents: experimental and correlated data
- Modeling extraction equilibria of butyric acid distributed between water and tri-n-butyl amine/diluent or tri-n-butyl phosphate/diluent system: Extension of the LSER approach
- Liquid liquid equilibria for acetophenone + n-alkane mixtures and characterization of acetophenone systems using DISQUAC
- Liquid-liquid equilibria for the extraction of furfural from aqueous solution using different solvents
- Bubble temperature measurements on seven binary mixtures formed by ethylbenzene at 94.7 kPa
- Excess molar volumes of (acetophenone + benzene, or toluene, or 1,3-xylene, or 1,3,5-trimethylbenzene) at temperatures (298.15 and 328.15) K
- Density and viscosity of binary liquid systems of N-methylacetamide with aromatic ketones at T = 308.15 K
- Ultrasonic studies on binary mixtures of some aromatic ketones with acetonitrile at T = 308.15 K
- Densities and derived thermodynamic properties of binary mixtures of diethylcarbonate, acetophenone, and 1-hexanol at T = (293.15 to 323.15) K for the liquid region and at ambient pressure
- Excess parameter studies on the binary mixtures of toluene with ketones at different temperatures
- PVT properties for binary ionic liquids of 1-methyl-1-propylpiperidinium bis(trifluoromethylsulfonyl)imide with anisole or acetophenone at pressures up to 50 MPa
- P-V-T properties of binary mixtures of the ionic liquid 1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide with anisole or acetophenone at elevated pressures
- Dielectric study of H-bonded interactions in amyl alcohols with ketones and DMSO at T = 298.15 K
- EXCESS MOLAR ENTHALPIES OF DIBROMOMETHANE WITH ACETONITRILE,FURAN AND ACETOPHENONE 303.15 K
- THERMODYNAMIC PROPERTIES OF DONOR ACCEPTOR COMPLEXES OF TERTIARY AMINE WITH ARYL KETONES IN HEXANE MEDIUM
- Examination of hydrogen-bonding interactions between dissolved solutes and alkylbenzene solvents based on Abraham model correlations derived from measured enthalpies of solvation
- Effect of halogen substitution on the enthalpies of solvation and hydrogen bonding of organic solutes in chlorobenzene and 1,2-dichlorobenzene derived using multi-parameter correlations
- New method for determination of vaporization and sublimation enthalpy of aromatic compounds at 298.15 K using solution calorimetry technique and group-additivity scheme
- Enthalpies of solution and enthalpies of solvation of organic solutes in ethylene glycol at 298.15 K: Prediction and analysis of intermolecular interaction contributions
- Densities and Viscosities of Binary Mixtures of N,N-Dimethylformamide with Benzyl Alcohol and Acetophenone at (298.15, 303.15, 308.15, and 313.15) K
- Partition Coefficients of Organic Solutes between Supercritical Carbon Dioxide and Water: Experimental Measurements and Empirical Correlations
- Isothermal Vapor-Liquid Equilibrium and Excess Enthalpy Data for the Binary Systems Water + 1,2-Ethanediol and Propene + Acetophenone
- Ultrasonic Studies of Binary Mixtures of Some Aromatic Ketones with N-Methyl-acetamide at 308.15 K
- Pressure-Volume-Temperature Properties for 1-Octanol + Acetophenone, Poly(Propylene Glycol) + 1-Octanol + Acetophenone, and Poly(Ethylene Glycol) + Poly(Ethylene Glycol Methyl Ether) + Anisole
- Vapor-Liquid Equilibria on Seven Binary Systems: Ethylene Oxide + 2-Methylpropane; Acetophenone + Phenol; cis-1,3-Dichloropropene + 1,2-Dichloropropane; 1,5-Hexadiene + Allyl Chloride; Isopropyl Acetate + Acetonitrile; Vinyl Chloride + Methyl Chloride; and 1,4-Butanediol + c-Butyrolactone
- Excess Volumes, Speeds of Sound, Isentropic Compressibilities, and Viscosities of Binary Mixtures of Acetophenone with Chlorotoluenes and Nitrotoluenes at 303.15 K
- Density, Viscosity, and Speed of Sound of (1-Octanol + 2-Methoxyethanol), (1-Octanol + N,N-Dimethylacetamide), and (1-Octanol + Acetophenone) at Temperatures of (298.15, 308.15, and 318.15) K
- Densities, Viscosities, and Refractive Indices of Binary Mixtures of Diethyl Oxalate with Some Ketones at (303.15, 308.15, and 313.15) K
- Liquid-Liquid Equilibrium in Ternary Systems Containing Ethylene Glycol, Monofunctional Benzene Derivative, and Ethyl Acetate
- Solute Partitioning Between 1-n-Butyl-3-methylimidazolium Trifluoromethanesulfonate Ionic Liquid and Supercritical CO2
- Isobaric Vapor Liquid Equilibrium Data for the Binary Mixtures 2-Methyl Propan-2-ol with Tetraethoxysilane and 1-Phenyl Ethanone at 95.5 kPa
- Density and Viscosity of Binary Mixtures of n-Butyl Acetate with Ketones at (298.15, 303.15, 308.15, and 313.15) K
- Isobaric Vapor Liquid Equilibrium Data for Binary Mixtures of 1-Phenylethanone with a Few Alcohols at 95.2 kPa
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Liquid-Liquid Equilibrium for the Ternary System Water + Ethylbenzene + Acetophenone and Water + Ethylbenzene + 1-Phenylethanol
- Densities, Viscosities, Speeds of Sound, and Refractive Indices for Binary Mixtures of Diethylcarbonate, Acetophenone, and 1-Hexanol at (293.15, 303.15, 313.15, and 323.15) K for the Liquid Region and at Ambient Pressure
- Viscosity, Density, and Speed of Sound for the Binary Mixtures of Formamide with 2-Methoxyethanol, Acetophenone, Acetonitrile, 1,2-Dimethoxyethane, and Dimethylsulfoxide at Different Temperatures
- Diffusion Coefficients of Organic Compounds at Infinite Dilution in Mixtures Involving Associating Compounds. Experimental Determination and Modeling by Group Contribution Methods
- Henry s Law Constants of Some Aromatic Aldehydes and Ketones Measured by an Internal Standard Method
- Excess Molar Enthalpies of Acetophenone + (Methanol, + Ethanol, + 1-Propanol, and + 2-Propanol) at Different Temperatures and Pressures
- Determination and Correlation of Excess Molar Enthalpies of Eight Binary Systems Containing Acetophenone at Different Temperatures
- Solubilities of Terephthalic Acid, Phthalic Acid, and Isophthalic Acid in Tetrahydrofuran, Cyclohexanone, 1,2-Diethoxyethane, and Acetophenone
- Density and Viscosity of Ketones with Toluene at Different Temperatures and at Atmospheric Pressure
- Densities, Viscosities, and Refractive Indices of Binary Mixtures of Acetophenone and 2-Alkanols
- Solubilities of 1,1?-(Propane-1,3-diyl)-bis(3-methyl-1H-imidazolium-1-yl) Dihexafluorophosphate in Different Solvents
- Solubility of 1,1'-(Butane-1,4-diyl)-bis(3-methyl-1H-imidazolium-1-yl) Dihexafluorophosphate in Water, Acetophenone, Cyclohexanone, Acetylacetone, and 2-Butanone
- Solubility of 1,1'-(Butane-1,4-diyl)-bis(3-methylpyridinium) Dihexafluorophosphate in Different Solvents from (288.15 to 333.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
Calculated This icon marks a calculated value or equation: a prediction, not a measurement.
Compiled This icon marks a compiled value or equation: taken from a data compilation such as ChemSep, not from an original measurement report.
These property values are available through the Cheméo API. A free account gives you an access key.