- InChI
- InChI=1S/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3
- InChI Key
- CRVGTESFCCXCTH-UHFFFAOYSA-N
- Formula
- C5H13NO2
- SMILES
- CN(CCO)CCO
- Molecular Weight1
- 119.16
- CAS
- 105-59-9
- Other Names
-
- 2,2'-(Methylimino)diethanol
- 2,2'-(methylazanediyl)bis(ethan-1-ol)
- 2,2'-methyliminodiethanol
- 2-(N-2-Hydroxyethyl-N-methylamino)ethanol
- Bis(2-hydroxyethyl)methylamine
- Diethanolmethylamine
- Ethanol, 2,2'-(methylimino)bis-
- Ethanol, 2,2'-(methylimino)di-
- Eve
- MDEA
- MDEA (diol)
- Methyl diethanolamine
- Methylbis(2-hydroxyethyl)amine
- Methyliminodiethanol
- N,N-Bis(2-hydroxyethyl)methylamine
- N,N-Di(2-hydroxyethyl)-N-methylamine
- N-(2-Hydroxyethyl)-N-methylethanolam
- N-Methyl-2,2'-iminodiethanol
- N-Methyl-2,2-iminodiethanol
- N-Methylaminodiglycol
- N-Methyldiethanolamine
- N-Methyldiethanolimine
- N-Methylimino-2,2'-diethanol
- N-Methyliminodiethanol
- NSC 11690
- USAF DO-52
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔfG° | -171.64 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -383.46 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 19.90 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 62.12 | kJ/mol | Joback Calculated Property |
| log10WS | 0.99 | Crippen Calculated Property | |
| logPoct/wat | -1.097 | Crippen Calculated Property | |
| McVol | 103.030 | ml/mol | McGowan Calculated Property |
| Pc | 4160.00 | kPa | Critica... |
| Tboil | [520.20; 520.45] | K |
|
| Tboil | 520.28 | K | Vapor L... |
| Tboil | 520.20 | K | NIST |
| Tboil | 520.45 | K | NIST |
| Tc | 667.49 | K | Joback Calculated Property |
| Tfus | [250.00; 252.15] | K |
|
| Tfus | 250.00 | K | Thermod... |
| Tfus | 252.15 | K | NIST |
| Vc | 0.371 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [244.80; 289.41] | J/mol×K | [510.60; 667.49] |
|
| Cp,gas | 244.80 | J/mol×K | 510.60 | Joback Calculated Property |
| Cp,gas | 253.06 | J/mol×K | 536.75 | Joback Calculated Property |
| Cp,gas | 260.98 | J/mol×K | 562.90 | Joback Calculated Property |
| Cp,gas | 268.56 | J/mol×K | 589.04 | Joback Calculated Property |
| Cp,gas | 275.81 | J/mol×K | 615.19 | Joback Calculated Property |
| Cp,gas | 282.76 | J/mol×K | 641.34 | Joback Calculated Property |
| Cp,gas | 289.41 | J/mol×K | 667.49 | Joback Calculated Property |
| Cp,liquid | [273.00; 304.00] | J/mol×K | [303.15; 353.15] |
|
| Cp,liquid | 273.00 | J/mol×K | 303.15 | Molar H... |
| Cp,liquid | 276.00 | J/mol×K | 308.15 | Molar H... |
| Cp,liquid | 279.00 | J/mol×K | 313.15 | Molar H... |
| Cp,liquid | 282.00 | J/mol×K | 318.15 | Molar H... |
| Cp,liquid | 285.00 | J/mol×K | 323.15 | Molar H... |
| Cp,liquid | 288.00 | J/mol×K | 328.15 | Molar H... |
| Cp,liquid | 290.00 | J/mol×K | 333.15 | Molar H... |
| Cp,liquid | 294.00 | J/mol×K | 338.15 | Molar H... |
| Cp,liquid | 298.00 | J/mol×K | 343.15 | Molar H... |
| Cp,liquid | 301.00 | J/mol×K | 348.15 | Molar H... |
| Cp,liquid | 304.00 | J/mol×K | 353.15 | Molar H... |
| η | [0.0041200; 0.1420200] | Pa×s | [288.00; 373.15] |
|
| η | 0.1420000 | Pa×s | 288.00 | Density... |
| η | 0.1420200 | Pa×s | 288.00 | Density... |
| η | 0.1420000 | Pa×s | 288.00 | Density... |
| η | 0.0731030 | Pa×s | 298.15 | Viscosi... |
| η | 0.0731000 | Pa×s | 298.15 | Viscosi... |
| η | 0.0558900 | Pa×s | 303.15 | Viscosi... |
| η | 0.0586210 | Pa×s | 303.15 | Density... |
| η | 0.0576900 | Pa×s | 303.15 | Density... |
| η | 0.0434500 | Pa×s | 308.15 | Viscosi... |
| η | 0.0347300 | Pa×s | 313.00 | Density... |
| η | 0.0347300 | Pa×s | 313.00 | Density... |
| η | 0.0347300 | Pa×s | 313.00 | Density... |
| η | 0.0347900 | Pa×s | 313.15 | Density... |
| η | 0.0376820 | Pa×s | 313.15 | Density... |
| η | 0.0341500 | Pa×s | 313.15 | Viscosi... |
| η | 0.0346170 | Pa×s | 313.15 | Viscosi... |
| η | 0.0271500 | Pa×s | 318.15 | Viscosi... |
| η | 0.0218800 | Pa×s | 323.15 | Density... |
| η | 0.0218200 | Pa×s | 323.15 | Viscosi... |
| η | 0.0177900 | Pa×s | 328.15 | Viscosi... |
| η | 0.0146600 | Pa×s | 333.00 | Density... |
| η | 0.0146600 | Pa×s | 333.00 | Density... |
| η | 0.0146600 | Pa×s | 333.00 | Density... |
| η | 0.0143770 | Pa×s | 333.15 | Viscosi... |
| η | 0.0146000 | Pa×s | 333.15 | Density... |
| η | 0.0152560 | Pa×s | 333.15 | Density... |
| η | 0.0146300 | Pa×s | 333.15 | Viscosi... |
| η | 0.0122000 | Pa×s | 338.15 | Viscosi... |
| η | 0.0102100 | Pa×s | 343.15 | Viscosi... |
| η | 0.0098550 | Pa×s | 343.15 | Density... |
| η | 0.0086000 | Pa×s | 348.15 | Viscosi... |
| η | 0.0086100 | Pa×s | 348.15 | Viscosi... |
| η | 0.0067560 | Pa×s | 353.15 | Density... |
| η | 0.0070820 | Pa×s | 353.15 | Viscosi... |
| η | 0.0073100 | Pa×s | 353.15 | Viscosi... |
| η | 0.0062900 | Pa×s | 358.15 | Viscosi... |
| η | 0.0062800 | Pa×s | 358.15 | Viscosi... |
| η | 0.0054300 | Pa×s | 363.15 | Viscosi... |
| η | 0.0052770 | Pa×s | 363.15 | Viscosi... |
| η | 0.0045390 | Pa×s | 363.15 | Density... |
| η | 0.0047200 | Pa×s | 368.15 | Viscosi... |
| η | 0.0041200 | Pa×s | 373.15 | Viscosi... |
| ΔvapH | [71.50; 73.00] | kJ/mol | [422.00; 455.00] |
|
| ΔvapH | 71.50 | kJ/mol | 422.00 | NIST |
| ΔvapH | 73.00 | kJ/mol | 455.00 | NIST |
| Pvap | [2.48; 101.30] | kPa | [409.69; 520.28] |
|
| Pvap | 2.48 | kPa | 409.69 | Ebullio... |
| Pvap | 2.98 | kPa | 413.43 | Ebullio... |
| Pvap | 3.48 | kPa | 416.72 | Ebullio... |
| Pvap | 4.48 | kPa | 421.96 | Ebullio... |
| Pvap | 5.48 | kPa | 426.65 | Ebullio... |
| Pvap | 6.48 | kPa | 430.48 | Ebullio... |
| Pvap | 7.98 | kPa | 435.50 | Ebullio... |
| Pvap | 20.00 | kPa | 467.34 | Vapor L... |
| Pvap | 20.00 | kPa | 467.40 | Vapor L... |
| Pvap | 30.00 | kPa | 479.37 | Vapor L... |
| Pvap | 30.00 | kPa | 479.40 | Vapor L... |
| Pvap | 40.00 | kPa | 488.14 | Vapor L... |
| Pvap | 40.00 | kPa | 488.17 | Vapor L... |
| Pvap | 101.30 | kPa | 520.28 | Vapor L... |
| n0 | [1.46008; 1.46840] | [293.15; 303.10] |
|
|
| n0 | 1.46840 | 293.15 | Experim... | |
| n0 | 1.46008 | 303.10 | Physica... | |
| ρl | [936.81; 1048.00] | kg/m3 | [283.15; 423.15] |
|
| ρl | 1048.00 | kg/m3 | 283.15 | Density... |
| ρl | 1047.53 | kg/m3 | 283.15 | Densiti... |
| ρl | 1044.50 | kg/m3 | 288.15 | Densiti... |
| ρl | 1046.36 | kg/m3 | 288.15 | Excess ... |
| ρl | 1041.60 | kg/m3 | 293.15 | Densiti... |
| ρl | 1041.12 | kg/m3 | 293.15 | Simulta... |
| ρl | 1040.50 | kg/m3 | 293.15 | Volumet... |
| ρl | 1039.90 | kg/m3 | 293.15 | Densiti... |
| ρl | 1040.06 | kg/m3 | 293.15 | Volumet... |
| ρl | 1040.31 | kg/m3 | 293.15 | Prepara... |
| ρl | 1040.60 | kg/m3 | 293.15 | Volumet... |
| ρl | 1037.70 | kg/m3 | 293.15 | Experim... |
| ρl | 1040.60 | kg/m3 | 293.15 | Volumet... |
| ρl | 1036.70 | kg/m3 | 298.00 | Measure... |
| ρl | 1037.86 | kg/m3 | 298.15 | Densiti... |
| ρl | 1036.80 | kg/m3 | 298.15 | Density... |
| ρl | 1038.22 | kg/m3 | 298.15 | Density... |
| ρl | 1036.81 | kg/m3 | 298.15 | Excess ... |
| ρl | 1036.42 | kg/m3 | 298.15 | Prepara... |
| ρl | 1037.00 | kg/m3 | 298.15 | Study o... |
| ρl | 1036.40 | kg/m3 | 298.15 | Experim... |
| ρl | 1036.83 | kg/m3 | 298.15 | Densiti... |
| ρl | 1034.10 | kg/m3 | 303.14 | Densiti... |
| ρl | 1033.02 | kg/m3 | 303.15 | Volumet... |
| ρl | 1032.55 | kg/m3 | 303.15 | Prepara... |
| ρl | 1032.47 | kg/m3 | 303.15 | Volumet... |
| ρl | 1032.40 | kg/m3 | 303.15 | Densiti... |
| ρl | 1032.80 | kg/m3 | 303.15 | Volumet... |
| ρl | 1034.49 | kg/m3 | 303.15 | Density... |
| ρl | 1033.80 | kg/m3 | 303.15 | Density... |
| ρl | 1033.06 | kg/m3 | 303.15 | Densiti... |
| ρl | 1033.60 | kg/m3 | 303.15 | Simulta... |
| ρl | 1032.60 | kg/m3 | 303.15 | Volumet... |
| ρl | 1029.40 | kg/m3 | 308.00 | Measure... |
| ρl | 1030.32 | kg/m3 | 308.14 | Densiti... |
| ρl | 1030.75 | kg/m3 | 308.15 | Density... |
| ρl | 1029.26 | kg/m3 | 308.15 | Densiti... |
| ρl | 1028.70 | kg/m3 | 308.15 | Prepara... |
| ρl | 1026.52 | kg/m3 | 313.15 | Densiti... |
| ρl | 1025.40 | kg/m3 | 313.15 | Volumet... |
| ρl | 1025.30 | kg/m3 | 313.15 | Density... |
| ρl | 1024.76 | kg/m3 | 313.15 | Volumet... |
| ρl | 1025.40 | kg/m3 | 313.15 | Volumet... |
| ρl | 1025.14 | kg/m3 | 313.15 | Prepara... |
| ρl | 1025.83 | kg/m3 | 313.15 | Simulta... |
| ρl | 1026.70 | kg/m3 | 313.15 | Density... |
| ρl | 1025.45 | kg/m3 | 313.15 | Densiti... |
| ρl | 1025.00 | kg/m3 | 313.15 | Density... |
| ρl | 1024.90 | kg/m3 | 313.15 | Densiti... |
| ρl | 1024.86 | kg/m3 | 313.15 | Volumet... |
| ρl | 1026.99 | kg/m3 | 313.15 | Density... |
| ρl | 1025.10 | kg/m3 | 313.15 | Experim... |
| ρl | 1026.70 | kg/m3 | 313.20 | Low pre... |
| ρl | 1023.25 | kg/m3 | 318.15 | Density... |
| ρl | 1022.70 | kg/m3 | 318.15 | Densiti... |
| ρl | 1021.62 | kg/m3 | 318.15 | Densiti... |
| ρl | 1021.34 | kg/m3 | 318.15 | Prepara... |
| ρl | 1018.50 | kg/m3 | 323.00 | Measure... |
| ρl | 1018.88 | kg/m3 | 323.14 | Densiti... |
| ρl | 1017.74 | kg/m3 | 323.15 | Volumet... |
| ρl | 1017.78 | kg/m3 | 323.15 | Densiti... |
| ρl | 1017.21 | kg/m3 | 323.15 | Volumet... |
| ρl | 1017.40 | kg/m3 | 323.15 | Density... |
| ρl | 1017.70 | kg/m3 | 323.15 | Density... |
| ρl | 1017.55 | kg/m3 | 323.15 | Prepara... |
| ρl | 1017.20 | kg/m3 | 323.15 | Densiti... |
| ρl | 1017.50 | kg/m3 | 323.15 | Experim... |
| ρl | 1018.90 | kg/m3 | 323.15 | Density... |
| ρl | 1019.47 | kg/m3 | 323.15 | Density... |
| ρl | 1017.80 | kg/m3 | 323.15 | Simulta... |
| ρl | 1017.12 | kg/m3 | 323.15 | Volumet... |
| ρl | 1017.80 | kg/m3 | 323.15 | Volumet... |
| ρl | 1018.90 | kg/m3 | 323.20 | Low pre... |
| ρl | 1015.02 | kg/m3 | 328.14 | Densiti... |
| ρl | 1013.89 | kg/m3 | 328.15 | Prepara... |
| ρl | 1015.64 | kg/m3 | 328.15 | Density... |
| ρl | 1011.43 | kg/m3 | 333.14 | Densiti... |
| ρl | 1010.03 | kg/m3 | 333.15 | Volumet... |
| ρl | 1009.50 | kg/m3 | 333.15 | Densiti... |
| ρl | 1010.07 | kg/m3 | 333.15 | Prepara... |
| ρl | 1009.60 | kg/m3 | 333.15 | Density... |
| ρl | 1011.80 | kg/m3 | 333.15 | Density... |
| ρl | 1009.51 | kg/m3 | 333.15 | Volumet... |
| ρl | 1010.00 | kg/m3 | 333.15 | Density... |
| ρl | 1010.00 | kg/m3 | 333.15 | Volumet... |
| ρl | 1009.90 | kg/m3 | 333.15 | Experim... |
| ρl | 1010.80 | kg/m3 | 333.15 | Simulta... |
| ρl | 1007.25 | kg/m3 | 338.14 | Densiti... |
| ρl | 1006.37 | kg/m3 | 338.15 | Prepara... |
| ρl | 1007.92 | kg/m3 | 338.15 | Density... |
| ρl | 1002.25 | kg/m3 | 343.15 | Volumet... |
| ρl | 1003.32 | kg/m3 | 343.15 | Densiti... |
| ρl | 1002.30 | kg/m3 | 343.15 | Volumet... |
| ρl | 1001.70 | kg/m3 | 343.15 | Densiti... |
| ρl | 1002.20 | kg/m3 | 343.15 | Experim... |
| ρl | 1001.73 | kg/m3 | 343.15 | Volumet... |
| ρl | 1002.76 | kg/m3 | 343.15 | Simulta... |
| ρl | 1002.33 | kg/m3 | 343.15 | Prepara... |
| ρl | 1002.20 | kg/m3 | 343.15 | Density... |
| ρl | 999.38 | kg/m3 | 348.15 | Densiti... |
| ρl | 998.62 | kg/m3 | 348.15 | Prepara... |
| ρl | 994.40 | kg/m3 | 353.14 | Volumet... |
| ρl | 995.41 | kg/m3 | 353.14 | Densiti... |
| ρl | 994.01 | kg/m3 | 353.15 | Excess ... |
| ρl | 994.50 | kg/m3 | 353.15 | Density... |
| ρl | 995.05 | kg/m3 | 353.15 | Prepara... |
| ρl | 993.90 | kg/m3 | 353.15 | Densiti... |
| ρl | 993.89 | kg/m3 | 353.15 | Volumet... |
| ρl | 991.41 | kg/m3 | 358.15 | Densiti... |
| ρl | 987.39 | kg/m3 | 363.15 | Densiti... |
| ρl | 986.47 | kg/m3 | 363.15 | Volumet... |
| ρl | 986.00 | kg/m3 | 363.15 | Densiti... |
| ρl | 985.96 | kg/m3 | 363.15 | Volumet... |
| ρl | 978.28 | kg/m3 | 373.15 | Densiti... |
| ρl | 970.22 | kg/m3 | 383.15 | Densiti... |
| ρl | 962.03 | kg/m3 | 393.15 | Densiti... |
| ρl | 953.71 | kg/m3 | 403.15 | Densiti... |
| ρl | 945.29 | kg/m3 | 413.15 | Densiti... |
| ρl | 936.81 | kg/m3 | 423.15 | Densiti... |
| csound,fluid | [1490.40; 1598.80] | m/s | [288.15; 323.15] |
|
| csound,fluid | 1598.80 | m/s | 288.15 | Density... |
| csound,fluid | 1585.48 | m/s | 293.15 | Density... |
| csound,fluid | 1583.10 | m/s | 293.15 | Density... |
| csound,fluid | 1570.13 | m/s | 298.15 | Density... |
| csound,fluid | 1564.10 | m/s | 298.15 | Density... |
| csound,fluid | 1554.81 | m/s | 303.15 | Density... |
| csound,fluid | 1546.00 | m/s | 303.15 | Density... |
| csound,fluid | 1539.47 | m/s | 308.15 | Density... |
| csound,fluid | 1531.00 | m/s | 308.15 | Density... |
| csound,fluid | 1516.10 | m/s | 313.15 | Density... |
| csound,fluid | 1524.19 | m/s | 313.15 | Density... |
| csound,fluid | 1503.20 | m/s | 318.15 | Density... |
| csound,fluid | 1508.79 | m/s | 318.15 | Density... |
| csound,fluid | 1490.40 | m/s | 323.15 | Density... |
| csound,fluid | 1493.40 | m/s | 323.15 | Density... |
| γ | [0.04; 0.04] | N/m | [288.15; 333.15] |
|
| γ | 0.04 | N/m | 288.15 | Surface... |
| γ | 0.04 | N/m | 293.15 | Surface... |
| γ | 0.04 | N/m | 298.15 | Surface... |
| γ | 0.04 | N/m | 303.15 | Surface... |
| γ | 0.04 | N/m | 303.15 | Viscosi... |
| γ | 0.04 | N/m | 308.15 | Surface... |
| γ | 0.04 | N/m | 313.15 | Surface... |
| γ | 0.04 | N/m | 313.15 | Viscosi... |
| γ | 0.04 | N/m | 323.15 | Viscosi... |
| γ | 0.04 | N/m | 333.15 | Viscosi... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 100.00 | 298.15 | 1036.0 |
| 100.00 | 303.15 | 1032.4 |
| 100.00 | 308.15 | 1028.6 |
| 100.00 | 313.15 | 1024.8 |
| 100.00 | 318.15 | 1021.0 |
| 100.00 | 323.15 | 1017.2 |
| 100.00 | 328.15 | 1013.3 |
| 100.00 | 333.15 | 1009.4 |
| 100.00 | 338.15 | 1005.6 |
| 100.00 | 343.15 | 1001.7 |
| 100.00 | 348.15 | 997.7 |
| 100.00 | 353.15 | 993.8 |
| 100.00 | 358.15 | 989.9 |
| 100.00 | 363.15 | 985.9 |
| 700.00 | 373.15 | 978.6 |
| 700.00 | 383.15 | 970.3 |
| 700.00 | 393.15 | 962.1 |
| 700.00 | 403.15 | 953.9 |
| 700.00 | 413.15 | 945.6 |
| 700.00 | 423.15 | 937.0 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 313.09 | 1007.00 | 1025.3 |
| 313.09 | 1989.00 | 1025.8 |
| 313.09 | 3027.00 | 1026.4 |
| 313.09 | 4003.00 | 1026.9 |
| 313.09 | 5004.00 | 1027.3 |
| 313.09 | 6004.00 | 1027.8 |
| 313.09 | 6996.00 | 1028.3 |
| 313.09 | 8006.00 | 1028.8 |
| 313.09 | 9066.00 | 1029.4 |
| 313.09 | 10021.00 | 1029.8 |
| 313.09 | 11008.00 | 1030.3 |
| 313.09 | 11995.00 | 1030.8 |
| 313.09 | 13024.00 | 1031.3 |
| 313.09 | 13984.00 | 1031.7 |
| 313.09 | 14994.00 | 1032.2 |
| 313.09 | 15992.00 | 1032.7 |
| 313.09 | 16977.00 | 1033.1 |
| 313.09 | 17994.00 | 1033.6 |
| 313.09 | 19000.00 | 1034.0 |
| 313.09 | 19985.00 | 1034.5 |
| 323.01 | 1003.00 | 1017.6 |
| 323.01 | 2020.00 | 1018.2 |
| 323.01 | 3006.00 | 1018.7 |
| 323.01 | 4031.00 | 1019.2 |
| 323.01 | 5002.00 | 1019.7 |
| 323.01 | 6020.00 | 1020.2 |
| 323.01 | 7003.00 | 1020.7 |
| 323.01 | 8000.00 | 1021.2 |
| 323.01 | 9006.00 | 1021.7 |
| 323.01 | 9991.00 | 1022.2 |
| 323.01 | 11005.00 | 1022.7 |
| 323.01 | 12000.00 | 1023.2 |
| 323.01 | 13010.00 | 1023.7 |
| 323.01 | 14000.00 | 1024.2 |
| 323.01 | 14987.00 | 1024.7 |
| 323.01 | 15987.00 | 1025.2 |
| 323.01 | 17012.00 | 1025.6 |
| 323.01 | 17991.00 | 1026.1 |
| 323.01 | 18995.00 | 1026.6 |
| 323.01 | 20012.00 | 1027.1 |
| 332.95 | 1045.00 | 1009.9 |
| 332.95 | 2032.00 | 1010.5 |
| 332.95 | 2995.00 | 1011.0 |
| 332.95 | 3991.00 | 1011.6 |
| 332.95 | 4983.00 | 1012.1 |
| 332.95 | 6016.00 | 1012.6 |
| 332.95 | 6998.00 | 1013.2 |
| 332.95 | 8009.00 | 1013.7 |
| 332.95 | 8993.00 | 1014.2 |
| 332.95 | 9991.00 | 1014.7 |
| 332.95 | 10985.00 | 1015.3 |
| 332.95 | 12014.00 | 1015.8 |
| 332.95 | 13079.00 | 1016.3 |
| 332.95 | 13992.00 | 1016.8 |
| 332.95 | 14999.00 | 1017.3 |
| 332.95 | 15997.00 | 1017.8 |
| 332.95 | 16989.00 | 1018.3 |
| 332.95 | 17997.00 | 1018.8 |
| 332.95 | 19011.00 | 1019.3 |
| 332.95 | 19963.00 | 1019.7 |
| 342.78 | 1004.00 | 1002.0 |
| 342.78 | 1998.00 | 1002.6 |
| 342.78 | 3050.00 | 1003.2 |
| 342.78 | 4015.00 | 1003.7 |
| 342.78 | 4998.00 | 1004.3 |
| 342.78 | 6020.00 | 1004.9 |
| 342.78 | 7011.00 | 1005.4 |
| 342.78 | 8034.00 | 1006.0 |
| 342.78 | 9001.00 | 1006.5 |
| 342.78 | 10000.00 | 1007.1 |
| 342.78 | 11000.00 | 1007.6 |
| 342.78 | 12012.00 | 1008.2 |
| 342.78 | 12947.00 | 1008.7 |
| 342.78 | 13991.00 | 1009.2 |
| 342.78 | 15001.00 | 1009.8 |
| 342.78 | 15987.00 | 1010.3 |
| 342.78 | 16998.00 | 1010.8 |
| 342.78 | 18005.00 | 1011.3 |
| 342.78 | 18981.00 | 1011.9 |
| 342.78 | 19980.00 | 1012.4 |
| 352.68 | 1013.00 | 994.4 |
| 352.68 | 2013.00 | 995.0 |
| 352.68 | 3004.00 | 995.6 |
| 352.68 | 3999.00 | 996.1 |
| 352.68 | 5003.00 | 996.8 |
| 352.68 | 6019.00 | 997.3 |
| 352.68 | 7005.00 | 997.8 |
| 352.68 | 8001.00 | 998.4 |
| 352.68 | 8984.00 | 999.0 |
| 352.68 | 9981.00 | 999.5 |
| 352.68 | 11029.00 | 1000.2 |
| 352.68 | 11980.00 | 1000.7 |
| 352.68 | 13051.00 | 1001.3 |
| 352.68 | 14000.00 | 1001.8 |
| 352.68 | 14988.00 | 1002.4 |
| 352.68 | 16018.00 | 1002.9 |
| 352.68 | 16978.00 | 1003.4 |
| 352.68 | 17977.00 | 1004.0 |
| 352.68 | 19003.00 | 1004.5 |
| 352.68 | 19990.00 | 1005.1 |
| 362.52 | 1005.00 | 986.7 |
| 362.52 | 2045.00 | 987.3 |
| 362.52 | 2982.00 | 987.8 |
| 362.52 | 4026.00 | 988.4 |
| 362.52 | 5007.00 | 988.9 |
| 362.52 | 6014.00 | 989.5 |
| 362.52 | 7015.00 | 990.2 |
| 362.52 | 7998.00 | 990.8 |
| 362.52 | 9003.00 | 991.3 |
| 362.52 | 9986.00 | 991.9 |
| 362.52 | 10996.00 | 992.5 |
| 362.52 | 12008.00 | 993.1 |
| 362.52 | 13004.00 | 993.7 |
| 362.52 | 13985.00 | 994.2 |
| 362.52 | 15010.00 | 994.8 |
| 362.52 | 15983.00 | 995.4 |
| 362.52 | 17007.00 | 995.7 |
| 362.52 | 17985.00 | 996.3 |
| 362.52 | 18994.00 | 996.9 |
| 362.52 | 19994.00 | 997.4 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.08e-08; 3214.74] | kPa | [252.15; 678.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.72666e+02 | |||
| Coefficient B | -1.85482e+04 | |||
| Coefficient C | -2.12756e+01 | |||
| Coefficient D | 3.18819e-06 | |||
| Temperature range, min. | 252.15 | |||
| Temperature range, max. | 678.00 | |||
| Pvap | 1.08e-08 | kPa | 252.15 | Calculated Property |
| Pvap | 3.37e-05 | kPa | 299.47 | Calculated Property |
| Pvap | 7.66e-03 | kPa | 346.78 | Calculated Property |
| Pvap | 0.35 | kPa | 394.10 | Calculated Property |
| Pvap | 5.47 | kPa | 441.42 | Calculated Property |
| Pvap | 42.15 | kPa | 488.73 | Calculated Property |
| Pvap | 196.32 | kPa | 536.05 | Calculated Property |
| Pvap | 636.16 | kPa | 583.37 | Calculated Property |
| Pvap | 1579.35 | kPa | 630.68 | Calculated Property |
| Pvap | 3214.74 | kPa | 678.00 | Calculated Property |
Similar Compounds
![Ethanol, 2,2'-[(1-methylethyl)imino]bis-.](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAPoAAAD6CAIAAAAHjs1qAAAZYElEQVR4nO3de1xUZf4H8A83RRHjIoohlqHDyJCwctHlomVIGema5mUVTbxgm4oDsiaJJsZKJOtamm7WmlTbaqtl5lppbWhe1wuYICCYhXIRuchwHeZyfn8Mq2s/rjNnzjMz5/t++Y9yXuf5yuvDl+ecOed5rDiOAyHiYM26AEKEQ3EnIkJxJyJCcSciQnEnIkJxJyJCcSciQnEnIkJxJyJCcSciQnEnIkJxJyJCcSciYsu6ACJ6HIfSUlRXo1cvuLvD2fnXB2i1UKthZQU7u/bPoNFAo4GNDWxsOh+Kujth55dfsHQpBg+Gpyf8/eHjA1dX+Pvj7behVN4/7KOP0Ls3vLw6PM+SJejdGwsWdDkgdXfCyOHDmDULTU2wsoK/P4YORWsrcnJw+TJWrsSePThyBO7u/I5J3Z2wcPEipk9HUxMmTEBhIbKz8cUX+OorlJbi00/h7IzsbEyeDJWK32Ep7oSF2Fi0tiIkBF99hREj7v+7tTVmzMDXX8PODhcuYPt2foeluBPBnT6NS5cAYOtW9OrVzgHBwVi0CADFnZi/Y8cAwMsLQUEdHhMdDQA//YTr13kcmeJOBJeTAwCjR3d2zG9+A2trAMjO5nFkujNDBFdVBQCDBnV2TN++cHREXR2qq2FvDwC3bsHBof2DW1u7OTLFnQhOl86OPjO6p3dvAFAq2+JuZYU+fdo/UqOBWt2dkSnuRHAPPQQA9fVdHKZQAICTE3RLIXl4oKSk/SMXLsQHH3RnZJq7E8ENHQoAxcWdHVNSgpYWAHj0UR5HprgTwY0dCwDnz6OxscNjsrIAwM4OAQE8jkxxJ4KbOhX29mhsxJ497R+g1bbdcZ8ypcPLU71Q3IngBgxAbCwArF3b9nnTr7z2Gs6fh60t1qzhd2SKO2EhLQ1+fqirw7hxWLcOly+joQGVlTh6FJMnIzUVAFJSEBjI77B0Z4aw0LcvsrKwYAG++AKpqW35vqdfP7zxBpYt431YijthxMkJBw/i9Gl8/jkuXMCdO7C3h4cHnngCc+Y88CGURIIlS+Dq2uGpxo+HrW3bFXCnrGh9dyIeNHcngjt+HJ99xmRk6u5EWCoV/PyQn4+//x1z5gg8OHV3Iqzt25Gfj+HDMX268INTdycCqqnBiBGoqcHhw4iKEn586u5EQGvXoqYGERFMsg7q7kQ4eXnw9weA7Gz4+jIpgbo7EUp8PNRqLF/OKuug7k4Esn8/ZsyAiwuuXevsAyMjo+5OjE+pRFISAPzpTwyzDoo7EUJGBoqLIZNh8WK2hdBkhhhZaSmkUjQ04OhRTJzIthbq7sTIkpLQ0IDp05lnHdTdiXGdPYuQEPTqhdxcDB/Ouhrq7sR4OA5yOTgOiYmmkHVQdydGlJmJBQvg7o7CQvTvz7oagOJOjKWhAd7eKCvDhx9i3jzW1bShyQwxjrQ0lJUhIABz57Iu5T7q7sQIbtyAjw+USpw5gzFjWFdzH3V3YgSJiWhpwbx5JpV1UHcn/Pv+e0yYgH79UFiIhx9mXc0DqLsTPmk0mgu7drWtiGRiWQfFnfDrvffeC9q79+XQUKxaxbqWdtBkhvCmtrZWIpFUVVUdOHBg2rRprMtpB3V3wpuUlJSqqqonn3zSNLMO6u6EL/n5+X5+flqt9uLFi35+fqzLaR91d8KPhIQElUoVGxtrslkHdXfCi8OHD0+ePNnZ2fnatWsDBgxgXU6HqLsTQ7W2tiYmJgJ47bXXTDnroLgTw7399tuFhYVSqfTll19mXUsXaDJDDFJZWSmRSOrq6o4cOTJp0iTW5XSBujsxyNq1a+vq6p577jnTzzqouxND5OTkBAYGWltbX7lyxdvbm3U5XaPuTvQnl8s1Gk1cXJxZZB3U3Yne9u3bN3v27IEDBxYWFjo5ObEup1uouxN9NDc3r1mzBkBqaqq5ZB0Ud6KfzZs3//zzz/7+/gsXLmRdSw/QZIb0WGlpqbe3d2NjY1ZW1vjx41mX0wPU3UmPrV69urGxcebMmeaVdVB3Jz115syZ0NBQe3v7q1evPvroo6zL6Rnq7qQHtFqtXC7nOO6Pf/yj2WUd3enu5eXldXV1UqlUmIJEpbS09OTJky+++CLrQrqL4zgrKys3N7eCggIHBwfW5fQc16msrCxHR8cxY8ZotdrOjyR6mD17tp2dHesI9ExSUtKpU6dYf+f01EV3b2ho8Pb2Lisry8zMnD9/vmDfUzE4ffp0WFiYvb19Tk7O0KFDWZfTXXZ2djY2Nqyr0FeXPxCZmZkABg0aVFdXZ/wfP7HQaDSBgYEANmzYwLoWEek67lqtNjQ0FMCrr74qQEEisWvXLgBDhgxpaGhgXYuIdOtG5MWLF4ODg+3s7HJzc4ebxkLdZq2+vl4ikVRUVOzdu3fWrFmsyxGRbt2IDAgImDt3rlKp1D0mQQy0cePGioqKkJCQmTNnsq5FXLr7MVNFRYW3t7dCoTh69OhEE9hkx3xdv35dJpOpVKqzZ88GBQWxLkdcuvsxk7u7++rVqwHEx8er1WpjlmTh5HK5UqlcuHAhZZ2B7k/zW1padBP3nTt3GutSwtIdO3YMgKOjY1lZGetaxKgHcec4bv/+/QBcXFyqqqqMVJAFU6lUvr6+ADZv3sy6FpHqWdw5jtNN3HUPTpAe2bp1KwAvL6+WlhbWtYhUj5+IzMvL8/f3B5Cdna3rVaQ7ampqJBJJdXX1oUOHJk+ezLockerxE5EymWzx4sVqtTo+Pt4YBVmq5OTk6urqp556irLOkD7Pu99rVIcPH46KijJGWRaGfiWaCH2ed3dxcUlOTsZ/76nxXZIF0t29XbZsGWWdMf2m/CqVSiaTAcjIyODzUsISHThwAHQ7yzToGXfuf24hl5eX81iQhVEqlSNGjADwzjvvsK6FcPq/vBcREREVFVVfX79+/XqeftNYoIyMjKKiIh8fn9jYWNa1EMNezS4uLvb19VWpVOfOndM9vU3+1+3btyUSiUKh+OabbyIjI1mXQwx7NXv48OHLli2797ouXzVZjOTkDQqFYurUqZR1U2HgZKiurs7d3R3Avn37eJhbWZBz5zhX1ztPPrmsuLiYdS2kjaELb/Tv3z8lJQVAYmJiU1MTDz9/FoHjsGoVqqsHjB273cvLi3U5pA0P68wsXrw4MDDw5s2bGRkZhp/NMnz8MU6exKBBoPdhTAo/q4idOnUqPDzc3t6+oKDAjF6qN5KmJowciZIS7NkD81lCRhT4WUUsNDT0hRdeaG5ufvXVV3k5oVnbtAklJQgIwLx5rEshD+JtjcibN29KpdLm5ubjx4+Hh4fzck5zdPMmpFI0N+PECYSFsa6GPIi3NSI9PT1XrVrFcZxcLtdqtXyd1uwkJKCpCXPnUtZNEZ8rADc3N0ul0pKSkt27d8fExPB1WjNy8iTGjUOfPsjPh+gvYUwRnysA9+nTZ9OmTQCSkpIUCgWPZzYLWi3kcnAckpIo6yaK5wWv58yZExYWdvv27bS0NH7PbPreew8XL8LTEwkJrEshHeB/O4NLly4FBQXZ2trm5ubqHgYUA4UC3t6oqMCnn2LGDNbVkA7wv53B6NGj58+f39raqluXRiQ2bEBFBUJD8cILrEshHTPKZjX3ngT8+uuvn376ad7Pb2qKiyGTQa3Gf/6DgADW1ZCOGWWzmkGDBiUlJQFISEgQw5JjcXFobcWSJZR1U2esrchaW1t9fX2Lioq2b9++bNkyYwxhIo4dQ2Qk+vdHYSHc3VlXQzplrK3IevXqlZ6eDmDdunXV1dVGGoU5lQorVgDAa69R1s2AEXfee/755yMjI2tra3VPCFukbdtQWIjhw2HRv8Ash3H3Vb169aqfnx/HcdnZ2Y8//rjxBmLizh1IJLh7F//6F559lnU1pBuMu6+qj4/P0qVLNRqNXC436kBMJCfj7l1MnEhZNxtG3zW7trZ2xIgR1dXVX3zxxZQpU4w6lpAuX0ZAAKyskJMDmYx1NaR7jL5rtrOzs25ljoSEBEtacszBARMnYvlyyro5MXp3B6BWq0ePHn3lypX09HQL+6hVrYatLesiSLcJEXcA3333XUREhKOjY2Fh4eDBgwUY0UA7dqC+Hg89hJdeauerp0/jhx8wbBhoKzEzI9iaB7qJ+8KFCwUb0RCenhzAAdyBA+189fXXOYB7+mnByyKGMfrc/Z4tW7b07t17z54958+fF2xQwy1fjro61kUQnggXdy8vr7i4OK1Wu3LlSs5Mlhxzc0N5OTZsYF0H4YlwcQewbt26wYMHnzlzZu/evUKOq7fkZNjaYts2XLrEuhTCB0Hj7ujo+PrrrwNYvXp1Y2OjkEPrRyrFwoXQaPDSSxDx6+aWQ9C4A4iJiQkKCrp169bmzZsFHlo/aWlwdcX589i5k3UpxGBC3zS2trZ+6623QkND33zzzYiICA8PD8PPaWVlzXGPGH4enSFDYGd3/68uLli/HitXYu1aTJsGc7iJSjrG5H5QZGRk3759+fov9Ov3sO6mIS9/fvyR4/57I/KbbziO49Rqzt+fA7jZs9vqpxuRZorBR4Jarfb27dtNTU1ubm4ODg6Gn9DBYRCPFwK9ev36X2xs8M47CAvD3r1YtAgREbyNRQTGIO4ffPDB5cuXhwwZUlBQwEvcBRASgpgY7N6NuDhcvsy6GqIvoS9V6+vr161bB+DNN980l6zrpKfD1RX5+Xj3XdalEH0JHffU1NTy8vLf/va3s2fPFnhoAw0YgE2bAGD9etTWsq6G6EXQuF+/fv2tt96ytrbeunWrlZWVkEPzYvFijBmD2lrs3s26FKIXQeOue+R9wYIFwcHBQo7LF2tr7NgBGxvcvcu6FKIX4eL+3XffHTp0yNHRMTU1VbBBeTd6dPuPBBOzIFDcNRpNfHw8gOTkZLN43r0TmzbRh03mSqDXO7Zt2xYXF/fYY49dvXq1d+/eAoxooCtX0NqKESPQv387X/3lF1RVoX9/iGbJVwshRNzvvZ198ODB3/3ud8YeTjB1dWhoAB+PQRCBCDGZ0S0kNmHCBEvK+okTkEgQG8u6DtITRu/ulrqyEq2pZI6M3t3j4+PVavXLL79sSVkH4OaGdesAYOVKtLayroZ0j3G7+8GDB59//nlnZ+eioiJXV1fjDcSESoXHH0dhIbZsQXw862pINxixu9/bwGPjxo2Wl3UAdnb485+B/27dQUyfEeO+ZcuWoqIi3TKRxhuFragoTJoEhYJe3zYPxprMiGe/moICjBoFjYZ2qjEDxurua9asUSgUU6dOteysA5BKsWzZ/U1ViSkzSncX216Td+9CIsGdO/jnP2nnPZPGf3fnOE4ul2u12vj4eDFkHYCTEzZuBICEBDQ1sa6GdIz/uH/yySc//PDDvc33RCI2FgEBuHkTW7awLoV0jOfJTHNzs1QqLSkp2b17d0xMDI9nNn0nT2LcOPTpg/x8DB3KuhrSHp67e1paWklJyejRo1988UV+z2z6wsIwbRqampCczLoU0gE+u/vNmzelUmlzc/Px48fDw8P5Oq0ZKSnByJFobsaJEwgLY10N+X/47O6JiYlNTU2///3vxZl1AEOHIj4eHAe5nNaUNEW8dfdTp06Fh4fb29vn5+c/8ghvS9iZnaYmjByJkhLs2QPxTehMHT/dXavVyuVyjuPWrFkj5qwD6NsXundxX3kFCgXrasiD+In7+++/f+HCBU9Pz8TERF5OaNaioxEaitu3kZ7OuhTyIB4mM/X19RKJpKKiYt++fTNpby4AwMWLCA6GrS1yc+l9VhPCQ3dPSUmpqKgICQmZMWOG4WezDAEBiI5GayuSkuiK1YQY2t2Li4t9fX1VKtW5c+cCAwP5KssClJVhxox/V1bGvfvu2xMmTGBdDgEM7+5yuVypVC5atIiy/isPP4yoqLPFxXkrVqxQq9WsyyEADNvO4NixYwAcHR3Ly8sNOY+lUiqVw4cPB7Bjxw7WtRCO4zj9465SqWQyGYCMjAweC7Iw+/fvB+Di4lJVVcW6FmJA3P/yl78A8PLyamlp4bEgyzNx4kQAut1kCVt6XqrW1NRIJJLq6uovv/zyueee43FyZXny8vL8/f0BZGdn+/r6si5H1PS8VF27dm11dXVERARlvUsymWzJkiVqtVoul7OuRez06e7UrnqKfhmaCH26u25hsOXLl1PWu8nFxUW3I5Xuvi3rckSsp5N9utWgH5VKpesOmzdvZl2LePUs7i0tLbobyTt37jRSQRbs3scUZWVlrGsRqZ5NZjIyMoqLi2Uy2eLFi43wm8bC6a7s6+vr169fz7oWkerBpWpFRYW3t7dCoTh69KjuXjLpqevXr8tkMpVKdfbs2aCgINbliE4Puvvq1asVCsX06dMp63rz8vJasWLFvbdhWJcjOt3t7hcvXgwODrazs8vNzdVN34l+7r0esHfv3lmzZrEuR1y61d05jlu5cqVWq121ahVl3UCOjo4bN24EkJiY2NjYyLockenO9WxmZiaAQYMG1dXVGfO6WSw0Go3ueekNGzawrkVcup7MNDQ0eHt7l5WVZWZmzp8/X4gfQRE4ffp0WFgYLdwgsK4nM2lpaWVlZQEBAdHR0QIUJBIhISEzZ85sbm4W1UqazHXR3W/cuOHj46NUKk+cOBFG62Lx6tatW1KptLGxMT09XffmgFmQSqVeXl6sq9BX53OdvLy8sWPHRkdHCzGxEp/169eb3UwmOjp6+/btrL9zeup67s5xXFNTk4ODgzDfTVFpaWkpKipas2YN60K6q76+/uTJk+Z7ySHEJvHEksydO/eTTz6ZOXPmvn37WNfSYxR30jOlpaXe3t6NjY1ZWVnjx49nXU7PGH3XbGJhPDw8dNvlyuVyjUbDupyeoe5Oeqy5udnHx+fnn3/etWvXkiVLWJfTAxR3oo99+/bNnj174MCBhYWFTk5OrMvpLprMEH3MmjVr/PjxlZWVqbrlvc0EdXeip5ycnMDAQBsbmx9//NHb25t1Od1C3Z3oyd/fPyYmprW11YwW9afuTvRXWVkpkUjq6uqOHDkyadIk1uV0jbo70d/AgQOTk5MBJCQkqFQq1uV0jeJODBIXFyeRSAoKCnbs2MG6lq7RZIYY6ssvv5wyZYqzs/O1a9cGDBjAupzOUHcnhpo8efIzzzxTW1tr+guKUHcnPMjPz/fz89NqtZcuXRo1ahTrcjpE3Z3wYOTIkX/4wx80Go2Jr3JM3Z3wo7a2ViKRVFVVHThwYNq0aazLaR91d8IPZ2fnlJQUAImJiS0tLazLaR/FnfBm6dKlo0aNunHjhm4jIxNEcSe8sbGx0QW99tAhlJezLqcdNHcnPPtpxYrHtm/H/PnIzGRdy69R3AnffvoJMhmUSpw5gzFjWFfzAJrMEL499hji48FxkMthYs2UujsxgoYGeHujrAwffoh581hXcx91d2IE/fph0yYASEpCQwPrau6juBPjmD8fwcEoLUV6OutS7qPJDDGas2cREoJevZCbC9PYFoC6OzGasWMxdy6USpjMKsfU3YkxlZZCKkVDA44ehQls6UXdnRiThwdeeQUA4uOhVrOuhuJOjC0xEcOGIS8Pf/sb61JoMkMEsH8/ZsyAiwuKiuDiwrAQ6u7E+F54AU88gZoasF5yjLo7EUReHvz9ASAnB+x25qHuTgQhk2HRIqjVYPp2H3V3IpSaGowYgZoaHD6MqCgmJVB3J0JxcUFyMgDI5VAqmZRAcScCWrECMhmKi/HOO0zGp8kMEdaxY4iMRP/+KCyEu7vAg1N3J8KaOBHPPguFAn/9q/CDU3cngissRFYWFi+GjY3AI1PciYjYsi6AiNvx4/j8c1y6hOpq9OoFDw+Eh2POHHh6PnDMtm1wc8POne2fZMcO/PvfGD8eK1Z0MZyQO9ITcl9lJTdxIge088fenktN5bTatiP37OEAztOzw1PFxHAAFx3d5Zh0qUpYUCgwbhyOHUP//khJQW4uGhpw5w6+/RZTp6KlBcnJbU8O84riTlhISEBBAVxdcfo01q+HTAYHBwwYgKeewuefY+NGAMjIwPff8zssxZ0IrrQUH34IAJs3t/+4WHIywsLAcXjjDX5HprgTwR08CJUKTk6YM6f9A6ys2i46v/0WtbU8jkxxJ4I7dw4AgoPRu3eHx4wbBwBaLc6f53FkuhFJBFdWBgDDhnV2jLs7HBzQ2IjSUlhbA0BNDZYsaf/gU6e6OTLFnQhOoQAAB4cuDuvXD42NUCjg5AQAjY14/30DR6a4E8Hpgt7lDh9NTQDQr1/bX93c8PHH7R+5ZQu++aY7I1PcieB0e6/qpjQdUSjaFpd0c2u7WrW3R2Rk+wfv3dvNkelSlQguIAAALlzobDnse1/VHcwTijsR3DPPAMCtW/jhhw6P+egjABg1Ch4ePI5McSeC8/dHeDgAxMejubmdA06daov7ypX8jkxxJyzs3Al7e1y6hMhI5Off/3etFv/4B6KioNHgiSewYAG/w9KlKmFBJsPhw5g2DSdPwscHvr4YNgwtLcjJwZ07ABAejs8+a7vjzh+KO2HkqadQUIBNm/DZZ8jNRW4uAFhbIygIsbGIibn/rpOdHRwcOrtPb28PBwfY23c5Jr3NRExAeTnu3Gl7vcPR0XjjUNyJiNClKhERijsREYo7ERGKOxERijsREYo7ERGKOxERijsREYo7ERGKOxERijsREYo7ERGKOxGR/wMPebeKfM3UHAAAAABJRU5ErkJggg==)
Find more compounds similar to Methyldiethanolamine.
Mixtures
- Methyldiethanolamine + Water
- Monoethanolamine + Methyldiethanolamine + Water
- Carbon dioxide + Methyldiethanolamine + Water
- Piperazine + Methyldiethanolamine
- Piperazine + Methyldiethanolamine + Water
- Dimethyl Sulfoxide + Methyldiethanolamine
- Methyldiethanolamine + Methyltriphenylphosphonium bromide
- Methyldiethanolamine + Water + Thiophene, tetrahydro-, 1,1-dioxide
- Ethanol + Methyldiethanolamine
- Monoethanolamine + Methyldiethanolamine
- Monoethanolamine + Ethanol + Methyldiethanolamine
- 3,3'-Iminobispropylamine + Methyldiethanolamine + Water
- Nitrous oxide + Methyldiethanolamine + Water
- Choline chloride + Methyldiethanolamine
- Tetra-N-butylammonium bromide + Methyldiethanolamine
- Carbon dioxide + Tetra-N-butylammonium bromide + Methyldiethanolamine
- Choline chloride + Carbon dioxide + Methyldiethanolamine
- 1,2-Ethanediol + Methyldiethanolamine
- 1,2-Ethanediol + Methyldiethanolamine + Water
- Diethanolamine + Methyldiethanolamine + Water
Find more mixtures with Methyldiethanolamine.
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Crippen Method
- Solubility of carbon dioxide in aqueous solutions of diisopropanolamine and methyldiethanolamine
- Thermodynamics of aqueous solutions of methyldiethanolamine and diisopropanolamine.
- Solubilities of CO2 in aqueous N-methyldiethanolamine and guanidinium trifluoromethanesulfonate ionic liquid systems at elevated pressure
- Experiments and theory for the surface tensions of carbonated MDEA - PZ aqueous solutions
- Experiment and model for the viscosity of carbonated MDEA - MEA aqueous solutions
- Measurement and prediction of densities, viscosities, and surface tensions for aqueous solutions of potassium citrate
- Experiment and model for the surface tension of carbonated MEA-MDEA aqueous solutions
- Low pressure solubilities of CO2 in guanidinium trifluoromethanesulfonate-MDEA systems
- The solubility measurement and modeling of CO2 in aqueous solution of N-methyldiethanolaminen + 2-amino-2-methyl-1- propanol + piperazine at high pressures
- Experimental investigation of the density and viscosity of CO2-loaded aqueous alkanolamine solutions
- Solubility of heptane in aqueous solutions of methyldiethanolamine (MDEA)
- Solubility data for toluene in various aqueous alkanolamine solutions
- Molar excess enthalpy (HEm) for various {alkanolamine (1) + water (2)} systems at T = (298.15, 313.15, and 323.15) K
- Solubility of ethylbenzene and xylene in pure water and aqueous alkanolamine solutions
- Heat capacities of aqueous solutions containing diethanolamine and N-methyldiethanolamine
- Liquid heat capacity of the solvent system (piperazine + n-methyldiethanolamine + water)
- Solubility of CO2 in the solvent system (water + monoethanolamine + triethanolamine)
- Equilibrium solubility of carbon dioxide in a 30 wt.% aqueous solution of 2-((2-aminoethyl)amino)ethanol at pressures between atmospheric and 4400 kPa: An experimental and modelling study
- Volumetric properties of binary mixtures of dimethyl sulfoxide with amines from (293.15 to 363.15) K
- Volumetric and viscometric behaviour of the binary systems of N-methyldiethanolamine and diethanolamine with 1-butyl-3-methylimidazolium acetate at various temperatures
- Experiments and model for the surface tension of (MDEA + [Bmim][BF4]) and (MDEA + [Bmim][Br]) aqueous solutions
- Experiment and model for the viscosities of MEA-PEG400, DEA-PEG400 and MDEA-PEG400 aqueous solutions
- High pressure measurement and thermodynamic modelling of the solubility of carbon dioxide in N-methyldiethanolamine and 1-butyl-3-methylimidazolium acetate mixture
- Measuring solubility of carbon dioxide in aqueous blends of N-methyldiethanolamine and 2-((2-aminoethyl)amino)ethanol at low CO2 loadings and modelling by electrolyte SAFT-HR EoS
- Molar excess enthalpy (Hm E) for systems of aqueous piperazine derivatives
- Measurement of Henry s Law constant and infinite dilution activity coefficient of isopropyl mercaptan and isobutyl mercaptan in (methyldiethanolamine (1) + water (2)) with w1 = 0.25 and 0.50 at temperature of (298 to 348) K using inert gas stripping method
- Viscosity and density measurements of aqueous amines at high pressures: MDEA-water and MEA-water mixtures for CO2 capture
- Measuring solubility of hydrogen sulphide in aqueous blends of N-methyldiethanolamine and 2-((2 aminoethyl)amino)ethanol and correlating by the Deshmukh-Mather model
- Measuring the density and viscosity of H2S-loaded aqueous methyldiethanolamine solution
- CO2 absorption with aqueous tertiary amine solutions: Equilibrium solubility and thermodynamic modeling
- Preparation and characterization of amine (N-methyl diethanolamine)-based transition temperature mixtures (deep eutectic analogues solvents)
- Simultaneous solubility measurement of (ethyl mercaptan + carbon dioxide) into the aqueous solutions of (N-methyl diethanolamine + sulfolane + water)
- Volumetric and viscometric properties of ternary solution of (N-methyldiethanolamine + monoethanolamine + ethanol)
- Solubility data for benzene in aqueous solutions of methyldiethanolamine (MDEA) and of diglycolamine (DGA)
- Solubility of Hexane in Aqueous Solutions of Methyldiethanolamine
- Measurement and Correlation of the Physicochemical Properties of Novel Aqueous Bis(3-aminopropyl)amine and Its Blend with N-Methyldiethanolamine for CO2 Capture
- Study of CO2 Absorption into Phase Change Solvents MAPA and DEEA
- Solubility of Nitrous Oxide in Aqueous Methyldiethanolamine Solutions
- Mutual Solubilities of Cyclohexane and Water in Aqueous Methyldiethanolamine /Cyclohexane Liquid-Liquid Equilibria
- Thermodynamic and Kinetic Studies of CO2 Capture by Glycol and Amine-Based Deep Eutectic Solvents
- Experimental Vapor-Liquid Equilibrium Data for Binary Mixtures of Methyldiethanolamine in Water and Ethylene Glycol under Vacuum
- Experimental Study of Carbon Dioxide Solubility in Aqueous N-Methyldiethanolamine Solution with 1-Butylpyridinium Tetrafluoroborate Ionic Liquid
- Viscosity, Density, and Volatility of Binary Mixtures of Imidazole, 2-Methylimidazole, 2,4,5-Trimethylimidazole, and 1,2,4,5-Tetramethylimidazole with Water
- Physicochemical Properties of the System N,N-Dimethyl-dipropylene-diamino-triacetonediamine (EvA34), Water, and Carbon Dioxide for Reactive Absorption
- Viscosity Measurement and Correlation of Unloaded and CO2-Loaded Aqueous Solutions of N-Methyldiethanolamine-Piperazine
- Density and Viscosity of the Nonaqueous and Aqueous Mixtures of Methyldiethanolamine and Monoethylene Glycol at Temperatures from 283.15 to 353.15 K
- Density and Viscosity of Aqueous Solutions of (N-Methyldiethanolamine + Monoethanolamine), (N-Methyldiethanolamine + Diethanolamine), (2-Amino-2-methyl-1-propanol + Monoethanolamine) and (2-Amino-2-methyl-1-propanol + Diethanolamine
- Densities and Excess Molar Volumes of Aqueous Solutions of n-Methyldiethanolamine (MDEA) at Temperatures from (283.15 to 363.15) K
- Physical Solubility and Diffusivity of N2O and CO2 into Aqueous Solutions of (2-Amino-2-methyl-1-propanol + Diethanolamine) and (N-Methyldiethanolamine + Diethanolamine)
- Viscosities for Aqueous Solutions of N-Methyldiethanolamine from 313.15 to 363.15 K
- Densities of Water + Diethanolamine + Methanol and Water + N-Methyldiethanolamine + Methanol at Temperatures Ranging from (283.15 to 353.15) K
- Measurement of Henry s Law Constants and Infinite Dilution Activity Coefficients of Propyl Mercaptan, Butyl Mercaptan, and Dimethyl Sulfide in Methyldiethanolamine (1) + Water (2) with w1 ) 0.50 Using a Gas Stripping Technique
- Density and Viscosity of Aqueous Blends of Three Alkanolamines: N-Methyldiethanolamine, Diethanolamine, and 2-Amino-2-methyl-1-propanol in the Range of (303 to 343) K
- Densities and Viscosities of Aqueous Ternary Mixtures of 2-(Methylamino)ethanol and 2-(Ethylamino)ethanol with Diethanolamine, Triethanolamine, N-Methyldiethanolamine, or 2-Amino-1-methyl-1-propanol from 298.15 to 323.15 K
- Density and Viscosity of Aqueous Solutions of 2-Piperidineethanol, (2-Piperidineethanol + Monoethanolamine), and (2-Piperidineethanol + Diethanolamine) from (288 to 333) K
- Solubility of Methane in Methyldiethanolamine
- Density and Viscosity of Aqueous Solutions of (N-Methyldiethanolamine + Piperazine) and (2-Amino-2-methyl-1-propanol + Piperazine) from (288 to 333) K
- Critical Point and Vapor Pressure Measurements for 17 Compounds by a Low Residence Time Flow Method
- Density and Viscosity of Aqueous Solutions of (2-Piperidineethanol + Piperazine) from (288 to 333) K and Surface Tension of Aqueous Solutions of (N-Methyldiethanolamine + Piperazine), (2-Amino-2-methyl-1-propanol + Piperazine), and (2-Piperidineethanol + Piperazine) from (293 to 323) K
- Ternary Isobaric Vapor-Liquid Equilibria of Methanol + N-Methyldiethanolamine + Water and Methanol + 2-Amino-2-methyl-1-propanol + Water Systems
- Molar Heat Capacity of Various Aqueous Alkanolamine Solutions from 303.15 K to 353.15 K
- Density, Viscosity, and Performances of Carbon Dioxide Capture in 16 Absorbents of Amine + Ionic Liquid + H2O, Ionic Liquid + H2O, and Amine + H2O Systems
- Density and Surface Tension of Aqueous Solutions of (2-(Methylamino)-ethanol +2-Amino-2-methyl-1-propanol) and (2-(Methylamino)-ethanol + N-Methyl-diethanolamine) from (298.15 to 323.15) K
- Freezing Point Depressions of Aqueous MEA, MDEA, and MEA-MDEA Measured with a New Apparatus
- Density, Viscosity, and Surface Tension of Aqueous Solutions of Potassium Glycinate + Piperazine in the Range of (288.15 to 323.15) K
- Physical Properties of Piperazine (PZ) Activated Aqueous Solutions of 2- Amino-2-hydroxymethyl-1, 3-propanediol (AHPD + PZ)
- Density of Water (1) + Diethanolamine (2) + CO2 (3) and Water (1) + N-Methyldiethanolamine (2) + CO2 (3) from (298.15 to 423.15) K
- Densities of Partially Carbonated Aqueous Diethanolamine and Methyldiethanolamine Solutions
- Density and Viscosity of Aqueous Mixtures of N-Methyldiethanolamines (MDEA) and Ionic Liquids
- Excess Enthalpy and Excess Volume for Pyridine + Methyldiethanolamine and Pyridine + Ethanolamine Mixtures
- New Vapor Liquid Liquid Equilibrium Data for Ethane and Propane in Alkanolamine Aqueous Solutions
- Vapor Liquid Equilibria for Three Binary Systems of N-Methylethanolamine, N-Methyldiethanolamine, and Ethylene Glycol at P = (40.0, 30.0, and 20.0) kPa
- Density, Surface Tension, and Viscosity of Ionic Liquids (1-Ethyl-3-methylimidazolium diethylphosphate and 1,3-Dimethylimidazolium dimethylphosphate) Aqueous Ternary Mixtures with MDEA
- Volumetric Properties of Binary Mixtures of 3-(Methylamino)propylamine with Water, N-Methyldiethanolamine, N,N-Dimethylethanolamine, and N,N-Diethylethanolamine from (283.15 to 363.15) K
- New Vapor Liquid Liquid Equilibrium Solubility Data for iso-Butane, n-Butane, n-Pentane, and n-Hexane in Alkanolamine Aqueous Solutions
- Density and Speed of Sound of Binary Mixtures of N-Methyldiethanolamine and Triethanolamine with Ethanol
- Densities, Excess Molar Volumes, Isothermal Compressibilities, and Isobaric Thermal Expansivities of the N-Methyldiethanolamine (1) + Water (2) System at Temperatures between (313 and 363) K and Pressures up to 20 MPa
- Surface Tension of Aqueous Binary Mixtures of 2-(Methylamino)ethanol and 2-(Ethylamino)ethanol and Aqueous Ternary Mixtures of These Amines with Triethanolamine or N-Methyldiethanolamine from (293.15 to 323.15) K
- Surface Tension of Binary Mixtures of N-Methyldiethanolamine and Triethanolamine with Ethanol
- Solubility of Methane in an Aqueous Methyldiethanolamine Solution (Mass Fraction 50 %)
- Densities, Viscosities, and Liquid Diffusivities in Aqueous Piperazine and Aqueous (Piperazine + N-Methyldiethanolamine) Solutions
- Viscosity, Refractive Index, Surface Tension, and Thermal Decomposition of Aqueous N-Methyldiethanolamine Solutions from (298.15 to 338.15) K
- Ebulliometric Determination of Vapor
- Measurement through a Gas Stripping Technique of Henry's Law Constants and Infinite Dilution Activity Coefficients of Propyl Mercaptan, Butyl Mercaptan, and Dimethyl Sulfide in Methyldiethanolamine (1) + Water (2) with w1 = 0.25 and 0.35
- Density and Excess Properties of Aqueous N-Methyldiethanolamine Solutions from (298.15 to 338.15) K
- Solubilities of Carbon Dioxide and Densities of Aqueous Sodium Glycinate Solutions before and after CO2 Absorption
- Thermophysical Properties of Aqueous Piperazine and Aqueous (N-Methyldiethanolamine + Piperazine) Solutions at Temperatures (298.15 to 338.15) K
- Density, Speed of Sound, and Isentropic Compressibility of Triethanolamine (or N-Methyldiethanolamine) + Water + Ethanol Solutions from t = (15 to 50) deg C
- Solubility of Carbon Dioxide in Aqueous Solutions of N-Methyldiethanolamine and Piperazine in the High Gas Loading Region
- Solubility of Carbon Dioxide in Aqueous Solutions of N-Methyldiethanolamine and Piperazine in the Low Gas Loading Region
- Density, Speed of Sound, Isentropic Compressibility, and Excess Volume of (Monoethanolamine + 2-Amino-2-methyl-1-propanol), (Monoethanolamine + Triethanolamine), and (Monoethanolamine + N-Methyldiethanolamine) at Temperatures from (293.15 to 323.15) K
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.