- Name
- 2-Butanone
- InChI
- InChI=1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3
- InChI Key
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- CCC(C)=O
- Mol. Weight (g/mol)
- 72.11
- CAS
- 78-93-3
- Name
- Triethylamine
- InChI
- InChI=1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3
- InChI Key
- ZMANZCXQSJIPKH-UHFFFAOYSA-N
- Formula
- C6H15N
- SMILES
- CCN(CC)CC
- Mol. Weight (g/mol)
- 101.19
- CAS
- 121-44-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- Excess molar enthalpy (molar enthalpy (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Triethylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0110 | 0.0004 |
| 0.0217 | 0.0004 |
| 0.0315 | 0.0004 |
| 0.0413 | 0.0004 |
| 0.0508 | 0.0004 |
| 0.0597 | 0.0004 |
| 0.0697 | 0.0003 |
| 0.0801 | 0.0003 |
| 0.0915 | 0.0003 |
| 0.1022 | 0.0003 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Triethylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0110 | 0.0004 |
| 0.0217 | 0.0004 |
| 0.0315 | 0.0004 |
| 0.0413 | 0.0004 |
| 0.0508 | 0.0004 |
| 0.0597 | 0.0004 |
| 0.0697 | 0.0003 |
| 0.0801 | 0.0003 |
| 0.0915 | 0.0003 |
| 0.1022 | 0.0003 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Triethylamine (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1089 | 0.2580 |
| 0.2107 | 0.4550 |
| 0.3018 | 0.6080 |
| 0.4042 | 0.7000 |
| 0.5033 | 0.7460 |
| 0.5906 | 0.7350 |
| 0.7022 | 0.6820 |
| 0.7876 | 0.5700 |
| 0.8875 | 0.3670 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Triethylamine (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1089 | 0.2580 |
| 0.2107 | 0.4550 |
| 0.3018 | 0.6080 |
| 0.4042 | 0.7000 |
| 0.5033 | 0.7460 |
| 0.5906 | 0.7350 |
| 0.7022 | 0.6820 |
| 0.7876 | 0.5700 |
| 0.8875 | 0.3670 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Triethylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0110 | 798.96 |
| 0.0217 | 798.22 |
| 0.0315 | 797.6 |
| 0.0413 | 796.87 |
| 0.0508 | 796.32 |
| 0.0597 | 795.5 |
| 0.0697 | 794.8 |
| 0.0801 | 794.25 |
| 0.0915 | 793.37 |
| 0.1022 | 792.79 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0684 | 730.666 |
| 293.15 | 0.1169 | 733.08 |
| 293.15 | 0.1627 | 735.417 |
| 293.15 | 0.2218 | 738.705 |
| 293.15 | 0.2686 | 741.43 |
| 293.15 | 0.3141 | 744.214 |
| 293.15 | 0.3549 | 746.818 |
| 293.15 | 0.4154 | 750.867 |
| 293.15 | 0.4636 | 754.264 |
| 293.15 | 0.5054 | 757.343 |
| 293.15 | 0.5572 | 761.332 |
| 293.15 | 0.6100 | 765.576 |
| 293.15 | 0.6519 | 769.122 |
| 293.15 | 0.7051 | 773.808 |
| 293.15 | 0.7603 | 778.962 |
| 293.15 | 0.8057 | 783.447 |
| 293.15 | 0.8586 | 788.929 |
| 293.15 | 0.9019 | 793.679 |
| 293.15 | 0.9451 | 798.586 |
| 298.15 | 0.0709 | 725.999 |
| 298.15 | 0.1149 | 728.152 |
| 298.15 | 0.1580 | 730.378 |
| 298.15 | 0.2181 | 733.668 |
| 298.15 | 0.2610 | 736.151 |
| 298.15 | 0.3203 | 739.738 |
| 298.15 | 0.3605 | 742.292 |
| 298.15 | 0.4159 | 745.987 |
| 298.15 | 0.4607 | 749.113 |
| 298.15 | 0.5106 | 752.756 |
| 298.15 | 0.5701 | 757.323 |
| 298.15 | 0.6039 | 760.048 |
| 298.15 | 0.6600 | 764.735 |
| 298.15 | 0.7122 | 769.362 |
| 298.15 | 0.7604 | 773.883 |
| 298.15 | 0.8023 | 777.983 |
| 298.15 | 0.8437 | 782.252 |
| 298.15 | 0.8921 | 787.444 |
| 298.15 | 0.9456 | 793.453 |
| 303.15 | 0.0686 | 721.221 |
| 303.15 | 0.1149 | 723.47 |
| 303.15 | 0.1643 | 726.011 |
| 303.15 | 0.2101 | 728.487 |
| 303.15 | 0.2639 | 731.565 |
| 303.15 | 0.3102 | 734.326 |
| 303.15 | 0.3502 | 736.816 |
| 303.15 | 0.3869 | 739.189 |
| 303.15 | 0.4500 | 743.482 |
| 303.15 | 0.5081 | 747.667 |
| 303.15 | 0.5652 | 752.023 |
| 303.15 | 0.6051 | 755.192 |
| 303.15 | 0.6561 | 759.446 |
| 303.15 | 0.7087 | 764.061 |
| 303.15 | 0.7630 | 769.188 |
| 303.15 | 0.7945 | 772.2 |
| 303.15 | 0.8542 | 778.238 |
| 303.15 | 0.8987 | 783.012 |
| 303.15 | 0.9500 | 788.818 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Triethylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0110 | 798.96 |
| 0.0217 | 798.22 |
| 0.0315 | 797.6 |
| 0.0413 | 796.87 |
| 0.0508 | 796.32 |
| 0.0597 | 795.5 |
| 0.0697 | 794.8 |
| 0.0801 | 794.25 |
| 0.0915 | 793.37 |
| 0.1022 | 792.79 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0684 | 730.666 |
| 293.15 | 0.1169 | 733.08 |
| 293.15 | 0.1627 | 735.417 |
| 293.15 | 0.2218 | 738.705 |
| 293.15 | 0.2686 | 741.43 |
| 293.15 | 0.3141 | 744.214 |
| 293.15 | 0.3549 | 746.818 |
| 293.15 | 0.4154 | 750.867 |
| 293.15 | 0.4636 | 754.264 |
| 293.15 | 0.5054 | 757.343 |
| 293.15 | 0.5572 | 761.332 |
| 293.15 | 0.6100 | 765.576 |
| 293.15 | 0.6519 | 769.122 |
| 293.15 | 0.7051 | 773.808 |
| 293.15 | 0.7603 | 778.962 |
| 293.15 | 0.8057 | 783.447 |
| 293.15 | 0.8586 | 788.929 |
| 293.15 | 0.9019 | 793.679 |
| 293.15 | 0.9451 | 798.586 |
| 298.15 | 0.0709 | 725.999 |
| 298.15 | 0.1149 | 728.152 |
| 298.15 | 0.1580 | 730.378 |
| 298.15 | 0.2181 | 733.668 |
| 298.15 | 0.2610 | 736.151 |
| 298.15 | 0.3203 | 739.738 |
| 298.15 | 0.3605 | 742.292 |
| 298.15 | 0.4159 | 745.987 |
| 298.15 | 0.4607 | 749.113 |
| 298.15 | 0.5106 | 752.756 |
| 298.15 | 0.5701 | 757.323 |
| 298.15 | 0.6039 | 760.048 |
| 298.15 | 0.6600 | 764.735 |
| 298.15 | 0.7122 | 769.362 |
| 298.15 | 0.7604 | 773.883 |
| 298.15 | 0.8023 | 777.983 |
| 298.15 | 0.8437 | 782.252 |
| 298.15 | 0.8921 | 787.444 |
| 298.15 | 0.9456 | 793.453 |
| 303.15 | 0.0686 | 721.221 |
| 303.15 | 0.1149 | 723.47 |
| 303.15 | 0.1643 | 726.011 |
| 303.15 | 0.2101 | 728.487 |
| 303.15 | 0.2639 | 731.565 |
| 303.15 | 0.3102 | 734.326 |
| 303.15 | 0.3502 | 736.816 |
| 303.15 | 0.3869 | 739.189 |
| 303.15 | 0.4500 | 743.482 |
| 303.15 | 0.5081 | 747.667 |
| 303.15 | 0.5652 | 752.023 |
| 303.15 | 0.6051 | 755.192 |
| 303.15 | 0.6561 | 759.446 |
| 303.15 | 0.7087 | 764.061 |
| 303.15 | 0.7630 | 769.188 |
| 303.15 | 0.7945 | 772.2 |
| 303.15 | 0.8542 | 778.238 |
| 303.15 | 0.8987 | 783.012 |
| 303.15 | 0.9500 | 788.818 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0684 | 1134.48 |
| 293.15 | 0.1169 | 1136.03 |
| 293.15 | 0.1627 | 1137.96 |
| 293.15 | 0.2218 | 1140.6 |
| 293.15 | 0.2686 | 1142.96 |
| 293.15 | 0.3141 | 1145.52 |
| 293.15 | 0.3549 | 1147.86 |
| 293.15 | 0.4154 | 1151.74 |
| 293.15 | 0.4636 | 1155.05 |
| 293.15 | 0.5054 | 1158.17 |
| 293.15 | 0.5572 | 1162.26 |
| 293.15 | 0.6100 | 1166.74 |
| 293.15 | 0.6519 | 1170.56 |
| 293.15 | 0.7051 | 1175.66 |
| 293.15 | 0.7603 | 1181.38 |
| 293.15 | 0.8057 | 1186.51 |
| 293.15 | 0.8586 | 1192.76 |
| 293.15 | 0.9019 | 1198.33 |
| 293.15 | 0.9451 | 1204.1 |
| 298.15 | 0.0709 | 1112.73 |
| 298.15 | 0.1149 | 1114.19 |
| 298.15 | 0.1580 | 1115.89 |
| 298.15 | 0.2181 | 1118.52 |
| 298.15 | 0.2610 | 1120.74 |
| 298.15 | 0.3203 | 1123.91 |
| 298.15 | 0.3605 | 1126.28 |
| 298.15 | 0.4159 | 1129.87 |
| 298.15 | 0.4607 | 1132.99 |
| 298.15 | 0.5106 | 1136.68 |
| 298.15 | 0.5701 | 1141.48 |
| 298.15 | 0.6039 | 1144.46 |
| 298.15 | 0.6600 | 1149.45 |
| 298.15 | 0.7122 | 1154.62 |
| 298.15 | 0.7604 | 1159.77 |
| 298.15 | 0.8023 | 1164.44 |
| 298.15 | 0.8437 | 1169.62 |
| 298.15 | 0.8921 | 1175.66 |
| 298.15 | 0.9456 | 1182.84 |
| 303.15 | 0.0686 | 1092.17 |
| 303.15 | 0.1149 | 1093.65 |
| 303.15 | 0.1643 | 1095.56 |
| 303.15 | 0.2101 | 1097.57 |
| 303.15 | 0.2639 | 1100.29 |
| 303.15 | 0.3102 | 1102.73 |
| 303.15 | 0.3502 | 1105.13 |
| 303.15 | 0.3869 | 1107.37 |
| 303.15 | 0.4500 | 1111.65 |
| 303.15 | 0.5081 | 1115.97 |
| 303.15 | 0.5652 | 1120.58 |
| 303.15 | 0.6051 | 1124.04 |
| 303.15 | 0.6561 | 1128.72 |
| 303.15 | 0.7087 | 1134.02 |
| 303.15 | 0.7630 | 1139.97 |
| 303.15 | 0.7945 | 1143.48 |
| 303.15 | 0.8542 | 1150.54 |
| 303.15 | 0.8987 | 1156.33 |
| 303.15 | 0.9500 | 1163.38 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0684 | 1134.48 |
| 293.15 | 0.1169 | 1136.03 |
| 293.15 | 0.1627 | 1137.96 |
| 293.15 | 0.2218 | 1140.6 |
| 293.15 | 0.2686 | 1142.96 |
| 293.15 | 0.3141 | 1145.52 |
| 293.15 | 0.3549 | 1147.86 |
| 293.15 | 0.4154 | 1151.74 |
| 293.15 | 0.4636 | 1155.05 |
| 293.15 | 0.5054 | 1158.17 |
| 293.15 | 0.5572 | 1162.26 |
| 293.15 | 0.6100 | 1166.74 |
| 293.15 | 0.6519 | 1170.56 |
| 293.15 | 0.7051 | 1175.66 |
| 293.15 | 0.7603 | 1181.38 |
| 293.15 | 0.8057 | 1186.51 |
| 293.15 | 0.8586 | 1192.76 |
| 293.15 | 0.9019 | 1198.33 |
| 293.15 | 0.9451 | 1204.1 |
| 298.15 | 0.0709 | 1112.73 |
| 298.15 | 0.1149 | 1114.19 |
| 298.15 | 0.1580 | 1115.89 |
| 298.15 | 0.2181 | 1118.52 |
| 298.15 | 0.2610 | 1120.74 |
| 298.15 | 0.3203 | 1123.91 |
| 298.15 | 0.3605 | 1126.28 |
| 298.15 | 0.4159 | 1129.87 |
| 298.15 | 0.4607 | 1132.99 |
| 298.15 | 0.5106 | 1136.68 |
| 298.15 | 0.5701 | 1141.48 |
| 298.15 | 0.6039 | 1144.46 |
| 298.15 | 0.6600 | 1149.45 |
| 298.15 | 0.7122 | 1154.62 |
| 298.15 | 0.7604 | 1159.77 |
| 298.15 | 0.8023 | 1164.44 |
| 298.15 | 0.8437 | 1169.62 |
| 298.15 | 0.8921 | 1175.66 |
| 298.15 | 0.9456 | 1182.84 |
| 303.15 | 0.0686 | 1092.17 |
| 303.15 | 0.1149 | 1093.65 |
| 303.15 | 0.1643 | 1095.56 |
| 303.15 | 0.2101 | 1097.57 |
| 303.15 | 0.2639 | 1100.29 |
| 303.15 | 0.3102 | 1102.73 |
| 303.15 | 0.3502 | 1105.13 |
| 303.15 | 0.3869 | 1107.37 |
| 303.15 | 0.4500 | 1111.65 |
| 303.15 | 0.5081 | 1115.97 |
| 303.15 | 0.5652 | 1120.58 |
| 303.15 | 0.6051 | 1124.04 |
| 303.15 | 0.6561 | 1128.72 |
| 303.15 | 0.7087 | 1134.02 |
| 303.15 | 0.7630 | 1139.97 |
| 303.15 | 0.7945 | 1143.48 |
| 303.15 | 0.8542 | 1150.54 |
| 303.15 | 0.8987 | 1156.33 |
| 303.15 | 0.9500 | 1163.38 |
Sources
- Thermodynamics of ketone + amine mixtures. Part X. Excess molarenthalpies at 298.15 K for N,N,N-triethylamine + 2-alkanone systems.Characterization of tertiary amine + 2-alkanone, and ofamino-ketone + n-alkane mixtures in terms of DISQUAC
- Studies of viscosities of dilute solutions of alkylamine in non-electrolyte solvents. II. Haloalkanes and other polar solvents
- Thermodynamics of ketone + amine mixtures Part IV. Volumetric and speed of sound data at (293.15; 298.15 and 303.15 K) for 2-butanone +dipropylamine, +dibutylamine or +triethylamine systems