- InChI
- InChI=1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3
- InChI Key
- ZMANZCXQSJIPKH-UHFFFAOYSA-N
- Formula
- C6H15N
- SMILES
- CCN(CC)CC
- Molecular Weight1
- 101.19
- CAS
- 121-44-8
- Other Names
-
- (C2H5)3N
- (Diethylamino)ethane
- 1069-58-5 (maleate)
- 554-68-7 (chloride)
- Ethanamine, N,N-diethyl-
- N,N,N-triethylamine
- N,N-DIETHYLETHANAMINE
- TEN
- Triaethylamin
- Trietilamina
- UN 1296
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Rg : Radius of Gyration.
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3200 | KDB | |
| PAff | 981.80 | kJ/mol | NIST |
| BasG | 951.00 | kJ/mol | NIST |
| ΔcH°liquid | [-4377.09; -4354.30] | kJ/mol |
|
| ΔcH°liquid | -4377.09 ± 0.54 | kJ/mol | NIST |
| ΔcH°liquid | -4354.30 | kJ/mol | NIST |
| μ | 0.90 | debye | KDB |
| ΔfG° | 110.40 | kJ/mol | KDB |
| Rg | 3.9300 | KDB | |
| ΔfH°gas | [-143.10; -92.90] | kJ/mol |
|
| ΔfH°gas | -99.65 | kJ/mol | KDB |
| ΔfH°gas | -134.10 | kJ/mol | NIST |
| ΔfH°gas | -92.90 ± 0.50 | kJ/mol | NIST |
| ΔfH°gas | -143.10 | kJ/mol | NIST |
| ΔfH°liquid | [-178.00; -127.80] | kJ/mol |
|
| ΔfH°liquid | -169.00 | kJ/mol | NIST |
| ΔfH°liquid | -127.80 ± 0.54 | kJ/mol | NIST |
| ΔfH°liquid | -178.00 | kJ/mol | NIST |
| ΔfusH° | 14.32 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 30.99 | kJ/mol | Joback Calculated Property |
| IE | [7.10; 8.24] | eV |
|
| IE | 7.53 ± 0.10 | eV | NIST |
| IE | 7.47 ± 0.04 | eV | NIST |
| IE | 7.53 ± 0.10 | eV | NIST |
| IE | 7.30 | eV | NIST |
| IE | 7.10 ± 0.10 | eV | NIST |
| IE | 7.20 ± 0.09 | eV | NIST |
| IE | 7.84 | eV | NIST |
| IE | 7.50 ± 0.02 | eV | NIST |
| IE | 8.03 | eV | NIST |
| IE | 8.24 ± 0.04 | eV | NIST |
| IE | 8.08 | eV | NIST |
| IE | 8.19 ± 0.05 | eV | NIST |
| log10WS | -0.14 | Aq. Sol... | |
| logPoct/wat | 1.348 | Crippen Calculated Property | |
| McVol | 105.380 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 3 | KDB | |
| NFPA Health | 2 | KDB | |
| Pc | 3032.00 | kPa | KDB |
| ρc | 257.02 ± 2.02 | kg/m3 | NIST |
| Inp | [672.00; 727.00] |
|
|
| Inp | 673.60 | NIST | |
| Inp | 673.60 | NIST | |
| Inp | 676.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 676.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 711.00 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | 677.00 | NIST | |
| Inp | 677.00 | NIST | |
| Inp | 679.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 677.00 | NIST | |
| Inp | 684.00 | NIST | |
| I | [727.00; 812.40] |
|
|
| I | 812.40 | NIST | |
| I | 775.00 | NIST | |
| I | 774.00 | NIST | |
| I | 770.00 | NIST | |
| I | 775.00 | NIST | |
| I | 763.00 | NIST | |
| I | 780.00 | NIST | |
| I | Outlier 727.00 | NIST | |
| Tboil | 362.00 | K | KDB |
| Tc | 535.60 | K | KDB |
| Tfus | [158.00; 158.45] | K |
|
| Tfus | 158.40 | K | KDB |
| Tfus | 158.23 | K | Aq. Sol... |
| Tfus | 158.45 | K | NIST |
| Tfus | 158.45 ± 0.40 | K | NIST |
| Tfus | Outlier 158.00 ± 2.00 | K | NIST |
| Tfus | 158.45 ± 1.00 | K | NIST |
| Tfus | 158.40 ± 0.20 | K | NIST |
| Vc | 0.389 | m3/kmol | KDB |
| Zc | 0.2648510 | KDB | |
| Zra | 0.27 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [183.89; 248.11] | J/mol×K | [349.12; 511.60] |
|
| Cp,gas | 183.89 | J/mol×K | 349.12 | Joback Calculated Property |
| Cp,gas | 195.67 | J/mol×K | 376.20 | Joback Calculated Property |
| Cp,gas | 207.01 | J/mol×K | 403.28 | Joback Calculated Property |
| Cp,gas | 217.91 | J/mol×K | 430.36 | Joback Calculated Property |
| Cp,gas | 228.39 | J/mol×K | 457.44 | Joback Calculated Property |
| Cp,gas | 238.45 | J/mol×K | 484.52 | Joback Calculated Property |
| Cp,gas | 248.11 | J/mol×K | 511.60 | Joback Calculated Property |
| Cp,liquid | [177.00; 218.10] | J/mol×K | [298.00; 298.15] |
|
| Cp,liquid | 177.00 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 216.43 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 218.10 | J/mol×K | 298.15 | NIST |
| η | [0.0002980; 0.0004229] | Pa×s | [283.15; 323.15] |
|
| η | 0.0004229 | Pa×s | 283.15 | Dynamic... |
| η | 0.0004085 | Pa×s | 286.15 | Dynamic... |
| η | 0.0003989 | Pa×s | 288.15 | Dynamic... |
| η | 0.0003900 | Pa×s | 290.15 | Dynamic... |
| η | 0.0003855 | Pa×s | 291.15 | Dynamic... |
| η | 0.0003847 | Pa×s | 291.35 | Dynamic... |
| η | 0.0003660 | Pa×s | 298.15 | Thermod... |
| η | 0.0003400 | Pa×s | 303.15 | Thermod... |
| η | 0.0003340 | Pa×s | 308.15 | Thermod... |
| η | 0.0003310 | Pa×s | 313.15 | Thermod... |
| η | 0.0002980 | Pa×s | 323.15 | Thermod... |
| ΔvapH | [31.01; 35.20] | kJ/mol | [275.00; 363.30] |
|
| ΔvapH | 35.20 ± 0.90 | kJ/mol | 275.00 | NIST |
| ΔvapH | 34.60 | kJ/mol | 311.00 | NIST |
| ΔvapH | 33.00 | kJ/mol | 311.00 | NIST |
| ΔvapH | 33.40 ± 0.20 | kJ/mol | 313.00 | NIST |
| ΔvapH | 33.90 ± 0.10 | kJ/mol | 313.00 | NIST |
| ΔvapH | 34.10 | kJ/mol | 320.00 | NIST |
| ΔvapH | 33.00 ± 0.20 | kJ/mol | 328.00 | NIST |
| ΔvapH | 34.80 | kJ/mol | 332.00 | NIST |
| ΔvapH | 33.90 | kJ/mol | 336.00 | NIST |
| ΔvapH | 33.30 | kJ/mol | 340.50 | NIST |
| ΔvapH | 32.20 ± 0.10 | kJ/mol | 343.00 | NIST |
| ΔvapH | 31.30 ± 0.20 | kJ/mol | 358.00 | NIST |
| ΔvapH | 31.01 | kJ/mol | 362.10 | NIST |
| ΔvapH | 31.38 | kJ/mol | 362.40 | KDB |
| ΔvapH | 33.18 | kJ/mol | 363.30 | NIST |
| Pvap | [2.46; 74.94] | kPa | [273.04; 352.77] |
|
| Pvap | 2.46 | kPa | 273.04 | Experim... |
| Pvap | 7.01 | kPa | 292.87 | Experim... |
| Pvap | 17.43 | kPa | 312.82 | Experim... |
| Pvap | 38.05 | kPa | 332.78 | Experim... |
| Pvap | 74.94 | kPa | 352.77 | Experim... |
| n0 | [1.38980; 1.40110] | [293.15; 318.15] |
|
|
| n0 | 1.39660 | 293.15 | Measure... | |
| n0 | 1.40110 | 298.15 | Densiti... | |
| n0 | 1.39920 | 298.15 | Density... | |
| n0 | 1.39830 | 298.15 | Density... | |
| n0 | 1.39830 | 303.15 | Densiti... | |
| n0 | 1.39580 | 303.15 | Density... | |
| n0 | 1.39550 | 303.15 | Density... | |
| n0 | 1.39500 | 308.15 | Densiti... | |
| n0 | 1.39260 | 308.15 | Density... | |
| n0 | 1.39290 | 308.15 | Density... | |
| n0 | 1.39280 | 313.15 | Densiti... | |
| n0 | 1.38980 | 318.15 | Densiti... | |
| ρl | [709.05; 732.03] | kg/m3 | [288.15; 313.15] |
|
| ρl | 732.03 | kg/m3 | 288.15 | Volumet... |
| ρl | 728.00 | kg/m3 | 293.00 | KDB |
| ρl | 727.70 | kg/m3 | 293.15 | Volumet... |
| ρl | 727.40 | kg/m3 | 293.15 | Volumet... |
| ρl | 722.56 | kg/m3 | 298.15 | Excess ... |
| ρl | 722.77 | kg/m3 | 298.15 | Volumet... |
| ρl | 723.02 | kg/m3 | 298.15 | Volumet... |
| ρl | 723.01 | kg/m3 | 298.15 | Partial... |
| ρl | 722.81 | kg/m3 | 298.15 | Thermod... |
| ρl | 722.81 | kg/m3 | 298.15 | Thermod... |
| ρl | 718.12 | kg/m3 | 303.15 | Volumet... |
| ρl | 718.36 | kg/m3 | 303.15 | Volumet... |
| ρl | 718.44 | kg/m3 | 303.15 | Studies... |
| ρl | 718.44 | kg/m3 | 303.15 | Studies... |
| ρl | 718.44 | kg/m3 | 303.15 | Studies... |
| ρl | 713.65 | kg/m3 | 308.15 | Volumet... |
| ρl | 709.05 | kg/m3 | 313.15 | Studies... |
| csound,fluid | [1090.65; 1132.77] | m/s | [293.15; 303.15] |
|
| csound,fluid | 1132.47 | m/s | 293.15 | Thermod... |
| csound,fluid | 1132.77 | m/s | 293.15 | Thermod... |
| csound,fluid | 1110.90 | m/s | 298.15 | Thermod... |
| csound,fluid | 1111.10 | m/s | 298.15 | Thermod... |
| csound,fluid | 1090.65 | m/s | 303.15 | Thermod... |
| csound,fluid | 1090.70 | m/s | 303.15 | Thermod... |
| γ | 0.02 | N/m | 293.20 | KDB |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Amount density, mol/m3 - Gas | Temperature, K - Gas | Viscosity, Pa*s - Gas |
| 2.2 | 299.67 | 6.4900e-06 |
| 2.2 | 299.85 | 6.4850e-06 |
| 2.2 | 313.96 | 6.7640e-06 |
| 2.2 | 326.63 | 7.0240e-06 |
| 2.2 | 339.05 | 7.2750e-06 |
| 2.2 | 352.50 | 7.5510e-06 |
| 2.2 | 366.60 | 7.8420e-06 |
| 2.2 | 381.14 | 8.1370e-06 |
| 2.2 | 394.56 | 8.4130e-06 |
| 2.2 | 409.20 | 8.7180e-06 |
| 2.2 | 422.79 | 8.9960e-06 |
| 2.2 | 437.42 | 9.2960e-06 |
| 2.2 | 451.72 | 9.5940e-06 |
| 2.2 | 466.58 | 9.9070e-06 |
| 2.2 | 480.36 | 0.0000 |
| 2.2 | 498.45 | 0.0000 |
| 3.13 | 300.02 | 6.4880e-06 |
| 3.13 | 303.12 | 6.5480e-06 |
| 3.13 | 316.33 | 6.8150e-06 |
| 3.13 | 324.26 | 6.9810e-06 |
| 3.13 | 338.31 | 7.2590e-06 |
| 3.13 | 352.91 | 7.5570e-06 |
| 3.13 | 366.49 | 7.8390e-06 |
| 3.13 | 380.67 | 8.1290e-06 |
| 3.13 | 394.95 | 8.4230e-06 |
| 3.13 | 412.99 | 8.8040e-06 |
| 3.13 | 423.41 | 9.0120e-06 |
| 3.13 | 437.51 | 9.3150e-06 |
| 3.13 | 451.74 | 9.5990e-06 |
| 3.13 | 469.98 | 9.9850e-06 |
| 3.13 | 480.86 | 0.0000 |
| 3.13 | 498.38 | 0.0000 |
| 4.2 | 296.98 | 6.4180e-06 |
| 4.2 | 297.97 | 6.4390e-06 |
| 4.2 | 310.02 | 6.6680e-06 |
| 4.2 | 324.95 | 6.9710e-06 |
| 4.2 | 338.63 | 7.2450e-06 |
| 4.2 | 353.30 | 7.5510e-06 |
| 4.2 | 365.86 | 7.8030e-06 |
| 4.2 | 385.41 | 8.2170e-06 |
| 4.2 | 394.25 | 8.3880e-06 |
| 4.2 | 409.73 | 8.7110e-06 |
| 4.2 | 423.93 | 8.9880e-06 |
| 4.2 | 436.97 | 9.2750e-06 |
| 4.2 | 451.76 | 9.5860e-06 |
| 4.2 | 466.71 | 9.8930e-06 |
| 4.2 | 481.32 | 0.0000 |
| 4.2 | 495.31 | 0.0000 |
| 4.99 | 297.98 | 6.4400e-06 |
| 4.99 | 298.33 | 6.4370e-06 |
| 4.99 | 314.61 | 6.7500e-06 |
| 4.99 | 325.84 | 6.9800e-06 |
| 4.99 | 338.25 | 7.2330e-06 |
| 4.99 | 352.46 | 7.5290e-06 |
| 4.99 | 367.25 | 7.8310e-06 |
| 4.99 | 380.54 | 8.1090e-06 |
| 4.99 | 394.51 | 8.3860e-06 |
| 4.99 | 409.32 | 8.7070e-06 |
| 4.99 | 423.25 | 8.9910e-06 |
| 4.99 | 437.62 | 9.2860e-06 |
| 4.99 | 451.28 | 9.5720e-06 |
| 4.99 | 466.45 | 9.8790e-06 |
| 4.99 | 480.43 | 0.0000 |
| 4.99 | 495.29 | 0.0000 |
| 6.31 | 297.59 | 6.4120e-06 |
| 6.31 | 299.36 | 6.4490e-06 |
| 6.31 | 310.29 | 6.6540e-06 |
| 6.31 | 324.90 | 6.9480e-06 |
| 6.31 | 337.84 | 7.2050e-06 |
| 6.31 | 352.41 | 7.4920e-06 |
| 6.31 | 366.77 | 7.7840e-06 |
| 6.31 | 381.83 | 8.1060e-06 |
| 6.31 | 394.49 | 8.3700e-06 |
| 6.31 | 408.97 | 8.6620e-06 |
| 6.31 | 423.92 | 8.9660e-06 |
| 6.31 | 437.11 | 9.2490e-06 |
| 6.31 | 451.66 | 9.5540e-06 |
| 6.31 | 465.92 | 9.8460e-06 |
| 6.31 | 481.09 | 0.0000 |
| 6.31 | 495.17 | 0.0000 |
| 7.52 | 299.24 | 6.4460e-06 |
| 7.52 | 326.04 | 6.9790e-06 |
| 7.52 | 338.12 | 7.2180e-06 |
| 7.52 | 352.32 | 7.5130e-06 |
| 7.52 | 366.72 | 7.8010e-06 |
| 7.52 | 385.75 | 8.2060e-06 |
| 7.52 | 394.86 | 8.3840e-06 |
| 7.52 | 409.67 | 8.6900e-06 |
| 7.52 | 423.03 | 8.9630e-06 |
| 7.52 | 437.87 | 9.2690e-06 |
| 7.52 | 451.93 | 9.5580e-06 |
| 7.52 | 471.39 | 9.9720e-06 |
| 7.52 | 480.70 | 0.0000 |
| 7.52 | 495.84 | 0.0000 |
| 8.75 | 297.87 | 6.4270e-06 |
| 8.75 | 300.11 | 6.4600e-06 |
| 8.75 | 311.78 | 6.6670e-06 |
| 8.75 | 324.05 | 6.9130e-06 |
| 8.75 | 338.92 | 7.2170e-06 |
| 8.75 | 352.34 | 7.4870e-06 |
| 8.75 | 366.42 | 7.7820e-06 |
| 8.75 | 381.06 | 8.0760e-06 |
| 8.75 | 395.11 | 8.3690e-06 |
| 8.75 | 408.35 | 8.6400e-06 |
| 8.75 | 422.67 | 8.9390e-06 |
| 8.75 | 437.76 | 9.2550e-06 |
| 8.75 | 451.45 | 9.5340e-06 |
| 8.75 | 466.63 | 9.8510e-06 |
| 8.75 | 480.12 | 0.0000 |
| 8.75 | 496.21 | 0.0000 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 101.33 | 0.0003 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.68] | kPa | [275.55; 385.31] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.29590e+01 | |||
| Coefficient B | -2.11704e+03 | |||
| Coefficient C | -1.08476e+02 | |||
| Temperature range, min. | 275.55 | |||
| Temperature range, max. | 385.31 | |||
| Pvap | 1.33 | kPa | 275.55 | Calculated Property |
| Pvap | 3.16 | kPa | 287.75 | Calculated Property |
| Pvap | 6.70 | kPa | 299.94 | Calculated Property |
| Pvap | 12.99 | kPa | 312.14 | Calculated Property |
| Pvap | 23.37 | kPa | 324.33 | Calculated Property |
| Pvap | 39.48 | kPa | 336.53 | Calculated Property |
| Pvap | 63.25 | kPa | 348.72 | Calculated Property |
| Pvap | 96.81 | kPa | 360.92 | Calculated Property |
| Pvap | 142.48 | kPa | 373.11 | Calculated Property |
| Pvap | 202.68 | kPa | 385.31 | Calculated Property |
| Pvap | [1.02e-05; 2785.21] | kPa | [158.45; 535.15] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 6.51266e+01 | |||
| Coefficient B | -6.12731e+03 | |||
| Coefficient C | -7.51862e+00 | |||
| Coefficient D | 5.20704e-06 | |||
| Temperature range, min. | 158.45 | |||
| Temperature range, max. | 535.15 | |||
| Pvap | 1.02e-05 | kPa | 158.45 | Calculated Property |
| Pvap | 6.09e-03 | kPa | 200.31 | Calculated Property |
| Pvap | 0.32 | kPa | 242.16 | Calculated Property |
| Pvap | 4.48 | kPa | 284.02 | Calculated Property |
| Pvap | 29.09 | kPa | 325.87 | Calculated Property |
| Pvap | 115.94 | kPa | 367.73 | Calculated Property |
| Pvap | 335.21 | kPa | 409.58 | Calculated Property |
| Pvap | 778.89 | kPa | 451.44 | Calculated Property |
| Pvap | 1554.27 | kPa | 493.29 | Calculated Property |
| Pvap | 2785.21 | kPa | 535.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Triethylamine.
Mixtures
- Benzene + Triethylamine
- n-Hexane + Triethylamine
- Ethanol + Triethylamine
- Triethylamine + 1-Butanol
- n-Hexane + Ethanol + Triethylamine
- n-Hexane + Triethylamine + 1-Butanol
- Triethylamine + Acetone
- 2-Butanone + Triethylamine
- 2-Pentanone + Triethylamine
- Triethylamine + 2-Heptanone
- Triethylamine + Water
- Trichloromethane + Triethylamine
- Triethylamine + Methyl Alcohol
- 1-Propanol + 2-Butanone + Triethylamine
- Acetonitrile + Triethylamine
- Triethylamine + 1,4-Dioxane
- Triethylamine + Ethyl Acetate
- Triethylamine + Acetic acid, butyl ester
- Benzene, chloro- + Triethylamine
- Benzene, nitro- + Triethylamine
Find more mixtures with Triethylamine.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Densities and Refractive Indices of Binary Mixtures of Benzene with Triethylamine and Tributylamine at Different Temperatures
- Excess molar volumes and excess molar enthalpies of binary and ternary mixtures of (ethanol or 1-butanol), triethylamine and n-hexane
- Thermodynamic properties of triethylamine +water liquid mixture from shear viscosity measurements
- The viscosity of triethylamine vapor at low densities and in the saturated vapor phase
- The viscosity of the binary vapor mixture methanol triethylamine at low densities and in the saturated vapor phase of the vapor liquid equilibrium
- Electrical conductivity investigation of diluted potassium chloride solutions in binary mixture triethylamine-water near its consolute point
- Thermodynamics of ketone + amine mixtures. Part X. Excess molarenthalpies at 298.15 K for N,N,N-triethylamine + 2-alkanone systems.Characterization of tertiary amine + 2-alkanone, and ofamino-ketone + n-alkane mixtures in terms of DISQUAC
- Measurement and correlation of the mutual solubility of diisopropylamine + water and triethylamine + water systems at high pressure
- Study of interaction between organic compounds and mono or dicationic oxygenated ionic liquids using gas chromatography
- Volumetric behaviour of binary mixtures of (trichloromethane + amines) at temperatures between T = (288.15 and 303.15) K at p = 0.1 MPa
- Thermodynamic study of (heptane + amine) mixtures. III: Excess and partial molar volumes in mixtures with secondary, tertiary, and cyclic amines at 298.15 K
- Thermodynamics of (ketone + amine) mixtures. Part VI. Volumetric and speed of sound data at (293.15, 298.15, and 303.15) K for (2-heptanone + dipropylamine, +dibutylamine, or +triethylamine) systems
- Partial molar volume of tertiary amines in methanol at T = 298.15 K. Solvation, shape and specific interactions
- Thermodynamics of (ketone + amine) mixtures. Part XI. Excess molar enthalpies at T = 298.15 K for the (1-propanol + N,N,N-triethylamine + 2-butanone) system
- Solvation parameter model and thermodynamic parameters in a dicationic ionic liquid based on pyrrolidinium
- Activity coefficients at infinite dilution of organic solutes in methylphosphonate based ionic liquids using gas-liquid chromatography
- Volumetric properties of binary mixtures of (acetonitrile + amines) at several temperatures with application of the ERAS model
- Studies of viscosities of dilute solutions of alkylamine in non-electrolyte solvents. II. Haloalkanes and other polar solvents
- Studies of partial molar volumes of alkylamine in non-electrolyte solvents I. Alkylamines in hydrocarbons at 303.15 and 313.15K
- Volumetric and transport properties of ternary mixtures containing 1-propanol, triethylamine or tri-n-butylamine and cyclohexane at 303.15 K: Experimental data, correlation and prediction by ERAS model
- Studies of viscosities of dilute solutions of alkylamines in non-electrolyte solvents III. Alkylamines in butanols 303.15K
- Studies of viscosities of dilute solutions of alkylamines in non-electrolyte solvents: IV. Alkylamines in 1,4-dioxane and oxolane at 303.15K
- Thermodynamics of ketone + amine mixtures Part IV. Volumetric and speed of sound data at (293.15; 298.15 and 303.15 K) for 2-butanone +dipropylamine, +dibutylamine or +triethylamine systems
- Thermodynamic study of Binary Mixtures of Tricyclo [5.2.1.0(2.6)] Decane with N-Methylpiperazine or Triethylamine at T = (298.15 to 323.15) K
- Density, Viscosity, Refractive Index, and Speed of Sound in the Binary Mixtures of 1,4-Dioxane + Ethanediol, + Hexane, + Tributylamine, or + Triethylamine at (298.15, 303.15, and 308.15) K
- Density, Viscosity, Refractive Index, and Speed of Sound in the Binary Mixtures of Tri-n-butylamine + Triethylamine, + Tetrahydrofuran, + Tetradecane, + Tetrachloroethylene, + Pyridine, or + Trichloroethylene at (298.15, 303.15, and 308.15) K
- Activity Coefficients at Infinite Dilution of Organic Compounds in Four New Imidazolium-Based Ionic Liquids
- Partition Coefficients of Organic Compounds in Four New Tetraalkylammonium Bis(trifluoromethylsulfonyl)imide Ionic Liquids Using Inverse Gas Chromatography
- Evaluation of the Performance of Trigeminal Tricationic Ionic Liquids for Separation Problems
- Activity Coefficients at Infinite Dilution for Organic Solutes Dissolved in Three 1-Alkyl-1-methylpyrrolidinium Bis(trifluoromethylsulfonyl)imide Ionic Liquids Bearing Short Linear Alkyl Side Chains of Three to Five Carbons
- Infinite Dilution Activity Coefficients of Solutes Dissolved in Two Trihexyl(tetradecyl)phosphonium Ionic Liquids
- Experimental Vapor Pressures of 2-Phenylethylamine, Benzylamine, Triethylamine, and cis-2,6-Dimethylpiperidine in the Range between 0.2 Pa and 75 kPa
- Activity Coefficients at Infinite Dilution of Organic Compounds in 1-Butyl-3-methylimidazolium Tetrafluoroborate Using Inverse Gas Chromatography
- Dynamic Viscosity Study of Binary Mixtures Triethylamine + Water at Temperatures Ranging from (283.15 to 291.35) K
- Partition Coefficients of Organic Compounds in New Imidazolium and Tetralkylammonium Based Ionic Liquids Using Inverse Gas Chromatography
- Study of Ether-, Alcohol-, or Cyano-Functionalized Ionic Liquids Using Inverse Gas Chromatography
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.