- Name
- Triethylamine
- InChI
- InChI=1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3
- InChI Key
- ZMANZCXQSJIPKH-UHFFFAOYSA-N
- Formula
- C6H15N
- SMILES
- CCN(CC)CC
- Mol. Weight (g/mol)
- 101.19
- CAS
- 121-44-8
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mass fraction
- η - Viscosity, Pa*s (2)
- σcond - Electrical conductivity, S/m
- ρl - Mass density, kg/m3 (2)
Mass fraction of Triethylamine (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Pressure, kPa - Liquid mixture 1 | Mass fraction of Triethylamine (1) - Liquid mixture 1 |
| 293.20 | 12400.00 | 0.2000 |
| 295.20 | 22100.00 | 0.2000 |
| 299.20 | 40700.00 | 0.2000 |
| 301.20 | 53500.00 | 0.2000 |
| 303.20 | 71600.00 | 0.2000 |
| 306.20 | 83200.00 | 0.2000 |
| 293.20 | 15700.00 | 0.2500 |
| 295.20 | 27600.00 | 0.2500 |
| 299.20 | 49300.00 | 0.2500 |
| 301.20 | 60900.00 | 0.2500 |
| 303.20 | 71000.00 | 0.2500 |
| 306.20 | 86600.00 | 0.2500 |
| 293.20 | 18600.00 | 0.3000 |
| 295.20 | 30800.00 | 0.3000 |
| 299.20 | 51700.00 | 0.3000 |
| 301.20 | 60000.00 | 0.3000 |
| 303.20 | 71200.00 | 0.3000 |
| 306.20 | 88100.00 | 0.3000 |
| 293.20 | 20200.00 | 0.4000 |
| 295.20 | 31600.00 | 0.4000 |
| 299.20 | 50400.00 | 0.4000 |
| 301.20 | 61100.00 | 0.4000 |
| 303.20 | 70700.00 | 0.4000 |
| 306.20 | 87200.00 | 0.4000 |
| 293.20 | 18400.00 | 0.5000 |
| 295.20 | 28600.00 | 0.5000 |
| 299.20 | 49300.00 | 0.5000 |
| 301.20 | 59700.00 | 0.5000 |
| 303.20 | 68100.00 | 0.5000 |
| 306.20 | 84200.00 | 0.5000 |
| 293.20 | 16300.00 | 0.6000 |
| 295.20 | 27400.00 | 0.6000 |
| 299.20 | 47500.00 | 0.6000 |
| 293.20 | 9500.00 | 0.7000 |
| 295.20 | 23600.00 | 0.7000 |
| 299.20 | 44800.00 | 0.7000 |
| 301.20 | 55100.00 | 0.7000 |
| 303.20 | 63200.00 | 0.7000 |
| 306.20 | 78000.00 | 0.7000 |
| 295.20 | 14400.00 | 0.8000 |
| 299.20 | 38000.00 | 0.8000 |
| 301.20 | 50300.00 | 0.8000 |
| 303.20 | 60200.00 | 0.8000 |
| 306.20 | 71100.00 | 0.8000 |
| 299.20 | 29400.00 | 0.8500 |
| 301.20 | 50300.00 | 0.8500 |
| 303.20 | 57400.00 | 0.8500 |
| 306.20 | 69200.00 | 0.8500 |
| 299.20 | 2110.00 | 0.9000 |
| 301.20 | 32700.00 | 0.9000 |
| 303.20 | 51300.00 | 0.9000 |
| 306.20 | 60400.00 | 0.9000 |
| 301.20 | 22400.00 | 0.9500 |
| 303.20 | 40000.00 | 0.9500 |
| 306.20 | 48100.00 | 0.9500 |
| 301.20 | 57200.00 | 0.6000 |
| 303.20 | 66300.00 | 0.6000 |
| 306.20 | 80800.00 | 0.6000 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Triethylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 283.15 | 0.0000 | 0.0013 |
| 283.15 | 0.0190 | 0.0025 |
| 283.15 | 0.0420 | 0.0041 |
| 283.15 | 0.0770 | 0.0055 |
| 283.15 | 0.1060 | 0.0066 |
| 283.15 | 0.1510 | 0.0067 |
| 283.15 | 0.2100 | 0.0056 |
| 283.15 | 0.2930 | 0.0042 |
| 283.15 | 0.4150 | 0.0028 |
| 283.15 | 0.6150 | 0.0018 |
| 283.15 | 1.0000 | 0.0004 |
| 286.15 | 0.0000 | 0.0012 |
| 286.15 | 0.0190 | 0.0022 |
| 286.15 | 0.0420 | 0.0035 |
| 286.15 | 0.0770 | 0.0048 |
| 286.15 | 0.1060 | 0.0055 |
| 286.15 | 0.1510 | 0.0055 |
| 286.15 | 0.2100 | 0.0048 |
| 286.15 | 0.2930 | 0.0037 |
| 286.15 | 0.4150 | 0.0025 |
| 286.15 | 0.6150 | 0.0015 |
| 286.15 | 1.0000 | 0.0004 |
| 288.15 | 0.0000 | 0.0011 |
| 288.15 | 0.0190 | 0.0020 |
| 288.15 | 0.0420 | 0.0032 |
| 288.15 | 0.0770 | 0.0042 |
| 288.15 | 0.1060 | 0.0047 |
| 288.15 | 0.1510 | 0.0048 |
| 288.15 | 0.2100 | 0.0043 |
| 288.15 | 0.2930 | 0.0034 |
| 288.15 | 0.4150 | 0.0023 |
| 288.15 | 0.6150 | 0.0014 |
| 288.15 | 1.0000 | 0.0004 |
| 290.15 | 0.0000 | 0.0011 |
| 290.15 | 0.0190 | 0.0019 |
| 290.15 | 0.0420 | 0.0029 |
| 290.15 | 0.0770 | 0.0038 |
| 290.15 | 0.1060 | 0.0041 |
| 290.15 | 0.1510 | 0.0041 |
| 290.15 | 0.2100 | 0.0039 |
| 290.15 | 0.2930 | 0.0031 |
| 290.15 | 0.4150 | 0.0022 |
| 290.15 | 0.6150 | 0.0012 |
| 290.15 | 1.0000 | 0.0004 |
| 291.15 | 0.0000 | 0.0011 |
| 291.15 | 0.0190 | 0.0018 |
| 291.15 | 0.0420 | 0.0028 |
| 291.15 | 0.0770 | 0.0035 |
| 291.15 | 0.1060 | 0.0038 |
| 291.15 | 0.1510 | 0.0038 |
| 291.15 | 0.2100 | 0.0036 |
| 291.15 | 0.2930 | 0.0030 |
| 291.15 | 0.4150 | 0.0021 |
| 291.15 | 0.6150 | 0.0011 |
| 291.15 | 1.0000 | 0.0004 |
| 291.35 | 0.0000 | 0.0011 |
| 291.35 | 0.0190 | 0.0018 |
| 291.35 | 0.0420 | 0.0028 |
| 291.35 | 0.0770 | 0.0035 |
| 291.35 | 0.1060 | 0.0037 |
| 291.35 | 0.1510 | 0.0037 |
| 291.35 | 0.2100 | 0.0036 |
| 291.35 | 0.2930 | 0.0030 |
| 291.35 | 0.4150 | 0.0021 |
| 291.35 | 0.6150 | 0.0011 |
| 291.35 | 1.0000 | 0.0004 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Triethylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 283.15 | 0.0000 | 0.0013 |
| 283.15 | 0.0192 | 0.0025 |
| 283.15 | 0.0429 | 0.0041 |
| 283.15 | 0.0775 | 0.0055 |
| 283.15 | 0.1060 | 0.0066 |
| 283.15 | 0.1510 | 0.0066 |
| 283.15 | 0.2117 | 0.0056 |
| 283.15 | 0.2930 | 0.0042 |
| 283.15 | 0.4167 | 0.0028 |
| 283.15 | 0.6150 | 0.0018 |
| 283.15 | 1.0000 | 0.0004 |
| 286.15 | 0.0000 | 0.0012 |
| 286.15 | 0.0192 | 0.0022 |
| 286.15 | 0.0429 | 0.0035 |
| 286.15 | 0.0775 | 0.0047 |
| 286.15 | 0.1060 | 0.0055 |
| 286.15 | 0.1510 | 0.0055 |
| 286.15 | 0.2117 | 0.0048 |
| 286.15 | 0.2930 | 0.0037 |
| 286.15 | 0.4167 | 0.0025 |
| 286.15 | 0.6150 | 0.0015 |
| 286.15 | 1.0000 | 0.0004 |
| 288.15 | 0.0000 | 0.0011 |
| 288.15 | 0.0192 | 0.0020 |
| 288.15 | 0.0429 | 0.0032 |
| 288.15 | 0.0775 | 0.0042 |
| 288.15 | 0.1060 | 0.0047 |
| 288.15 | 0.1510 | 0.0048 |
| 288.15 | 0.2117 | 0.0043 |
| 288.15 | 0.2930 | 0.0034 |
| 288.15 | 0.4167 | 0.0023 |
| 288.15 | 0.6150 | 0.0013 |
| 288.15 | 1.0000 | 0.0004 |
| 290.15 | 0.0000 | 0.0011 |
| 290.15 | 0.0192 | 0.0019 |
| 290.15 | 0.0429 | 0.0029 |
| 290.15 | 0.0775 | 0.0038 |
| 290.15 | 0.1060 | 0.0041 |
| 290.15 | 0.1510 | 0.0041 |
| 290.15 | 0.2117 | 0.0038 |
| 290.15 | 0.2930 | 0.0031 |
| 290.15 | 0.4167 | 0.0022 |
| 290.15 | 0.6150 | 0.0012 |
| 290.15 | 1.0000 | 0.0004 |
| 291.15 | 0.0000 | 0.0011 |
| 291.15 | 0.0192 | 0.0018 |
| 291.15 | 0.0429 | 0.0028 |
| 291.15 | 0.0775 | 0.0035 |
| 291.15 | 0.1060 | 0.0037 |
| 291.15 | 0.1510 | 0.0038 |
| 291.15 | 0.2117 | 0.0036 |
| 291.15 | 0.2930 | 0.0030 |
| 291.15 | 0.4167 | 0.0021 |
| 291.15 | 0.6150 | 0.0011 |
| 291.15 | 1.0000 | 0.0004 |
| 291.35 | 0.0000 | 0.0010 |
| 291.35 | 0.0192 | 0.0018 |
| 291.35 | 0.0429 | 0.0028 |
| 291.35 | 0.0775 | 0.0035 |
| 291.35 | 0.1060 | 0.0037 |
| 291.35 | 0.1510 | 0.0037 |
| 291.35 | 0.2117 | 0.0036 |
| 291.35 | 0.2930 | 0.0030 |
| 291.35 | 0.4167 | 0.0021 |
| 291.35 | 0.6150 | 0.0011 |
| 291.35 | 1.0000 | 0.0004 |
Electrical conductivity, S/m [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mass fraction = 0.321 (Liquid)
| Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
|---|---|
| 284.65 | 0.0470 |
| 285.14 | 0.0482 |
| 285.64 | 0.0493 |
| 286.14 | 0.0505 |
| 286.65 | 0.0516 |
| 287.14 | 0.0528 |
| 287.65 | 0.0540 |
| 288.09 | 0.0550 |
| 288.59 | 0.0562 |
| 288.89 | 0.0568 |
| 289.14 | 0.0574 |
| 289.42 | 0.0581 |
| 289.65 | 0.0586 |
| 289.91 | 0.0592 |
| 290.15 | 0.0598 |
| 290.33 | 0.0603 |
| 290.44 | 0.0606 |
| 290.55 | 0.0608 |
| 290.65 | 0.0611 |
| 290.75 | 0.0614 |
| 290.84 | 0.0617 |
| 290.94 | 0.0620 |
| 291.05 | 0.0623 |
| 291.15 | 0.0626 |
| 291.19 | 0.0628 |
| 291.24 | 0.0629 |
| 291.29 | 0.0631 |
| 291.34 | 0.0633 |
| 291.39 | 0.0635 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mass fraction = 0.321 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 284.65 | 935.6 |
| 285.14 | 935.2 |
| 285.64 | 934.7 |
| 286.14 | 934.2 |
| 286.65 | 933.7 |
| 287.14 | 933.1 |
| 287.65 | 932.5 |
| 288.09 | 932.0 |
| 288.59 | 931.4 |
| 288.89 | 931.0 |
| 289.14 | 930.7 |
| 289.42 | 930.3 |
| 289.65 | 930.0 |
| 289.91 | 929.6 |
| 290.15 | 929.3 |
| 290.33 | 929.0 |
| 290.44 | 928.9 |
| 290.55 | 928.7 |
| 290.65 | 928.6 |
| 290.75 | 928.4 |
| 290.84 | 928.3 |
| 290.94 | 928.2 |
| 291.05 | 928.0 |
| 291.15 | 927.8 |
| 291.19 | 927.8 |
| 291.24 | 927.7 |
| 291.29 | 927.6 |
| 291.34 | 927.5 |
| 291.39 | 927.5 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Triethylamine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0000 | 999.5 |
| 283.15 | 0.0192 | 985.3 |
| 283.15 | 0.0429 | 965.8 |
| 283.15 | 0.0775 | 936.2 |
| 283.15 | 0.1060 | 919.0 |
| 283.15 | 0.1510 | 895.1 |
| 283.15 | 0.2117 | 868.0 |
| 283.15 | 0.2930 | 839.5 |
| 283.15 | 0.4167 | 809.3 |
| 283.15 | 0.6150 | 775.0 |
| 283.15 | 1.0000 | 737.0 |
| 286.15 | 0.0000 | 999.3 |
| 286.15 | 0.0192 | 984.3 |
| 286.15 | 0.0429 | 964.2 |
| 286.15 | 0.0775 | 934.0 |
| 286.15 | 0.1060 | 916.3 |
| 286.15 | 0.1510 | 892.4 |
| 286.15 | 0.2117 | 865.3 |
| 286.15 | 0.2930 | 836.8 |
| 286.15 | 0.4167 | 806.6 |
| 286.15 | 0.6150 | 772.3 |
| 286.15 | 1.0000 | 734.0 |
| 288.15 | 0.0000 | 999.0 |
| 288.15 | 0.0192 | 983.6 |
| 288.15 | 0.0429 | 962.8 |
| 288.15 | 0.0775 | 931.7 |
| 288.15 | 0.1060 | 913.8 |
| 288.15 | 0.1510 | 889.9 |
| 288.15 | 0.2117 | 862.8 |
| 288.15 | 0.2930 | 834.3 |
| 288.15 | 0.4167 | 804.1 |
| 288.15 | 0.6150 | 769.8 |
| 288.15 | 1.0000 | 731.8 |
| 290.15 | 0.0000 | 998.7 |
| 290.15 | 0.0192 | 982.8 |
| 290.15 | 0.0429 | 961.4 |
| 290.15 | 0.0775 | 929.0 |
| 290.15 | 0.1060 | 910.9 |
| 290.15 | 0.1510 | 887.0 |
| 290.15 | 0.2117 | 859.9 |
| 290.15 | 0.2930 | 831.4 |
| 290.15 | 0.4167 | 801.2 |
| 290.15 | 0.6150 | 766.9 |
| 290.15 | 1.0000 | 729.8 |
| 291.15 | 0.0000 | 998.5 |
| 291.15 | 0.0192 | 982.4 |
| 291.15 | 0.0429 | 960.5 |
| 291.15 | 0.0775 | 927.5 |
| 291.15 | 0.1060 | 909.2 |
| 291.15 | 0.1510 | 885.3 |
| 291.15 | 0.2117 | 858.2 |
| 291.15 | 0.2930 | 829.7 |
| 291.15 | 0.4167 | 799.5 |
| 291.15 | 0.6150 | 765.2 |
| 291.15 | 1.0000 | 728.7 |
| 291.35 | 0.0000 | 998.5 |
| 291.35 | 0.0192 | 982.3 |
| 291.35 | 0.0429 | 960.4 |
| 291.35 | 0.0775 | 927.1 |
| 291.35 | 0.1060 | 909.0 |
| 291.35 | 0.1510 | 885.1 |
| 291.35 | 0.2117 | 858.0 |
| 291.35 | 0.2930 | 829.5 |
| 291.35 | 0.4167 | 799.3 |
| 291.35 | 0.6150 | 765.0 |
| 291.35 | 1.0000 | 728.5 |
Sources
- Thermodynamic properties of triethylamine +water liquid mixture from shear viscosity measurements
- Electrical conductivity investigation of diluted potassium chloride solutions in binary mixture triethylamine-water near its consolute point
- Measurement and correlation of the mutual solubility of diisopropylamine + water and triethylamine + water systems at high pressure
- Dynamic Viscosity Study of Binary Mixtures Triethylamine + Water at Temperatures Ranging from (283.15 to 291.35) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.