- Name
- Sodium nitrate
- InChI
- InChI=1S/NO3.Na/c2-1(3)4;/q-1;+1
- InChI Key
- VWDWKYIASSYTQR-UHFFFAOYSA-N
- Formula
- NNaO3
- SMILES
- O=[N+]([O-])O[Na]
- Mol. Weight (g/mol)
- 84.99
- Name
- Glycine
- InChI
- InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)
- InChI Key
- DHMQDGOQFOQNFH-UHFFFAOYSA-N
- Formula
- C2H5NO2
- SMILES
- NCC(=O)O
- Mol. Weight (g/mol)
- 75.07
- CAS
- 56-40-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Glycine (2) - Liquid | Molality, mol/kg of Sodium nitrate (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 0.5000 | 0.8950 |
| 0.4000 | 0.5000 | 0.8830 |
| 0.8000 | 0.5000 | 0.8720 |
| 1.3 | 0.5000 | 0.8730 |
| 1.8 | 0.5000 | 0.8540 |
| 0.0000 | 1.0000 | 0.8650 |
| 0.2000 | 1.0000 | 0.8600 |
| 0.4000 | 1.0000 | 0.8500 |
| 0.8000 | 1.0000 | 0.8610 |
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Glycine (2) - Liquid | Molality, mol/kg of Sodium nitrate (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 1.0000 | 0.8540 |
| 0.2000 | 1.0000 | 0.8340 |
| 0.4030 | 1.0000 | 0.8320 |
| 0.6030 | 1.0000 | 0.8260 |
| 0.8120 | 1.0000 | 0.8160 |
| 1.001 | 1.0000 | 0.8100 |
| 1.195 | 1.0000 | 0.8160 |
| 1.403 | 1.0000 | 0.8150 |
| 1.608 | 1.0000 | 0.8050 |
| 1.797 | 1.0000 | 0.8170 |
| 1.991 | 1.0000 | 0.8180 |
| 2.176 | 1.0000 | 0.8060 |
| 2.603 | 1.0000 | 0.8170 |
| 2.999 | 1.0000 | 0.8260 |
| 0.0000 | 3.0 | 0.8050 |
| 0.2000 | 3.0 | 0.8150 |
| 0.4000 | 3.0 | 0.8080 |
| 0.6000 | 3.0 | 0.8130 |
| 0.7990 | 3.0 | 0.7960 |
| 0.9990 | 3.0 | 0.7930 |
| 1.5 | 3.0 | 0.7850 |
| 1.998 | 3.0 | 0.7790 |
| 2.5 | 3.0 | 0.7720 |
| 2.999 | 3.0 | 0.7700 |
Osmotic coefficient [ref]
Operational conditions:
- Molality, mol/kg = 0.242 (Liquid)
- Temperature, K = 310.15 (Liquid)
| Molality, mol/kg of Sodium nitrate (1) - Liquid | Osmotic coefficient - Liquid |
|---|---|
| 0.1080 | 0.9460 |
| 0.3690 | 0.8820 |
| 0.5270 | 0.8580 |
| 0.9600 | 0.8460 |
| 0.9890 | 0.8440 |
| 1.743 | 0.8200 |
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Glycine (2) - Liquid | Molality, mol/kg of Sodium nitrate (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 0.5000 | 0.8950 |
| 0.4000 | 0.5000 | 0.8830 |
| 0.8000 | 0.5000 | 0.8720 |
| 1.3 | 0.5000 | 0.8730 |
| 1.8 | 0.5000 | 0.8540 |
| 0.0000 | 1.0000 | 0.8650 |
| 0.2000 | 1.0000 | 0.8600 |
| 0.4000 | 1.0000 | 0.8500 |
| 0.8000 | 1.0000 | 0.8610 |
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Glycine (2) - Liquid | Molality, mol/kg of Sodium nitrate (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 1.0000 | 0.8540 |
| 0.2000 | 1.0000 | 0.8340 |
| 0.4030 | 1.0000 | 0.8320 |
| 0.6030 | 1.0000 | 0.8260 |
| 0.8120 | 1.0000 | 0.8160 |
| 1.001 | 1.0000 | 0.8100 |
| 1.195 | 1.0000 | 0.8160 |
| 1.403 | 1.0000 | 0.8150 |
| 1.608 | 1.0000 | 0.8050 |
| 1.797 | 1.0000 | 0.8170 |
| 1.991 | 1.0000 | 0.8180 |
| 2.176 | 1.0000 | 0.8060 |
| 2.603 | 1.0000 | 0.8170 |
| 2.999 | 1.0000 | 0.8260 |
| 0.0000 | 3.0 | 0.8050 |
| 0.2000 | 3.0 | 0.8150 |
| 0.4000 | 3.0 | 0.8080 |
| 0.6000 | 3.0 | 0.8130 |
| 0.7990 | 3.0 | 0.7960 |
| 0.9990 | 3.0 | 0.7930 |
| 1.5 | 3.0 | 0.7850 |
| 1.998 | 3.0 | 0.7790 |
| 2.5 | 3.0 | 0.7720 |
| 2.999 | 3.0 | 0.7700 |
Osmotic coefficient [ref]
Operational conditions:
- Molality, mol/kg = 0.242 (Liquid)
- Temperature, K = 310.15 (Liquid)
| Molality, mol/kg of Sodium nitrate (1) - Liquid | Osmotic coefficient - Liquid |
|---|---|
| 0.1080 | 0.9460 |
| 0.3690 | 0.8820 |
| 0.5270 | 0.8580 |
| 0.9600 | 0.8460 |
| 0.9890 | 0.8440 |
| 1.743 | 0.8200 |
Mole fraction of Glycine (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Sodium nitrate (1) - Liquid | Mole fraction of Glycine (2) - Liquid |
| 293.15 | 0.0000 | 0.0512 |
| 293.15 | 0.0100 | 0.0528 |
| 293.15 | 0.0300 | 0.0542 |
| 293.15 | 0.0500 | 0.0570 |
| 293.15 | 0.1000 | 0.0609 |
| 303.15 | 0.0000 | 0.0619 |
| 303.15 | 0.0100 | 0.0631 |
| 303.15 | 0.0300 | 0.0653 |
| 303.15 | 0.0500 | 0.0674 |
| 303.15 | 0.1000 | 0.0705 |
| 313.15 | 0.0000 | 0.0726 |
| 313.15 | 0.0100 | 0.0742 |
| 313.15 | 0.0300 | 0.0764 |
| 313.15 | 0.0500 | 0.0786 |
| 313.15 | 0.1000 | 0.0814 |
| 323.15 | 0.0000 | 0.0844 |
| 323.15 | 0.0100 | 0.0859 |
| 323.15 | 0.0300 | 0.0881 |
| 323.15 | 0.0500 | 0.0903 |
| 323.15 | 0.1000 | 0.0930 |
| 333.15 | 0.0000 | 0.0963 |
| 333.15 | 0.0100 | 0.0981 |
| 333.15 | 0.0300 | 0.1000 |
| 333.15 | 0.0500 | 0.1020 |
| 333.15 | 0.1000 | 0.1050 |
| 343.15 | 0.0000 | 0.1098 |
| 343.15 | 0.0100 | 0.1111 |
| 343.15 | 0.0300 | 0.1133 |
| 343.15 | 0.0500 | 0.1159 |
| 343.15 | 0.1000 | 0.1187 |
Molality, mol/kg of Glycine (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Sodium nitrate (1) - Liquid | Molality, mol/kg of Glycine (2) - Liquid |
|---|---|
| 1.0000 | 3.61 |
| 3.0 | 4.36 |
Mole fraction of Glycine (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Sodium nitrate (1) - Liquid | Mole fraction of Glycine (2) - Liquid |
| 293.15 | 0.0000 | 0.0512 |
| 293.15 | 0.0100 | 0.0528 |
| 293.15 | 0.0300 | 0.0542 |
| 293.15 | 0.0500 | 0.0570 |
| 293.15 | 0.1000 | 0.0609 |
| 303.15 | 0.0000 | 0.0619 |
| 303.15 | 0.0100 | 0.0631 |
| 303.15 | 0.0300 | 0.0653 |
| 303.15 | 0.0500 | 0.0674 |
| 303.15 | 0.1000 | 0.0705 |
| 313.15 | 0.0000 | 0.0726 |
| 313.15 | 0.0100 | 0.0742 |
| 313.15 | 0.0300 | 0.0764 |
| 313.15 | 0.0500 | 0.0786 |
| 313.15 | 0.1000 | 0.0814 |
| 323.15 | 0.0000 | 0.0844 |
| 323.15 | 0.0100 | 0.0859 |
| 323.15 | 0.0300 | 0.0881 |
| 323.15 | 0.0500 | 0.0903 |
| 323.15 | 0.1000 | 0.0930 |
| 333.15 | 0.0000 | 0.0963 |
| 333.15 | 0.0100 | 0.0981 |
| 333.15 | 0.0300 | 0.1000 |
| 333.15 | 0.0500 | 0.1020 |
| 333.15 | 0.1000 | 0.1050 |
| 343.15 | 0.0000 | 0.1098 |
| 343.15 | 0.0100 | 0.1111 |
| 343.15 | 0.0300 | 0.1133 |
| 343.15 | 0.0500 | 0.1159 |
| 343.15 | 0.1000 | 0.1187 |
Molality, mol/kg of Glycine (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Sodium nitrate (1) - Liquid | Molality, mol/kg of Glycine (2) - Liquid |
|---|---|
| 1.0000 | 3.61 |
| 3.0 | 4.36 |
Molar enthalpy of solution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
- Molality, mol/kg = 0.1 (Liquid)
| Solvent: Molality, mol/kg of Sodium nitrate (1) - Liquid | Molar enthalpy of solution, kJ/mol - Liquid |
|---|---|
| 0.0000 | 14.15 |
| 0.1997 | 13.68 |
| 0.4997 | 13.07 |
| 0.6996 | 12.69 |
| 0.9999 | 12.23 |
| 1.4967 | 11.27 |
| 2.0001 | 10.63 |
| 2.4433 | 10.25 |
| 2.9954 | 9.92 |
Apparent molar enthalpy, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
- Molality, mol/kg = 0.1 (Liquid)
| Solvent: Molality, mol/kg of Sodium nitrate (1) - Liquid | Apparent molar enthalpy, kJ/mol - Liquid |
|---|---|
| 0.0000 | 14.15 |
| 0.1997 | 13.68 |
| 0.4997 | 13.07 |
| 0.6996 | 12.69 |
| 0.9999 | 12.23 |
| 1.4967 | 11.27 |
| 2.0001 | 10.63 |
| 2.4433 | 10.25 |
| 2.9954 | 9.92 |
Molar enthalpy of solution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
- Molality, mol/kg = 0.1 (Liquid)
| Solvent: Molality, mol/kg of Sodium nitrate (1) - Liquid | Molar enthalpy of solution, kJ/mol - Liquid |
|---|---|
| 0.0000 | 14.15 |
| 0.1997 | 13.68 |
| 0.4997 | 13.07 |
| 0.6996 | 12.69 |
| 0.9999 | 12.23 |
| 1.4967 | 11.27 |
| 2.0001 | 10.63 |
| 2.4433 | 10.25 |
| 2.9954 | 9.92 |
Apparent molar enthalpy, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
- Molality, mol/kg = 0.1 (Liquid)
| Solvent: Molality, mol/kg of Sodium nitrate (1) - Liquid | Apparent molar enthalpy, kJ/mol - Liquid |
|---|---|
| 0.0000 | 14.15 |
| 0.1997 | 13.68 |
| 0.4997 | 13.07 |
| 0.6996 | 12.69 |
| 0.9999 | 12.23 |
| 1.4967 | 11.27 |
| 2.0001 | 10.63 |
| 2.4433 | 10.25 |
| 2.9954 | 9.92 |
Sources
- Solubility of alpha-glycine in water with additives at a temperature range of (293.15 - 343.15) K: Experimental data and results of thermodynamic modeling
- Measuring and modeling aqueous electrolyte/amino-acid solutions with ePC-SAFT
- Enthalpies of transfer of amino acids from water to aqueous solutions of sodium nitrate and sodium perchlorate at T = 298.15K
- Enthalpies of Transfer of Amino Acids from Water to Aqueous Solutions of Alkali Metal Nitrates
- Activity of Water and Osmotic Coefficients for Two- and Three-Basic Amino Acid Ternary Solutions