- Name
- Ammonium sulfate
- InChI
- InChI=1S/H8N2O4S/c1-5-7(3,4)6-2/h1-2H4
- InChI Key
- KTMPTTWZBSFVPI-UHFFFAOYSA-N
- Formula
- H8N2O4S
- SMILES
- NOS(=O)(=O)ON
- Mol. Weight (g/mol)
- 132.14
- CAS
- 7783-20-2
- Name
- Glycine
- InChI
- InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)
- InChI Key
- DHMQDGOQFOQNFH-UHFFFAOYSA-N
- Formula
- C2H5NO2
- SMILES
- NCC(=O)O
- Mol. Weight (g/mol)
- 75.07
- CAS
- 56-40-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Glycine (2) - Liquid | Molality, mol/kg of Ammonium sulfate (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 1.0000 | 0.6430 |
| 0.2000 | 1.0000 | 0.6610 |
| 0.3990 | 1.0000 | 0.6710 |
| 0.5990 | 1.0000 | 0.6800 |
| 0.8000 | 1.0000 | 0.6990 |
| 0.9980 | 1.0000 | 0.6860 |
| 1.499 | 1.0000 | 0.7120 |
| 1.999 | 1.0000 | 0.7270 |
| 2.496 | 1.0000 | 0.7290 |
| 3.0 | 1.0000 | 0.7510 |
| 3.499 | 1.0000 | 0.7650 |
| 0.0000 | 3.0 | 0.6290 |
| 0.2000 | 3.0 | 0.6360 |
| 0.3990 | 3.0 | 0.6550 |
| 0.5980 | 3.0 | 0.6540 |
| 0.7990 | 3.0 | 0.6590 |
| 0.9970 | 3.0 | 0.6700 |
| 1.499 | 3.0 | 0.6870 |
| 1.999 | 3.0 | 0.7020 |
| 2.494 | 3.0 | 0.7160 |
| 3.0 | 3.0 | 0.7220 |
(Relative) activity of Water (3) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Ammonium sulfate (1) - Liquid | Molality, mol/kg of Glycine (2) - Liquid | (Relative) activity of Water (3) - Liquid |
| 0.5000 | 0.4000 | 0.9760 |
| 0.5000 | 0.8025 | 0.9700 |
| 0.5000 | 1.1984 | 0.9640 |
| 0.5000 | 1.202 | 0.9640 |
| 0.5000 | 1.5973 | 0.9580 |
| 0.5000 | 2.001 | 0.9530 |
| 0.5000 | 2.3922 | 0.9470 |
| 0.5000 | 2.8027 | 0.9410 |
| 0.5000 | 2.9947 | 0.9380 |
| 0.5000 | 3.296 | 0.9330 |
| 1.0000 | 0.3006 | 0.9610 |
| 1.0000 | 0.7022 | 0.9550 |
| 1.0000 | 1.0962 | 0.9500 |
| 1.0000 | 1.4961 | 0.9440 |
| 1.0000 | 1.8979 | 0.9380 |
| 1.0000 | 2.3001 | 0.9320 |
| 1.0000 | 2.6966 | 0.9260 |
| 1.0000 | 3.097 | 0.9190 |
| 1.0000 | 3.5998 | 0.9110 |
| 2.0 | 0.1997 | 0.9310 |
| 2.0 | 0.5993 | 0.9250 |
| 2.0 | 0.9731 | 0.9190 |
| 2.0 | 1.4013 | 0.9120 |
| 2.0 | 1.7953 | 0.9060 |
| 2.0 | 2.1997 | 0.8990 |
| 2.0 | 2.6075 | 0.8930 |
| 2.0 | 2.9981 | 0.8860 |
| 2.0 | 3.4087 | 0.8800 |
| 2.0 | 3.7085 | 0.8740 |
| 3.5 | 0.3988 | 0.8770 |
| 3.5 | 0.7986 | 0.8720 |
| 3.5 | 1.2025 | 0.8650 |
| 3.5 | 1.6012 | 0.8580 |
| 3.5 | 1.9955 | 0.8520 |
| 3.5 | 2.3927 | 0.8460 |
| 3.5 | 2.804 | 0.8400 |
| 3.5 | 3.2023 | 0.8340 |
| 3.5 | 3.5953 | 0.8280 |
| 5.0 | 0.1992 | 0.8300 |
| 5.0 | 0.5990 | 0.8240 |
| 5.0 | 0.9984 | 0.8170 |
| 5.0 | 1.3944 | 0.8110 |
| 5.0 | 1.7863 | 0.8040 |
| 5.0 | 2.1962 | 0.7970 |
| 5.0 | 2.5897 | 0.7910 |
| 5.0 | 2.9829 | 0.7850 |
| 5.0 | 3.3931 | 0.7790 |
| 5.0 | 3.7044 | 0.7750 |
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Glycine (2) - Liquid | Molality, mol/kg of Ammonium sulfate (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 1.0000 | 0.6430 |
| 0.2000 | 1.0000 | 0.6610 |
| 0.3990 | 1.0000 | 0.6710 |
| 0.5990 | 1.0000 | 0.6800 |
| 0.8000 | 1.0000 | 0.6990 |
| 0.9980 | 1.0000 | 0.6860 |
| 1.499 | 1.0000 | 0.7120 |
| 1.999 | 1.0000 | 0.7270 |
| 2.496 | 1.0000 | 0.7290 |
| 3.0 | 1.0000 | 0.7510 |
| 3.499 | 1.0000 | 0.7650 |
| 0.0000 | 3.0 | 0.6290 |
| 0.2000 | 3.0 | 0.6360 |
| 0.3990 | 3.0 | 0.6550 |
| 0.5980 | 3.0 | 0.6540 |
| 0.7990 | 3.0 | 0.6590 |
| 0.9970 | 3.0 | 0.6700 |
| 1.499 | 3.0 | 0.6870 |
| 1.999 | 3.0 | 0.7020 |
| 2.494 | 3.0 | 0.7160 |
| 3.0 | 3.0 | 0.7220 |
(Relative) activity of Water (3) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Ammonium sulfate (1) - Liquid | Molality, mol/kg of Glycine (2) - Liquid | (Relative) activity of Water (3) - Liquid |
| 0.5000 | 0.4000 | 0.9760 |
| 0.5000 | 0.8025 | 0.9700 |
| 0.5000 | 1.1984 | 0.9640 |
| 0.5000 | 1.202 | 0.9640 |
| 0.5000 | 1.5973 | 0.9580 |
| 0.5000 | 2.001 | 0.9530 |
| 0.5000 | 2.3922 | 0.9470 |
| 0.5000 | 2.8027 | 0.9410 |
| 0.5000 | 2.9947 | 0.9380 |
| 0.5000 | 3.296 | 0.9330 |
| 1.0000 | 0.3006 | 0.9610 |
| 1.0000 | 0.7022 | 0.9550 |
| 1.0000 | 1.0962 | 0.9500 |
| 1.0000 | 1.4961 | 0.9440 |
| 1.0000 | 1.8979 | 0.9380 |
| 1.0000 | 2.3001 | 0.9320 |
| 1.0000 | 2.6966 | 0.9260 |
| 1.0000 | 3.097 | 0.9190 |
| 1.0000 | 3.5998 | 0.9110 |
| 2.0 | 0.1997 | 0.9310 |
| 2.0 | 0.5993 | 0.9250 |
| 2.0 | 0.9731 | 0.9190 |
| 2.0 | 1.4013 | 0.9120 |
| 2.0 | 1.7953 | 0.9060 |
| 2.0 | 2.1997 | 0.8990 |
| 2.0 | 2.6075 | 0.8930 |
| 2.0 | 2.9981 | 0.8860 |
| 2.0 | 3.4087 | 0.8800 |
| 2.0 | 3.7085 | 0.8740 |
| 3.5 | 0.3988 | 0.8770 |
| 3.5 | 0.7986 | 0.8720 |
| 3.5 | 1.2025 | 0.8650 |
| 3.5 | 1.6012 | 0.8580 |
| 3.5 | 1.9955 | 0.8520 |
| 3.5 | 2.3927 | 0.8460 |
| 3.5 | 2.804 | 0.8400 |
| 3.5 | 3.2023 | 0.8340 |
| 3.5 | 3.5953 | 0.8280 |
| 5.0 | 0.1992 | 0.8300 |
| 5.0 | 0.5990 | 0.8240 |
| 5.0 | 0.9984 | 0.8170 |
| 5.0 | 1.3944 | 0.8110 |
| 5.0 | 1.7863 | 0.8040 |
| 5.0 | 2.1962 | 0.7970 |
| 5.0 | 2.5897 | 0.7910 |
| 5.0 | 2.9829 | 0.7850 |
| 5.0 | 3.3931 | 0.7790 |
| 5.0 | 3.7044 | 0.7750 |
Mole fraction of Glycine (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Ammonium sulfate (1) - Liquid | Mole fraction of Glycine (2) - Liquid |
| 293.15 | 0.0100 | 0.0522 |
| 293.15 | 0.0500 | 0.0551 |
| 293.15 | 0.1000 | 0.0578 |
| 303.15 | 0.0100 | 0.0629 |
| 303.15 | 0.0500 | 0.0651 |
| 303.15 | 0.1000 | 0.0687 |
| 313.15 | 0.0100 | 0.0728 |
| 313.15 | 0.0500 | 0.0766 |
| 313.15 | 0.1000 | 0.0788 |
| 323.15 | 0.0100 | 0.0858 |
| 323.15 | 0.0500 | 0.0877 |
| 323.15 | 0.1000 | 0.0906 |
| 333.15 | 0.0100 | 0.0976 |
| 333.15 | 0.0500 | 0.1005 |
| 333.15 | 0.1000 | 0.1029 |
| 343.15 | 0.0100 | 0.1114 |
| 343.15 | 0.0500 | 0.1138 |
| 343.15 | 0.1000 | 0.1162 |
Mass ratio of solute to solvent of Glycine (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Ammonium sulfate (1) - Liquid | Temperature, K - Liquid | Mass ratio of solute to solvent of Glycine (2) - Liquid |
| 0.1670 | 298.15 | 0.2465 |
| 0.1670 | 323.15 | 0.3839 |
| 0.2330 | 298.15 | 0.2494 |
| 0.2330 | 323.15 | 0.3889 |
| 0.3330 | 298.15 | 0.2543 |
| 0.3340 | 323.15 | 0.3907 |
| 0.5000 | 298.15 | 0.2597 |
| 0.5000 | 323.15 | 0.3985 |
| 0.7000 | 298.15 | 0.2650 |
| 0.7000 | 323.15 | 0.4028 |
| 1.0000 | 298.15 | 0.2712 |
| 1.0000 | 323.15 | 0.4116 |
| 1.5 | 298.15 | 0.2748 |
| 1.5 | 323.15 | 0.4183 |
| 2.0 | 298.15 | 0.2772 |
| 2.0 | 323.15 | 0.4205 |
Molality, mol/kg of Glycine (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Ammonium sulfate (1) - Liquid | Molality, mol/kg of Glycine (2) - Liquid |
|---|---|
| 1.0000 | 3.61 |
| 3.0 | 3.64 |
Mole fraction of Glycine (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Ammonium sulfate (1) - Liquid | Mole fraction of Glycine (2) - Liquid |
| 293.15 | 0.0100 | 0.0522 |
| 293.15 | 0.0500 | 0.0551 |
| 293.15 | 0.1000 | 0.0578 |
| 303.15 | 0.0100 | 0.0629 |
| 303.15 | 0.0500 | 0.0651 |
| 303.15 | 0.1000 | 0.0687 |
| 313.15 | 0.0100 | 0.0728 |
| 313.15 | 0.0500 | 0.0766 |
| 313.15 | 0.1000 | 0.0788 |
| 323.15 | 0.0100 | 0.0858 |
| 323.15 | 0.0500 | 0.0877 |
| 323.15 | 0.1000 | 0.0906 |
| 333.15 | 0.0100 | 0.0976 |
| 333.15 | 0.0500 | 0.1005 |
| 333.15 | 0.1000 | 0.1029 |
| 343.15 | 0.0100 | 0.1114 |
| 343.15 | 0.0500 | 0.1138 |
| 343.15 | 0.1000 | 0.1162 |
Mass ratio of solute to solvent of Glycine (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of Ammonium sulfate (1) - Liquid | Temperature, K - Liquid | Mass ratio of solute to solvent of Glycine (2) - Liquid |
| 0.1670 | 298.15 | 0.2465 |
| 0.1670 | 323.15 | 0.3839 |
| 0.2330 | 298.15 | 0.2494 |
| 0.2330 | 323.15 | 0.3889 |
| 0.3330 | 298.15 | 0.2543 |
| 0.3340 | 323.15 | 0.3907 |
| 0.5000 | 298.15 | 0.2597 |
| 0.5000 | 323.15 | 0.3985 |
| 0.7000 | 298.15 | 0.2650 |
| 0.7000 | 323.15 | 0.4028 |
| 1.0000 | 298.15 | 0.2712 |
| 1.0000 | 323.15 | 0.4116 |
| 1.5 | 298.15 | 0.2748 |
| 1.5 | 323.15 | 0.4183 |
| 2.0 | 298.15 | 0.2772 |
| 2.0 | 323.15 | 0.4205 |
Molality, mol/kg of Glycine (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Ammonium sulfate (1) - Liquid | Molality, mol/kg of Glycine (2) - Liquid |
|---|---|
| 1.0000 | 3.61 |
| 3.0 | 3.64 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Solvent: Mole fraction = 0.0027 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Glycine (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0730 |
| 293.15 | 0.0002 | 0.0730 |
| 293.15 | 0.0004 | 0.0730 |
| 293.15 | 0.0007 | 0.0730 |
| 293.15 | 0.0011 | 0.0730 |
| 293.15 | 0.0015 | 0.0731 |
| 293.15 | 0.0018 | 0.0731 |
| 293.15 | 0.0022 | 0.0731 |
| 293.15 | 0.0028 | 0.0732 |
| 298.15 | 0.0000 | 0.0720 |
| 298.15 | 0.0002 | 0.0720 |
| 298.15 | 0.0004 | 0.0720 |
| 298.15 | 0.0007 | 0.0720 |
| 298.15 | 0.0011 | 0.0721 |
| 298.15 | 0.0015 | 0.0721 |
| 298.15 | 0.0018 | 0.0721 |
| 298.15 | 0.0022 | 0.0722 |
| 298.15 | 0.0028 | 0.0722 |
| 303.15 | 0.0000 | 0.0715 |
| 303.15 | 0.0002 | 0.0715 |
| 303.15 | 0.0004 | 0.0716 |
| 303.15 | 0.0007 | 0.0716 |
| 303.15 | 0.0011 | 0.0716 |
| 303.15 | 0.0015 | 0.0717 |
| 303.15 | 0.0018 | 0.0717 |
| 303.15 | 0.0022 | 0.0717 |
| 303.15 | 0.0028 | 0.0718 |
| 308.15 | 0.0000 | 0.0707 |
| 308.15 | 0.0002 | 0.0707 |
| 308.15 | 0.0004 | 0.0707 |
| 308.15 | 0.0007 | 0.0707 |
| 308.15 | 0.0011 | 0.0707 |
| 308.15 | 0.0015 | 0.0708 |
| 308.15 | 0.0018 | 0.0708 |
| 308.15 | 0.0022 | 0.0708 |
| 308.15 | 0.0028 | 0.0709 |
| 313.15 | 0.0000 | 0.0699 |
| 313.15 | 0.0002 | 0.0699 |
| 313.15 | 0.0004 | 0.0699 |
| 313.15 | 0.0007 | 0.0699 |
| 313.15 | 0.0011 | 0.0700 |
| 313.15 | 0.0015 | 0.0700 |
| 313.15 | 0.0018 | 0.0700 |
| 313.15 | 0.0022 | 0.0701 |
| 313.15 | 0.0028 | 0.0701 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Solvent: Mole fraction = 0.0027 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Glycine (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0730 |
| 293.15 | 0.0002 | 0.0730 |
| 293.15 | 0.0004 | 0.0730 |
| 293.15 | 0.0007 | 0.0730 |
| 293.15 | 0.0011 | 0.0730 |
| 293.15 | 0.0015 | 0.0731 |
| 293.15 | 0.0018 | 0.0731 |
| 293.15 | 0.0022 | 0.0731 |
| 293.15 | 0.0028 | 0.0732 |
| 298.15 | 0.0000 | 0.0720 |
| 298.15 | 0.0002 | 0.0720 |
| 298.15 | 0.0004 | 0.0720 |
| 298.15 | 0.0007 | 0.0720 |
| 298.15 | 0.0011 | 0.0721 |
| 298.15 | 0.0015 | 0.0721 |
| 298.15 | 0.0018 | 0.0721 |
| 298.15 | 0.0022 | 0.0722 |
| 298.15 | 0.0028 | 0.0722 |
| 303.15 | 0.0000 | 0.0715 |
| 303.15 | 0.0002 | 0.0715 |
| 303.15 | 0.0004 | 0.0716 |
| 303.15 | 0.0007 | 0.0716 |
| 303.15 | 0.0011 | 0.0716 |
| 303.15 | 0.0015 | 0.0717 |
| 303.15 | 0.0018 | 0.0717 |
| 303.15 | 0.0022 | 0.0717 |
| 303.15 | 0.0028 | 0.0718 |
| 308.15 | 0.0000 | 0.0707 |
| 308.15 | 0.0002 | 0.0707 |
| 308.15 | 0.0004 | 0.0707 |
| 308.15 | 0.0007 | 0.0707 |
| 308.15 | 0.0011 | 0.0707 |
| 308.15 | 0.0015 | 0.0708 |
| 308.15 | 0.0018 | 0.0708 |
| 308.15 | 0.0022 | 0.0708 |
| 308.15 | 0.0028 | 0.0709 |
| 313.15 | 0.0000 | 0.0699 |
| 313.15 | 0.0002 | 0.0699 |
| 313.15 | 0.0004 | 0.0699 |
| 313.15 | 0.0007 | 0.0699 |
| 313.15 | 0.0011 | 0.0700 |
| 313.15 | 0.0015 | 0.0700 |
| 313.15 | 0.0018 | 0.0700 |
| 313.15 | 0.0022 | 0.0701 |
| 313.15 | 0.0028 | 0.0701 |
Sources
- Solubility of alpha-glycine in water with additives at a temperature range of (293.15 - 343.15) K: Experimental data and results of thermodynamic modeling
- The effect of ammonium sulfate on the solubility of amino acids in water at (298.15 and 323.15) K
- Measuring and modeling aqueous electrolyte/amino-acid solutions with ePC-SAFT
- Surface Tension of Glycine, Alanine, Aminobutyric Acid, Norvaline, and Norleucine in Water and in Aqueous Solutions of Strong Electrolytes at Temperatures from (293.15 to 313.15) K
- Water Activity in Aqueous Amino Acid Solutions Containing Ammonium Sulfate at 298.2 K