- Name
- caffeine
- InChI
- InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3
- InChI Key
- RYYVLZVUVIJVGH-UHFFFAOYSA-N
- Formula
- C8H10N4O2
- SMILES
- Cn1c(=O)c2c(ncn2C)n(C)c1=O
- Mol. Weight (g/mol)
- 194.19
- CAS
- 58-08-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (4)
- η - Viscosity, Pa*s (4)
- ρl - Mass density, kg/m3 (6)
- csound,fluid - Speed of Sound, m/s (2)
Mole fraction of caffeine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of caffeine (1) - Liquid |
|---|---|
| 298.00 | 0.0019 |
| 303.00 | 0.0025 |
| 308.00 | 0.0031 |
| 313.00 | 0.0041 |
| 318.00 | 0.0052 |
| 323.00 | 0.0079 |
| 328.00 | 0.0096 |
| 333.00 | 0.0112 |
| 338.00 | 0.0135 |
| 343.00 | 0.0157 |
Mole fraction of caffeine (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of caffeine (1) - Liquid |
|---|---|
| 288.01 | 0.0012 |
| 298.11 | 0.0016 |
| 308.09 | 0.0023 |
| 318.11 | 0.0030 |
| 328.15 | 0.0040 |
Mole fraction of caffeine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of caffeine (1) - Liquid |
|---|---|
| 298.00 | 0.0019 |
| 303.00 | 0.0025 |
| 308.00 | 0.0031 |
| 313.00 | 0.0041 |
| 318.00 | 0.0052 |
| 323.00 | 0.0079 |
| 328.00 | 0.0096 |
| 333.00 | 0.0112 |
| 338.00 | 0.0135 |
| 343.00 | 0.0157 |
Mole fraction of caffeine (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of caffeine (1) - Liquid |
|---|---|
| 288.01 | 0.0012 |
| 298.11 | 0.0016 |
| 308.09 | 0.0023 |
| 318.11 | 0.0030 |
| 328.15 | 0.0040 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of caffeine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0051 | 0.0011 |
| 288.15 | 0.0069 | 0.0011 |
| 288.15 | 0.0090 | 0.0011 |
| 288.15 | 0.0199 | 0.0011 |
| 288.15 | 0.0298 | 0.0012 |
| 288.15 | 0.0353 | 0.0012 |
| 288.15 | 0.0398 | 0.0012 |
| 288.15 | 0.0495 | 0.0012 |
| 298.15 | 0.0051 | 0.0009 |
| 298.15 | 0.0069 | 0.0009 |
| 298.15 | 0.0090 | 0.0009 |
| 298.15 | 0.0199 | 0.0009 |
| 298.15 | 0.0298 | 0.0009 |
| 298.15 | 0.0353 | 0.0009 |
| 298.15 | 0.0398 | 0.0009 |
| 298.15 | 0.0495 | 0.0009 |
| 308.15 | 0.0051 | 0.0007 |
| 308.15 | 0.0069 | 0.0007 |
| 308.15 | 0.0090 | 0.0007 |
| 308.15 | 0.0199 | 0.0007 |
| 308.15 | 0.0298 | 0.0007 |
| 308.15 | 0.0353 | 0.0007 |
| 308.15 | 0.0398 | 0.0007 |
| 308.15 | 0.0495 | 0.0007 |
| 318.15 | 0.0051 | 0.0006 |
| 318.15 | 0.0069 | 0.0006 |
| 318.15 | 0.0090 | 0.0006 |
| 318.15 | 0.0199 | 0.0006 |
| 318.15 | 0.0298 | 0.0006 |
| 318.15 | 0.0353 | 0.0006 |
| 318.15 | 0.0398 | 0.0006 |
| 318.15 | 0.0495 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of caffeine (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 0.0051 | 288.15 | 0.0011 |
| 0.0069 | 288.15 | 0.0011 |
| 0.0090 | 288.15 | 0.0011 |
| 0.0199 | 288.15 | 0.0011 |
| 0.0298 | 288.15 | 0.0012 |
| 0.0353 | 288.15 | 0.0012 |
| 0.0398 | 288.15 | 0.0012 |
| 0.0495 | 288.15 | 0.0012 |
| 0.0051 | 298.15 | 0.0009 |
| 0.0069 | 298.15 | 0.0009 |
| 0.0090 | 298.15 | 0.0009 |
| 0.0199 | 298.15 | 0.0009 |
| 0.0298 | 298.15 | 0.0009 |
| 0.0353 | 298.15 | 0.0009 |
| 0.0398 | 298.15 | 0.0009 |
| 0.0495 | 298.15 | 0.0009 |
| 0.0051 | 308.15 | 0.0007 |
| 0.0069 | 308.15 | 0.0007 |
| 0.0090 | 308.15 | 0.0007 |
| 0.0199 | 308.15 | 0.0007 |
| 0.0298 | 308.15 | 0.0007 |
| 0.0353 | 308.15 | 0.0007 |
| 0.0398 | 308.15 | 0.0007 |
| 0.0495 | 308.15 | 0.0007 |
| 0.0051 | 318.15 | 0.0006 |
| 0.0069 | 318.15 | 0.0006 |
| 0.0090 | 318.15 | 0.0006 |
| 0.0199 | 318.15 | 0.0006 |
| 0.0298 | 318.15 | 0.0006 |
| 0.0353 | 318.15 | 0.0006 |
| 0.0398 | 318.15 | 0.0006 |
| 0.0495 | 318.15 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of caffeine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0051 | 0.0011 |
| 288.15 | 0.0069 | 0.0011 |
| 288.15 | 0.0090 | 0.0011 |
| 288.15 | 0.0199 | 0.0011 |
| 288.15 | 0.0298 | 0.0012 |
| 288.15 | 0.0353 | 0.0012 |
| 288.15 | 0.0398 | 0.0012 |
| 288.15 | 0.0495 | 0.0012 |
| 298.15 | 0.0051 | 0.0009 |
| 298.15 | 0.0069 | 0.0009 |
| 298.15 | 0.0090 | 0.0009 |
| 298.15 | 0.0199 | 0.0009 |
| 298.15 | 0.0298 | 0.0009 |
| 298.15 | 0.0353 | 0.0009 |
| 298.15 | 0.0398 | 0.0009 |
| 298.15 | 0.0495 | 0.0009 |
| 308.15 | 0.0051 | 0.0007 |
| 308.15 | 0.0069 | 0.0007 |
| 308.15 | 0.0090 | 0.0007 |
| 308.15 | 0.0199 | 0.0007 |
| 308.15 | 0.0298 | 0.0007 |
| 308.15 | 0.0353 | 0.0007 |
| 308.15 | 0.0398 | 0.0007 |
| 308.15 | 0.0495 | 0.0007 |
| 318.15 | 0.0051 | 0.0006 |
| 318.15 | 0.0069 | 0.0006 |
| 318.15 | 0.0090 | 0.0006 |
| 318.15 | 0.0199 | 0.0006 |
| 318.15 | 0.0298 | 0.0006 |
| 318.15 | 0.0353 | 0.0006 |
| 318.15 | 0.0398 | 0.0006 |
| 318.15 | 0.0495 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of caffeine (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 0.0051 | 288.15 | 0.0011 |
| 0.0069 | 288.15 | 0.0011 |
| 0.0090 | 288.15 | 0.0011 |
| 0.0199 | 288.15 | 0.0011 |
| 0.0298 | 288.15 | 0.0012 |
| 0.0353 | 288.15 | 0.0012 |
| 0.0398 | 288.15 | 0.0012 |
| 0.0495 | 288.15 | 0.0012 |
| 0.0051 | 298.15 | 0.0009 |
| 0.0069 | 298.15 | 0.0009 |
| 0.0090 | 298.15 | 0.0009 |
| 0.0199 | 298.15 | 0.0009 |
| 0.0298 | 298.15 | 0.0009 |
| 0.0353 | 298.15 | 0.0009 |
| 0.0398 | 298.15 | 0.0009 |
| 0.0495 | 298.15 | 0.0009 |
| 0.0051 | 308.15 | 0.0007 |
| 0.0069 | 308.15 | 0.0007 |
| 0.0090 | 308.15 | 0.0007 |
| 0.0199 | 308.15 | 0.0007 |
| 0.0298 | 308.15 | 0.0007 |
| 0.0353 | 308.15 | 0.0007 |
| 0.0398 | 308.15 | 0.0007 |
| 0.0495 | 308.15 | 0.0007 |
| 0.0051 | 318.15 | 0.0006 |
| 0.0069 | 318.15 | 0.0006 |
| 0.0090 | 318.15 | 0.0006 |
| 0.0199 | 318.15 | 0.0006 |
| 0.0298 | 318.15 | 0.0006 |
| 0.0353 | 318.15 | 0.0006 |
| 0.0398 | 318.15 | 0.0006 |
| 0.0495 | 318.15 | 0.0006 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of caffeine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0051 | 999.404 |
| 288.15 | 0.0069 | 999.505 |
| 288.15 | 0.0090 | 999.619 |
| 288.15 | 0.0199 | 1000.215 |
| 288.15 | 0.0299 | 1000.769 |
| 288.15 | 0.0353 | 1001.071 |
| 288.15 | 0.0401 | 1001.338 |
| 288.15 | 0.0499 | 1001.886 |
| 298.15 | 0.0051 | 997.304 |
| 298.15 | 0.0069 | 997.399 |
| 298.15 | 0.0090 | 997.504 |
| 298.15 | 0.0199 | 998.06 |
| 298.15 | 0.0299 | 998.576 |
| 298.15 | 0.0353 | 998.853 |
| 298.15 | 0.0401 | 999.101 |
| 298.15 | 0.0499 | 999.619 |
| 308.15 | 0.0051 | 994.303 |
| 308.15 | 0.0069 | 994.39 |
| 308.15 | 0.0090 | 994.488 |
| 308.15 | 0.0199 | 995.013 |
| 308.15 | 0.0299 | 995.497 |
| 308.15 | 0.0353 | 995.759 |
| 308.15 | 0.0401 | 996.001 |
| 308.15 | 0.0499 | 996.484 |
| 318.15 | 0.0051 | 990.464 |
| 318.15 | 0.0069 | 990.545 |
| 318.15 | 0.0090 | 990.637 |
| 318.15 | 0.0199 | 991.121 |
| 318.15 | 0.0299 | 991.571 |
| 318.15 | 0.0353 | 991.812 |
| 318.15 | 0.0401 | 992.025 |
| 318.15 | 0.0499 | 992.483 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of caffeine (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0051 | 288.15 | 999.404 |
| 0.0069 | 288.15 | 999.505 |
| 0.0090 | 288.15 | 999.619 |
| 0.0199 | 288.15 | 1000.215 |
| 0.0299 | 288.15 | 1000.769 |
| 0.0353 | 288.15 | 1001.071 |
| 0.0401 | 288.15 | 1001.338 |
| 0.0499 | 288.15 | 1001.886 |
| 0.0051 | 298.15 | 997.304 |
| 0.0069 | 298.15 | 997.399 |
| 0.0090 | 298.15 | 997.504 |
| 0.0199 | 298.15 | 998.06 |
| 0.0299 | 298.15 | 998.576 |
| 0.0353 | 298.15 | 998.853 |
| 0.0401 | 298.15 | 999.101 |
| 0.0499 | 298.15 | 999.619 |
| 0.0051 | 308.15 | 994.303 |
| 0.0069 | 308.15 | 994.39 |
| 0.0090 | 308.15 | 994.488 |
| 0.0199 | 308.15 | 995.013 |
| 0.0299 | 308.15 | 995.497 |
| 0.0353 | 308.15 | 995.759 |
| 0.0401 | 308.15 | 996.001 |
| 0.0499 | 308.15 | 996.484 |
| 0.0051 | 318.15 | 990.464 |
| 0.0069 | 318.15 | 990.545 |
| 0.0090 | 318.15 | 990.637 |
| 0.0199 | 318.15 | 991.121 |
| 0.0299 | 318.15 | 991.571 |
| 0.0353 | 318.15 | 991.812 |
| 0.0401 | 318.15 | 992.025 |
| 0.0499 | 318.15 | 992.483 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of caffeine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0050 | 998.731 |
| 293.15 | 0.0100 | 998.986 |
| 293.15 | 0.0200 | 999.492 |
| 293.15 | 0.0400 | 1000.685 |
| 293.15 | 0.0600 | 1001.781 |
| 298.15 | 0.0050 | 997.275 |
| 298.15 | 0.0100 | 997.549 |
| 298.15 | 0.0200 | 998.082 |
| 298.15 | 0.0400 | 999.091 |
| 298.15 | 0.0600 | 1000.023 |
| 303.15 | 0.0050 | 996.169 |
| 303.15 | 0.0100 | 996.422 |
| 303.15 | 0.0200 | 996.912 |
| 303.15 | 0.0400 | 997.986 |
| 303.15 | 0.0600 | 999.147 |
| 308.15 | 0.0050 | 994.279 |
| 308.15 | 0.0100 | 994.556 |
| 308.15 | 0.0200 | 995.092 |
| 308.15 | 0.0400 | 996.095 |
| 308.15 | 0.0600 | 997.015 |
| 313.15 | 0.0050 | 992.732 |
| 313.15 | 0.0100 | 992.974 |
| 313.15 | 0.0200 | 993.452 |
| 313.15 | 0.0400 | 994.51 |
| 313.15 | 0.0600 | 995.632 |
| 318.15 | 0.0050 | 990.833 |
| 318.15 | 0.0100 | 990.981 |
| 318.15 | 0.0200 | 991.327 |
| 318.15 | 0.0400 | 992.156 |
| 318.15 | 0.0600 | 992.958 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of caffeine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0051 | 999.404 |
| 288.15 | 0.0069 | 999.505 |
| 288.15 | 0.0090 | 999.619 |
| 288.15 | 0.0199 | 1000.215 |
| 288.15 | 0.0299 | 1000.769 |
| 288.15 | 0.0353 | 1001.071 |
| 288.15 | 0.0401 | 1001.338 |
| 288.15 | 0.0499 | 1001.886 |
| 298.15 | 0.0051 | 997.304 |
| 298.15 | 0.0069 | 997.399 |
| 298.15 | 0.0090 | 997.504 |
| 298.15 | 0.0199 | 998.06 |
| 298.15 | 0.0299 | 998.576 |
| 298.15 | 0.0353 | 998.853 |
| 298.15 | 0.0401 | 999.101 |
| 298.15 | 0.0499 | 999.619 |
| 308.15 | 0.0051 | 994.303 |
| 308.15 | 0.0069 | 994.39 |
| 308.15 | 0.0090 | 994.488 |
| 308.15 | 0.0199 | 995.013 |
| 308.15 | 0.0299 | 995.497 |
| 308.15 | 0.0353 | 995.759 |
| 308.15 | 0.0401 | 996.001 |
| 308.15 | 0.0499 | 996.484 |
| 318.15 | 0.0051 | 990.464 |
| 318.15 | 0.0069 | 990.545 |
| 318.15 | 0.0090 | 990.637 |
| 318.15 | 0.0199 | 991.121 |
| 318.15 | 0.0299 | 991.571 |
| 318.15 | 0.0353 | 991.812 |
| 318.15 | 0.0401 | 992.025 |
| 318.15 | 0.0499 | 992.483 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of caffeine (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0051 | 288.15 | 999.404 |
| 0.0069 | 288.15 | 999.505 |
| 0.0090 | 288.15 | 999.619 |
| 0.0199 | 288.15 | 1000.215 |
| 0.0299 | 288.15 | 1000.769 |
| 0.0353 | 288.15 | 1001.071 |
| 0.0401 | 288.15 | 1001.338 |
| 0.0499 | 288.15 | 1001.886 |
| 0.0051 | 298.15 | 997.304 |
| 0.0069 | 298.15 | 997.399 |
| 0.0090 | 298.15 | 997.504 |
| 0.0199 | 298.15 | 998.06 |
| 0.0299 | 298.15 | 998.576 |
| 0.0353 | 298.15 | 998.853 |
| 0.0401 | 298.15 | 999.101 |
| 0.0499 | 298.15 | 999.619 |
| 0.0051 | 308.15 | 994.303 |
| 0.0069 | 308.15 | 994.39 |
| 0.0090 | 308.15 | 994.488 |
| 0.0199 | 308.15 | 995.013 |
| 0.0299 | 308.15 | 995.497 |
| 0.0353 | 308.15 | 995.759 |
| 0.0401 | 308.15 | 996.001 |
| 0.0499 | 308.15 | 996.484 |
| 0.0051 | 318.15 | 990.464 |
| 0.0069 | 318.15 | 990.545 |
| 0.0090 | 318.15 | 990.637 |
| 0.0199 | 318.15 | 991.121 |
| 0.0299 | 318.15 | 991.571 |
| 0.0353 | 318.15 | 991.812 |
| 0.0401 | 318.15 | 992.025 |
| 0.0499 | 318.15 | 992.483 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of caffeine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0050 | 998.731 |
| 293.15 | 0.0100 | 998.986 |
| 293.15 | 0.0200 | 999.492 |
| 293.15 | 0.0400 | 1000.685 |
| 293.15 | 0.0600 | 1001.781 |
| 298.15 | 0.0050 | 997.275 |
| 298.15 | 0.0100 | 997.549 |
| 298.15 | 0.0200 | 998.082 |
| 298.15 | 0.0400 | 999.091 |
| 298.15 | 0.0600 | 1000.023 |
| 303.15 | 0.0050 | 996.169 |
| 303.15 | 0.0100 | 996.422 |
| 303.15 | 0.0200 | 996.912 |
| 303.15 | 0.0400 | 997.986 |
| 303.15 | 0.0600 | 999.147 |
| 308.15 | 0.0050 | 994.279 |
| 308.15 | 0.0100 | 994.556 |
| 308.15 | 0.0200 | 995.092 |
| 308.15 | 0.0400 | 996.095 |
| 308.15 | 0.0600 | 997.015 |
| 313.15 | 0.0050 | 992.732 |
| 313.15 | 0.0100 | 992.974 |
| 313.15 | 0.0200 | 993.452 |
| 313.15 | 0.0400 | 994.51 |
| 313.15 | 0.0600 | 995.632 |
| 318.15 | 0.0050 | 990.833 |
| 318.15 | 0.0100 | 990.981 |
| 318.15 | 0.0200 | 991.327 |
| 318.15 | 0.0400 | 992.156 |
| 318.15 | 0.0600 | 992.958 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of caffeine (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0050 | 1497.15 |
| 303.15 | 0.0050 | 1509.48 |
| 308.15 | 0.0050 | 1520.09 |
| 313.15 | 0.0050 | 1529.13 |
| 293.15 | 0.0050 | 1483.0 |
| 318.15 | 0.0050 | 1536.69 |
| 293.15 | 0.0100 | 1483.47 |
| 298.15 | 0.0100 | 1497.57 |
| 303.15 | 0.0100 | 1509.85 |
| 308.15 | 0.0100 | 1520.43 |
| 313.15 | 0.0100 | 1529.43 |
| 318.15 | 0.0100 | 1536.97 |
| 298.15 | 0.0200 | 1498.04 |
| 293.15 | 0.0200 | 1483.98 |
| 303.15 | 0.0200 | 1510.28 |
| 308.15 | 0.0200 | 1520.8 |
| 313.15 | 0.0200 | 1529.75 |
| 318.15 | 0.0200 | 1537.24 |
| 298.15 | 0.0400 | 1499.04 |
| 303.15 | 0.0400 | 1511.15 |
| 293.15 | 0.0400 | 1485.11 |
| 308.15 | 0.0400 | 1521.58 |
| 313.15 | 0.0400 | 1530.43 |
| 318.15 | 0.0400 | 1537.84 |
| 298.15 | 0.0600 | 1500.06 |
| 293.15 | 0.0600 | 1486.22 |
| 303.15 | 0.0600 | 1512.1 |
| 308.15 | 0.0600 | 1522.43 |
| 313.15 | 0.0600 | 1531.2 |
| 318.15 | 0.0600 | 1538.52 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of caffeine (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0050 | 1497.15 |
| 303.15 | 0.0050 | 1509.48 |
| 308.15 | 0.0050 | 1520.09 |
| 313.15 | 0.0050 | 1529.13 |
| 293.15 | 0.0050 | 1483.0 |
| 318.15 | 0.0050 | 1536.69 |
| 293.15 | 0.0100 | 1483.47 |
| 298.15 | 0.0100 | 1497.57 |
| 303.15 | 0.0100 | 1509.85 |
| 308.15 | 0.0100 | 1520.43 |
| 313.15 | 0.0100 | 1529.43 |
| 318.15 | 0.0100 | 1536.97 |
| 298.15 | 0.0200 | 1498.04 |
| 293.15 | 0.0200 | 1483.98 |
| 303.15 | 0.0200 | 1510.28 |
| 308.15 | 0.0200 | 1520.8 |
| 313.15 | 0.0200 | 1529.75 |
| 318.15 | 0.0200 | 1537.24 |
| 298.15 | 0.0400 | 1499.04 |
| 303.15 | 0.0400 | 1511.15 |
| 293.15 | 0.0400 | 1485.11 |
| 308.15 | 0.0400 | 1521.58 |
| 313.15 | 0.0400 | 1530.43 |
| 318.15 | 0.0400 | 1537.84 |
| 298.15 | 0.0600 | 1500.06 |
| 293.15 | 0.0600 | 1486.22 |
| 303.15 | 0.0600 | 1512.1 |
| 308.15 | 0.0600 | 1522.43 |
| 313.15 | 0.0600 | 1531.2 |
| 318.15 | 0.0600 | 1538.52 |
Sources
- Thermodynamic modeling studies of aqueous solubility of caffeine, gallic acid and their cocrystal in the temperature range of 303 K-363 K
- Volumetric, Viscometric and Spectroscopic Approach to Study the Solvation Behavior of Xanthine Drugs in Aqueous Solutions of NaCl at T = 288.15 318.15 K and at p = 101.325 kPa
- Measurement and Correlation of Solubility of Theobromine, Theophylline, and Caffeine in Water and Organic Solvents at Various Temperatures
- Volumetric, Viscometric, and 1H NMR Studies on Caffeine, Theophylline, and Theobromine in Aqueous Solutions of MgCl2 at Temperatures T = (288.15 to 318.15) K and at Pressure p = 101.3 kPa
- Effect of Caffeine on the Physicochemical Properties of Neurotransmitter GABA: Thermodynamic and Theoretical Approach