- Name
- N,N,N',N'',N''-pentamethyldiethylenetriamine
- InChI
- InChI=1S/C9H23N3/c1-10(2)6-8-12(5)9-7-11(3)4/h6-9H2,1-5H3
- InChI Key
- UKODFQOELJFMII-UHFFFAOYSA-N
- Formula
- C9H23N3
- SMILES
- CN(C)CCN(C)CCN(C)C
- Mol. Weight (g/mol)
- 173.30
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of N,N,N',N'',N''-pentamethyldiethylenetriamine (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 303.15 | 0.0486 | -2.682 |
| 303.15 | 0.0990 | -3.968 |
| 303.15 | 0.1500 | -4.3 |
| 303.15 | 0.2072 | -4.511 |
| 303.15 | 0.2492 | -4.391 |
| 303.15 | 0.3000 | -4.185 |
| 303.15 | 0.4063 | -3.52 |
| 303.15 | 0.4895 | -3.043 |
| 303.15 | 0.6117 | -2.252 |
| 323.15 | 0.0506 | -2.347 |
| 323.15 | 0.1024 | -3.453 |
| 323.15 | 0.1500 | -3.8 |
| 323.15 | 0.2000 | -3.981 |
| 323.15 | 0.2500 | -3.88 |
| 323.15 | 0.3062 | -3.634 |
| 323.15 | 0.4001 | -3.223 |
| 323.15 | 0.5005 | -2.584 |
| 323.15 | 0.6001 | -2.002 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of N,N,N',N'',N''-pentamethyldiethylenetriamine (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 303.15 | 0.0486 | -2.682 |
| 303.15 | 0.0990 | -3.968 |
| 303.15 | 0.1500 | -4.3 |
| 303.15 | 0.2072 | -4.511 |
| 303.15 | 0.2492 | -4.391 |
| 303.15 | 0.3000 | -4.185 |
| 303.15 | 0.4063 | -3.52 |
| 303.15 | 0.4895 | -3.043 |
| 303.15 | 0.6117 | -2.252 |
| 323.15 | 0.0506 | -2.347 |
| 323.15 | 0.1024 | -3.453 |
| 323.15 | 0.1500 | -3.8 |
| 323.15 | 0.2000 | -3.981 |
| 323.15 | 0.2500 | -3.88 |
| 323.15 | 0.3062 | -3.634 |
| 323.15 | 0.4001 | -3.223 |
| 323.15 | 0.5005 | -2.584 |
| 323.15 | 0.6001 | -2.002 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of N,N,N',N'',N''-pentamethyldiethylenetriamine (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 283.15 | 0.1330 | 0.87 |
| 283.15 | 0.3016 | 0.68 |
| 283.15 | 0.4120 | 0.58 |
| 283.15 | 0.5328 | 0.53 |
| 283.15 | 0.6713 | 0.47 |
| 283.15 | 0.7685 | 0.41 |
| 283.15 | 0.8999 | 0.24 |
| 293.15 | 0.1330 | 1.75 |
| 293.15 | 0.3016 | 1.40 |
| 293.15 | 0.4120 | 1.21 |
| 293.15 | 0.5328 | 1.12 |
| 293.15 | 0.6713 | 0.98 |
| 293.15 | 0.7685 | 0.85 |
| 293.15 | 0.8999 | 0.50 |
| 303.15 | 0.1330 | 3.33 |
| 303.15 | 0.3016 | 2.74 |
| 303.15 | 0.4120 | 2.40 |
| 303.15 | 0.5328 | 2.23 |
| 303.15 | 0.6713 | 1.95 |
| 303.15 | 0.7685 | 1.66 |
| 303.15 | 0.8999 | 0.97 |
| 313.15 | 0.1330 | 6.01 |
| 313.15 | 0.3016 | 5.09 |
| 313.15 | 0.4120 | 4.49 |
| 313.15 | 0.5328 | 4.18 |
| 313.15 | 0.6713 | 3.66 |
| 313.15 | 0.7685 | 3.05 |
| 313.15 | 0.8999 | 1.78 |
| 323.15 | 0.1330 | 10.40 |
| 323.15 | 0.3016 | 9.03 |
| 323.15 | 0.4120 | 8.01 |
| 323.15 | 0.5328 | 7.49 |
| 323.15 | 0.6713 | 6.53 |
| 323.15 | 0.7685 | 5.36 |
| 323.15 | 0.8999 | 3.10 |
| 333.15 | 0.1330 | 17.29 |
| 333.15 | 0.3016 | 15.34 |
| 333.15 | 0.4120 | 13.71 |
| 333.15 | 0.5328 | 12.84 |
| 333.15 | 0.6713 | 11.16 |
| 333.15 | 0.7685 | 9.04 |
| 333.15 | 0.8999 | 5.18 |
| 343.15 | 0.1330 | 27.73 |
| 343.15 | 0.3016 | 25.12 |
| 343.15 | 0.4120 | 22.60 |
| 343.15 | 0.5328 | 21.20 |
| 343.15 | 0.6713 | 18.36 |
| 343.15 | 0.7685 | 14.66 |
| 343.15 | 0.8999 | 8.31 |
| 353.15 | 0.1330 | 43.08 |
| 353.15 | 0.3016 | 39.79 |
| 353.15 | 0.4120 | 36.01 |
| 353.15 | 0.5328 | 33.81 |
| 353.15 | 0.6713 | 29.19 |
| 353.15 | 0.7685 | 23.01 |
| 353.15 | 0.8999 | 12.90 |
| 363.15 | 0.1330 | 65.02 |
| 363.15 | 0.3016 | 61.15 |
| 363.15 | 0.4120 | 55.65 |
| 363.15 | 0.5328 | 52.28 |
| 363.15 | 0.6713 | 44.97 |
| 363.15 | 0.7685 | 35.05 |
| 363.15 | 0.8999 | 19.42 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of N,N,N',N'',N''-pentamethyldiethylenetriamine (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 283.15 | 0.1330 | 0.87 |
| 283.15 | 0.3016 | 0.68 |
| 283.15 | 0.4120 | 0.58 |
| 283.15 | 0.5328 | 0.53 |
| 283.15 | 0.6713 | 0.47 |
| 283.15 | 0.7685 | 0.41 |
| 283.15 | 0.8999 | 0.24 |
| 293.15 | 0.1330 | 1.75 |
| 293.15 | 0.3016 | 1.40 |
| 293.15 | 0.4120 | 1.21 |
| 293.15 | 0.5328 | 1.12 |
| 293.15 | 0.6713 | 0.98 |
| 293.15 | 0.7685 | 0.85 |
| 293.15 | 0.8999 | 0.50 |
| 303.15 | 0.1330 | 3.33 |
| 303.15 | 0.3016 | 2.74 |
| 303.15 | 0.4120 | 2.40 |
| 303.15 | 0.5328 | 2.23 |
| 303.15 | 0.6713 | 1.95 |
| 303.15 | 0.7685 | 1.66 |
| 303.15 | 0.8999 | 0.97 |
| 313.15 | 0.1330 | 6.01 |
| 313.15 | 0.3016 | 5.09 |
| 313.15 | 0.4120 | 4.49 |
| 313.15 | 0.5328 | 4.18 |
| 313.15 | 0.6713 | 3.66 |
| 313.15 | 0.7685 | 3.05 |
| 313.15 | 0.8999 | 1.78 |
| 323.15 | 0.1330 | 10.40 |
| 323.15 | 0.3016 | 9.03 |
| 323.15 | 0.4120 | 8.01 |
| 323.15 | 0.5328 | 7.49 |
| 323.15 | 0.6713 | 6.53 |
| 323.15 | 0.7685 | 5.36 |
| 323.15 | 0.8999 | 3.10 |
| 333.15 | 0.1330 | 17.29 |
| 333.15 | 0.3016 | 15.34 |
| 333.15 | 0.4120 | 13.71 |
| 333.15 | 0.5328 | 12.84 |
| 333.15 | 0.6713 | 11.16 |
| 333.15 | 0.7685 | 9.04 |
| 333.15 | 0.8999 | 5.18 |
| 343.15 | 0.1330 | 27.73 |
| 343.15 | 0.3016 | 25.12 |
| 343.15 | 0.4120 | 22.60 |
| 343.15 | 0.5328 | 21.20 |
| 343.15 | 0.6713 | 18.36 |
| 343.15 | 0.7685 | 14.66 |
| 343.15 | 0.8999 | 8.31 |
| 353.15 | 0.1330 | 43.08 |
| 353.15 | 0.3016 | 39.79 |
| 353.15 | 0.4120 | 36.01 |
| 353.15 | 0.5328 | 33.81 |
| 353.15 | 0.6713 | 29.19 |
| 353.15 | 0.7685 | 23.01 |
| 353.15 | 0.8999 | 12.90 |
| 363.15 | 0.1330 | 65.02 |
| 363.15 | 0.3016 | 61.15 |
| 363.15 | 0.4120 | 55.65 |
| 363.15 | 0.5328 | 52.28 |
| 363.15 | 0.6713 | 44.97 |
| 363.15 | 0.7685 | 35.05 |
| 363.15 | 0.8999 | 19.42 |
Sources
- Excess molar enthalpies for binary mixtures of different amines with water
- Vapour-liquid equilibria, enthalpy of vaporisation, and excess Gibbs energies of binary mixtures of {3,3-diamino-N-methyldipropylamine (DNM) (or N,N,N',N'',N''-pentamethyldiethylenetriamine (PMDETA)) + water}
Note: These property values are available through the Cheméo API. A free account gives you an access key.