- Name
- Heptadecane
- InChI
- InChI=1S/C17H36/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2/h3-17H2,1-2H3
- InChI Key
- NDJKXXJCMXVBJW-UHFFFAOYSA-N
- Formula
- C17H36
- SMILES
- CCCCCCCCCCCCCCCCC
- Mol. Weight (g/mol)
- 240.47
- CAS
- 629-78-7
- Name
- Acetic acid, butyl ester
- InChI
- InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3
- InChI Key
- DKPFZGUDAPQIHT-UHFFFAOYSA-N
- Formula
- C6H12O2
- SMILES
- CCCCOC(C)=O
- Mol. Weight (g/mol)
- 116.16
- CAS
- 123-86-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 318.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetic acid, butyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0954 | 0.4622 |
| 0.1878 | 0.8414 |
| 0.2686 | 1.1255 |
| 0.3397 | 1.3312 |
| 0.4009 | 1.4619 |
| 0.4599 | 1.5512 |
| 0.5118 | 1.597 |
| 0.5532 | 1.6002 |
| 0.5903 | 1.5958 |
| 0.5962 | 1.5934 |
| 0.6293 | 1.543 |
| 0.6674 | 1.4744 |
| 0.7073 | 1.3893 |
| 0.7491 | 1.2734 |
| 0.7926 | 1.1331 |
| 0.8356 | 0.9700 |
| 0.8781 | 0.7831 |
| 0.9208 | 0.5574 |
| 0.9615 | 0.2994 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 318.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetic acid, butyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0954 | 0.4622 |
| 0.1878 | 0.8414 |
| 0.2686 | 1.1255 |
| 0.3397 | 1.3312 |
| 0.4009 | 1.4619 |
| 0.4599 | 1.5512 |
| 0.5118 | 1.597 |
| 0.5532 | 1.6002 |
| 0.5903 | 1.5958 |
| 0.5962 | 1.5934 |
| 0.6293 | 1.543 |
| 0.6674 | 1.4744 |
| 0.7073 | 1.3893 |
| 0.7491 | 1.2734 |
| 0.7926 | 1.1331 |
| 0.8356 | 0.9700 |
| 0.8781 | 0.7831 |
| 0.9208 | 0.5574 |
| 0.9615 | 0.2994 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 318.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetic acid, butyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0632 | 1.9700e-07 |
| 0.1040 | 3.4700e-07 |
| 0.1206 | 3.8500e-07 |
| 0.1949 | 5.9000e-07 |
| 0.2755 | 7.8000e-07 |
| 0.3444 | 9.0000e-07 |
| 0.4115 | 9.7900e-07 |
| 0.4696 | 1.0480e-06 |
| 0.5150 | 1.0820e-06 |
| 0.5713 | 1.0820e-06 |
| 0.6623 | 1.0300e-06 |
| 0.7646 | 9.0600e-07 |
| 0.8420 | 6.9500e-07 |
| 0.8976 | 5.2000e-07 |
| 0.9384 | 3.4700e-07 |
| 0.9717 | 1.7900e-07 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 318.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetic acid, butyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0632 | 1.9700e-07 |
| 0.1040 | 3.4700e-07 |
| 0.1206 | 3.8500e-07 |
| 0.1949 | 5.9000e-07 |
| 0.2755 | 7.8000e-07 |
| 0.3444 | 9.0000e-07 |
| 0.4115 | 9.7900e-07 |
| 0.4696 | 1.0480e-06 |
| 0.5150 | 1.0820e-06 |
| 0.5713 | 1.0820e-06 |
| 0.6623 | 1.0300e-06 |
| 0.7646 | 9.0600e-07 |
| 0.8420 | 6.9500e-07 |
| 0.8976 | 5.2000e-07 |
| 0.9384 | 3.4700e-07 |
| 0.9717 | 1.7900e-07 |