- InChI
- InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3
- InChI Key
- DKPFZGUDAPQIHT-UHFFFAOYSA-N
- Formula
- C6H12O2
- SMILES
- CCCCOC(C)=O
- Molecular Weight1
- 116.16
- CAS
- 123-86-4
- Other Names
-
- 1-Acetoxybutane
- 1-Butanol, acetate
- 1-Butyl acetate
- Acetate de butyle
- Acetic acid butyl ester
- Acetic acid n-butyl ester
- BUTYL ACETATE
- BUTYL ETHANOATE
- Butile
- Butile(acetati di)
- Butyl ester of acetic acid
- Butyl ester, acetic acid
- Butylacetat
- Butylacetaten
- Butyle
- Butyle (acetate de)
- Butylester kyseliny octove
- CH3COO(CH2)3CH3
- N-BUTYL ACETATE
- NSC 9298
- UN 1123
- ethanoic acid, butyl ester
- n-Butyl ethanoate
- ω : Acentric Factor.
- Tig : Autoignition Temperature (K).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- LFL : Lower Flammability Limit (% in Air).
- UFL : Upper Flammability Limit (% in Air).
- Tflash,cc : Flash Point (Closed Cup Method) (K).
- Tflash,oc : Flash Point (Open Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Rg : Radius of Gyration.
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4170 | KDB | |
| Tig | 677.59 | K | KDB |
| ΔcH°liquid | [-3543.00; -3467.00] | kJ/mol |
|
| ΔcH°liquid | -3467.00 | kJ/mol | NIST |
| ΔcH°liquid | -3543.00 | kJ/mol | NIST |
| μ | 1.80 | debye | KDB |
| η | 0.0006680 | Pa×s | Excess Molar Volumes and Viscosity Deviations of Binary Liquid Mixtures of 1,3-Dioxolane and 1,4-Dioxane with Butyl Acetate, Butyric Acid, Butylamine, and 2-Butanone at 298.15 K |
| LFL | 1.70 | % in Air | KDB |
| UFL | 7.60 | % in Air | KDB |
| Tflash,cc | 310.37 | K | KDB |
| Tflash,oc | 297.04 | K | KDB |
| ΔfG° | -234.28 | kJ/mol | Joback Calculated Property |
| Rg | 4.1700 | KDB | |
| ΔfH°gas | [-566.00; -486.80] | kJ/mol |
|
| ΔfH°gas | -486.80 | kJ/mol | KDB |
| ΔfH°gas | -566.00 | kJ/mol | NIST |
| ΔfH°liquid | -609.60 | kJ/mol | NIST |
| ΔfusH° | 14.08 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [37.50; 43.89] | kJ/mol |
|
| ΔvapH° | 43.89 | kJ/mol | NIST |
| ΔvapH° | 42.40 | kJ/mol | NIST |
| ΔvapH° | 42.70 | kJ/mol | NIST |
| ΔvapH° | 43.10 | kJ/mol | NIST |
| ΔvapH° | 41.00 ± 0.50 | kJ/mol | NIST |
| ΔvapH° | 43.60 ± 0.50 | kJ/mol | NIST |
| ΔvapH° | 43.70 ± 0.20 | kJ/mol | NIST |
| ΔvapH° | 43.60 ± 0.20 | kJ/mol | NIST |
| ΔvapH° | 43.60 ± 0.20 | kJ/mol | NIST |
| ΔvapH° | Outlier 37.50 | kJ/mol | NIST |
| IE | [9.56; 10.17] | eV |
|
| IE | 9.92 ± 0.05 | eV | NIST |
| IE | 10.01 | eV | NIST |
| IE | 9.56 ± 0.03 | eV | NIST |
| IE | 10.02 ± 0.05 | eV | NIST |
| IE | 10.17 | eV | NIST |
| log10WS | -1.24 | Aq. Solubility Prediction | |
| logPoct/wat | 1.350 | Crippen Calculated Property | |
| McVol | 102.840 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 3 | KDB | |
| NFPA Health | 1 | KDB | |
| Pc | [3090.00; 3140.00] | kPa |
|
| Pc | 3140.00 | kPa | KDB |
| Pc | 3090.00 ± 20.00 | kPa | NIST |
| Pc | 3100.00 ± 101.32 | kPa | NIST |
| Inp | [769.00; 830.10] |
|
|
| Inp | 796.20 | NIST | |
| Inp | 784.76 | NIST | |
| Inp | 805.85 | NIST | |
| Inp | 805.20 | NIST | |
| Inp | 801.50 | NIST | |
| Inp | 804.70 | NIST | |
| Inp | 801.60 | NIST | |
| Inp | 799.40 | NIST | |
| Inp | 798.20 | NIST | |
| Inp | 796.80 | NIST | |
| Inp | 797.88 | NIST | |
| Inp | 797.88 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 809.40 | NIST | |
| Inp | 808.30 | NIST | |
| Inp | 806.60 | NIST | |
| Inp | 786.00 | NIST | |
| Inp | Outlier 774.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 786.00 | NIST | |
| Inp | Outlier 774.00 | NIST | |
| Inp | 781.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 790.00 | NIST | |
| Inp | 818.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 792.00 | NIST | |
| Inp | Outlier 770.00 | NIST | |
| Inp | 796.40 | NIST | |
| Inp | 784.00 | NIST | |
| Inp | 786.00 | NIST | |
| Inp | 786.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 802.00 | NIST | |
| Inp | 805.00 | NIST | |
| Inp | 787.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 799.00 | NIST | |
| Inp | 804.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 802.00 | NIST | |
| Inp | 801.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 799.00 | NIST | |
| Inp | 817.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 788.00 | NIST | |
| Inp | 789.00 | NIST | |
| Inp | 805.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 787.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | Outlier 775.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 797.00 | NIST | |
| Inp | 814.00 | NIST | |
| Inp | 804.90 | NIST | |
| Inp | 820.00 | NIST | |
| Inp | 816.00 | NIST | |
| Inp | 791.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 792.30 | NIST | |
| Inp | 795.00 | NIST | |
| Inp | 791.00 | NIST | |
| Inp | 791.00 | NIST | |
| Inp | 811.00 | NIST | |
| Inp | 818.00 | NIST | |
| Inp | Outlier 830.10 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 817.00 | NIST | |
| Inp | 797.00 | NIST | |
| Inp | 799.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 819.00 | NIST | |
| Inp | 802.00 | NIST | |
| Inp | 812.80 | NIST | |
| Inp | 802.00 | NIST | |
| Inp | 814.00 | NIST | |
| Inp | 814.00 | NIST | |
| Inp | 820.00 | NIST | |
| Inp | 816.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 791.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 792.00 | NIST | |
| Inp | 790.00 | NIST | |
| Inp | 788.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 805.00 | NIST | |
| Inp | Outlier 769.00 | NIST | |
| Inp | 809.00 | NIST | |
| Inp | 786.00 | NIST | |
| Inp | 816.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 817.00 | NIST | |
| Inp | Outlier 828.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 820.00 | NIST | |
| Inp | 819.00 | NIST | |
| Inp | Outlier 829.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 817.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 795.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 795.00 | NIST | |
| Inp | 808.00 | NIST | |
| Inp | 807.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 799.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 789.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 786.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 818.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 814.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 797.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 808.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 819.00 | NIST | |
| Inp | 811.00 | NIST | |
| Inp | Outlier 776.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 820.00 | NIST | |
| Inp | 819.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 808.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 811.00 | NIST | |
| Inp | 814.00 | NIST | |
| Inp | 816.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 804.00 | NIST | |
| Inp | 799.00 | NIST | |
| Inp | 795.00 | NIST | |
| Inp | 802.00 | NIST | |
| Inp | 802.00 | NIST | |
| Inp | 795.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 799.00 | NIST | |
| Inp | 797.00 | NIST | |
| Inp | 799.00 | NIST | |
| Inp | 796.00 | NIST | |
| Inp | 789.00 | NIST | |
| Inp | 791.00 | NIST | |
| Inp | 788.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 793.00 | NIST | |
| Inp | 819.00 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 795.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 796.20 | NIST | |
| Inp | 804.70 | NIST | |
| Inp | 797.88 | NIST | |
| Inp | 806.60 | NIST | |
| Inp | Outlier 774.00 | NIST | |
| Inp | 786.00 | NIST | |
| Inp | 805.00 | NIST | |
| I | [1036.00; 1114.00] |
|
|
| I | 1082.00 | NIST | |
| I | 1053.00 | NIST | |
| I | 1064.00 | NIST | |
| I | 1080.00 | NIST | |
| I | 1079.00 | NIST | |
| I | 1091.00 | NIST | |
| I | Outlier 1036.00 | NIST | |
| I | 1068.00 | NIST | |
| I | 1085.00 | NIST | |
| I | 1078.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1086.00 | NIST | |
| I | 1095.00 | NIST | |
| I | 1078.00 | NIST | |
| I | 1070.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1070.00 | NIST | |
| I | 1080.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1049.00 | NIST | |
| I | Outlier 1100.00 | NIST | |
| I | Outlier 1105.00 | NIST | |
| I | Outlier 1100.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1057.00 | NIST | |
| I | 1067.00 | NIST | |
| I | 1052.00 | NIST | |
| I | 1086.80 | NIST | |
| I | 1072.00 | NIST | |
| I | 1052.00 | NIST | |
| I | 1056.00 | NIST | |
| I | 1052.00 | NIST | |
| I | 1078.00 | NIST | |
| I | 1086.00 | NIST | |
| I | 1072.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1072.00 | NIST | |
| I | 1050.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1064.00 | NIST | |
| I | 1066.00 | NIST | |
| I | 1076.20 | NIST | |
| I | 1075.20 | NIST | |
| I | 1077.40 | NIST | |
| I | 1074.50 | NIST | |
| I | 1074.00 | NIST | |
| I | 1074.40 | NIST | |
| I | 1073.70 | NIST | |
| I | 1074.10 | NIST | |
| I | 1057.00 | NIST | |
| I | 1058.00 | NIST | |
| I | 1065.00 | NIST | |
| I | 1077.00 | NIST | |
| I | 1085.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1080.00 | NIST | |
| I | 1062.00 | NIST | |
| I | 1062.00 | NIST | |
| I | 1074.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1080.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1067.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1073.00 | NIST | |
| I | 1065.00 | NIST | |
| I | 1093.00 | NIST | |
| I | 1068.00 | NIST | |
| I | 1046.00 | NIST | |
| I | 1074.00 | NIST | |
| I | 1070.00 | NIST | |
| I | 1077.00 | NIST | |
| I | 1064.00 | NIST | |
| I | 1088.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1066.00 | NIST | |
| I | 1070.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1092.00 | NIST | |
| I | Outlier 1105.00 | NIST | |
| I | 1072.00 | NIST | |
| I | 1072.00 | NIST | |
| I | Outlier 1100.00 | NIST | |
| I | 1047.00 | NIST | |
| I | 1076.00 | NIST | |
| I | 1072.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1071.00 | NIST | |
| I | 1071.00 | NIST | |
| I | 1076.00 | NIST | |
| I | 1077.00 | NIST | |
| I | 1070.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1068.00 | NIST | |
| I | 1070.00 | NIST | |
| I | Outlier 1114.00 | NIST | |
| I | 1063.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1098.00 | NIST | |
| I | Outlier 1040.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1088.00 | NIST | |
| I | 1077.00 | NIST | |
| I | 1085.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1065.00 | NIST | |
| I | 1070.00 | NIST | |
| I | 1070.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1073.00 | NIST | |
| I | 1074.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1057.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1060.00 | NIST | |
| I | 1086.00 | NIST | |
| I | 1068.00 | NIST | |
| I | 1086.00 | NIST | |
| I | 1086.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1070.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1091.00 | NIST | |
| I | 1078.00 | NIST | |
| I | 1046.00 | NIST | |
| I | 1088.00 | NIST | |
| I | 1092.00 | NIST | |
| I | 1047.00 | NIST | |
| I | 1071.00 | NIST | |
| I | 1068.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1049.00 | NIST | |
| I | 1057.00 | NIST | |
| I | 1052.00 | NIST | |
| I | 1072.00 | NIST | |
| I | 1064.00 | NIST | |
| I | 1074.50 | NIST | |
| I | 1077.00 | NIST | |
| I | 1062.00 | NIST | |
| I | 1063.00 | NIST | |
| I | 1059.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1073.00 | NIST | |
| I | 1060.00 | NIST | |
| I | 1091.00 | NIST | |
| Tboil | [397.70; 399.85] | K |
|
| Tboil | 399.20 | K | KDB |
| Tboil | 399.11 | K | Vapor liquid equilibria for the binary mixtures of 2,3-butanediol with n-butanol, n-butyl acetate, and ethyl acetate at 101.3 kPa |
| Tboil | 399.15 | K | Isobaric VLE data for the system of butan-1-ol + butylethanoate + 1-butyl-3-methylimidazoliumbis[(trifluoromethyl)sulfonyl]imide |
| Tboil | 399.07 | K | Isobaric (vapour + liquid) equilibria of binary systems containing butyl acetate for the separation of methoxy aromatic compounds (anisole and guaiacol) from biomass fast pyrolysis oil |
| Tboil | 399.26 | K | Vapour-liquid equilibrium and extractive distillation for separation of azeotrope isopropyl alcohol and diisopropyl ether |
| Tboil | 399.09 | K | Vapor Liquid Equilibria Measurements for the Five Linear C6 Esters with n-Octane |
| Tboil | 399.15 | K | Measurement and Correlation of Isobaric Vapor-Liquid Equilibrium for Binary Systems of Allyl Alcohol with Isobutyl Acetate, Butyl Acetate, and Butyl Propionate at 101.3 kPa |
| Tboil | 398.98 | K | Measurement and Modelization of VLE for Butyl Acetate with Methanol, Ethanol, 1-Propanol, and 1-Butanol. Experimental Data at 0.15 MPa |
| Tboil | 399.18 | K | Vapor-Liquid Equilibria at 101.32 kPa and Excess Properties of Binary Mixtures of Butyl Esters + tert-Butyl Alcohol |
| Tboil | 399.11 | K | Liquid-Liquid Equilibria of Water + Acetoin + Butyl Acetate at several temperatures |
| Tboil | 399.15 | K | Phase Equilibrium (VLE, LLE, and VLLE) Data of the Ternary System: Ionic Liquid [OMIM][PF6] + Butan-1-ol + Butyl Acetate |
| Tboil | 399.11 | K | Liquid Liquid Equilibria of Water + 2,3-Butanediol + Butyl Acetate at T ) 298.15 K, T ) 308.15 K, and T ) 318.15 K |
| Tboil | 399.10 ± 0.10 | K | NIST |
| Tboil | 399.20 ± 0.40 | K | NIST |
| Tboil | 398.20 | K | NIST |
| Tboil | 399.70 | K | NIST |
| Tboil | 399.00 | K | NIST |
| Tboil | 399.20 | K | NIST |
| Tboil | 399.20 ± 0.60 | K | NIST |
| Tboil | 399.30 ± 0.50 | K | NIST |
| Tboil | 399.00 ± 2.00 | K | NIST |
| Tboil | 399.00 ± 3.00 | K | NIST |
| Tboil | 399.15 | K | NIST |
| Tboil | 399.85 ± 0.30 | K | NIST |
| Tboil | Outlier 398.00 ± 3.00 | K | NIST |
| Tboil | 398.15 ± 2.00 | K | NIST |
| Tboil | 399.15 ± 0.60 | K | NIST |
| Tboil | 399.24 ± 0.06 | K | NIST |
| Tboil | 399.26 ± 0.11 | K | NIST |
| Tboil | Outlier 398.00 ± 2.00 | K | NIST |
| Tboil | 399.40 ± 0.50 | K | NIST |
| Tboil | Outlier 398.00 ± 1.50 | K | NIST |
| Tboil | 399.65 ± 0.25 | K | NIST |
| Tboil | Outlier 397.70 ± 1.50 | K | NIST |
| Tc | [560.20; 579.10] | K |
|
| Tc | 579.00 | K | KDB |
| Tc | 575.40 ± 0.60 | K | NIST |
| Tc | 579.00 | K | NIST |
| Tc | 560.20 ± 10.00 | K | NIST |
| Tc | 561.00 ± 10.00 | K | NIST |
| Tc | 579.10 ± 3.00 | K | NIST |
| Tfus | [195.00; 199.65] | K |
|
| Tfus | 195.00 | K | KDB |
| Tfus | 199.65 | K | NIST |
| Tfus | 196.35 ± 0.30 | K | NIST |
| Ttriple | [196.03; 196.12] | K |
|
| Ttriple | 196.03 ± 0.10 | K | NIST |
| Ttriple | 196.12 ± 0.05 | K | NIST |
| Vc | 0.400 | m3/kmol | KDB |
| Zc | 0.2609000 | KDB | |
| Zra | 0.26 | KDB |
Temperature Dependent Properties
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 100.00 | 875.7 |
| 298.15 | 1000.00 | 876.3 |
| 298.15 | 2000.00 | 877.2 |
| 298.15 | 3000.00 | 878.0 |
| 298.15 | 3100.00 | 878.1 |
| 298.15 | 5000.00 | 879.9 |
| 298.15 | 10000.00 | 883.8 |
| 298.15 | 15000.00 | 887.6 |
| 298.15 | 20000.00 | 891.3 |
| 298.15 | 25000.00 | 894.9 |
| 298.15 | 30000.00 | 899.1 |
| 298.15 | 35000.00 | 903.7 |
| 303.15 | 100.00 | 870.4 |
| 303.15 | 1000.00 | 871.1 |
| 303.15 | 2000.00 | 872.0 |
| 303.15 | 3000.00 | 872.9 |
| 303.15 | 3100.00 | 873.0 |
| 303.15 | 5000.00 | 874.7 |
| 303.15 | 10000.00 | 878.8 |
| 303.15 | 15000.00 | 882.8 |
| 303.15 | 20000.00 | 886.5 |
| 303.15 | 25000.00 | 890.2 |
| 303.15 | 30000.00 | 894.4 |
| 303.15 | 35000.00 | 899.1 |
| 308.15 | 100.00 | 865.1 |
| 308.15 | 1000.00 | 865.9 |
| 308.15 | 2000.00 | 866.9 |
| 308.15 | 3000.00 | 867.8 |
| 308.15 | 3100.00 | 867.8 |
| 308.15 | 5000.00 | 869.6 |
| 308.15 | 10000.00 | 873.9 |
| 308.15 | 15000.00 | 878.0 |
| 308.15 | 20000.00 | 881.9 |
| 308.15 | 25000.00 | 885.6 |
| 308.15 | 30000.00 | 890.0 |
| 308.15 | 35000.00 | 894.8 |
| 313.15 | 100.00 | 859.9 |
| 313.15 | 1000.00 | 860.8 |
| 313.15 | 2000.00 | 861.7 |
| 313.15 | 3000.00 | 862.7 |
| 313.15 | 3100.00 | 862.7 |
| 313.15 | 5000.00 | 864.6 |
| 313.15 | 10000.00 | 869.0 |
| 313.15 | 15000.00 | 873.2 |
| 313.15 | 20000.00 | 877.2 |
| 313.15 | 25000.00 | 881.0 |
| 313.15 | 30000.00 | 885.6 |
| 313.15 | 35000.00 | 890.5 |
| 318.15 | 100.00 | 854.9 |
| 318.15 | 1000.00 | 855.7 |
| 318.15 | 2000.00 | 856.7 |
| 318.15 | 3000.00 | 857.8 |
| 318.15 | 3100.00 | 857.9 |
| 318.15 | 5000.00 | 859.6 |
| 318.15 | 10000.00 | 864.2 |
| 318.15 | 15000.00 | 868.5 |
| 318.15 | 20000.00 | 872.6 |
| 318.15 | 25000.00 | 876.5 |
| 318.15 | 30000.00 | 881.3 |
| 318.15 | 35000.00 | 886.3 |
| 323.15 | 100.00 | 849.7 |
| 323.15 | 1000.00 | 851.0 |
| 323.15 | 2000.00 | 852.0 |
| 323.15 | 3000.00 | 853.0 |
| 323.15 | 3100.00 | 853.1 |
| 323.15 | 5000.00 | 854.6 |
| 323.15 | 10000.00 | 859.4 |
| 323.15 | 15000.00 | 863.9 |
| 323.15 | 20000.00 | 868.1 |
| 323.15 | 25000.00 | 872.3 |
| 323.15 | 30000.00 | 877.3 |
| 323.15 | 35000.00 | 882.4 |
| 328.15 | 100.00 | 844.6 |
| 328.15 | 1000.00 | 845.7 |
| 328.15 | 2000.00 | 846.8 |
| 328.15 | 3000.00 | 847.9 |
| 328.15 | 3100.00 | 848.0 |
| 328.15 | 5000.00 | 849.7 |
| 328.15 | 10000.00 | 854.6 |
| 328.15 | 15000.00 | 859.3 |
| 328.15 | 20000.00 | 863.6 |
| 328.15 | 25000.00 | 867.8 |
| 328.15 | 30000.00 | 872.5 |
| 328.15 | 35000.00 | 877.7 |
| 333.15 | 100.00 | 839.6 |
| 333.15 | 1000.00 | 840.7 |
| 333.15 | 2000.00 | 841.8 |
| 333.15 | 3000.00 | 842.9 |
| 333.15 | 3100.00 | 842.9 |
| 333.15 | 5000.00 | 844.9 |
| 333.15 | 10000.00 | 850.0 |
| 333.15 | 15000.00 | 854.8 |
| 333.15 | 20000.00 | 859.3 |
| 333.15 | 25000.00 | 863.6 |
| 333.15 | 30000.00 | 868.6 |
| 333.15 | 35000.00 | 873.9 |
| 338.15 | 100.00 | 834.5 |
| 338.15 | 1000.00 | 835.6 |
| 338.15 | 2000.00 | 836.7 |
| 338.15 | 3000.00 | 837.9 |
| 338.15 | 3100.00 | 838.0 |
| 338.15 | 5000.00 | 840.1 |
| 338.15 | 10000.00 | 845.5 |
| 338.15 | 15000.00 | 850.1 |
| 338.15 | 20000.00 | 855.0 |
| 338.15 | 25000.00 | 859.5 |
| 338.15 | 30000.00 | 864.6 |
| 338.15 | 35000.00 | 870.1 |
| 343.15 | 100.00 | 829.5 |
| 343.15 | 1000.00 | 830.5 |
| 343.15 | 2000.00 | 831.7 |
| 343.15 | 3000.00 | 832.9 |
| 343.15 | 3100.00 | 833.0 |
| 343.15 | 5000.00 | 835.2 |
| 343.15 | 10000.00 | 840.7 |
| 343.15 | 15000.00 | 845.7 |
| 343.15 | 20000.00 | 850.5 |
| 343.15 | 25000.00 | 855.1 |
| 343.15 | 30000.00 | 860.7 |
| 343.15 | 35000.00 | 866.3 |
| 348.15 | 100.00 | 824.4 |
| 348.15 | 1000.00 | 825.4 |
| 348.15 | 2000.00 | 826.7 |
| 348.15 | 3000.00 | 827.9 |
| 348.15 | 3100.00 | 828.0 |
| 348.15 | 5000.00 | 830.5 |
| 348.15 | 10000.00 | 836.1 |
| 348.15 | 15000.00 | 841.3 |
| 348.15 | 20000.00 | 846.2 |
| 348.15 | 25000.00 | 850.9 |
| 348.15 | 30000.00 | 856.6 |
| 348.15 | 35000.00 | 862.4 |
| 353.15 | 100.00 | 819.3 |
| 353.15 | 1000.00 | 820.4 |
| 353.15 | 2000.00 | 821.7 |
| 353.15 | 3000.00 | 822.9 |
| 353.15 | 3100.00 | 823.0 |
| 353.15 | 5000.00 | 825.5 |
| 353.15 | 10000.00 | 831.3 |
| 353.15 | 15000.00 | 836.7 |
| 353.15 | 20000.00 | 841.8 |
| 353.15 | 25000.00 | 846.7 |
| 353.15 | 30000.00 | 852.5 |
| 353.15 | 35000.00 | 858.4 |
| 358.15 | 100.00 | 811.6 |
| 358.15 | 1000.00 | 813.2 |
| 358.15 | 2000.00 | 813.9 |
| 358.15 | 3100.00 | 815.3 |
| 358.15 | 5000.00 | 817.7 |
| 358.15 | 10000.00 | 823.6 |
| 358.15 | 15000.00 | 829.1 |
| 358.15 | 20000.00 | 835.5 |
| 363.15 | 100.00 | 806.1 |
| 363.15 | 1000.00 | 807.5 |
| 363.15 | 2000.00 | 808.8 |
| 363.15 | 3000.00 | 810.1 |
| 363.15 | 3100.00 | 810.3 |
| 363.15 | 5000.00 | 812.8 |
| 363.15 | 10000.00 | 819.2 |
| 363.15 | 15000.00 | 824.9 |
| 363.15 | 20000.00 | 830.4 |
| 368.15 | 100.00 | 800.3 |
| 368.15 | 1000.00 | 802.1 |
| 368.15 | 2000.00 | 803.6 |
| 368.15 | 3000.00 | 804.8 |
| 368.15 | 3100.00 | 805.0 |
| 368.15 | 5000.00 | 807.7 |
| 368.15 | 10000.00 | 814.3 |
| 368.15 | 15000.00 | 820.3 |
| 368.15 | 20000.00 | 825.9 |
| 373.15 | 100.00 | 795.8 |
| 373.15 | 1000.00 | 797.2 |
| 373.15 | 2000.00 | 798.7 |
| 373.15 | 3000.00 | 800.2 |
| 373.15 | 3100.00 | 800.4 |
| 373.15 | 5000.00 | 803.1 |
| 373.15 | 10000.00 | 809.9 |
| 373.15 | 15000.00 | 815.9 |
| 373.15 | 20000.00 | 821.3 |
| 378.15 | 100.00 | 790.4 |
| 378.15 | 1000.00 | 791.9 |
| 378.15 | 2000.00 | 793.7 |
| 378.15 | 3000.00 | 795.2 |
| 378.15 | 3100.00 | 795.4 |
| 378.15 | 5000.00 | 798.0 |
| 378.15 | 10000.00 | 804.7 |
| 378.15 | 15000.00 | 810.8 |
| 378.15 | 20000.00 | 817.1 |
| 383.15 | 100.00 | 785.2 |
| 383.15 | 1000.00 | 786.7 |
| 383.15 | 2000.00 | 788.3 |
| 383.15 | 3000.00 | 789.9 |
| 383.15 | 3100.00 | 790.0 |
| 383.15 | 5000.00 | 792.9 |
| 383.15 | 10000.00 | 800.1 |
| 383.15 | 15000.00 | 806.7 |
| 383.15 | 20000.00 | 812.8 |
| 388.15 | 100.00 | 779.9 |
| 388.15 | 1000.00 | 781.6 |
| 388.15 | 2000.00 | 783.2 |
| 388.15 | 3000.00 | 785.2 |
| 388.15 | 3100.00 | 785.4 |
| 388.15 | 5000.00 | 788.4 |
| 388.15 | 10000.00 | 795.8 |
| 388.15 | 15000.00 | 802.4 |
| 388.15 | 20000.00 | 808.6 |
| 393.15 | 100.00 | 775.2 |
| 393.15 | 1000.00 | 776.4 |
| 393.15 | 2000.00 | 778.1 |
| 393.15 | 3000.00 | 779.5 |
| 393.15 | 3100.00 | 779.7 |
| 393.15 | 5000.00 | 782.8 |
| 393.15 | 10000.00 | 790.6 |
| 393.15 | 15000.00 | 797.7 |
| 393.15 | 20000.00 | 804.2 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [294.21; 424.78] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.46670e+01 | |||
| Coefficient B | -3.49621e+03 | |||
| Coefficient C | -5.10730e+01 | |||
| Temperature range, min. | 294.21 | |||
| Temperature range, max. | 424.78 | |||
| Pvap | 1.33 | kPa | 294.21 | Calculated Property |
| Pvap | 3.00 | kPa | 308.72 | Calculated Property |
| Pvap | 6.18 | kPa | 323.23 | Calculated Property |
| Pvap | 11.83 | kPa | 337.73 | Calculated Property |
| Pvap | 21.29 | kPa | 352.24 | Calculated Property |
| Pvap | 36.30 | kPa | 366.75 | Calculated Property |
| Pvap | 59.05 | kPa | 381.26 | Calculated Property |
| Pvap | 92.20 | kPa | 395.76 | Calculated Property |
| Pvap | 138.89 | kPa | 410.27 | Calculated Property |
| Pvap | 202.66 | kPa | 424.78 | Calculated Property |
| Pvap | [1.41e-04; 3056.18] | kPa | [199.65; 579.15] |
KDB Vapor Pressure Data
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 8.07098e+01 | |||
| Coefficient B | -7.79009e+03 | |||
| Coefficient C | -9.58507e+00 | |||
| Coefficient D | 5.19348e-06 | |||
| Temperature range, min. | 199.65 | |||
| Temperature range, max. | 579.15 | |||
| Pvap | 1.41e-04 | kPa | 199.65 | Calculated Property |
| Pvap | 0.02 | kPa | 241.82 | Calculated Property |
| Pvap | 0.64 | kPa | 283.98 | Calculated Property |
| Pvap | 6.72 | kPa | 326.15 | Calculated Property |
| Pvap | 37.57 | kPa | 368.32 | Calculated Property |
| Pvap | 138.45 | kPa | 410.48 | Calculated Property |
| Pvap | 383.82 | kPa | 452.65 | Calculated Property |
| Pvap | 871.75 | kPa | 494.82 | Calculated Property |
| Pvap | 1717.87 | kPa | 536.98 | Calculated Property |
| Pvap | 3056.18 | kPa | 579.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Acetic acid, butyl ester.
Mixtures
- Toluene + Acetic acid, butyl ester
- Acetic acid, butyl ester + Ethylbenzene
- p-Xylene + Acetic acid, butyl ester
- Acetic acid, butyl ester + Mesitylene
- Benzene, (1-methylethyl)- + Acetic acid, butyl ester
- Benzene, n-butyl- + Acetic acid, butyl ester
- Acetic acid, butyl ester + Benzene, (2-methylpropyl)-
- Benzene, tert-butyl- + Acetic acid, butyl ester
- Butane, 1-chloro- + Acetic acid, butyl ester
- Acetic acid, butyl ester + Pentane, 1-chloro-
- Acetic acid, butyl ester + Hexane, 1-chloro-
- Heptane, 1-chloro- + Acetic acid, butyl ester
- Octane, 1-chloro- + Acetic acid, butyl ester
- Trichloroethylene + Acetic acid, butyl ester
- Benzene + Acetic acid, butyl ester
- Acetic acid, butyl ester + o-Xylene
- Benzene, 1,3-dimethyl- + Acetic acid, butyl ester
- Acetic acid, butyl ester + Cyclohexane
- Acetic acid, butyl ester + 2,3-Butanediol
- Acetic acid, butyl ester + Simvastatin
Find more mixtures with Acetic acid, butyl ester.
Sources
- KDB Vapor Pressure Data
- Cheméo Relay (1.0)
- Crippen Method
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Effect of Temperature on the Change of Refractive Index on Mixing for Butyl Acetate + Aromatic Hydrocarbons
- Densities, Excess Molar Volumes, Viscosities, and Refractive Indices of Binary Mixtures of n-Butyl Acetate with 1-Chloroalkanes (C4 C8) at 298.15 K
- Excess Volumes and Excess Isentropic Compressibilities of Binary Liquid Mixtures of Trichloroethylene with Esters at 303.15 K
- Topological and thermodynamic investigations of molecular interactions in binary mixtures: Molar excess volumes and molar excess enthalpies
- Experimental isobaric vapour liquid liquid equilibrium data for the quaternary systems water (1) ethanol (2) acetone (3) n-butyl acetate (4) and water (1) ethanol (2) acetone (3) methyl ethyl ketone (4) and their partially miscible-constituent ternaries
- Vapor liquid equilibria for the binary mixtures of 2,3-butanediol with n-butanol, n-butyl acetate, and ethyl acetate at 101.3 kPa
- Solubility and limiting activity coefficient of simvastatin in different organic solvents
- Liquid liquid equilibrium of ternary mixture (propargyl alcohol +water + butyl acetate)
- Solubility of lansoprazole in different solvents
- Isobaric VLE data for the system of butan-1-ol + butylethanoate + 1-butyl-3-methylimidazoliumbis[(trifluoromethyl)sulfonyl]imide
- Liquid-liquid equilibria for ternary systems acetic acid + n-butylacetate + hydrocarbons at 293.15 K
- Temperature dependence of limiting activity coefficients, Henry's law constants, and related infinite dilution properties of C4-C6 isomeric n-alkyl ethanoates/ethyl n-alkanoates in water. Measurement, critical compilation, correlation, and recommended data
- Phase equilibria of (water + butyric acid + butyl acetate) ternary systems at different temperatures
- Liquid-liquid equilibrium for the ternary system water + 2-methyl-1-propanol + butyl acetate and water + 2-methyl-2-propanol + butyl acetate at (298.15 and 323.15) K
- Liquid-liquid equilibrium and critical states for the system acetic acid + n-butanol + n-butyl acetate + water at 308.15 K
- Measurement and correlation of solubility of D-camphor-10-sulfonic acid in pure solvents
- Solution thermodynamics of simvastatin in pure solvents and binary solvent mixtures
- Liquid-liquid equilibrium data for water + formic acid + solvent (butyl acetate, ethyl acetate, and isoamyl alcohol) at T = 291.15 K
- Abraham model linear free energy relationships for describing the partitioning and solubility behavior of nonelectrolyte organic solutes dissolved in pyridine at 298.15 K
- Isothermal vapor-liquid equilibria, excess molar volume and the deviation of refractive indices for binary mixtures of 1-butanol, 1- hexanol, 3-methyl-1-butanol and butyl acetate
- Liquid-liquid equilibrium determination and thermodynamics modeling for extraction of isopropanol from its aqueous solution
- Liquid-liquid equilibria and COSMO-SAC modeling of organic solvent/ ionic liquid - hydroxyacetone - water mixtures
- Liquid-liquid equilibrium data for ternary systems of water + acetic acid + acetate esters at 293.2 K and 303.2 K and ~ 95 kPa
- Quaternary liquid-liquid equilibrium, solubility and critical states: Acetic acid - n-butanol - n-butyl acetate - water at 318.15 K and atmospheric pressure
- Thermodynamic properties of (an ester + an alkane). XVI. Experimental HEm and V Em values and a new correlation method for (an alkyl ethanoate + an n-alkane) at 318.15 K
- Properties of ionic liquid HMIMPF6 with carbonates, ketones and alkyl acetates
- Thermodynamic study of (alkyl esters + a,x-alkyl dihalides)III. HE m and V E m for 20 binary mixtures {xCu-1H2u-1CO2C4H9 + (1 - x)a,x-ClCH2(CH2)v-2CH2Cl}, where u = 1 to 4, a = 1 and v = x = 2 to 6
- Molecular interactions in (2,4,6-trimethyl-1,3,5-trioxane + n-alkyl acetates) at T=(298.15, 303.15, and 308.15) K
- Densities, speeds of sound, and refractive indices of the ternary mixtures (toluene + methyl acetate + butyl acetate) and (toluene + methyl acetate + methyl heptanoate) at 298.15 K
- Densities, surface tensions, and derived surface thermodynamics properties of (trimethylbenzene + propyl acetate, or butyl acetate) from T = 298.15 K to 313.15 K
- Liquid phase equilibria of (water + phosphoric acid + 1-butanol or butyl acetate) ternary systems at T = 308.2 K
- Experimental and theoretical study of surface tension of binary mixtures of (n-alkyl acetates + heptane, benzene, and toluene)
- Thermodynamic study of (alkyl esters + alpha,beta-alkyl dihalides) VI.H and V for 20 binary mixtures {xCu-1H2u-1CO2(CH2)3CH3 + (1 - x)alpha,omega-BrCH2(CH2)v-2CH2Br}, where u = 1 to 5, alpha = 1, and v = omega = 2 to 6
- Application of ERAS-model and Prigogine-Flory-Patterson theory to excess molar volumes for ternary mixtures of (2-chlorobutane + butylacetate + isobutanol) at T = 298.15 K
- Study on thermo physical and excess molar properties of binary systems of ionic liquids. I: [Cnmim][PF6] (n = 6, 8) and alkyl acetates
- Thermodynamics of 4'-bromomethyl-2-cyanobiphenyl in different solvents
- Isobaric (vapour + liquid) equilibria of binary systems containing butyl acetate for the separation of methoxy aromatic compounds (anisole and guaiacol) from biomass fast pyrolysis oil
- Solution thermodynamics of valnemulin hydrogen fumarate in different pure solvents
- Thermodynamic equilibrium of 4-hydroxy-2,5-dimethyl-3(2H)-furanone in different solvent systems
- Binary mixtures of ([C4mim][NTf2] + molecular organic solvents): Thermophysical, acoustic and transport properties at various compositions and temperatures
- Measurement and correlation of solubility and solution thermodynamics of 1,3-dimethylurea in different solvents from T = (288.15 to 328.15) K
- Solid-liquid phase equilibrium and mixing properties of 2-Cyano-4'-methylbiphenyl in pure solvents
- Solubility and thermodynamic properties of vanillyl alcohol in some pure solvents
- Measurement and thermodynamic modelling of ternary liquid-liquid equilibrium for extraction of thioglycolic acid from aqueous solution with different solvents
- Vapour-liquid equilibrium and extractive distillation for separation of azeotrope isopropyl alcohol and diisopropyl ether
- Densities, speeds of sound, isentropic compressibilities, refractive indexes, and viscosities of tetrahydrofuran with haloalkane or alkyl ethanoate at T = 303.15 K
- Studies of viscosities of dilute solutions of alkylamine in non-electrolyte solvents. II. Haloalkanes and other polar solvents
- Studies on liquid liquid interactions of some ternary mixtures by density, viscosity, ultrasonic speed and refractive index measurements
- Determination and correlation of solubility and mixing properties of isonicotinamide (form II) in some pure solvents
- Solubility and Caloric Properties of Cinnarizine
- Vapor Liquid Equilibria Measurements for the Five Linear C6 Esters with n-Octane
- Liquid Liquid Equilibria for the Ternary System n-Butyl Acetate + Pyrocatechol + Water at Different Temperatures at 101.3 kPa
- Measurement and Correlation of Solubility on Reactive Crystallization of Methyl D-(-)-4-Hydroxy-phenylglycinate
- Isobaric Vapor Liquid Equilibrium for Binary Systems of Thioglycolic Acid with Water, Butyl Acetate, Butyl Formate, and Isobutyl Acetate at 101.3 kPa
- Measurement and Correlation of Solubility of Amorphous Cefmetazole Sodium in Pure Solvents and Binary Solvent Mixtures
- Measurement and Correlation of the Solubility of e-CL-20 in 12 Organic Solvents at Temperatures Ranging from 278.15 to 318.15 K
- Ternary Liquid Liquid Equilibrium of Azeotropes (Ester + Alcohol) with Different Ionic Liquids at T = 298.15 K
- Measurements and Modeling of VLE Data for Butyl Acetate with 2-Propanol or 2-Butanol. Binary Systems at 0.15 and 0.6 MPa
- Vapor-Liquid Equilibrium Data for Binary Mixtures of Dimethyl Carbonate with Methyl Acetate, Ethyl Acetate, n-Propyl Acetate, Isopropyl Acetate, n-Butyl Acetate, and Isoamyl Acetate at 93.13 kPa
- Solubility Modeling and Mixing Properties for Benzoin in Different Monosolvents and Solvent Mixtures at the Temperature Range from 273.15 to 313.15 K
- Determination and Thermodynamic Analysis of the Solubility of Limonin in Eight Organic Solvents and Ethyl Acetate + 2-Propanol Binary Solvents from 283.2 to 323.2 K
- Measurement and Correlation of Isobaric Vapor-Liquid Equilibrium for Binary Systems of Allyl Alcohol with Isobutyl Acetate, Butyl Acetate, and Butyl Propionate at 101.3 kPa
- Measurement and Modelization of VLE for Butyl Acetate with Methanol, Ethanol, 1-Propanol, and 1-Butanol. Experimental Data at 0.15 MPa
- Investigation of Molecular Interactions in Binary Mixtures of n-Butyl Acetate and (C6 - C10) 1-Alkanol: PC-SAFT Model
- Solubility Determination of Nicotinamide and Its Application for the Cocrystallization with Benzoic Acid
- Solubility Measurement and Correlation of Probenecid in 12 Pure Organic Solvents and Thermodynamic Properties of Mixing of Solutions
- Volumetric and FT-IR Studies of the Binary Liquid Mixtures of Tributylamine and Alkyl Ester (C1-C5)
- Determination and Modeling of Solubility of 4-Aminobenzamide in Different Pure Solvents
- Liquid-Liquid Equilibrium Measurements and Correlation for Ternary Systems (Butyl Acetate + 1-Butanol + Ethylene Glycol/1,3-Propanediol/Ethanolamine) at 298.15 K
- Solubility and Thermodynamic Modeling of Dimethyl Terephthalate in Pure Solvents and the Evaluation of the Mixing Properties of the Solutions
- Densities, Excess Molar Volumes, Viscosities, Speeds of Sound, Excess Isentropic Compressibilities, and Relative Permittivities for Alkyl (Methyl, Ethyl, Butyl, and Isoamyl) Acetates + Glycols at Different Temperatures
- Vapor-Liquid Equilibria at 101.32 kPa and Excess Properties of Binary Mixtures of Butyl Esters + tert-Butyl Alcohol
- Thermodynamics of Phase and Chemical Equilibrium in a Strongly Nonideal Esterification System.
- Density and Viscosity Correlation for Several Common Fragrance and Flavor Esters
- Density and Viscosity for a Binary Mixture of cis-3-Hexenyl Formate, Butyl Acetate, trans-2-Hexenyl Acetate, and cis-3-Hexenyl Acetate with Ethanol at Several Temperatures
- Liquid-Liquid Equilibria for Water + Benzonitrile + Ethyl Acetate or + Butyl Acetate
- Solubility of Lovastatin in Acetone, Methanol, Ethanol, Ethyl Acetate, and Butyl Acetate between 283 K and 323 K
- Solubility of Hydroquinone in Different Solvents from 276.65 K to 345.10 K
- Excess Molar Volumes and Viscosity Deviations of Binary Liquid Mixtures of 1,3-Dioxolane and 1,4-Dioxane with Butyl Acetate, Butyric Acid, Butylamine, and 2-Butanone at 298.15 K
- Solubility of o-Phthalic Acid in Methanol + Water and Methanol + Butyl Acetate from (295.87 to 359.75) K
- PVT Property Measurements for Some Aliphatic Esters from (298 to 393) K and up to 35 MPa
- Viscosities and Interfacial Properties of I-Methyl-3-butylimidazolium Hexafluorophosphate and 1-Isobutenyl-3-methylimidazolium Tetrafluoroborate Ionic Liquids
- Solubility of 1H-1,2,4-Triazole in Ethanol, 1-Propanol, 2-Propanol, 1,2-Propanediol, Ethyl Formate, Methyl Acetate, Ethyl Acetate, and Butyl Acetate at (283 to 363) K
- Solubility of 3-Nitrophthalic Acid in Different Solvents between 278 K and 353 K
- Liquid-Liquid Equilibrium in Systems with an Ionic Liquid: Experimental Data for an Example of the Biphasic Acid Scavenging Utilizing Ionic Liquids Process
- Activity Coefficients at Infinite Dilution for Hydrocarbons in Fatty Alcohols Determined by Gas-Liquid Chromatography
- Liquid-Liquid Equilibria of Water + Acetoin + Butyl Acetate at several temperatures
- Solubilities of Phloretin in 12 Solvents at Different Temperatures
- Solubilities of Betulinic Acid in Thirteen Organic Solvents at Different Temperatures
- Activity Coefficients at Infinite Dilution by GLC in Alkanediamines as Stationary Phases
- Density and Viscosity of Binary Mixtures of n-Butyl Acetate with Ketones at (298.15, 303.15, 308.15, and 313.15) K
- Biomass-Derived Platform Chemicals: Thermodynamic Studies on the Extraction of 5-Hydroxymethylfurfural from Ionic Liquids
- Determination and Prediction of Vapor Liquid Equilibria for a System Containing Water + Butyl Acetate + Cyclohexane + Ethanol
- Densities and Speeds of Sound of Binary Liquid Mixtures of Some n-Alkoxypropanols with Methyl Acetate, Ethyl Acetate, and n-Butyl Acetate at T = (288.15, 293.15, 298.15, 303.15, and 308.15) K
- Vapor Liquid Equilibrium at 350 K, Excess Molar Enthalpies at 298 K, and Excess Molar Volumes at 298 K of Binary Mixtures Containing Ethyl Acetate, Butyl Acetate, and 2-Butanol
- Vapor Liquid Equilibrium for Several Compounds Relevant to the Biofuels Industry Modeled with the Wilson Equation
- Phase Equilibrium (VLE, LLE, and VLLE) Data of the Ternary System: Ionic Liquid [OMIM][PF6] + Butan-1-ol + Butyl Acetate
- Solubility Determination and Thermodynamic Models for 2-Methylnaphthalene in Different Solvents from T = (278.15 to 303.15) K
- Liquid-Liquid Equilibria for the Ternary Systems Acetic Acid + Water + Butyl Acetate and Acetic Acid + Water + 2-Methyl Propyl Acetate at 304.15 K, 332.15 K, and 366.15 K
- Solubility of Chlorpheniramine Maleate in Ethanol, 1-Propanol, 1-Butanol, Benzene, Ethyl Acetate, Ethyl Formate, and Butyl Acetate between 283 K and 333 K
- Solubility of 1-H-Tetrazole-1-acetic Acid in Different Solvents between 283 K and 323 K
- Phase Equilibrium for the Esterification Reaction of Acetic Acid + Butan-1-ol at 101.3 kPa
- Liquid Liquid Equilibria of Water + 2,3-Butanediol + Butyl Acetate at T ) 298.15 K, T ) 308.15 K, and T ) 318.15 K
- Solubility of Losartan Potassium in Different Pure Solvents from (293.15 to 343.15) K
- Solubility of Lovastatin in Ethyl Acetate, Propyl Acetate, Isopropyl Acetate, Butyl Acetate, sec-Butyl Acetate, Isobutyl Acetate, tert-Butyl Acetate, and 2-Butanone, between (285 and 313) K
- Ternary Liquid-Liquid Equilibria for Systems Containing Alcohol or Acetic Acid + Ester + 1-Ethyl-3-methylimidazolium Hydrogen Sulfate at 313.2 K Using Headspace Gas Chromatography
- Densities, Viscosities, and Speeds of Sound of Binary Liquid Mixtures of Sulfolane with Ethyl Acetate, n-Propyl Acetate, and n-Butyl Acetate at Temperature of (303.15, 308.15, and 313.15) K
- Solubility of Cloxacillin Sodium in Different Binary Solvents
- Solubility of Valsartan in Different Organic Solvents and Ethanol + Water Binary Mixtures from (278.15 to 313.15) K
- Solubility of Tiamulin Hydrogen Fumarate in Acetone, Acetonitrile, Ethyl Acetate, Ethyl Formate, and Butyl Acetate from (288.2 to 318.2) K
- Solubility of 2-Aminopyridine in Ethanol + n-Butyl Acetate from (288.15 to 318.15) K
- Isobaric Vapor-Liquid Equilibria for the Binary Systems Benzene + Methyl Ethanoate, Benzene + Butyl Ethanoate, and Benzene + Methyl Heptanoate at 101.31kPa
- Solubility of 3-Aminopyridine in Acetone + n-Butyl Acetate from (288.15 to 323.15) K
- Surface Tension and Surface Properties of Binary Mixtures of 1,4-Dioxane or N,N-Dimethyl Formamide with n-Alkyl Acetates
- Solubility of Penicillin Sulfoxide in Different Solvents
- Liquid-Liquid Equilibria, Density, Viscosity, and Surface and Interfacial Tension of the System Water + n-Butyl Acetate + 1-Propanol at 323.15 K and Atmospheric Pressure
- Solubility of Captopril in 2-Propanol, Acetone, Acetonitrile, Methyl Acetate, Ethyl Acetate, and Butyl Acetate
- Densities, Sound Speed, and IR Studies of (Methanol + 1-Acetoxybutane) and (Methanol + 1,1-Dimethylethyl Ester) at (298.15, 303.15, 308.15, and 313.15) K
- Study of Ether-, Alcohol-, or Cyano-Functionalized Ionic Liquids Using Inverse Gas Chromatography
- Surface Tension Data of Aqueous Binary Mixtures of Methyl, Ethyl, Propyl, and Butyl Acetates at 298.15 K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.