- Name
- Cyclohexane, methyl-
- InChI
- InChI=1S/C7H14/c1-7-5-3-2-4-6-7/h7H,2-6H2,1H3
- InChI Key
- UAEPNZWRGJTJPN-UHFFFAOYSA-N
- Formula
- C7H14
- SMILES
- CC1CCCCC1
- Mol. Weight (g/mol)
- 98.19
- CAS
- 108-87-2
- Name
- Mesitylene
- InChI
- InChI=1S/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3
- InChI Key
- AUHZEENZYGFFBQ-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- Cc1cc(C)cc(C)c1
- Mol. Weight (g/mol)
- 120.19
- CAS
- 108-67-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (4)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0007 |
| 298.15 | 0.1007 | 0.0007 |
| 298.15 | 0.1993 | 0.0006 |
| 298.15 | 0.3035 | 0.0006 |
| 298.15 | 0.4063 | 0.0006 |
| 298.15 | 0.4974 | 0.0006 |
| 298.15 | 0.6085 | 0.0006 |
| 298.15 | 0.7027 | 0.0006 |
| 298.15 | 0.7973 | 0.0006 |
| 298.15 | 0.9020 | 0.0007 |
| 298.15 | 1.0000 | 0.0007 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.1007 | 0.0006 |
| 303.15 | 0.1993 | 0.0006 |
| 303.15 | 0.3035 | 0.0006 |
| 303.15 | 0.4063 | 0.0006 |
| 303.15 | 0.4974 | 0.0006 |
| 303.15 | 0.6085 | 0.0006 |
| 303.15 | 0.7027 | 0.0006 |
| 303.15 | 0.7973 | 0.0006 |
| 303.15 | 0.9020 | 0.0006 |
| 303.15 | 1.0000 | 0.0006 |
| 308.15 | 0.0000 | 0.0006 |
| 308.15 | 0.1007 | 0.0006 |
| 308.15 | 0.1993 | 0.0006 |
| 308.15 | 0.3035 | 0.0006 |
| 308.15 | 0.4063 | 0.0006 |
| 308.15 | 0.4974 | 0.0005 |
| 308.15 | 0.6085 | 0.0005 |
| 308.15 | 0.7027 | 0.0006 |
| 308.15 | 0.7973 | 0.0006 |
| 308.15 | 0.9020 | 0.0006 |
| 308.15 | 1.0000 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0007 |
| 298.15 | 0.1007 | 0.0007 |
| 298.15 | 0.1993 | 0.0006 |
| 298.15 | 0.3035 | 0.0006 |
| 298.15 | 0.4063 | 0.0006 |
| 298.15 | 0.4974 | 0.0006 |
| 298.15 | 0.6085 | 0.0006 |
| 298.15 | 0.7027 | 0.0006 |
| 298.15 | 0.7973 | 0.0006 |
| 298.15 | 0.9020 | 0.0007 |
| 298.15 | 1.0000 | 0.0007 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.1007 | 0.0006 |
| 303.15 | 0.1993 | 0.0006 |
| 303.15 | 0.3035 | 0.0006 |
| 303.15 | 0.4063 | 0.0006 |
| 303.15 | 0.4974 | 0.0006 |
| 303.15 | 0.6085 | 0.0006 |
| 303.15 | 0.7027 | 0.0006 |
| 303.15 | 0.7973 | 0.0006 |
| 303.15 | 0.9020 | 0.0006 |
| 303.15 | 1.0000 | 0.0006 |
| 308.15 | 0.0000 | 0.0006 |
| 308.15 | 0.1007 | 0.0006 |
| 308.15 | 0.1993 | 0.0006 |
| 308.15 | 0.3035 | 0.0006 |
| 308.15 | 0.4063 | 0.0006 |
| 308.15 | 0.4974 | 0.0005 |
| 308.15 | 0.6085 | 0.0005 |
| 308.15 | 0.7027 | 0.0006 |
| 308.15 | 0.7973 | 0.0006 |
| 308.15 | 0.9020 | 0.0006 |
| 308.15 | 1.0000 | 0.0006 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.496 |
| 298.15 | 0.1007 | 1.489 |
| 298.15 | 0.1993 | 1.4817 |
| 298.15 | 0.3035 | 1.474 |
| 298.15 | 0.4063 | 1.4663 |
| 298.15 | 0.4974 | 1.4593 |
| 298.15 | 0.6085 | 1.4508 |
| 298.15 | 0.7027 | 1.4436 |
| 298.15 | 0.7973 | 1.4363 |
| 298.15 | 0.9020 | 1.4285 |
| 298.15 | 1.0000 | 1.4217 |
| 303.15 | 0.0000 | 1.4936 |
| 303.15 | 0.1007 | 1.4865 |
| 303.15 | 0.1993 | 1.4809 |
| 303.15 | 0.3035 | 1.473 |
| 303.15 | 0.4063 | 1.4647 |
| 303.15 | 0.4974 | 1.4565 |
| 303.15 | 0.6085 | 1.4529 |
| 303.15 | 0.7027 | 1.4421 |
| 303.15 | 0.7973 | 1.4347 |
| 303.15 | 0.9020 | 1.4265 |
| 303.15 | 1.0000 | 1.4192 |
| 308.15 | 0.0000 | 1.4913 |
| 308.15 | 0.1007 | 1.4843 |
| 308.15 | 0.1993 | 1.4771 |
| 308.15 | 0.3035 | 1.4692 |
| 308.15 | 0.4063 | 1.4614 |
| 308.15 | 0.4974 | 1.4544 |
| 308.15 | 0.6085 | 1.4459 |
| 308.15 | 0.7027 | 1.4386 |
| 308.15 | 0.7973 | 1.4312 |
| 308.15 | 0.9020 | 1.4233 |
| 308.15 | 1.0000 | 1.4163 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4969 |
| 298.15 | 0.0463 | 1.4935 |
| 298.15 | 0.0962 | 1.4897 |
| 298.15 | 0.1970 | 1.4821 |
| 298.15 | 0.2868 | 1.4752 |
| 298.15 | 0.3963 | 1.4668 |
| 298.15 | 0.4972 | 1.4591 |
| 298.15 | 0.5956 | 1.4515 |
| 298.15 | 0.6974 | 1.4437 |
| 298.15 | 0.7932 | 1.4364 |
| 298.15 | 0.8942 | 1.4286 |
| 298.15 | 0.9497 | 1.4244 |
| 298.15 | 1.0000 | 1.4206 |
| 313.15 | 0.0000 | 1.4892 |
| 313.15 | 0.0524 | 1.4855 |
| 313.15 | 0.1075 | 1.4814 |
| 313.15 | 0.2051 | 1.4742 |
| 313.15 | 0.3140 | 1.466 |
| 313.15 | 0.4067 | 1.4589 |
| 313.15 | 0.5093 | 1.451 |
| 313.15 | 0.6083 | 1.4434 |
| 313.15 | 0.7071 | 1.4356 |
| 313.15 | 0.8106 | 1.4275 |
| 313.15 | 0.9093 | 1.4198 |
| 313.15 | 0.9596 | 1.4159 |
| 313.15 | 1.0000 | 1.4127 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.496 |
| 298.15 | 0.1007 | 1.489 |
| 298.15 | 0.1993 | 1.4817 |
| 298.15 | 0.3035 | 1.474 |
| 298.15 | 0.4063 | 1.4663 |
| 298.15 | 0.4974 | 1.4593 |
| 298.15 | 0.6085 | 1.4508 |
| 298.15 | 0.7027 | 1.4436 |
| 298.15 | 0.7973 | 1.4363 |
| 298.15 | 0.9020 | 1.4285 |
| 298.15 | 1.0000 | 1.4217 |
| 303.15 | 0.0000 | 1.4936 |
| 303.15 | 0.1007 | 1.4865 |
| 303.15 | 0.1993 | 1.4809 |
| 303.15 | 0.3035 | 1.473 |
| 303.15 | 0.4063 | 1.4647 |
| 303.15 | 0.4974 | 1.4565 |
| 303.15 | 0.6085 | 1.4529 |
| 303.15 | 0.7027 | 1.4421 |
| 303.15 | 0.7973 | 1.4347 |
| 303.15 | 0.9020 | 1.4265 |
| 303.15 | 1.0000 | 1.4192 |
| 308.15 | 0.0000 | 1.4913 |
| 308.15 | 0.1007 | 1.4843 |
| 308.15 | 0.1993 | 1.4771 |
| 308.15 | 0.3035 | 1.4692 |
| 308.15 | 0.4063 | 1.4614 |
| 308.15 | 0.4974 | 1.4544 |
| 308.15 | 0.6085 | 1.4459 |
| 308.15 | 0.7027 | 1.4386 |
| 308.15 | 0.7973 | 1.4312 |
| 308.15 | 0.9020 | 1.4233 |
| 308.15 | 1.0000 | 1.4163 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4969 |
| 298.15 | 0.0463 | 1.4935 |
| 298.15 | 0.0962 | 1.4897 |
| 298.15 | 0.1970 | 1.4821 |
| 298.15 | 0.2868 | 1.4752 |
| 298.15 | 0.3963 | 1.4668 |
| 298.15 | 0.4972 | 1.4591 |
| 298.15 | 0.5956 | 1.4515 |
| 298.15 | 0.6974 | 1.4437 |
| 298.15 | 0.7932 | 1.4364 |
| 298.15 | 0.8942 | 1.4286 |
| 298.15 | 0.9497 | 1.4244 |
| 298.15 | 1.0000 | 1.4206 |
| 313.15 | 0.0000 | 1.4892 |
| 313.15 | 0.0524 | 1.4855 |
| 313.15 | 0.1075 | 1.4814 |
| 313.15 | 0.2051 | 1.4742 |
| 313.15 | 0.3140 | 1.466 |
| 313.15 | 0.4067 | 1.4589 |
| 313.15 | 0.5093 | 1.451 |
| 313.15 | 0.6083 | 1.4434 |
| 313.15 | 0.7071 | 1.4356 |
| 313.15 | 0.8106 | 1.4275 |
| 313.15 | 0.9093 | 1.4198 |
| 313.15 | 0.9596 | 1.4159 |
| 313.15 | 1.0000 | 1.4127 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 861.2 |
| 298.15 | 0.1007 | 851.6 |
| 298.15 | 0.1993 | 842.0 |
| 298.15 | 0.3035 | 832.0 |
| 298.15 | 0.4063 | 822.0 |
| 298.15 | 0.4974 | 813.1 |
| 298.15 | 0.6085 | 802.2 |
| 298.15 | 0.7027 | 793.1 |
| 298.15 | 0.7973 | 784.0 |
| 298.15 | 0.9020 | 774.1 |
| 298.15 | 1.0000 | 765.0 |
| 303.15 | 0.0000 | 857.1 |
| 303.15 | 0.1007 | 847.5 |
| 303.15 | 0.1993 | 837.9 |
| 303.15 | 0.3035 | 827.9 |
| 303.15 | 0.4063 | 817.9 |
| 303.15 | 0.4974 | 808.9 |
| 303.15 | 0.6085 | 798.1 |
| 303.15 | 0.7027 | 788.9 |
| 303.15 | 0.7973 | 779.7 |
| 303.15 | 0.9020 | 769.8 |
| 303.15 | 1.0000 | 760.7 |
| 308.15 | 0.0000 | 853.0 |
| 308.15 | 0.1007 | 843.3 |
| 308.15 | 0.1993 | 833.8 |
| 308.15 | 0.3035 | 823.7 |
| 308.15 | 0.4063 | 813.7 |
| 308.15 | 0.4974 | 804.8 |
| 308.15 | 0.6085 | 793.9 |
| 308.15 | 0.7027 | 784.7 |
| 308.15 | 0.7973 | 775.5 |
| 308.15 | 0.9020 | 765.6 |
| 308.15 | 1.0000 | 756.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 861.1 |
| 298.15 | 0.0463 | 856.7 |
| 298.15 | 0.0962 | 851.9 |
| 298.15 | 0.1970 | 842.2 |
| 298.15 | 0.2868 | 833.5 |
| 298.15 | 0.3963 | 822.8 |
| 298.15 | 0.4972 | 813.0 |
| 298.15 | 0.5956 | 803.4 |
| 298.15 | 0.6974 | 793.6 |
| 298.15 | 0.7932 | 784.3 |
| 298.15 | 0.8942 | 774.8 |
| 298.15 | 0.9497 | 769.6 |
| 298.15 | 1.0000 | 765.1 |
| 313.15 | 0.0000 | 848.8 |
| 313.15 | 0.0524 | 843.8 |
| 313.15 | 0.1075 | 838.5 |
| 313.15 | 0.2051 | 829.1 |
| 313.15 | 0.3140 | 818.5 |
| 313.15 | 0.4067 | 809.5 |
| 313.15 | 0.5093 | 799.5 |
| 313.15 | 0.6083 | 789.8 |
| 313.15 | 0.7071 | 780.1 |
| 313.15 | 0.8106 | 770.1 |
| 313.15 | 0.9093 | 760.4 |
| 313.15 | 0.9596 | 755.7 |
| 313.15 | 1.0000 | 751.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 861.2 |
| 298.15 | 0.1007 | 851.6 |
| 298.15 | 0.1993 | 842.0 |
| 298.15 | 0.3035 | 832.0 |
| 298.15 | 0.4063 | 822.0 |
| 298.15 | 0.4974 | 813.1 |
| 298.15 | 0.6085 | 802.2 |
| 298.15 | 0.7027 | 793.1 |
| 298.15 | 0.7973 | 784.0 |
| 298.15 | 0.9020 | 774.1 |
| 298.15 | 1.0000 | 765.0 |
| 303.15 | 0.0000 | 857.1 |
| 303.15 | 0.1007 | 847.5 |
| 303.15 | 0.1993 | 837.9 |
| 303.15 | 0.3035 | 827.9 |
| 303.15 | 0.4063 | 817.9 |
| 303.15 | 0.4974 | 808.9 |
| 303.15 | 0.6085 | 798.1 |
| 303.15 | 0.7027 | 788.9 |
| 303.15 | 0.7973 | 779.7 |
| 303.15 | 0.9020 | 769.8 |
| 303.15 | 1.0000 | 760.7 |
| 308.15 | 0.0000 | 853.0 |
| 308.15 | 0.1007 | 843.3 |
| 308.15 | 0.1993 | 833.8 |
| 308.15 | 0.3035 | 823.7 |
| 308.15 | 0.4063 | 813.7 |
| 308.15 | 0.4974 | 804.8 |
| 308.15 | 0.6085 | 793.9 |
| 308.15 | 0.7027 | 784.7 |
| 308.15 | 0.7973 | 775.5 |
| 308.15 | 0.9020 | 765.6 |
| 308.15 | 1.0000 | 756.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 861.1 |
| 298.15 | 0.0463 | 856.7 |
| 298.15 | 0.0962 | 851.9 |
| 298.15 | 0.1970 | 842.2 |
| 298.15 | 0.2868 | 833.5 |
| 298.15 | 0.3963 | 822.8 |
| 298.15 | 0.4972 | 813.0 |
| 298.15 | 0.5956 | 803.4 |
| 298.15 | 0.6974 | 793.6 |
| 298.15 | 0.7932 | 784.3 |
| 298.15 | 0.8942 | 774.8 |
| 298.15 | 0.9497 | 769.6 |
| 298.15 | 1.0000 | 765.1 |
| 313.15 | 0.0000 | 848.8 |
| 313.15 | 0.0524 | 843.8 |
| 313.15 | 0.1075 | 838.5 |
| 313.15 | 0.2051 | 829.1 |
| 313.15 | 0.3140 | 818.5 |
| 313.15 | 0.4067 | 809.5 |
| 313.15 | 0.5093 | 799.5 |
| 313.15 | 0.6083 | 789.8 |
| 313.15 | 0.7071 | 780.1 |
| 313.15 | 0.8106 | 770.1 |
| 313.15 | 0.9093 | 760.4 |
| 313.15 | 0.9596 | 755.7 |
| 313.15 | 1.0000 | 751.9 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1346.0 |
| 0.1007 | 1328.0 |
| 0.1993 | 1312.0 |
| 0.3035 | 1295.0 |
| 0.4063 | 1280.0 |
| 0.4974 | 1267.0 |
| 0.6085 | 1253.0 |
| 0.7027 | 1244.0 |
| 0.7973 | 1235.0 |
| 0.9020 | 1225.0 |
| 1.0000 | 1217.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1336.0 |
| 298.15 | 0.0463 | 1330.0 |
| 298.15 | 0.0962 | 1323.0 |
| 298.15 | 0.1970 | 1310.0 |
| 298.15 | 0.2868 | 1298.0 |
| 298.15 | 0.3963 | 1283.0 |
| 298.15 | 0.4972 | 1271.0 |
| 298.15 | 0.5956 | 1259.0 |
| 298.15 | 0.6974 | 1247.0 |
| 298.15 | 0.7932 | 1236.0 |
| 298.15 | 0.8942 | 1226.0 |
| 298.15 | 0.9497 | 1220.0 |
| 298.15 | 1.0000 | 1215.0 |
| 313.15 | 0.0000 | 1277.0 |
| 313.15 | 0.0524 | 1269.0 |
| 313.15 | 0.1075 | 1262.0 |
| 313.15 | 0.2051 | 1248.0 |
| 313.15 | 0.3140 | 1233.0 |
| 313.15 | 0.4067 | 1221.0 |
| 313.15 | 0.5093 | 1207.0 |
| 313.15 | 0.6083 | 1195.0 |
| 313.15 | 0.7071 | 1183.0 |
| 313.15 | 0.8106 | 1171.0 |
| 313.15 | 0.9093 | 1159.0 |
| 313.15 | 0.9596 | 1154.0 |
| 313.15 | 1.0000 | 1150.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1346.0 |
| 0.1007 | 1328.0 |
| 0.1993 | 1312.0 |
| 0.3035 | 1295.0 |
| 0.4063 | 1280.0 |
| 0.4974 | 1267.0 |
| 0.6085 | 1253.0 |
| 0.7027 | 1244.0 |
| 0.7973 | 1235.0 |
| 0.9020 | 1225.0 |
| 1.0000 | 1217.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1336.0 |
| 298.15 | 0.0463 | 1330.0 |
| 298.15 | 0.0962 | 1323.0 |
| 298.15 | 0.1970 | 1310.0 |
| 298.15 | 0.2868 | 1298.0 |
| 298.15 | 0.3963 | 1283.0 |
| 298.15 | 0.4972 | 1271.0 |
| 298.15 | 0.5956 | 1259.0 |
| 298.15 | 0.6974 | 1247.0 |
| 298.15 | 0.7932 | 1236.0 |
| 298.15 | 0.8942 | 1226.0 |
| 298.15 | 0.9497 | 1220.0 |
| 298.15 | 1.0000 | 1215.0 |
| 313.15 | 0.0000 | 1277.0 |
| 313.15 | 0.0524 | 1269.0 |
| 313.15 | 0.1075 | 1262.0 |
| 313.15 | 0.2051 | 1248.0 |
| 313.15 | 0.3140 | 1233.0 |
| 313.15 | 0.4067 | 1221.0 |
| 313.15 | 0.5093 | 1207.0 |
| 313.15 | 0.6083 | 1195.0 |
| 313.15 | 0.7071 | 1183.0 |
| 313.15 | 0.8106 | 1171.0 |
| 313.15 | 0.9093 | 1159.0 |
| 313.15 | 0.9596 | 1154.0 |
| 313.15 | 1.0000 | 1150.0 |
Sources
- Excess and deviation properties for the binary mixtures of methylcyclohexane with benzene, toluene, p-xylene, mesitylene, and anisole at T = (298.15, 303.15, and 308.15) K
- Density, Speed of Sound, and Refractive Index for Binary Mixtures Containing Cycloalkanes with o-Xylene, m-Xylene, p-Xylene, and Mesitylene at T = (298.15 and 313.15) K