- InChI
- InChI=1S/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3
- InChI Key
- AUHZEENZYGFFBQ-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- Cc1cc(C)cc(C)c1
- Molecular Weight1
- 120.19
- CAS
- 108-67-8
- Other Names
-
- 1,3,5-trimethylbenzene
- 1,3,5-trimethylbenzene (mesitylene)
- 2,4,6-Trimethylbenzene
- 3,5-Dimethyltoluene
- Benzene, 1,3,5-trimethyl-
- Fleet-X
- NSC 9273
- S-TRIMETHYLBENEZENE
- TMB
- UN 2325
- s-Trimethylbenzene
- sym-Trimethylbenzene
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Δc,grossH : Heat of Combustion, Gross form (kJ/mol).
- Δc,netH : Heat of Combustion, Net Form (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- S°gas : Molar entropy at standard conditions (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3990 | KDB | |
| PAff | [835.10; 836.20] | kJ/mol |
|
| PAff | 836.20 | kJ/mol | NIST |
| PAff | 835.10 | kJ/mol | NIST |
| BasG | [808.60; 808.80] | kJ/mol |
|
| BasG | 808.60 | kJ/mol | NIST |
| BasG | 808.80 | kJ/mol | NIST |
| ΔcH°liquid | [-5202.70; -5193.10] | kJ/mol |
|
| ΔcH°liquid | -5193.10 ± 1.30 | kJ/mol | NIST |
| ΔcH°liquid | -5202.70 | kJ/mol | NIST |
| Cp,liquid | 207.43 | J/mol×K | Thermodynamics of mixtures involving some (benzene derivatives + benzonitrile) |
| μ | 0.10 | debye | KDB |
| ΔfG° | 118.00 | kJ/mol | KDB |
| Δc,grossH | 5193.14 | kJ/mol | KDB |
| Δc,netH | 4929.045 | kJ/mol | KDB |
| ΔfH°gas | -16.08 | kJ/mol | KDB |
| ΔfusH° | 12.33 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [47.47; 47.60] | kJ/mol |
|
| ΔvapH° | 47.51 | kJ/mol | NIST |
| ΔvapH° | Outlier 47.60 | kJ/mol | NIST |
| ΔvapH° | 47.50 ± 2.10 | kJ/mol | NIST |
| ΔvapH° | 47.50 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 47.50 | kJ/mol | NIST |
| ΔvapH° | 47.50 ± 0.20 | kJ/mol | NIST |
| ΔvapH° | 47.50 | kJ/mol | NIST |
| ΔvapH° | 47.47 | kJ/mol | NIST |
| IE | [8.20; 8.65] | eV |
|
| IE | 8.40 ± 0.01 | eV | NIST |
| IE | 8.41 ± 0.01 | eV | NIST |
| IE | 8.46 | eV | NIST |
| IE | Outlier 8.20 ± 0.10 | eV | NIST |
| IE | 8.47 | eV | NIST |
| IE | 8.40 ± 0.01 | eV | NIST |
| IE | 8.55 | eV | NIST |
| IE | 8.39 ± 0.01 | eV | NIST |
| IE | 8.41 ± 0.02 | eV | NIST |
| IE | 8.42 | eV | NIST |
| IE | 8.42 | eV | NIST |
| IE | 8.45 | eV | NIST |
| IE | 8.45 ± 0.05 | eV | NIST |
| IE | 8.45 ± 0.05 | eV | NIST |
| IE | Outlier 8.65 ± 0.03 | eV | NIST |
| log10WS | [-3.40; -3.40] |
|
|
| log10WS | -3.40 | Aq. Solubility Prediction | |
| log10WS | -3.40 | Estimated Solubility | |
| logPoct/wat | 2.612 | Crippen Calculated Property | |
| McVol | 113.910 | ml/mol | McGowan Calculated Property |
| Pc | [3127.00; 3260.00] | kPa |
|
| Pc | 3127.00 | kPa | KDB |
| Pc | 3130.00 ± 40.00 | kPa | NIST |
| Pc | 3161.90 ± 0.31 | kPa | NIST |
| Pc | 3255.00 ± 0.32 | kPa | NIST |
| Pc | 3127.00 ± 6.00 | kPa | NIST |
| Pc | 3260.00 ± 9.81 | kPa | NIST |
| Inp | [152.10; 1013.00] |
|
|
| Inp | 979.50 | NIST | |
| Inp | 984.80 | NIST | |
| Inp | 947.50 | NIST | |
| Inp | 952.20 | NIST | |
| Inp | 953.33 | NIST | |
| Inp | 963.80 | NIST | |
| Inp | 972.10 | NIST | |
| Inp | 976.10 | NIST | |
| Inp | 981.30 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 962.40 | NIST | |
| Inp | 967.30 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 975.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 966.00 | NIST | |
| Inp | 952.70 | NIST | |
| Inp | 953.10 | NIST | |
| Inp | 956.20 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 974.00 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 963.30 | NIST | |
| Inp | 967.90 | NIST | |
| Inp | 973.50 | NIST | |
| Inp | 957.00 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 964.70 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 965.40 | NIST | |
| Inp | 964.60 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 965.50 | NIST | |
| Inp | 965.50 | NIST | |
| Inp | 962.70 | NIST | |
| Inp | 988.00 | NIST | |
| Inp | 1000.00 | NIST | |
| Inp | 990.00 | NIST | |
| Inp | 1000.00 | NIST | |
| Inp | 1000.00 | NIST | |
| Inp | 986.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 952.10 | NIST | |
| Inp | 967.60 | NIST | |
| Inp | 971.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 971.20 | NIST | |
| Inp | 965.30 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 1007.00 | NIST | |
| Inp | 1013.00 | NIST | |
| Inp | 998.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 974.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 1002.00 | NIST | |
| Inp | 996.40 | NIST | |
| Inp | 955.00 | NIST | |
| Inp | 970.10 | NIST | |
| Inp | 998.00 | NIST | |
| Inp | 981.00 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 959.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 961.80 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 970.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 1002.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 1006.00 | NIST | |
| Inp | 975.00 | NIST | |
| Inp | 959.90 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 961.50 | NIST | |
| Inp | 964.90 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 948.90 | NIST | |
| Inp | 974.20 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 954.50 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 984.30 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 964.10 | NIST | |
| Inp | 955.50 | NIST | |
| Inp | 961.50 | NIST | |
| Inp | 964.90 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 954.28 | NIST | |
| Inp | 954.69 | NIST | |
| Inp | 955.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 954.56 | NIST | |
| Inp | 956.80 | NIST | |
| Inp | 953.66 | NIST | |
| Inp | 953.27 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 953.37 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 997.20 | NIST | |
| Inp | 978.22 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 985.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 961.00 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 961.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 992.00 | NIST | |
| Inp | 989.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 979.00 | NIST | |
| Inp | 979.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 989.00 | NIST | |
| Inp | 974.00 | NIST | |
| Inp | 1003.00 | NIST | |
| Inp | 985.00 | NIST | |
| Inp | 988.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 971.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 956.18 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 957.00 | NIST | |
| Inp | 974.70 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 940.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 999.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 992.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 997.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 1003.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 985.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 962.60 | NIST | |
| Inp | 968.90 | NIST | |
| Inp | 966.50 | NIST | |
| Inp | 967.40 | NIST | |
| Inp | 967.70 | NIST | |
| Inp | 976.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 973.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 973.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | Outlier 173.80 | NIST | |
| Inp | Outlier 152.10 | NIST | |
| Inp | 961.80 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 961.50 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 954.56 | NIST | |
| Inp | 953.37 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 997.00 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 985.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 967.70 | NIST | |
| Inp | 960.00 | NIST | |
| I | [1210.00; 1300.70] |
|
|
| I | 1275.10 | NIST | |
| I | 1287.30 | NIST | |
| I | Outlier 1300.70 | NIST | |
| I | 1217.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1242.20 | NIST | |
| I | 1236.90 | NIST | |
| I | 1220.30 | NIST | |
| I | 1251.00 | NIST | |
| I | 1297.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1263.00 | NIST | |
| I | 1271.00 | NIST | |
| I | 1279.00 | NIST | |
| I | 1255.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1254.00 | NIST | |
| I | 1268.30 | NIST | |
| I | 1237.00 | NIST | |
| I | 1252.00 | NIST | |
| I | 1248.00 | NIST | |
| I | 1283.00 | NIST | |
| I | 1250.00 | NIST | |
| I | 1241.00 | NIST | |
| I | 1246.00 | NIST | |
| I | 1249.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1251.00 | NIST | |
| I | 1253.00 | NIST | |
| I | 1248.00 | NIST | |
| I | 1249.00 | NIST | |
| I | 1254.00 | NIST | |
| I | 1257.00 | NIST | |
| I | 1270.00 | NIST | |
| I | 1281.00 | NIST | |
| I | 1297.00 | NIST | |
| I | 1233.00 | NIST | |
| I | 1245.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1246.00 | NIST | |
| I | 1287.00 | NIST | |
| I | 1290.00 | NIST | |
| I | 1288.00 | NIST | |
| I | 1242.00 | NIST | |
| I | 1291.00 | NIST | |
| I | 1251.00 | NIST | |
| I | 1254.00 | NIST | |
| I | 1240.00 | NIST | |
| I | 1251.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1242.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1271.00 | NIST | |
| I | 1242.00 | NIST | |
| I | 1271.00 | NIST | |
| I | 1228.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1248.00 | NIST | |
| I | 1249.00 | NIST | |
| S°gas | 385.30 ± 0.63 | J/mol×K | NIST |
| S°liquid | 273.55 | J/mol×K | NIST |
| Tboil | [431.00; 489.07] | K |
|
| Tboil | 437.83 | K | Phase equilibria of three binary systems containing 2,5-dimethylthiophene and 2-ethylthiophene in hydrocarbons |
| Tboil | 437.89 | K | KDB |
| Tboil | 437.90 | K | NIST |
| Tboil | 437.10 ± 1.00 | K | NIST |
| Tboil | 438.00 ± 3.00 | K | NIST |
| Tboil | 437.80 ± 1.00 | K | NIST |
| Tboil | 437.75 ± 1.00 | K | NIST |
| Tboil | 437.00 ± 1.50 | K | NIST |
| Tboil | 438.00 ± 4.00 | K | NIST |
| Tboil | 436.00 ± 4.00 | K | NIST |
| Tboil | 431.00 ± 5.00 | K | NIST |
| Tboil | 433.00 ± 5.00 | K | NIST |
| Tboil | 437.90 ± 0.60 | K | NIST |
| Tboil | 437.00 ± 4.00 | K | NIST |
| Tboil | 438.20 ± 0.50 | K | NIST |
| Tboil | 438.00 ± 0.60 | K | NIST |
| Tboil | 437.86 ± 0.03 | K | NIST |
| Tboil | 437.86 ± 0.10 | K | NIST |
| Tboil | 437.85 ± 0.30 | K | NIST |
| Tboil | 437.86 ± 0.10 | K | NIST |
| Tboil | 437.80 ± 0.60 | K | NIST |
| Tboil | 437.87 ± 0.20 | K | NIST |
| Tboil | 437.86 ± 0.20 | K | NIST |
| Tboil | Outlier 489.07 ± 0.25 | K | NIST |
| Tboil | 438.00 ± 0.30 | K | NIST |
| Tboil | 438.20 ± 0.50 | K | NIST |
| Tboil | 437.86 ± 0.20 | K | NIST |
| Tboil | 438.10 ± 0.60 | K | NIST |
| Tboil | 437.86 ± 0.20 | K | NIST |
| Tboil | 437.85 ± 0.20 | K | NIST |
| Tboil | 437.95 ± 0.30 | K | NIST |
| Tboil | 437.95 ± 0.30 | K | NIST |
| Tboil | 437.75 ± 0.25 | K | NIST |
| Tboil | 438.20 ± 0.50 | K | NIST |
| Tboil | 437.70 ± 0.50 | K | NIST |
| Tboil | 436.00 ± 3.00 | K | NIST |
| Tboil | 438.90 ± 1.50 | K | NIST |
| Tboil | 437.00 ± 2.00 | K | NIST |
| Tboil | 437.91 ± 0.30 | K | NIST |
| Tboil | 438.70 ± 0.30 | K | NIST |
| Tboil | 437.20 ± 1.50 | K | NIST |
| Tboil | 437.79 ± 0.25 | K | NIST |
| Tboil | 437.80 ± 1.00 | K | NIST |
| Tboil | 437.20 ± 1.50 | K | NIST |
| Tboil | 437.90 ± 1.00 | K | NIST |
| Tboil | 437.80 ± 0.50 | K | NIST |
| Tboil | 437.80 ± 0.50 | K | NIST |
| Tboil | 437.80 ± 0.50 | K | NIST |
| Tboil | 437.75 ± 0.30 | K | NIST |
| Tboil | 439.00 ± 3.00 | K | NIST |
| Tboil | 438.00 ± 0.30 | K | NIST |
| Tboil | 438.00 ± 4.00 | K | NIST |
| Tboil | 437.87 ± 0.30 | K | NIST |
| Tboil | 437.25 ± 0.50 | K | NIST |
| Tboil | 435.00 ± 2.00 | K | NIST |
| Tboil | 438.00 ± 2.00 | K | NIST |
| Tc | [637.10; 643.70] | K |
|
| Tc | 637.30 | K | KDB |
| Tc | 637.30 ± 0.50 | K | NIST |
| Tc | 638.65 ± 0.06 | K | NIST |
| Tc | 638.35 ± 0.06 | K | NIST |
| Tc | 637.10 ± 0.63 | K | NIST |
| Tc | 637.27 ± 0.10 | K | NIST |
| Tc | 637.29 ± 0.30 | K | NIST |
| Tc | Outlier 643.70 ± 6.00 | K | NIST |
| Tc | 640.90 ± 4.00 | K | NIST |
| Tfus | [206.67; 228.43] | K |
|
| Tfus | 228.40 | K | KDB |
| Tfus | 228.23 | K | Aq. Solubility Prediction |
| Tfus | 223.33 ± 0.10 | K | NIST |
| Tfus | 221.41 ± 0.10 | K | NIST |
| Tfus | 228.42 ± 0.07 | K | NIST |
| Tfus | 228.00 ± 2.00 | K | NIST |
| Tfus | 219.20 ± 2.00 | K | NIST |
| Tfus | 227.99 ± 0.30 | K | NIST |
| Tfus | 228.37 ± 0.30 | K | NIST |
| Tfus | Outlier 206.67 ± 0.20 | K | NIST |
| Tfus | 228.41 ± 0.40 | K | NIST |
| Tfus | 228.42 ± 0.20 | K | NIST |
| Tfus | 228.31 ± 0.40 | K | NIST |
| Tfus | 228.41 ± 0.05 | K | NIST |
| Tfus | 228.43 ± 0.02 | K | NIST |
| Tfus | 221.47 ± 0.03 | K | NIST |
| Tfus | 223.36 ± 0.03 | K | NIST |
| Tfus | 228.36 ± 0.20 | K | NIST |
| Tfus | 221.45 ± 2.00 | K | NIST |
| Tfus | 228.35 ± 1.50 | K | NIST |
| Tfus | 220.45 ± 0.30 | K | NIST |
| Tfus | 219.70 ± 0.80 | K | NIST |
| Tfus | 218.70 ± 5.00 | K | NIST |
| Tfus | 215.70 ± 5.00 | K | NIST |
| Ttriple | [228.42; 228.42] | K |
|
| Ttriple | 228.42 ± 0.01 | K | NIST |
| Ttriple | 228.42 ± 0.01 | K | NIST |
| Vc | 0.437 | m3/kmol | Relay (1.0) Calculated Property |
Temperature Dependent Properties
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [6.96e-04; 3113.46] | kPa | [228.46; 637.38] |
KDB Vapor Pressure Data
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 8.58665e+01 | |||
| Coefficient B | -8.51220e+03 | |||
| Coefficient C | -1.03429e+01 | |||
| Coefficient D | 5.70952e-06 | |||
| Temperature range, min. | 228.46 | |||
| Temperature range, max. | 637.38 | |||
| Pvap | 6.96e-04 | kPa | 228.46 | Calculated Property |
| Pvap | 0.06 | kPa | 273.90 | Calculated Property |
| Pvap | 1.17 | kPa | 319.33 | Calculated Property |
| Pvap | 9.73 | kPa | 364.77 | Calculated Property |
| Pvap | 46.84 | kPa | 410.20 | Calculated Property |
| Pvap | 156.66 | kPa | 455.64 | Calculated Property |
| Pvap | 408.78 | kPa | 501.07 | Calculated Property |
| Pvap | 897.43 | kPa | 546.51 | Calculated Property |
| Pvap | 1744.79 | kPa | 591.94 | Calculated Property |
| Pvap | 3113.46 | kPa | 637.38 | Calculated Property |
Similar Compounds
Find more compounds similar to Mesitylene.
Mixtures
- Acetic acid + Mesitylene + Water
- Octane + Mesitylene
- Acetic acid, propyl ester + Mesitylene
- Acetic acid, butyl ester + Mesitylene
- Morpholine, 4-acetyl- + Mesitylene
- Acetophenone + Mesitylene
- Cyclohexane, methyl- + Mesitylene
- Benzonitrile + Mesitylene
- Anisole + Mesitylene
- Tetrafluoromethane + Mesitylene
- Methane, trifluoro- + Mesitylene
- Methane, difluoro- + Mesitylene
- Methyl fluoride + Mesitylene
- Tetrahydrofuran + Mesitylene
- Thiophene, 2-ethyl- + Mesitylene
- Ethanol + Mesitylene
- 1-Propanol + Mesitylene
- 2-Propanol + Mesitylene
- 1-Butanol + Mesitylene
- 1-Pentanol + Mesitylene
Find more mixtures with Mesitylene.
Sources
- KDB Vapor Pressure Data
- Cheméo Relay (1.0)
- Crippen Method
- Effect of Temperature on the Change of Refractive Index on Mixing for Butyl Acetate + Aromatic Hydrocarbons
- Densities and Volumetric Properties of Binary Mixtures of Butyl Acrylate with Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene at Temperatures from 288.15 K to 318.15 K
- Ultrasonic and viscometric study of molecular interactions in binary mixtures of aniline with 1-propanol, 2-propanol, 2-methyl-1-propanol, and 2-methyl-2-propanol at different temperatures
- Solubility of hydrofluorocarbons in aromatic solvents and alcohols: Experimental data and modeling with CPA EoS
- Phase equilibria of three binary systems containing 2,5-dimethylthiophene and 2-ethylthiophene in hydrocarbons
- Liquid-liquid equilibria for ternary systems water + acetic acid + 1,2,4-trimethylbenzene and water + acetic acid + 1,3,5- trimethylbenzene at (303.2 - 343.2) K
- Evaluation of 1-ethyl-3-methylimidazolium methylsulfate and 1,3-dimethylimidazolium methylsulfate as solvents for extraction of alkylbenzenes from hexadecane at 313 and 333 K
- Excess molar volumes of (acetophenone + benzene, or toluene, or 1,3-xylene, or 1,3,5-trimethylbenzene) at temperatures (298.15 and 328.15) K
- Thermodynamic properties of (tetradecane + benzene, + toluene, + chlorobenzene, + bromobenzene, + anisole) binary mixtures at T = (298.15, 303.15, and 308.15) K
- Excess and deviation properties for the binary mixtures of methylcyclohexane with benzene, toluene, p-xylene, mesitylene, and anisole at T = (298.15, 303.15, and 308.15) K
- Excess molar volumes and refractive indices of (methoxybenzene + benzene, or toluene, or o-xylene, or m-xylene, or p-xylene, or mesitylene) binary mixtures between T = (288.15 to 303.15) K
- Densities, surface tensions, and derived surface thermodynamics properties of (trimethylbenzene + propyl acetate, or butyl acetate) from T = 298.15 K to 313.15 K
- Thermodynamics of mixtures involving some (benzene derivatives + benzonitrile)
- Excess molar volumes of (octane + benzene, or toluene, or 1,3-xylene, or 1,3,5-trimethylbenzene) at temperatures between (298.15 and 328.15) K
- Densities and volumetric properties of (N-acetylmorpholine + aromatic hydrocarbon) binary mixtures from T = (293.15 to 343.15) K
- Acoustic and thermodynamic properties of binary mixtures of 1-nonanol with o-xylene, m-xylene, p-xylene, ethylbenzene and mesitylene at T = (298.15 and 308.15) K
- Measurement of activity coefficients at infinite dilution of organic solutes in the ionic liquid 1-hexyl-1,4-diaza[2.2.2]bicyclooctanium bis(trifluoromethylsulfonyl)imide using gas-liquid chromatography
- Modified solution calorimetry approach for determination of vaporization and sublimation enthalpies of branched-chain aliphatic and alkyl aromatic compounds at T = 298.15 K
- Physicochemical study of intermolecular interactions in 1,4-dioxane + aromatic hydrocarbons binary mixtures at different temperatures by using ultrasonic and viscometric methods
- Liquid-liquid equilibrium for methyl butyl ketone + o-, m-, p-cresol + water ternary systems and COSMO-SAC predictions
- Examination of hydrogen-bonding interactions between dissolved solutes and alkylbenzene solvents based on Abraham model correlations derived from measured enthalpies of solvation
- Effect of halogen substitution on the enthalpies of solvation and hydrogen bonding of organic solutes in chlorobenzene and 1,2-dichlorobenzene derived using multi-parameter correlations
- Solubility of 2-Ethylanthraquinone in Binary Mixtures of Oligooxymethylene Dimethyl Ethers with Different Number of CH2O Groups of n = 2, 3, and 4 from 293.15 to 343.15 K
- Phase Equilibrium Measurement and Thermodynamic Modeling of the 4-Methylpentan-2-one/3-Methylphenol, and 4-Methylphenol/Water Ternary Systems at 298.2, 313.2, and 323.2 K and 0.1 MPa
- Densities and Dynamic Viscosities of Alicyclic Cyclohexane with Toluene, o-Xylene, and Mesitylene at T = (303.15 to 323.15) K and Atmospheric Pressure
- Thermal Conductivity and Thermal Diffusivity of Twenty-Nine Liquids: Alkenes, Cyclic (Alkanes, Alkenes, Alkadienes, Aromatics), and Deuterated Hydrocarbons
- Excess Molar volumes and Surface Tensions of Trimethylbenzene with Tetrahydrofuran Tetrachloromethane and Dimethylsulfoxide at 298.15 K
- Excess Molar Volumes and Surface Tensions of 1,2,4-Trimethylbenzene and 1,3,5-Trimethylbenzene with 1-Butanol, 2-Methyl-1-propanol, 2-Butanol, and 2-Methyl-2-propanol at 298.15 K
- Excess Molar Volumes and Surface Tensions of Trimethylbenzene + Ethylene Glycol Ester at 298.15 K and 313.15 K
- Liquid-Liquid Equilibria Measurements for Ternary System of Hexadecane + 1,3,5-Trimethylbenzene + N-Methyl-2-pyrrolidone
- Densities and Surface Tensions of Trimethylbenzene + Dimethyl Carbonate or + Diethyl Carbonate at 298.15 K and 313.15 K
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene with Anisole at (288.15, 293.15, 298.15, and 303.15) K
- Excess Molar Volumes and Surface Tensions of 1,2,4- Trimethylbenzene and 1,3,5- Trimethylbenzene with 1,1-Diethoxyethane and 2,2-Dimethoxypropane at (298.15, 308.15, and 313.15) K
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Limiting Binary Diffusivities of Aniline, Styrene, and Mesitylene in Supercritical Carbon Dioxide
- Excess Enthalpies of (N-Methylformamide or N-Methylacetamide) + Aromatic Compounds at 303.15 K
- Refractive Indices of Binary Mixtures of Tetrahydrofuran with Aromatic Hydrocarbon at Temperatures from (288.15 to 318.15) K
- Excess Molar Volumes and Surface Tensions of 1,2,4-Trimethylbenzene and 1,3,5-Trimethylbenzene with Isopropyl Acetate and Isobutyl Acetate at (298.15, 308.15, and 313.15) K
- Shear Viscosity of Mixtures of r-Tocopherol with Nonpolar Solvents
- Densities, Refractive Indices, and Excess Properties of Binary Mixtures of 1,4-Dioxane with Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene at Temperatures from (288.15 to 318.15) K
- Density, Speed of Sound, and Refractive Index for Binary Mixtures Containing Cycloalkanes with o-Xylene, m-Xylene, p-Xylene, and Mesitylene at T = (298.15 and 313.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- Zabransky, M., Ruzicka, V., Majer, V. and Domalski, E. (1997), Heat Capacity of Liquids: Critical Review and Recommended Values - Monograph No. 6, J. Phys. & Chem. Ref. Data (JPCRD), National Institute of Standards and Technology, Gaithersburg, MD
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
These property values are available through the Cheméo API. A free account gives you an access key.