- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Molecular Weight1
- 106.17
- CAS
- 108-38-3
- Other Names
-
- 1,3-dimethylbenzene
- 1,3-dimethylbenzene (m-xylene)
- 1,3-xylene
- 2,4-Xylene
- NSC 61769
- m-Dimethylbenzene
- m-Methyltoluene
- m-Xylol
- m-xylene
- meta-xylene
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- Tig : Autoignition Temperature (K).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- Csat : Molar heat capacity at saturation pressure (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- SProt : Protonation entropy at 298K (J/mol×K).
- εr : Dielectric Constant (Relative permittivity).
- LFL : Lower Flammability Limit (% in Air).
- UFL : Upper Flammability Limit (% in Air).
- Tflash,cc : Flash Point (Closed Cup Method) (K).
- Tflash,oc : Flash Point (Open Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Rg : Radius of Gyration.
- Δc,grossH : Heat of Combustion, Gross form (kJ/mol).
- Δc,netH : Heat of Combustion, Net Form (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- NFPA Safety : NFPA Safety Rating.
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- Ip : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°gas : Molar entropy at standard conditions (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λgas : Gas thermal conductivity (W/m×K).
- λliquid : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- UQi : UNIQUAC Qi Parameter.
- URi : UNIQUAC Ri Parameter.
- Vc : Critical Volume (m3/kmol).
- VCOSTALD : COSTALD Characteristic Volume (m3/kmol).
- ωSRK : SRK acentric factor.
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | [0.3250; 0.3311] |
|
|
| ω | 0.3310 | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value | |
| ω | 0.3311 | Passut and Danner (1973), critical constants and acentric factors Compiled value | |
| ω | 0.3270 | ChemSep v8.3 pure component data Compiled value | |
| ω | 0.3250 | KDB | |
| PAff | [809.10; 816.70] | kJ/mol |
|
| PAff | 812.10 | kJ/mol | NIST |
| PAff | 816.70 | kJ/mol | NIST |
| PAff | 809.10 ± 1.20 | kJ/mol | NIST |
| Tig | [800.15; 803.15] | K |
|
| Tig | 803.15 | K | KDB |
| Tig | 800.15 | K | NCMS SOLV-DB |
| BasG | [782.40; 787.80] | kJ/mol |
|
| BasG | 786.20 | kJ/mol | NIST |
| BasG | 787.80 | kJ/mol | NIST |
| BasG | 782.40 ± 1.80 | kJ/mol | NIST |
| ΔcH°liquid | [-4581.40; -4549.56] | kJ/mol |
|
| ΔcH°liquid | -4549.56 ± 0.54 | kJ/mol | NIST |
| ΔcH°liquid | -4551.86 ± 0.63 | kJ/mol | NIST |
| ΔcH°liquid | -4567.60 | kJ/mol | NIST |
| ΔcH°liquid | -4581.40 | kJ/mol | NIST |
| Cp,liquid | 181.38 | J/mol×K | Thermodynamics of mixtures involving some (benzene derivatives + benzonitrile) |
| μ | [0.30; 0.30] | debye |
|
| μ | 0.30 | debye | ChemSep v8.3 pure component data Compiled value |
| μ | 0.30 | debye | KDB |
| η | [0.0005870; 0.0005870] | Pa×s |
|
| η | 0.0005870 | Pa×s | Viscosities, Densities, and Speeds of Sound of Binary Mixtures of o-Xylene, m-Xylene, p-Xylene, and Isopropylbenzene with 2-Butanone at 298.15 K |
| η | 0.0005870 | Pa×s | Viscosities, Densities, and Speeds of Sound of Binary Mixtures of o-Xylene, m-Xylene, p-Xylene, and Isopropylbenzene with 4-Methylpentan-2-one at 298.15 K |
| SProt | 19.20 | J/mol×K | NIST |
| εr | 2.37 | NCMS SOLV-DB | |
| LFL | 1.10 | % in Air | KDB |
| UFL | 6.40 | % in Air | KDB |
| Tflash,cc | 298.15 | K | NCMS SOLV-DB |
| Tflash,oc | 302.04 | K | KDB |
| ΔfG° | [118.76; 118.90] | kJ/mol |
|
| ΔfG° | 118.76 | kJ/mol | ChemSep v8.3 pure component data Compiled value |
| ΔfG° | 118.90 | kJ/mol | KDB |
| Rg | 3.8970 | KDB | |
| Δc,grossH | 4551.86 | kJ/mol | KDB |
| Δc,netH | 4331.779 | kJ/mol | KDB |
| ΔfH°gas | [17.20; 17.32] | kJ/mol |
|
| ΔfH°gas | 17.32 | kJ/mol | ChemSep v8.3 pure component data Compiled value |
| ΔfH°gas | 17.25 | kJ/mol | KDB |
| ΔfH°gas | 17.20 ± 0.75 | kJ/mol | NIST |
| ΔfH°liquid | -25.40 ± 0.75 | kJ/mol | NIST |
| ΔfusH° | 10.13 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [36.40; 43.04] | kJ/mol |
|
| ΔvapH° | 42.63 | kJ/mol | NCMS SOLV-DB |
| ΔvapH° | 42.68 | kJ/mol | NIST |
| ΔvapH° | 42.70 | kJ/mol | NIST |
| ΔvapH° | 43.04 | kJ/mol | NIST |
| ΔvapH° | 36.40 | kJ/mol | NIST |
| ΔvapH° | 42.70 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 42.65 | kJ/mol | NIST |
| ΔvapH° | 42.60 | kJ/mol | NIST |
| ΔvapH° | 36.40 ± 0.40 | kJ/mol | NIST |
| IE | [8.50; 8.90] | eV |
|
| IE | 8.55 ± 0.02 | eV | NIST |
| IE | 8.56 | eV | NIST |
| IE | 8.57 ± 0.01 | eV | NIST |
| IE | Outlier 8.90 ± 0.05 | eV | NIST |
| IE | 8.50 ± 0.02 | eV | NIST |
| IE | 8.55 ± 0.05 | eV | NIST |
| IE | 8.56 | eV | NIST |
| IE | 8.56 ± 0.01 | eV | NIST |
| IE | 8.56 | eV | NIST |
| IE | 8.82 | eV | NIST |
| IE | 8.55 | eV | NIST |
| IE | 8.71 ± 0.01 | eV | NIST |
| IE | 8.75 ± 0.03 | eV | NIST |
| log10WS | [-2.82; -2.82] |
|
|
| log10WS | -2.82 | Aq. Solubility Prediction | |
| log10WS | -2.82 | Estimated Solubility | |
| logPoct/wat | 3.200 | NCMS SOLV-DB | |
| McVol | 99.820 | ml/mol | McGowan Calculated Property |
| NFPA Fire | [%!d(float64=3); %!d(float64=3)] |
|
|
| NFPA Fire | 3 | KDB | |
| NFPA Fire | 3 | NCMS SOLV-DB | |
| NFPA Health | [%!d(float64=2); %!d(float64=2)] |
|
|
| NFPA Health | 2 | KDB | |
| NFPA Health | 2 | NCMS SOLV-DB | |
| NFPA Safety | 0 | NCMS SOLV-DB | |
| Pc | [3343.73; 3546.38] | kPa |
|
| Pc | 3541.00 | kPa | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 3 Compiled value |
| Pc | 3546.38 | kPa | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Pc | 3541.15 | kPa | Passut and Danner (1973), critical constants and acentric factors Compiled value |
| Pc | 3541.00 | kPa | ChemSep v8.3 pure component data Compiled value |
| Pc | 3541.00 | kPa | KDB |
| Pc | 3540.00 ± 40.00 | kPa | NIST |
| Pc | 3541.20 ± 5.00 | kPa | NIST |
| Pc | 3541.00 ± 6.00 | kPa | NIST |
| Pc | Outlier 3343.73 ± 151.99 | kPa | NIST |
| Pc | 3510.00 ± 3.92 | kPa | NIST |
| Ptriple | 3.18e-03 | kPa | ChemSep v8.3 pure component data Compiled value |
| ρc | [283.46; 284.95] | kg/m3 |
|
| ρc | 283.46 ± 4.25 | kg/m3 | NIST |
| ρc | 284.95 ± 5.31 | kg/m3 | NIST |
| Inp | [130.11; 908.00] |
|
|
| Inp | 859.00 | NIST | |
| Inp | 848.40 | NIST | |
| Inp | 855.20 | NIST | |
| Inp | 852.10 | NIST | |
| Inp | 850.50 | NIST | |
| Inp | 852.30 | NIST | |
| Inp | 856.70 | NIST | |
| Inp | 882.70 | NIST | |
| Inp | 888.10 | NIST | |
| Inp | 849.80 | NIST | |
| Inp | 852.30 | NIST | |
| Inp | 854.80 | NIST | |
| Inp | 857.40 | NIST | |
| Inp | 859.60 | NIST | |
| Inp | 860.90 | NIST | |
| Inp | 863.50 | NIST | |
| Inp | 856.77 | NIST | |
| Inp | 876.00 | NIST | |
| Inp | 876.00 | NIST | |
| Inp | 876.00 | NIST | |
| Inp | 863.30 | NIST | |
| Inp | 871.20 | NIST | |
| Inp | 856.10 | NIST | |
| Inp | 856.40 | NIST | |
| Inp | 856.40 | NIST | |
| Inp | 856.60 | NIST | |
| Inp | 855.90 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 857.00 | NIST | |
| Inp | 857.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 856.00 | NIST | |
| Inp | 865.20 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 854.00 | NIST | |
| Inp | 850.10 | NIST | |
| Inp | 855.30 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 868.00 | NIST | |
| Inp | 862.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 850.20 | NIST | |
| Inp | 880.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 862.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 856.10 | NIST | |
| Inp | 856.60 | NIST | |
| Inp | 859.60 | NIST | |
| Inp | 876.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 877.00 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 863.20 | NIST | |
| Inp | 866.60 | NIST | |
| Inp | 871.10 | NIST | |
| Inp | 876.60 | NIST | |
| Inp | 859.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 850.50 | NIST | |
| Inp | 855.70 | NIST | |
| Inp | 860.60 | NIST | |
| Inp | 860.80 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 861.70 | NIST | |
| Inp | 856.40 | NIST | |
| Inp | 857.40 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 855.30 | NIST | |
| Inp | 855.60 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 863.20 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 862.00 | NIST | |
| Inp | 862.00 | NIST | |
| Inp | 857.76 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 882.00 | NIST | |
| Inp | 886.00 | NIST | |
| Inp | 868.00 | NIST | |
| Inp | 857.80 | NIST | |
| Inp | 863.20 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 857.00 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 869.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 878.00 | NIST | |
| Inp | 852.30 | NIST | |
| Inp | 861.10 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 867.10 | NIST | |
| Inp | 866.30 | NIST | |
| Inp | 860.30 | NIST | |
| Inp | 896.00 | NIST | |
| Inp | 847.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 858.00 | NIST | |
| Inp | 862.00 | NIST | |
| Inp | 895.00 | NIST | |
| Inp | 902.00 | NIST | |
| Inp | 908.00 | NIST | |
| Inp | 889.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 900.00 | NIST | |
| Inp | 872.50 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 862.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 859.00 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 887.00 | NIST | |
| Inp | 865.05 | NIST | |
| Inp | 858.00 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 875.00 | NIST | |
| Inp | 853.20 | NIST | |
| Inp | 853.20 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 859.40 | NIST | |
| Inp | 898.00 | NIST | |
| Inp | 838.00 | NIST | |
| Inp | 861.70 | NIST | |
| Inp | 864.40 | NIST | |
| Inp | 866.50 | NIST | |
| Inp | 848.20 | NIST | |
| Inp | 877.80 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 849.00 | NIST | |
| Inp | 868.00 | NIST | |
| Inp | 847.00 | NIST | |
| Inp | 847.00 | NIST | |
| Inp | 855.50 | NIST | |
| Inp | 890.21 | NIST | |
| Inp | 892.69 | NIST | |
| Inp | 862.00 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 844.60 | NIST | |
| Inp | 850.20 | NIST | |
| Inp | 853.80 | NIST | |
| Inp | 855.40 | NIST | |
| Inp | 869.30 | NIST | |
| Inp | 861.70 | NIST | |
| Inp | 864.40 | NIST | |
| Inp | 866.50 | NIST | |
| Inp | 852.91 | NIST | |
| Inp | 853.44 | NIST | |
| Inp | 854.00 | NIST | |
| Inp | 853.38 | NIST | |
| Inp | 853.85 | NIST | |
| Inp | 853.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 853.96 | NIST | |
| Inp | 850.24 | NIST | |
| Inp | 852.98 | NIST | |
| Inp | 854.72 | NIST | |
| Inp | 865.16 | NIST | |
| Inp | 868.16 | NIST | |
| Inp | 870.12 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 861.50 | NIST | |
| Inp | 885.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 873.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 879.49 | NIST | |
| Inp | 854.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 877.00 | NIST | |
| Inp | 855.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 868.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 870.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 849.00 | NIST | |
| Inp | 862.00 | NIST | |
| Inp | 847.00 | NIST | |
| Inp | 855.00 | NIST | |
| Inp | 853.00 | NIST | |
| Inp | 858.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 868.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 870.00 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 859.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 869.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 870.00 | NIST | |
| Inp | 878.00 | NIST | |
| Inp | 878.00 | NIST | |
| Inp | 871.20 | NIST | |
| Inp | 875.00 | NIST | |
| Inp | 849.00 | NIST | |
| Inp | 848.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 869.00 | NIST | |
| Inp | 875.00 | NIST | |
| Inp | 873.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 846.40 | NIST | |
| Inp | 875.00 | NIST | |
| Inp | 877.00 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 857.00 | NIST | |
| Inp | 873.00 | NIST | |
| Inp | 873.00 | NIST | |
| Inp | 875.30 | NIST | |
| Inp | 853.00 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 848.00 | NIST | |
| Inp | 851.00 | NIST | |
| Inp | 851.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 856.00 | NIST | |
| Inp | 857.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 851.20 | NIST | |
| Inp | 853.20 | NIST | |
| Inp | 856.10 | NIST | |
| Inp | 858.20 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 851.00 | NIST | |
| Inp | 853.00 | NIST | |
| Inp | 856.00 | NIST | |
| Inp | 859.00 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 853.00 | NIST | |
| Inp | 854.00 | NIST | |
| Inp | 835.00 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 872.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 873.00 | NIST | |
| Inp | 880.00 | NIST | |
| Inp | 876.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 853.00 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 867.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 847.12 | NIST | |
| Inp | 878.00 | NIST | |
| Inp | 888.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 856.00 | NIST | |
| Inp | 877.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 854.00 | NIST | |
| Inp | 856.00 | NIST | |
| Inp | 865.00 | NIST | |
| Inp | 869.00 | NIST | |
| Inp | 873.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 860.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 855.00 | NIST | |
| Inp | 866.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 855.00 | NIST | |
| Inp | 856.00 | NIST | |
| Inp | 869.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 864.40 | NIST | |
| Inp | 868.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 845.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 876.00 | NIST | |
| Inp | 849.00 | NIST | |
| Inp | 852.00 | NIST | |
| Inp | 854.00 | NIST | |
| Inp | 858.00 | NIST | |
| Inp | 864.00 | NIST | |
| Inp | 863.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 858.00 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | Outlier 130.11 | NIST | |
| Inp | 874.00 | NIST | |
| Inp | 871.00 | NIST | |
| Inp | 864.40 | NIST | |
| Inp | 849.00 | NIST | |
| Inp | 890.21 | NIST | |
| Inp | 850.20 | NIST | |
| Inp | 853.38 | NIST | |
| Inp | 853.96 | NIST | |
| Inp | 868.16 | NIST | |
| Ip | [1099.00; 1195.00] |
|
|
| Ip | 1176.50 | NIST | |
| Ip | Outlier 1188.10 | NIST | |
| Ip | 1123.00 | NIST | |
| Ip | 1123.00 | NIST | |
| Ip | 1134.60 | NIST | |
| Ip | 1147.30 | NIST | |
| Ip | 1149.90 | NIST | |
| Ip | 1151.00 | NIST | |
| Ip | 1157.00 | NIST | |
| Ip | 1145.00 | NIST | |
| Ip | 1166.41 | NIST | |
| Ip | 1171.52 | NIST | |
| Ip | 1176.29 | NIST | |
| Ip | 1151.54 | NIST | |
| Ip | 1156.28 | NIST | |
| Ip | 1161.65 | NIST | |
| Ip | 1145.30 | NIST | |
| Ip | 1149.00 | NIST | |
| Ip | 1175.80 | NIST | |
| Ip | 1175.80 | NIST | |
| Ip | 1140.70 | NIST | |
| Ip | 1124.30 | NIST | |
| Ip | Outlier 1192.00 | NIST | |
| Ip | Outlier 1185.00 | NIST | |
| Ip | Outlier 1195.00 | NIST | |
| Ip | Outlier 1194.00 | NIST | |
| Ip | 1168.00 | NIST | |
| Ip | 1176.00 | NIST | |
| Ip | 1182.00 | NIST | |
| Ip | 1161.00 | NIST | |
| Ip | 1143.00 | NIST | |
| Ip | 1142.00 | NIST | |
| Ip | 1141.00 | NIST | |
| Ip | 1143.00 | NIST | |
| Ip | 1142.00 | NIST | |
| Ip | 1143.00 | NIST | |
| Ip | 1149.00 | NIST | |
| Ip | 1123.00 | NIST | |
| Ip | 1140.00 | NIST | |
| Ip | 1149.00 | NIST | |
| Ip | 1161.00 | NIST | |
| Ip | 1129.00 | NIST | |
| Ip | 1143.00 | NIST | |
| Ip | 1132.00 | NIST | |
| Ip | 1143.00 | NIST | |
| Ip | 1150.00 | NIST | |
| Ip | 1131.00 | NIST | |
| Ip | 1132.00 | NIST | |
| Ip | 1148.00 | NIST | |
| Ip | 1146.00 | NIST | |
| Ip | 1150.00 | NIST | |
| Ip | 1129.00 | NIST | |
| Ip | 1129.00 | NIST | |
| Ip | 1144.00 | NIST | |
| Ip | 1136.00 | NIST | |
| Ip | 1142.00 | NIST | |
| Ip | 1149.00 | NIST | |
| Ip | 1142.00 | NIST | |
| Ip | 1134.00 | NIST | |
| Ip | 1134.00 | NIST | |
| Ip | 1158.00 | NIST | |
| Ip | 1141.00 | NIST | |
| Ip | 1141.00 | NIST | |
| Ip | 1138.00 | NIST | |
| Ip | Outlier 1099.00 | NIST | |
| Ip | 1123.00 | NIST | |
| Ip | 1143.00 | NIST | |
| Ip | 1116.00 | NIST | |
| Ip | 1118.00 | NIST | |
| Ip | 1144.00 | NIST | |
| Ip | 1147.00 | NIST | |
| Ip | 1162.00 | NIST | |
| Ip | 1142.00 | NIST | |
| Ip | 1143.00 | NIST | |
| Ip | 1132.00 | NIST | |
| Ip | 1136.00 | NIST | |
| Ip | 1138.00 | NIST | |
| Ip | 1160.00 | NIST | |
| Ip | Outlier 1190.00 | NIST | |
| Ip | 1172.00 | NIST | |
| Ip | 1183.00 | NIST | |
| Ip | Outlier 1193.00 | NIST | |
| Ip | 1148.00 | NIST | |
| Ip | 1160.00 | NIST | |
| Ip | 1161.00 | NIST | |
| Ip | 1156.00 | NIST | |
| Ip | 1159.00 | NIST | |
| Ip | 1170.00 | NIST | |
| Ip | 1180.00 | NIST | |
| Ip | Outlier 1195.00 | NIST | |
| Ip | 1138.00 | NIST | |
| Ip | 1148.00 | NIST | |
| Ip | 1124.00 | NIST | |
| Ip | 1160.00 | NIST | |
| Ip | 1120.00 | NIST | |
| Ip | 1136.00 | NIST | |
| Ip | 1146.00 | NIST | |
| Ip | 1156.00 | NIST | |
| Ip | 1121.00 | NIST | |
| Ip | 1134.00 | NIST | |
| Ip | 1135.00 | NIST | |
| Ip | 1133.00 | NIST | |
| Ip | 1126.00 | NIST | |
| Ip | 1149.00 | NIST | |
| Ip | 1132.00 | NIST | |
| Ip | 1148.00 | NIST | |
| Ip | 1137.00 | NIST | |
| Ip | 1124.00 | NIST | |
| Ip | 1138.00 | NIST | |
| Ip | 1121.00 | NIST | |
| Ip | 1138.00 | NIST | |
| Ip | 1138.00 | NIST | |
| Ip | 1147.00 | NIST | |
| Ip | 1144.00 | NIST | |
| Ip | 1132.00 | NIST | |
| Ip | 1135.00 | NIST | |
| Ip | 1131.00 | NIST | |
| Ip | 1133.00 | NIST | |
| Ip | 1135.00 | NIST | |
| Ip | 1132.00 | NIST | |
| Ip | 1146.00 | NIST | |
| Ip | 1132.00 | NIST | |
| Ip | 1136.00 | NIST | |
| Ip | 1121.00 | NIST | |
| Ip | 1158.00 | NIST | |
| Ip | 1161.00 | NIST | |
| Ip | 1135.00 | NIST | |
| Ip | 1118.00 | NIST | |
| Ip | 1147.00 | NIST | |
| Ip | 1145.00 | NIST | |
| Ip | 1137.00 | NIST | |
| Ip | 1124.00 | NIST | |
| Ip | 1164.00 | NIST | |
| Ip | 1145.00 | NIST | |
| Ip | 1138.00 | NIST | |
| Ip | 1164.00 | NIST | |
| Ip | 1130.00 | NIST | |
| Ip | 1147.00 | NIST | |
| Ip | 1131.00 | NIST | |
| Ip | 1147.00 | NIST | |
| Ip | 1150.00 | NIST | |
| Ip | 1143.00 | NIST | |
| Ip | 1172.00 | NIST | |
| Ip | 1161.00 | NIST | |
| Ip | Outlier 1195.00 | NIST | |
| Ip | 1132.00 | NIST | |
| Ip | 1160.00 | NIST | |
| Ip | 1121.00 | NIST | |
| Ip | 1149.00 | NIST | |
| Ip | 1138.00 | NIST | |
| S°gas | 358.20 ± 1.30 | J/mol×K | NIST |
| S°liquid | [252.30; 253.80] | J/mol×K |
|
| S°liquid | 253.80 | J/mol×K | NIST |
| S°liquid | 252.30 | J/mol×K | NIST |
| Tboil | [409.00; 413.35] | K |
|
| Tboil | 412.00 | K | Isobaric vapor-liquid equilibrium for the binary mixtures of nonane with cyclohexane, toluene, m-xylene, or p-xylene at 101.3 kPa |
| Tboil | 412.21 | K | Isobaric Vapor-Liquid Equilibium for the Binary Systems of Methyl Formate with o-Xylene, m-Xylene, p-Xylene, and Ethylbenzene at 101.33 kPa |
| Tboil | 412.34 | K | ChemSep v8.3 pure component data Compiled value |
| Tboil | 412.27 | K | KDB |
| Tboil | 412.27 | K | NCMS SOLV-DB |
| Tboil | 412.15 ± 0.20 | K | NIST |
| Tboil | 412.29 ± 0.15 | K | NIST |
| Tboil | 412.30 | K | NIST |
| Tboil | 412.30 | K | NIST |
| Tboil | 412.20 ± 0.20 | K | NIST |
| Tboil | 412.40 ± 0.20 | K | NIST |
| Tboil | 412.25 ± 1.00 | K | NIST |
| Tboil | Outlier 409.00 ± 8.00 | K | NIST |
| Tboil | 412.23 ± 0.20 | K | NIST |
| Tboil | 412.30 ± 0.50 | K | NIST |
| Tboil | 412.10 ± 0.40 | K | NIST |
| Tboil | 412.00 ± 1.50 | K | NIST |
| Tboil | 412.40 ± 0.50 | K | NIST |
| Tboil | 412.25 ± 0.02 | K | NIST |
| Tboil | 412.40 ± 0.60 | K | NIST |
| Tboil | 412.30 ± 0.15 | K | NIST |
| Tboil | 412.40 ± 0.50 | K | NIST |
| Tboil | 412.35 ± 0.50 | K | NIST |
| Tboil | 412.25 ± 0.01 | K | NIST |
| Tboil | 412.15 ± 1.00 | K | NIST |
| Tboil | 412.26 ± 0.06 | K | NIST |
| Tboil | 412.35 ± 0.30 | K | NIST |
| Tboil | 412.38 ± 0.10 | K | NIST |
| Tboil | 412.22 ± 0.20 | K | NIST |
| Tboil | 412.35 ± 0.50 | K | NIST |
| Tboil | 412.45 ± 0.20 | K | NIST |
| Tboil | 412.65 ± 1.20 | K | NIST |
| Tboil | 412.20 ± 0.50 | K | NIST |
| Tboil | 412.20 ± 0.50 | K | NIST |
| Tboil | 412.20 ± 0.50 | K | NIST |
| Tboil | 412.50 ± 0.20 | K | NIST |
| Tboil | 412.50 ± 0.30 | K | NIST |
| Tboil | 412.45 ± 0.40 | K | NIST |
| Tboil | Outlier 409.00 ± 3.00 | K | NIST |
| Tboil | 412.15 ± 0.10 | K | NIST |
| Tboil | 412.00 ± 2.00 | K | NIST |
| Tboil | 412.15 ± 0.30 | K | NIST |
| Tboil | 412.00 ± 2.00 | K | NIST |
| Tboil | 412.45 ± 0.50 | K | NIST |
| Tboil | 412.45 ± 0.50 | K | NIST |
| Tboil | 411.90 ± 0.70 | K | NIST |
| Tboil | 413.35 ± 1.50 | K | NIST |
| Tboil | 412.40 ± 1.50 | K | NIST |
| Tc | [616.50; 622.20] | K |
|
| Tc | 617.00 | K | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 3 Compiled value |
| Tc | 617.00 | K | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Tc | 617.05 | K | Passut and Danner (1973), critical constants and acentric factors Compiled value |
| Tc | 617.00 | K | ChemSep v8.3 pure component data Compiled value |
| Tc | 617.00 | K | KDB |
| Tc | 617.00 ± 0.50 | K | NIST |
| Tc | 617.05 ± 0.10 | K | NIST |
| Tc | 616.97 ± 0.10 | K | NIST |
| Tc | 616.50 ± 0.15 | K | NIST |
| Tc | 620.00 ± 3.00 | K | NIST |
| Tc | 617.45 ± 2.00 | K | NIST |
| Tc | 616.80 ± 0.60 | K | NIST |
| Tc | Outlier 622.20 ± 6.00 | K | NIST |
| Tc | 618.80 ± 2.00 | K | NIST |
| Tfus | [219.55; 226.65] | K |
|
| Tfus | 225.35 | K | Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) Compiled value |
| Tfus | 225.30 | K | ChemSep v8.3 pure component data Compiled value |
| Tfus | 225.30 | K | KDB |
| Tfus | 225.55 | K | Aq. Solubility Prediction |
| Tfus | 225.28 | K | NCMS SOLV-DB |
| Tfus | 225.20 ± 0.15 | K | NIST |
| Tfus | 225.80 ± 0.30 | K | NIST |
| Tfus | 225.22 ± 0.15 | K | NIST |
| Tfus | 225.17 ± 0.01 | K | NIST |
| Tfus | 225.25 ± 0.10 | K | NIST |
| Tfus | 226.65 ± 0.20 | K | NIST |
| Tfus | 225.80 ± 0.50 | K | NIST |
| Tfus | 223.85 ± 0.30 | K | NIST |
| Tfus | Outlier 219.55 ± 0.40 | K | NIST |
| Ttriple | [219.60; 225.30] | K |
|
| Ttriple | 225.28 | K | Staveley, Lobo and Calado (1981), triple points Compiled value |
| Ttriple | 225.30 | K | ChemSep v8.3 pure component data Compiled value |
| Ttriple | 219.60 ± 0.30 | K | NIST |
| Ttriple | 219.60 ± 0.30 | K | NIST |
| UQi | 3.54 | ChemSep v8.3 pure component data Compiled value | |
| URi | 4.66 | ChemSep v8.3 pure component data Compiled value | |
| Vc | [0.375; 0.376] | m3/kmol |
|
| Vc | 0.375 | m3/kmol | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 3 Compiled value |
| Vc | 0.376 | m3/kmol | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Vc | 0.375 | m3/kmol | ChemSep v8.3 pure component data Compiled value |
| Vc | 0.375 | m3/kmol | KDB |
| Vc | 0.375 | m3/kmol | NIST |
| VCOSTALD | 0.37 | m3/kmol | Hankinson and Thomson (1979), COSTALD parameters Compiled value |
| ωSRK | 0.32 | Hankinson and Thomson (1979), COSTALD parameters Compiled value | |
| Zc | [0.2588420; 0.2590000] |
|
|
| Zc | 0.2590000 | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 3 Compiled value | |
| Zc | 0.2590000 | ChemSep v8.3 pure component data Compiled value | |
| Zc | 0.2588420 | KDB | |
| Zra | [0.26; 0.26] |
|
|
| Zra | 0.26 | Hankinson and Thomson (1979), COSTALD parameters Compiled value | |
| Zra | 0.26 | ChemSep v8.3 pure component data Compiled value | |
| Zra | 0.26 | KDB |
Temperature Dependent Properties
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 273.56 | 100.00 | 0.0008 |
| 273.55 | 1000.00 | 0.0008 |
| 273.55 | 5000.00 | 0.0008 |
| 273.54 | 10000.00 | 0.0009 |
| 273.55 | 15000.00 | 0.0009 |
| 273.55 | 20000.00 | 0.0009 |
| 273.54 | 25000.00 | 0.0010 |
| 273.54 | 30000.00 | 0.0010 |
| 283.24 | 100.00 | 0.0007 |
| 283.25 | 1000.00 | 0.0007 |
| 283.25 | 5000.00 | 0.0007 |
| 283.24 | 10000.00 | 0.0008 |
| 283.25 | 15000.00 | 0.0008 |
| 283.25 | 20000.00 | 0.0008 |
| 283.25 | 25000.00 | 0.0009 |
| 283.25 | 30000.00 | 0.0009 |
| 293.07 | 100.00 | 0.0006 |
| 293.06 | 1000.00 | 0.0006 |
| 293.07 | 5000.00 | 0.0006 |
| 293.07 | 10000.00 | 0.0007 |
| 293.07 | 15000.00 | 0.0007 |
| 293.06 | 20000.00 | 0.0007 |
| 293.06 | 25000.00 | 0.0007 |
| 293.07 | 30000.00 | 0.0008 |
| 302.90 | 100.00 | 0.0006 |
| 302.90 | 1000.00 | 0.0006 |
| 302.88 | 5000.00 | 0.0006 |
| 302.90 | 10000.00 | 0.0006 |
| 302.89 | 15000.00 | 0.0006 |
| 302.90 | 20000.00 | 0.0006 |
| 302.88 | 25000.00 | 0.0007 |
| 302.87 | 30000.00 | 0.0007 |
| 313.30 | 100.00 | 0.0005 |
| 313.29 | 1000.00 | 0.0005 |
| 313.30 | 5000.00 | 0.0005 |
| 313.30 | 10000.00 | 0.0005 |
| 313.31 | 15000.00 | 0.0006 |
| 313.31 | 20000.00 | 0.0006 |
| 313.31 | 25000.00 | 0.0006 |
| 313.31 | 30000.00 | 0.0006 |
| 323.01 | 100.00 | 0.0004 |
| 323.01 | 1000.00 | 0.0005 |
| 323.01 | 5000.00 | 0.0005 |
| 323.00 | 10000.00 | 0.0005 |
| 323.02 | 15000.00 | 0.0005 |
| 323.02 | 20000.00 | 0.0005 |
| 323.02 | 25000.00 | 0.0005 |
| 323.02 | 30000.00 | 0.0006 |
| 333.10 | 100.00 | 0.0004 |
| 333.11 | 1000.00 | 0.0004 |
| 333.11 | 5000.00 | 0.0004 |
| 333.11 | 10000.00 | 0.0004 |
| 333.11 | 15000.00 | 0.0005 |
| 333.11 | 20000.00 | 0.0005 |
| 333.12 | 25000.00 | 0.0005 |
| 333.12 | 30000.00 | 0.0005 |
| 342.98 | 100.00 | 0.0004 |
| 342.98 | 1000.00 | 0.0004 |
| 342.98 | 5000.00 | 0.0004 |
| 342.98 | 10000.00 | 0.0004 |
| 342.98 | 15000.00 | 0.0004 |
| 342.97 | 20000.00 | 0.0004 |
| 342.97 | 25000.00 | 0.0005 |
| 342.97 | 30000.00 | 0.0005 |
| 352.89 | 100.00 | 0.0003 |
| 352.89 | 1000.00 | 0.0003 |
| 352.89 | 5000.00 | 0.0004 |
| 352.89 | 10000.00 | 0.0004 |
| 352.89 | 15000.00 | 0.0004 |
| 352.88 | 20000.00 | 0.0004 |
| 352.88 | 25000.00 | 0.0004 |
| 352.88 | 30000.00 | 0.0004 |
| 362.69 | 100.00 | 0.0003 |
| 362.70 | 1000.00 | 0.0003 |
| 362.70 | 5000.00 | 0.0003 |
| 362.70 | 10000.00 | 0.0003 |
| 362.71 | 15000.00 | 0.0004 |
| 362.71 | 20000.00 | 0.0004 |
| 362.71 | 25000.00 | 0.0004 |
| 362.71 | 30000.00 | 0.0004 |
| 372.50 | 100.00 | 0.0003 |
| 372.50 | 1000.00 | 0.0003 |
| 372.51 | 5000.00 | 0.0003 |
| 372.51 | 10000.00 | 0.0003 |
| 372.51 | 15000.00 | 0.0003 |
| 372.51 | 20000.00 | 0.0003 |
| 372.51 | 25000.00 | 0.0004 |
| 372.51 | 30000.00 | 0.0004 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 100.00 | 0.0006 |
| 298.15 | 40100.00 | 0.0008 |
| 298.15 | 41000.00 | 0.0008 |
| 298.15 | 79700.00 | 0.0010 |
| 298.15 | 80300.00 | 0.0010 |
| 298.15 | 80400.00 | 0.0010 |
| 298.15 | 80800.00 | 0.0010 |
| 298.15 | 120200.00 | 0.0013 |
| 298.15 | 120400.00 | 0.0013 |
| 298.15 | 159100.00 | 0.0016 |
| 298.15 | 159400.00 | 0.0016 |
| 298.15 | 160000.00 | 0.0016 |
| 298.15 | 161300.00 | 0.0016 |
| 298.15 | 191300.00 | 0.0019 |
| 298.15 | 198500.00 | 0.0020 |
| 298.15 | 100.00 | 0.0006 |
| 298.15 | 100.00 | 0.0006 |
| 298.15 | 100.00 | 0.0006 |
| 323.15 | 100.00 | 0.0004 |
| 323.15 | 41700.00 | 0.0006 |
| 323.15 | 80500.00 | 0.0008 |
| 323.15 | 81400.00 | 0.0008 |
| 323.15 | 121700.00 | 0.0010 |
| 323.15 | 159200.00 | 0.0012 |
| 323.15 | 160000.00 | 0.0012 |
| 323.15 | 189600.00 | 0.0013 |
| 323.15 | 100.00 | 0.0004 |
| 348.15 | 100.00 | 0.0004 |
| 348.15 | 41400.00 | 0.0005 |
| 348.15 | 80900.00 | 0.0006 |
| 348.15 | 121200.00 | 0.0007 |
| 348.15 | 158900.00 | 0.0009 |
| 348.15 | 160800.00 | 0.0009 |
| 348.15 | 192300.00 | 0.0010 |
| 348.15 | 100.00 | 0.0004 |
| 348.15 | 80900.00 | 0.0006 |
| 373.15 | 100.00 | 0.0003 |
| 373.15 | 41800.00 | 0.0004 |
| 373.15 | 80800.00 | 0.0005 |
| 373.15 | 81400.00 | 0.0005 |
| 373.15 | 121100.00 | 0.0006 |
| 373.15 | 158600.00 | 0.0007 |
| 373.15 | 160800.00 | 0.0007 |
| 373.15 | 191300.00 | 0.0008 |
| 373.15 | 100.00 | 0.0003 |
| 398.15 | 100.00 | 0.0002 |
| 398.15 | 39700.00 | 0.0003 |
| 398.15 | 79700.00 | 0.0004 |
| 398.15 | 80300.00 | 0.0004 |
| 398.15 | 119900.00 | 0.0005 |
| 398.15 | 159700.00 | 0.0006 |
| 398.15 | 160700.00 | 0.0006 |
| 398.15 | 197100.00 | 0.0007 |
| 398.15 | 100.00 | 0.0002 |
| 423.15 | 21300.00 | 0.0002 |
| 423.15 | 21800.00 | 0.0003 |
| 423.15 | 40500.00 | 0.0003 |
| 423.15 | 80400.00 | 0.0004 |
| 423.15 | 80600.00 | 0.0004 |
| 423.15 | 122200.00 | 0.0004 |
| 423.15 | 160300.00 | 0.0005 |
| 423.15 | 161600.00 | 0.0005 |
| 423.15 | 195700.00 | 0.0006 |
| 448.15 | 19900.00 | 0.0002 |
| 448.15 | 20900.00 | 0.0002 |
| 448.15 | 40500.00 | 0.0003 |
| 448.15 | 79600.00 | 0.0003 |
| 448.15 | 81000.00 | 0.0003 |
| 448.15 | 120500.00 | 0.0004 |
| 448.15 | 161000.00 | 0.0005 |
| 448.15 | 162300.00 | 0.0005 |
| 448.15 | 190700.00 | 0.0005 |
| 473.15 | 19900.00 | 0.0002 |
| 473.15 | 20100.00 | 0.0002 |
| 473.15 | 40000.00 | 0.0002 |
| 473.15 | 79900.00 | 0.0003 |
| 473.15 | 80200.00 | 0.0003 |
| 473.15 | 120800.00 | 0.0004 |
| 473.15 | 163000.00 | 0.0004 |
| 473.15 | 163800.00 | 0.0004 |
| 473.15 | 196400.00 | 0.0005 |
| Reference | ||
Refractive index (Na D-line)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
| 93.00 | 298.15 | 1.4943 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 100.00 | 293.15 | 864.2 |
| 1000.00 | 293.15 | 864.4 |
| 3000.00 | 293.15 | 865.8 |
| 5000.00 | 293.15 | 866.9 |
| 10000.00 | 293.15 | 870.5 |
| 15000.00 | 293.15 | 873.8 |
| 20000.00 | 293.15 | 877.0 |
| 25000.00 | 293.15 | 880.2 |
| 30000.00 | 293.15 | 883.2 |
| 35000.00 | 293.15 | 886.0 |
| 40000.00 | 293.15 | 888.7 |
| 50000.00 | 293.15 | 894.4 |
| 60000.00 | 293.15 | 899.1 |
| 100.00 | 303.15 | 855.0 |
| 1000.00 | 303.15 | 855.4 |
| 3000.00 | 303.15 | 857.5 |
| 5000.00 | 303.15 | 858.8 |
| 10000.00 | 303.15 | 862.3 |
| 15000.00 | 303.15 | 865.8 |
| 20000.00 | 303.15 | 869.0 |
| 25000.00 | 303.15 | 872.2 |
| 30000.00 | 303.15 | 875.3 |
| 35000.00 | 303.15 | 878.2 |
| 40000.00 | 303.15 | 881.0 |
| 50000.00 | 303.15 | 886.7 |
| 60000.00 | 303.15 | 892.0 |
| 100.00 | 313.15 | 846.7 |
| 1000.00 | 313.15 | 846.9 |
| 3000.00 | 313.15 | 848.6 |
| 5000.00 | 313.15 | 850.1 |
| 10000.00 | 313.15 | 854.0 |
| 15000.00 | 313.15 | 857.6 |
| 20000.00 | 313.15 | 861.1 |
| 25000.00 | 313.15 | 864.5 |
| 30000.00 | 313.15 | 867.7 |
| 35000.00 | 313.15 | 870.9 |
| 40000.00 | 313.15 | 873.8 |
| 50000.00 | 313.15 | 879.8 |
| 60000.00 | 313.15 | 885.1 |
| 100.00 | 323.15 | 837.7 |
| 1000.00 | 323.15 | 838.6 |
| 3000.00 | 323.15 | 840.2 |
| 5000.00 | 323.15 | 841.9 |
| 10000.00 | 323.15 | 845.9 |
| 15000.00 | 323.15 | 849.8 |
| 20000.00 | 323.15 | 853.6 |
| 25000.00 | 323.15 | 857.0 |
| 30000.00 | 323.15 | 860.4 |
| 35000.00 | 323.15 | 863.7 |
| 40000.00 | 323.15 | 866.9 |
| 50000.00 | 323.15 | 873.0 |
| 60000.00 | 323.15 | 878.8 |
| 100.00 | 333.15 | 829.0 |
| 1000.00 | 333.15 | 829.8 |
| 3000.00 | 333.15 | 831.7 |
| 5000.00 | 333.15 | 833.4 |
| 10000.00 | 333.15 | 837.6 |
| 15000.00 | 333.15 | 841.6 |
| 20000.00 | 333.15 | 845.6 |
| 25000.00 | 333.15 | 849.3 |
| 30000.00 | 333.15 | 852.8 |
| 35000.00 | 333.15 | 856.2 |
| 40000.00 | 333.15 | 859.7 |
| 50000.00 | 333.15 | 866.0 |
| 60000.00 | 333.15 | 871.9 |
| 100.00 | 343.15 | 820.0 |
| 1000.00 | 343.15 | 821.1 |
| 3000.00 | 343.15 | 823.0 |
| 5000.00 | 343.15 | 825.0 |
| 10000.00 | 343.15 | 829.4 |
| 15000.00 | 343.15 | 833.6 |
| 20000.00 | 343.15 | 837.9 |
| 25000.00 | 343.15 | 841.7 |
| 30000.00 | 343.15 | 845.5 |
| 35000.00 | 343.15 | 849.2 |
| 40000.00 | 343.15 | 852.5 |
| 50000.00 | 343.15 | 859.1 |
| 60000.00 | 343.15 | 865.0 |
| 100.00 | 353.15 | 811.3 |
| 1000.00 | 353.15 | 812.2 |
| 3000.00 | 353.15 | 814.3 |
| 5000.00 | 353.15 | 816.2 |
| 10000.00 | 353.15 | 821.0 |
| 15000.00 | 353.15 | 825.7 |
| 20000.00 | 353.15 | 829.8 |
| 25000.00 | 353.15 | 834.0 |
| 30000.00 | 353.15 | 838.0 |
| 35000.00 | 353.15 | 841.7 |
| 40000.00 | 353.15 | 845.3 |
| 50000.00 | 353.15 | 852.1 |
| 60000.00 | 353.15 | 858.5 |
| 100.00 | 363.15 | 802.2 |
| 1000.00 | 363.15 | 803.3 |
| 3000.00 | 363.15 | 805.5 |
| 5000.00 | 363.15 | 807.6 |
| 10000.00 | 363.15 | 812.4 |
| 15000.00 | 363.15 | 817.6 |
| 20000.00 | 363.15 | 821.8 |
| 25000.00 | 363.15 | 826.0 |
| 30000.00 | 363.15 | 830.2 |
| 35000.00 | 363.15 | 834.2 |
| 40000.00 | 363.15 | 838.1 |
| 50000.00 | 363.15 | 845.2 |
| 60000.00 | 363.15 | 852.0 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [71.69; 359.34] | J/mol×K | [150.00; 1500.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 6.20920e+01 | |||
| Coefficient B | -5.72210e+02 | |||
| Coefficient C | 6.06724e+00 | |||
| Coefficient D | 6.25770e-05 | |||
| Coefficient E | -3.78110e-08 | |||
| Temperature range, min. | 150.00 | |||
| Temperature range, max. | 1500.00 | |||
| Cp,gas | 71.69 | J/mol×K | 150.00 | Calculated Property |
| Cp,gas | 127.15 | J/mol×K | 300.00 | Calculated Property |
| Cp,gas | 185.58 | J/mol×K | 450.00 | Calculated Property |
| Cp,gas | 232.38 | J/mol×K | 600.00 | Calculated Property |
| Cp,gas | 268.52 | J/mol×K | 750.00 | Calculated Property |
| Cp,gas | 296.52 | J/mol×K | 900.00 | Calculated Property |
| Cp,gas | 318.38 | J/mol×K | 1050.00 | Calculated Property |
| Cp,gas | 335.52 | J/mol×K | 1200.00 | Calculated Property |
| Cp,gas | 348.94 | J/mol×K | 1350.00 | Calculated Property |
| Cp,gas | 359.34 | J/mol×K | 1500.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | [160.58; 290.81] | J/mol×K | [217.00; 540.15] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,liquid in J/mol×K, T in K | |||
| Coefficient A | 1.27090e+02 | |||
| Coefficient B | -6.29990e+01 | |||
| Coefficient C | 2.46844e+00 | |||
| Coefficient D | 6.85490e-03 | |||
| Coefficient E | -3.27780e-06 | |||
| Temperature range, min. | 217.00 | |||
| Temperature range, max. | 540.15 | |||
| Cp,liquid | 160.58 | J/mol×K | 217.00 | Calculated Property |
| Cp,liquid | 169.33 | J/mol×K | 252.91 | Calculated Property |
| Cp,liquid | 179.37 | J/mol×K | 288.81 | Calculated Property |
| Cp,liquid | 190.82 | J/mol×K | 324.72 | Calculated Property |
| Cp,liquid | 203.76 | J/mol×K | 360.62 | Calculated Property |
| Cp,liquid | 218.23 | J/mol×K | 396.53 | Calculated Property |
| Cp,liquid | 234.23 | J/mol×K | 432.43 | Calculated Property |
| Cp,liquid | 251.72 | J/mol×K | 468.34 | Calculated Property |
| Cp,liquid | 270.63 | J/mol×K | 504.24 | Calculated Property |
| Cp,liquid | 290.81 | J/mol×K | 540.15 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | [0.0018334; 0.0001449] | Pa×s | [225.30; 493.60] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is η in Pa×s, T in K | |||
| Coefficient A | -1.33620e+01 | |||
| Coefficient B | 1.14140e+03 | |||
| Coefficient C | 3.71820e-01 | |||
| Coefficient D | -3.94230e-07 | |||
| Coefficient E | 2.00000e+00 | |||
| Temperature range, min. | 225.30 | |||
| Temperature range, max. | 493.60 | |||
| η | 0.0018334 | Pa×s | 225.30 | Calculated Property |
| η | 0.0010563 | Pa×s | 255.11 | Calculated Property |
| η | 0.0006848 | Pa×s | 284.92 | Calculated Property |
| η | 0.0004828 | Pa×s | 314.73 | Calculated Property |
| η | 0.0003620 | Pa×s | 344.54 | Calculated Property |
| η | 0.0002844 | Pa×s | 374.36 | Calculated Property |
| η | 0.0002315 | Pa×s | 404.17 | Calculated Property |
| η | 0.0001939 | Pa×s | 433.98 | Calculated Property |
| η | 0.0001661 | Pa×s | 463.79 | Calculated Property |
| η | 0.0001449 | Pa×s | 493.60 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [46.56; 0.00] | kJ/mol | [225.30; 617.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is ΔvapH in kJ/mol, T in K | |||
| Coefficient A | 5.95620e+01 | |||
| Coefficient B | 6.78410e-01 | |||
| Coefficient C | -3.89380e-01 | |||
| Coefficient D | 6.11150e-03 | |||
| Coefficient E | 1.02190e-01 | |||
| Critical temperature, Tc (K) | 6.17000e+02 | |||
| Temperature range, min. | 225.30 | |||
| Temperature range, max. | 617.00 | |||
| ΔvapH | 46.56 | kJ/mol | 225.30 | Calculated Property |
| ΔvapH | 44.28 | kJ/mol | 268.82 | Calculated Property |
| ΔvapH | 41.97 | kJ/mol | 312.34 | Calculated Property |
| ΔvapH | 39.57 | kJ/mol | 355.87 | Calculated Property |
| ΔvapH | 37.01 | kJ/mol | 399.39 | Calculated Property |
| ΔvapH | 34.14 | kJ/mol | 442.91 | Calculated Property |
| ΔvapH | 30.77 | kJ/mol | 486.43 | Calculated Property |
| ΔvapH | 26.52 | kJ/mol | 529.96 | Calculated Property |
| ΔvapH | 20.41 | kJ/mol | 573.48 | Calculated Property |
| ΔvapH | 0.00 | kJ/mol | 617.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.63] | kPa | [300.97; 439.80] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.45202e+01 | |||
| Coefficient B | -3.62202e+03 | |||
| Coefficient C | -4.64790e+01 | |||
| Temperature range, min. | 300.97 | |||
| Temperature range, max. | 439.80 | |||
| Pvap | 1.33 | kPa | 300.97 | Calculated Property |
| Pvap | 3.01 | kPa | 316.40 | Calculated Property |
| Pvap | 6.21 | kPa | 331.82 | Calculated Property |
| Pvap | 11.91 | kPa | 347.25 | Calculated Property |
| Pvap | 21.44 | kPa | 362.67 | Calculated Property |
| Pvap | 36.52 | kPa | 378.10 | Calculated Property |
| Pvap | 59.35 | kPa | 393.52 | Calculated Property |
| Pvap | 92.54 | kPa | 408.95 | Calculated Property |
| Pvap | 139.14 | kPa | 424.37 | Calculated Property |
| Pvap | 202.63 | kPa | 439.80 | Calculated Property |
| Pvap | [2.85e-03; 3534.41] | kPa | [225.30; 617.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is Pvap in kPa, T in K | |||
| Coefficient A | 9.10602e+01 | |||
| Coefficient B | -8.16470e+03 | |||
| Coefficient C | -1.12690e+01 | |||
| Coefficient D | 7.21010e-06 | |||
| Coefficient E | 2.00000e+00 | |||
| Comment | Range stopped at Tc; ChemSep gives it to 617.05 K. | |||
| Temperature range, min. | 225.30 | |||
| Temperature range, max. | 617.00 | |||
| Pvap | 2.85e-03 | kPa | 225.30 | Calculated Property |
| Pvap | 0.16 | kPa | 268.82 | Calculated Property |
| Pvap | 2.44 | kPa | 312.34 | Calculated Property |
| Pvap | 16.94 | kPa | 355.87 | Calculated Property |
| Pvap | 71.29 | kPa | 399.39 | Calculated Property |
| Pvap | 215.79 | kPa | 442.91 | Calculated Property |
| Pvap | 522.71 | kPa | 486.43 | Calculated Property |
| Pvap | 1086.51 | kPa | 529.96 | Calculated Property |
| Pvap | 2032.02 | kPa | 573.48 | Calculated Property |
| Pvap | 3534.41 | kPa | 617.00 | Calculated Property |
| Pvap | [3.23e-03; 3526.67] | kPa | [225.30; 617.05] |
KDB Vapor Pressure Data
|
| Equation | ln(Y) = A + B/T + C·ln(T) + D·T² + E/T² Y is Pvap in kPa, T in K | |||
| Coefficient A | 7.68670e+01 | |||
| Coefficient B | -7.55661e+03 | |||
| Coefficient C | -9.10668e+00 | |||
| Coefficient D | 5.40363e-06 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 225.30 | |||
| Temperature range, max. | 617.05 | |||
| Pvap | 3.23e-03 | kPa | 225.30 | Calculated Property |
| Pvap | 0.17 | kPa | 268.83 | Calculated Property |
| Pvap | 2.44 | kPa | 312.36 | Calculated Property |
| Pvap | 16.77 | kPa | 355.88 | Calculated Property |
| Pvap | 70.86 | kPa | 399.41 | Calculated Property |
| Pvap | 216.17 | kPa | 442.94 | Calculated Property |
| Pvap | 527.17 | kPa | 486.47 | Calculated Property |
| Pvap | 1098.76 | kPa | 529.99 | Calculated Property |
| Pvap | 2048.41 | kPa | 573.52 | Calculated Property |
| Pvap | 3526.67 | kPa | 617.05 | Calculated Property |
| Pvap | [6.37; 103.91] | kPa | [332.40; 413.19] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.41288e+01 | |||
| Coefficient B | -3.36918e+03 | |||
| Coefficient C | -5.79910e+01 | |||
| Reference | Williamham, Taylor, et al., 1945 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 332.40 | |||
| Temperature range, max. | 413.19 | |||
| Pvap | 6.37 | kPa | 332.40 | Calculated Property |
| Pvap | 9.39 | kPa | 341.38 | Calculated Property |
| Pvap | 13.53 | kPa | 350.35 | Calculated Property |
| Pvap | 19.07 | kPa | 359.33 | Calculated Property |
| Pvap | 26.35 | kPa | 368.31 | Calculated Property |
| Pvap | 35.76 | kPa | 377.28 | Calculated Property |
| Pvap | 47.72 | kPa | 386.26 | Calculated Property |
| Pvap | 62.71 | kPa | 395.24 | Calculated Property |
| Pvap | 81.25 | kPa | 404.21 | Calculated Property |
| Pvap | 103.91 | kPa | 413.19 | Calculated Property |
| Pvap | [0.23; 6.58] | kPa | [273.00; 333.00] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.63299e+01 | |||
| Coefficient B | -4.59721e+03 | |||
| Coefficient C | -1.47720e+01 | |||
| Reference | Pitzer and Scott, 1943 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 273.00 | |||
| Temperature range, max. | 333.00 | |||
| Pvap | 0.23 | kPa | 273.00 | Calculated Property |
| Pvap | 0.36 | kPa | 279.67 | Calculated Property |
| Pvap | 0.55 | kPa | 286.33 | Calculated Property |
| Pvap | 0.82 | kPa | 293.00 | Calculated Property |
| Pvap | 1.21 | kPa | 299.67 | Calculated Property |
| Pvap | 1.75 | kPa | 306.33 | Calculated Property |
| Pvap | 2.50 | kPa | 313.00 | Calculated Property |
| Pvap | 3.50 | kPa | 319.67 | Calculated Property |
| Pvap | 4.83 | kPa | 326.33 | Calculated Property |
| Pvap | 6.58 | kPa | 333.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ρl | [918.12; 280.42] | kg/m3 | [225.30; 617.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A / B^(1 + (1 − T/C)^D) Y is ρl in kg/m3, T in K | |||
| Coefficient A | 7.31498e+01 | |||
| Coefficient B | 2.60860e-01 | |||
| Coefficient C | 6.17000e+02 | |||
| Coefficient D | 2.74790e-01 | |||
| Temperature range, min. | 225.30 | |||
| Temperature range, max. | 617.00 | |||
| ρl | 918.12 | kg/m3 | 225.30 | Calculated Property |
| ρl | 884.08 | kg/m3 | 268.82 | Calculated Property |
| ρl | 848.26 | kg/m3 | 312.34 | Calculated Property |
| ρl | 810.19 | kg/m3 | 355.87 | Calculated Property |
| ρl | 769.26 | kg/m3 | 399.39 | Calculated Property |
| ρl | 724.45 | kg/m3 | 442.91 | Calculated Property |
| ρl | 674.02 | kg/m3 | 486.43 | Calculated Property |
| ρl | 614.50 | kg/m3 | 529.96 | Calculated Property |
| ρl | 536.33 | kg/m3 | 573.48 | Calculated Property |
| ρl | 280.42 | kg/m3 | 617.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| γ | [0.04; 0.02] | N/m | [225.25; 412.15] |
Jasper (1972), surface tension of pure liquid compounds Compiled value
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is γ in N/m, T in K | |||
| Coefficient A | 6.13858e-02 | |||
| Coefficient B | -1.10400e-04 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 225.25 | |||
| Temperature range, max. | 412.15 | |||
| γ | 0.04 | N/m | 225.25 | Calculated Property |
| γ | 0.03 | N/m | 246.02 | Calculated Property |
| γ | 0.03 | N/m | 266.78 | Calculated Property |
| γ | 0.03 | N/m | 287.55 | Calculated Property |
| γ | 0.03 | N/m | 308.32 | Calculated Property |
| γ | 0.03 | N/m | 329.08 | Calculated Property |
| γ | 0.02 | N/m | 349.85 | Calculated Property |
| γ | 0.02 | N/m | 370.62 | Calculated Property |
| γ | 0.02 | N/m | 391.38 | Calculated Property |
| γ | 0.02 | N/m | 412.15 | Calculated Property |
| γ | [0.04; 1.67e-05] | N/m | [225.30; 613.08] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is γ in N/m, T in K | |||
| Coefficient A | -8.12750e-03 | |||
| Coefficient B | 8.60690e+01 | |||
| Coefficient C | -3.59830e+00 | |||
| Coefficient D | 2.06020e-03 | |||
| Coefficient E | -6.95880e-06 | |||
| Comment | Range stopped where the equation turns negative; ChemSep gives it to 617 K. | |||
| Temperature range, min. | 225.30 | |||
| Temperature range, max. | 613.08 | |||
| γ | 0.04 | N/m | 225.30 | Calculated Property |
| γ | 0.03 | N/m | 268.39 | Calculated Property |
| γ | 0.03 | N/m | 311.47 | Calculated Property |
| γ | 0.02 | N/m | 354.56 | Calculated Property |
| γ | 0.02 | N/m | 397.65 | Calculated Property |
| γ | 0.01 | N/m | 440.74 | Calculated Property |
| γ | 0.01 | N/m | 483.82 | Calculated Property |
| γ | 0.01 | N/m | 526.91 | Calculated Property |
| γ | 0.00 | N/m | 570.00 | Calculated Property |
| γ | 1.67e-05 | N/m | 613.08 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λgas | [0.00; 0.10] | W/m×K | [225.30; 1000.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A·T^B / (1 + C/T + D/T²) Y is λgas in W/m×K, T in K | |||
| Coefficient A | 2.80010e-09 | |||
| Coefficient B | 2.42980e+00 | |||
| Coefficient C | -5.75120e+02 | |||
| Coefficient D | 1.22260e+05 | |||
| Temperature range, min. | 225.30 | |||
| Temperature range, max. | 1000.00 | |||
| λgas | 0.00 | W/m×K | 225.30 | Calculated Property |
| λgas | 0.01 | W/m×K | 311.38 | Calculated Property |
| λgas | 0.02 | W/m×K | 397.46 | Calculated Property |
| λgas | 0.03 | W/m×K | 483.53 | Calculated Property |
| λgas | 0.04 | W/m×K | 569.61 | Calculated Property |
| λgas | 0.05 | W/m×K | 655.69 | Calculated Property |
| λgas | 0.06 | W/m×K | 741.77 | Calculated Property |
| λgas | 0.07 | W/m×K | 827.84 | Calculated Property |
| λgas | 0.08 | W/m×K | 913.92 | Calculated Property |
| λgas | 0.10 | W/m×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λliquid | [0.15; 0.10] | W/m×K | [225.30; 413.10] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is λliquid in W/m×K, T in K | |||
| Coefficient A | -2.11580e-02 | |||
| Coefficient B | -2.73240e+01 | |||
| Coefficient C | -1.26630e+00 | |||
| Coefficient D | -1.66640e-03 | |||
| Coefficient E | -3.67440e-07 | |||
| Temperature range, min. | 225.30 | |||
| Temperature range, max. | 413.10 | |||
| λliquid | 0.15 | W/m×K | 225.30 | Calculated Property |
| λliquid | 0.14 | W/m×K | 246.17 | Calculated Property |
| λliquid | 0.14 | W/m×K | 267.03 | Calculated Property |
| λliquid | 0.13 | W/m×K | 287.90 | Calculated Property |
| λliquid | 0.13 | W/m×K | 308.77 | Calculated Property |
| λliquid | 0.12 | W/m×K | 329.63 | Calculated Property |
| λliquid | 0.12 | W/m×K | 350.50 | Calculated Property |
| λliquid | 0.11 | W/m×K | 371.37 | Calculated Property |
| λliquid | 0.11 | W/m×K | 392.23 | Calculated Property |
| λliquid | 0.10 | W/m×K | 413.10 | Calculated Property |
Similar Compounds
Find more compounds similar to Benzene, 1,3-dimethyl-.
Mixtures
- Acetonitrile + Benzene, 1,3-dimethyl-
- Ethanol + Benzene, 1,3-dimethyl- + Water
- Ethanol + Benzene, 1,3-dimethyl-
- Benzene + Benzene, 1,3-dimethyl-
- Benzene, 1,3-dimethyl- + 1-Butanol
- Benzene, 1,3-dimethyl- + Cyclohexane
- n-Hexane + Benzene, 1,3-dimethyl-
- 2-Propanol + Benzene, 1,3-dimethyl-
- 1-Hexene + Benzene, 1,3-dimethyl-
- Benzene, 1,3-dimethyl- + Methyl Alcohol
- Benzene, 1,3-dimethyl- + Water
- 2-Pyrrolidinone, 1-methyl- + Benzene, 1,3-dimethyl-
- Benzene, 1,3-dimethyl- + Thiophene, tetrahydro-, 1,1-dioxide
- p-Xylene + Benzene, 1,3-dimethyl-
- Benzene, nitro- + Benzene, 1,3-dimethyl-
- Toluene + Benzene, 1,3-dimethyl-
- Formamide, N,N-dimethyl- + Benzene, 1,3-dimethyl-
- Benzene, 1,3-dimethyl- + 2-[2-(2-hydroxypropoxy)propoxy]-1-propanol
- Benzene, 1,3-dimethyl- + Octane
- Benzene, 1,3-dimethyl- + 1,4-Dioxane
Find more mixtures with Benzene, 1,3-dimethyl-.
Sources
- KDB Vapor Pressure Data
- Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) ChEDL chemicals 1.5.2, from Bradley, J.-C.; Williams, A.; Lang, A. Jean-Claude Bradley Open Melting Point Dataset. Figshare, 2014 (CC0).
- Hankinson and Thomson (1979), COSTALD parameters ChEDL chemicals 1.5.2, from Hankinson, R. W.; Thomson, G. H. A New Correlation for Saturated Densities of Liquids and Their Mixtures. AIChE J. 1979, 25, 653-663.
- IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 3 ChEDL chemicals 1.5.2, from Tsonopoulos, C.; Ambrose, D. Vapor-Liquid Critical Properties of Elements and Compounds. 3. Aromatic Hydrocarbons. J. Chem. Eng. Data 1995, 40, 547-558.
- Jasper (1972), surface tension of pure liquid compounds ChEDL chemicals 1.5.2, from Jasper, J. J. The Surface Tension of Pure Liquid Compounds. J. Phys. Chem. Ref. Data 1972, 1, 841-1010 (as transcribed in Lange's Handbook).
- Passut and Danner (1973), critical constants and acentric factors ChEDL chemicals 1.5.2, from Passut, C. A.; Danner, R. P. Acentric Factor. A Valuable Correlating Parameter for the Properties of Hydrocarbons. Ind. Eng. Chem. Process Des. Dev. 1973, 12, 365-368.
- PSRK revision IV (2005), critical constants and acentric factors of 1000 components ChEDL chemicals 1.5.2, from Horstmann, S.; Jabłoniec, A.; Krafczyk, J.; Fischer, K.; Gmehling, J. PSRK Group Contribution Equation of State: Comprehensive Revision and Extension IV, Including Critical Constants and α-Function Parameters for 1000 Components. Fluid Phase Equilib. 2005, 227, 157-164.
- Staveley, Lobo and Calado (1981), triple points ChEDL chemicals 1.5.2, from Staveley, L. A. K.; Lobo, L. Q.; Calado, J. C. G. Triple-Points of Low Melting Substances and Their Use in Cryogenic Work. Cryogenics 1981, 21, 131-144.
- ChemSep v8.3 pure component data Converted from ChemSep v8.3 pure component data, H. Kooijman and R. Taylor (2021, 2022), Artistic License 2.0; see how the values differ.
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Experimental Study of the Dynamic Viscosity Deviations in the Binary Systems: Hexane + Ethylbenzene, + o-Xylene, + m-Xylene, + p-Xylene at 298.15 K
- Densities and Volumetric Properties of Binary Mixtures of Butyl Acrylate with Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene at Temperatures from 288.15 K to 318.15 K
- Bubble temperature measurements on the binary mixtures formed by decane with a variety of compounds at 95.8 kPa
- Experimental and theoretical surface tension deviations in the binary systems propyl propanoate + o-, m- and p-xylene at 298.15K
- Topological and thermodynamic investigations of molecular interactions in binary mixtures: Molar excess volumes and molar excess enthalpies
- Bubble points of some binary mixtures formed by o-cresol at 95.75 kPa
- Determination and correlation of vapor liquid equilibrium for binary systems consisting of close-boiling components
- Vapour liquid equilibria, enthalpy of mixing of binary mixtures containing diisopropylether DIPE and monoaromatic hydrocarbons Experimental results and modelling
- Separation of aromatic hydrocarbons from alkanes using ammonium ionic liquid C2NTf2 at T = 298.15K
- Ultrasonic and viscometric study of molecular interactions in binary mixtures of aniline with 1-propanol, 2-propanol, 2-methyl-1-propanol, and 2-methyl-2-propanol at different temperatures
- Liquid liquid equilibrium of ternary systems 1-butyl-3-methylimidazolium hexafluorophosphate + aromatic + aliphatic
- Excess Gibbs' energies of the binary mixtures formed by N,N-dimethylformamide with xylenes and cresols at 95.1 kPa
- Influence of temperature on thermodynamics of ethers + xylenes
- Activity coefficients at infinite dilution measurements for organic solutes and water in the ionic liquid 1-butyl-1-methylpyrrolidinium trifluoromethanesulfonate using GLC
- Isothermal vapor liquid equilibria for binary mixtures of benzene, toluene, m-xylene, and N-methylformamide at 333.15K and 353.15K
- Activity coefficients at infinite dilution measurements for organic solutes and water in the 1-hexyloxymethyl-3-methyl-imidazolium and 1,3-dihexyloxymethyl-imidazolium bis(trifluoromethylsulfonyl)-imide ionic liquids The cation influence
- Vapor liquid equilibria and density measurement for binary mixtures of toluene, benzene, o-xylene, m-xylene, sulfolane and nonane at 333.15K and 353.15K
- Vapor liquid equilibria and density measurement for binary mixtures of o-xylene + NMF, m-xylene +NMF and p-xylene +NMF at 333.15 K, 343.15 K and 353.15 K from 0 kPa to 101.3 kPa
- Liquid liquid equilibrium of ternary systems 1-octyl-3-methylimidazolium hexafluorophosphate + aromatic + aliphatic hydrocarbons
- Isomer effect in the separation of octane and xylenes using the ionic liquid 1-ethyl-3-methylimidazolium bis{(trifluoromethyl)sulfonyl}amide
- Application of [EMpy][ESO4] ionic liquid as solvent for the liquid extraction of xylenes from hexane
- Gas-liquid chromatography measurements of activity coefficients at infinite dilution of hydrocarbons and alkanols in 1-alkyl-3-methylimidazolium bis(oxalato)borate
- Activity coefficients at infinite dilution of organic solutes in the ionic liquid 1-ethyl-3-methylimidazolium methanesulfonate
- Study of [EMim][ESO4] ionic liquid as solvent in the liquid-liquid extraction of xylenes from their mixtures with hexane
- Isobaric vapor-liquid equilibrium for the binary mixtures of nonane with cyclohexane, toluene, m-xylene, or p-xylene at 101.3 kPa
- Activity coefficients at infinite dilution of organic solutes in the ionic liquid ethyl(2-hydroxyethyl)dimethyl-ammonium diethylphosphate using gas liquid chromatography
- Activity coefficients at infinite dilution of organic solutes in 1-octyl-3-methylimidazolium nitrate using gas-liquid chromatography
- Solubility of hydrofluorocarbons in aromatic solvents and alcohols: Experimental data and modeling with CPA EoS
- Isobaric vapor-liquid equilibrium of binary systems of decane with p-, o-, m-xylene at 20 kPa
- Isobaric vapor-liquid equilibrium data of the binary systems of octane with p, o, m-xylene at 20 kPa
- (Liquid-liquid) equilibria for ternary and quaternary systems of representative compounds of gasoline + methanol at 293.15 K: Experimental data and correlation
- Enthalpies and Gibbs free energies of solvation in ethylene glycol at298 K: Influence of the solvophobic effect
- Phase equilibria of binary mixtures (ionic liquid + aromatic hydrocarbon): Effect of the structure of the components on the solubility
- Isobaric vapor-liquid equilibrium for n-undecane + p-, o-, m-xylene at 10 kPa
- Vapor-liquid equilibrium for the binary mixtures of dipropylene glycol with aromatic hydrocarbons: Experimental and regression
- Experimental and theoretical study of interaction between organic compounds and 1- (4-sulfobutyl)-3-methylimidazolium based ionic liquids
- Extraction of benzene, ethylbenzene, and xylenes from n-heptane using binary mixtures of [4empy][Tf2N] and [emim][DCA] ionic liquids
- Study of interaction between organic compounds and mono or dicationic oxygenated ionic liquids using gas chromatography
- Liquid-liquid phase diagrams of poly(ethylene glycol) and aromatic hydrocarbons
- Measurement of infinite dilution partition coefficients of isomeric benzene derivatives in [bmim][Tf2N]-CO2 biphasic system and correlation with the ePC-SAFT equation of state
- Activity coefficients at infinite dilution of organic solvents and water in 1-butyl-3-methylimidazolium dicyanamide. A literature review of hexane/hex-1-ene separation
- Vapour-liquid equilibrium for tripropylene glycol + aromatic hydrocarbons binary systems: Experimental data and regression
- Abraham model linear free energy relationships for describing the partitioning and solubility behavior of nonelectrolyte organic solutes dissolved in pyridine at 298.15 K
- High selective water/butan-1-ol separation on investigation of limiting activity coefficients with [P8,8,8,8][[NTf2] ionic liquid
- Separation of binary mixtures based on limiting activity coefficients data using specific ammonium-based ionic liquid and modelling of thermodynamic functions
- Thermodynamics and activity coefficients at infinite dilution for organic solutes in the ionic liquid 1-butyl-1-methylpyrrolidinium dicyanamide
- New ionic liquid [P4,4,4,4][NTf2] in bio-butanol extraction on investigation of limiting activity coefficients
- Ammonium ionic liquids in extraction of bio-butan-1-ol from water phase using activity coefficients at infinite dilution
- Application of trihexyltetradecylphosphonium dicyanamide ionic liquid for various types of separations problems: Activity coefficients at infinite dilution measurements utilizing GLC method
- (Vapour + liquid) equilibria of (1-butanol + benzene, or toluene, or o-, or m-, or p-xylene) at T = 308.15 K
- Volumetric properties of (cyclohexanone + a xylene) at temperature between (293.15 and 353.15) K
- Densities and volumetric properties of a (xylene + dimethyl sulfoxide) at temperature from (293.15 to 353.15) K
- Excess molar volumes of (acetophenone + benzene, or toluene, or 1,3-xylene, or 1,3,5-trimethylbenzene) at temperatures (298.15 and 328.15) K
- A study of densities and volumetric properties of binary mixtures containing nitrobenzene at T = (293.15 to 353.15) K
- Liquid + liquid equilibria for ternary mixtures of (solvent + aromatic hydrocarbon + alkane)
- Excess volumes and partial molar volumes of binary mixtures of 1,2-propanediol carbonate with xylene in the temperature range of (293.15 to 353.15) K
- Liquid phase behaviour of 1-hexyloxymethyl-3-methyl-imidazolium-based ionic liquids with hydrocarbons: The influence of anion
- (Liquid + liquid) equilibria for ternary mixtures of (methanol or ethanol + toluene or m-xylene + n-dodecane)
- (Vapor + liquid) equilibria of binary mixtures formed by iso-octane with a variety of compounds at 95.8 kPa
- Systems with ionic liquids: Measurement of VLE and c1 data and prediction of their thermodynamic behavior using original UNIFAC, mod. UNIFAC(Do) and COSMO-RS(Ol)
- Excess molar volumes and refractive indices of (methoxybenzene + benzene, or toluene, or o-xylene, or m-xylene, or p-xylene, or mesitylene) binary mixtures between T = (288.15 to 303.15) K
- Densities and volumetric properties of binary mixtures of xylene with N,N-dimethylformamide at different temperatures
- Thermodynamics of mixtures involving some (benzene derivatives + benzonitrile)
- A study of densities and volumetric properties of binary mixtures of N-methyl-2-pyrrolidone with xylene at different temperatures and atmospheric pressure
- (Liquid + liquid) equilibria of three ternary systems: (heptane + benzene + N-formylmorpholine), (heptane + toluene + N-formylmorpholine), (heptane + xylene + N-formylmorpholine) from T = (298.15 to 353.15) K
- (Liquid + liquid) equilibria of ternary and quaternary systems containing n-hexane, toluene, m-xylene, propanol, sulfolane, and water at T = 303.15 K
- Activity coefficients and excess Gibbs free energy of some binary mixtures formed by p-cresol at 95.23 kPa
- Measurement of activity coefficients at infinite dilution in 1-hexadecyl-3-methylimidazolium tetrafluoroborate ionic liquid
- (Liquid + liquid) equilibria of {heptane + xylene + N-formylmorpholine} ternary system
- Excess molar volumes of (octane + benzene, or toluene, or 1,3-xylene, or 1,3,5-trimethylbenzene) at temperatures between (298.15 and 328.15) K
- Measurements of activity coefficients at infinite dilution of aromatic and aliphatic hydrocarbons, alcohols, and water in the new ionic liquid [EMIM][SCN] using GLC
- Activity coefficients at infinite dilution measurements for organic solutes and water in the ionic liquid triethylsulphonium bis(trifluoromethylsulfonyl)imide
- Measurements of activity coefficients at infinite dilution of aliphatic and aromatic hydrocarbons, alcohols, thiophene, tetrahydrofuran, MTBE, and water in ionic liquid [BMIM][SCN] using GLC
- Activity coefficients at infinite dilution measurements for organic solutes and water in the ionic liquid 4-methyl-N-butyl-pyridinium bis(trifluoromethylsulfonyl)-imide
- (Liquid + liquid) equilibria in the binary systems (aliphatic, or aromatic hydrocarbons + 1-ethyl-3-methylimidazolium ethylsulfate, or 1-butyl-3-methylimidazolium methylsulfate ionic liquids)
- Gas liquid chromatography measurements of activity coefficients at infinite dilution of various organic solutes and water in tri-iso-butylmethylphosphonium tosylate ionic liquid
- Thermochemistry of ionic liquid-catalysed reactions. Isomerisation and transalkylation of tert-alkyl-benzenes. Are these systems ideal?
- Activity coefficients at infinite dilution of organic solutes in the ionic liquid 1-ethyl-3-methylimidazolium tetracyanoborate [EMIM][TCB] using gas liquid chromatography
- Measurements of activity coefficients at infinite dilution of organic solutes and water in 1-propyl-1-methylpiperidinium bis{(trifluoromethyl)sulfonyl}imide ionic liquid using g.l.c.
- Activity coefficients at infinite dilution of organic solutes in N-alkylpyridinium bis(trifluoromethylsulfonyl)imide ([CnPY][NTf2], n = 2, 4, 5) using gas liquid chromatography
- Excess molar volumes, excess molar enthalpies, and excess isentropic compressibilities of tetrahydropyran with aromatic hydrocarbons
- Measurements of activity coefficients at infinite dilution of organic compounds and water in isoquinolinium-based ionic liquid [C8iQuin][NTf2] using GLC
- Activity coefficients at infinite dilution measurements for organic solutes and water in the ionic liquid 1-ethyl-3-methylimidazolium tetracyanoborate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(3-hydroxypropyl)pyridinium bis(trifluoromethylsulfonyl)-amide
- Thermodynamics and activity coefficients at infinite dilution measurements for organic solutes and water in the ionic liquid 1-butyl-1-methylpyrrolidinium tetracyanoborate
- Interactions of volatile organic compounds with the ionic liquid 1-ethyl-3-methylimidazolium tetracyanoborate
- Volumetric properties of binary mixtures of tributylamine with benzene derivatives and comparison with ERAS model results at temperatures from (293.15 to 333.15) K
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(2-methoxyethyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)-amide
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-hexyl-3-methylimidazolium tetracyanoborate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)-1-methylpiperidinium bis(trifluoromethylsulfonyl)-amide
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-ethyl-3-methylimidazolium methanesulfonate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)-1-methylpyrrolidinium bis(trifluoromethylsulfonyl)-amide
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(2-methoxyethyl)-4-methylmorpholinium trifluorotris(perfluoroethyl)phosphate
- Effect of temperature and composition on the density, refractive index, and excess quantities of binary mixtures of 2,4,6,8-tetramethyl-2,4,6,8- tetraethenylcyclotetrasiloxane with aromatic hydrocarbons
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)- 1-methylpiperidinium trifluorotris(perfluoroethyl)phosphate
- Interactions of volatile organic compounds with the ionic liquids 1-butyl-1-methylpyrrolidinium tetracyanoborate and 1-butyl-1-methylpyrrolidinium bis(oxalato)borate
- Physicochemical properties and activity coefficients at infinite dilution for organic solutes and water in a novel bicyclic guanidinium superbase-derived protic ionic liquid
- Acoustic and thermodynamic properties of binary mixtures of 1-nonanol with o-xylene, m-xylene, p-xylene, ethylbenzene and mesitylene at T = (298.15 and 308.15) K
- Experimental and theoretical study on infinite dilution activity coefficients of various solutes in piperidinium ionic liquids
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)- 1-methylpyrrolidinium trifluorotris(perfluoroethyl)phosphate
- Measurements of activity coefficients at infinite dilution for organic solutes and water in N-hexylisoquinolinium thiocyanate, [HiQuin][SCN] using GLC
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-hydroxyethyl)- 3-methylimidazolium trifluorotris(perfluoroethyl)phosphate
- Infinite dilution activity coefficients of volatile organic compounds in two ionic liquids composed of the tris(pentafluoroethyl) trifluorophosphate ([FAP]) anion and a functionalized cation
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-butyl-1-methylpyrrolidinium tricyanomethanide
- Phase behaviour of aqueous mixtures of acetic acid with isomers of xylene
- Thermodynamics and activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-butyl-1-methylmorpholinium tricyanomethanide
- The study of activity coefficients at infinite dilution for organic solutes and water in 1-butyl-4-methylpyridinium dicyanamide, [B4MPy][DCA] using GLC
- Activity coefficients at infinite dilution of organic solutes in 1-hexyl-3- methylimidazolium trifluoroacetate and influence of interfacial adsorption using gas liquid chromatography
- Activity coefficients at infinite dilution of organic solutes in the ionic liquid 1-butyl-3-methylimidazolium methyl sulfate
- Thermodynamics and activity coefficients at infinite dilution for organic solutes, water and diols in the ionic liquid choline bis(trifluoromethylsulfonyl)imide
- Thermodynamics of solvation in propylene glycol and methyl cellosolve
- Measurement and correlation of solubility of 4-chloro-2,5-dimethoxynitrobenzene and 4-chloro-2,5- dimethoxyaniline in methanol, ethanol, xylene and toluene
- Solvation parameter model and thermodynamic parameters in a dicationic ionic liquid based on pyrrolidinium
- Experimental and theoretically study of interaction between organic compounds and tricyanomethanide based ionic liquids
- Activity coefficients at infinite dilution of organic solutes in methylphosphonate based ionic liquids using gas-liquid chromatography
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(3-hydroxypropyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)-amide
- Activity coefficients at infinite dilution for organic solutes and water in 1-ethyl-1-methylpyrrolidinium lactate
- Activity coefficients at infinite dilution, physicochemical and thermodynamic properties for organic solutes and water in the ionic liquid ethyl-dimethyl-(2-methoxyethyl)ammonium trifluorotris-(perfluoroethyl)phosphate
- Modified solution calorimetry approach for determination of vaporization and sublimation enthalpies of branched-chain aliphatic and alkyl aromatic compounds at T = 298.15 K
- Activity coefficients at infinite dilution of alkanes, alkenes, alkyl benzenes in dimethylphosphate based ionic liquids using gas liquid chromatography
- Viscosity measurements of ortho-xylene, meta-xylene, para-xylene and ethylbenzene
- A 1-alkylcyanopyridinium-based ionic liquid in the separation processes
- Thermodynamics and selectivity of separation based on activity coefficients at infinite dilution of various solutes in 1-allyl-3-methylimidazolium bis{(trifluoromethyl)sulfonyl}imide ionic liquid
- Separation of aliphatic from aromatic hydrocarbons and sulphur compounds from fuel based on measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid N,N-diethyl-N-methyl-N-(2-methoxy-ethyl)ammonium bis(trifluoromethylsulfonyl)imide
- Thermodynamics and activity coefficients at infinite dilution for organic solutes in the ionic liquid 1-hexyl-2,3-dimethylimidazolium bis(trifluoromethylsulfonyl)imide
- Thermodynamics and limiting activity coefficients measurements for organic solutes and water in the ionic liquid 1-dodecyl-3-methylimidzolium bis(trifluoromethylsulfonyl) imide
- Surface tension and density of mixtures of m-xylene + n-alkane at 293.15 K: Analysis under the extended Langmuir and Shereshefsky models
- Physicochemical study of intermolecular interactions in 1,4-dioxane + aromatic hydrocarbons binary mixtures at different temperatures by using ultrasonic and viscometric methods
- Separation of binary mixtures hexane/hex-1-ene, cyclohexane/cyclohexene and ethylbenzene/styrene based on limiting activity coefficients
- Thermodynamics and activity coefficients at infinite dilution for organic compounds and water in the ionic liquid 1-butyl-3-methylimidazolium perchlorate
- New aspects of relationship between the enthalpies of fusion of aromatic compounds at the melting temperatures and the enthalpies of solution in benzene at 298.15 K. Part I
- Separation of water/butan-1-ol based on activity coefficients at infinite dilution in 1,3-didecyl-2-methylimidazolium dicyanamide ionic liquid
- Separation of binary mixtures hexane/hex-1-ene, cyclohexane/cyclohexene and ethylbenzene/styrene based on gamma infinity data measurements
- Separation of binary mixtures based on gamma infinity data using [OMMIM][NTf2] ionic liquid and modelling of thermodynamic functions
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid trihexyl-tetradecyl-phosphonium tricyanomethanide
- Liquid-liquid equilibria for the ternary system of water + furfural + solvents at 303.15 and 323.15 K under atmospheric pressure
- Thermodynamic study of molecular interaction-selectivity in separation processes based on limiting activity coefficients
- Abraham model correlations for describing the thermodynamic properties of solute transfer into pentyl acetate based on headspace chromatographic and solubility measurements
- Thermodynamics and selectivity of separation based on activity coefficients at infinite dilution of various solutes in ionic liquid [HMMIM][BF4]
- The use of ionic liquids for separation of binary hydrocarbons mixtures based on gamma infinity data measurements
- Thermodynamics and activity coefficients at infinite dilution for organic compounds in the ionic liquid 1-hexyl-3-methylimidazolium chloride
- Separation of binary mixtures based on gamma infinity data using [OMMIM][BF4] ionic liquid and modelling of thermodynamic functions
- Determination of the thermodynamic parameters of ionic liquid 1-propyl-3-methylimidazolium bromide by gas-liquid chromatography
- Thermodynamic characterization of binary mixtures of poly(propylene glycol) 425 with toluene and o-, m- and p-xylenes
- P.rho.T measurements and modelling of (n-decane + m-xylene) mixtures from 293.15 K to 363.15 K at pressures up to 60 MPa
- Separation of (water/butan-1-ol) binary systems based on activity coefficients at infinite dilution with phosphonium ionic liquid
- Molecular interactions in binary mixtures containing o-toluidine
- Excess Molar Enthalpies for Binary and Ternary Mixtures containing Cyclic Ether, 2-Methylaniline and Aromatic Hydrocarbons
- Calorimetric study of solvation of low polar solutes in propylene glycol and methyl cellosolve at 298 K
- Effect of halogen substitution on the enthalpies of solvation and hydrogen bonding of organic solutes in chlorobenzene and 1,2-dichlorobenzene derived using multi-parameter correlations
- Standard molar Gibbs free energy and enthalpy of solvation of lowpolar solutes in formamide derivatives at 298 K
- Thermodynamics of hydrogen bonding and van der Waals interactions of organic solutes in solutions of imidazolium based ionic liquids: "structure-property" relationships
- Liquid-Liquid Equilibrium for Ternary Systems Water + Acetic Acid + m-Xylene and Water + Acetic Acid + o-Xylene at (303.2 to 343.2) K
- Activity Coefficients at Infinite Dilution of Organic Solutes and Water in Tributylethylphosphonium Diethylphosphate Using Gas Liquid Chromatography: Thermodynamic Properties of Mixtures Containing Ionic Liquids
- Isobaric Vapor Liquid Equilibrium for the Binary Systems of Diethyl Carbonate with Xylene Isomers and Ethylbenzene at 101.33 kPa
- Mutual solubility of aromatic hydrocarbons in pyrrolidinium and ammonium-based ionic liquids and its modeling using the Cubic-Plus-Association (CPA) Equation of State
- Measurement and Correlation of the Solubility of e-CL-20 in 12 Organic Solvents at Temperatures Ranging from 278.15 to 318.15 K
- Isobaric Vapor Liquid Equilibrium Data for the Binary Systems of Dimethyl Carbonate with Xylene Isomers at 93.13 kPa
- Viscometric Studies of Molecular Interactions in Binary Liquid Mixtures of Isomeric Xylenes with Methanol
- Determination of Activity Coefficients at Infinite Dilution of Organic Solutes in the Ionic Liquid 1-(2-Hydroxyethyl)-3-methylimidazolium Nonafluoro-1-butanesulfonate Using Gas-Liquid Chromatography
- Refractive Index and Vapor-Liquid Equilibrium Data for the Binary Systems of Anisole with Xylene Isomers at 93.13 kPa
- Thermophysical Study of Binary Systems of tert-Amyl Methyl Ether with n-Hexane and m-Xylene
- Thermodynamic Parameters of a New Synthesized Tricationic Ionic Liquid Stationary Phase by Inverse Gas Chromatography
- Determination of Activity Coefficients at Infinite Dilution of Solutes in N,N'-Di(2-ethylhexyl)isobutyramide Using Inverse Gas-Liquid Chromatography
- Assessment of Pyrrolidinium-Based Ionic Liquid for the Separation of Binary Mixtures Based on Activity Coefficients at Infinite Dilution
- Liquid-liquid equilibria for mixtures of (Furfural + an Aromatic hydrocarbon + an alkane) at T=298.15 K
- Excess Molar Entalpies of Dimethyl Carbonate with o-Xylene, m-Xylene, p-Xylene, Ethylbenzene, or Ethyl Benzoate at 298.15 K
- Solubility of 1-Alkyl-3-methylimidazolium Hexafluorophosphate in Hydrocarbons
- Excess Molar Enthalpies for Dimethyl Carbonate with o-Xylene, m-Xylene, p-Xylene, Ethylbenzene or Ethyl Benzoate at 298.15 K and 10.2 MPa
- Excess Molar Volumes and Surface Tensions of Xylene with 2-propanol or 2-methyl-2-propanol at 298.15 K
- Densities, Excess Molar Volumes, Viscosities, Speeds of Sound, Excess Isentropic Compressibilities, and Relative Permittivities for CmH2m+1(OCH2CH2)nOH (m ) 1 or 2 or 4 andn ) 1) + Benzene, + Toluene, + (o-, m-, and p-) Xylenes, + Ethylbenzene, and + Cyclohexane
- Thermal Conductivity and Thermal Diffusivity of Twenty-Nine Liquids: Alkenes, Cyclic (Alkanes, Alkenes, Alkadienes, Aromatics), and Deuterated Hydrocarbons
- Excess Molar Volumes and Surface Tensions of Xylene with Acetone or 2-Butanone at 298.15 K
- Solubilities of Bis (2,2,6,6-Tetramethyl-4-Piperidinyl) Maleate in Hexane, Heptane, Octane, m-Xylene and Tetrahydrofuran from (253.15 to 310.15) K
- Excess Molar Volumes and Viscosities of Binary Mixtures of Sulfolane with Benzene, Toluene, Ethylbenzene, p-Xylene, o-Xylene, and m-Xylene at 303.15 and 323.15 K and Atmospheric Pressure
- Solubility of Alkylbenzenes and a Model for Predicting the Solubility of Liquid Organics in High-Temperature Water
- Excess Molar Volumes and Surface Tensions of Xylene with Isopropyl Ether or Methyl tert-Butyl Ether at 298.15 K
- Viscosity, Density, and Refractive Index of Some (Ester + Hydrocarbon) Binary Mixtures at 303.15 K and 313.15 K
- Vapor-Liquid Equilibria Data for Binary Systems of Ethylbenzene + Xylene Isomers at 100.65 kPa
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of o-Xylene, m-Xylene, p-Xylene, and Isopropylbenzene with 2-Butanone at 298.15 K
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of o-Xylene, m-Xylene, p-Xylene, and Isopropylbenzene with 4-Methylpentan-2-one at 298.15 K
- Saturated Heat Capacities of Some Linear and Branched Alkylbenzenes between (332 and 401) K
- Densities, Surface Tensions, and Refractive Indexes of Propyl Propanoate + Hexane + m-Xylene at 298.15 K
- Isobaric Vapor-Liquid Equilibria for the Binary Mixtures of Styrene with Ethylbenzene, o-Xylene, m-Xylene, and p-Xylene
- Thermodynamic Properties of Mixtures Containing Ionic Liquids: Activity Coefficients at Infinite Dilution of Organic Compounds in 1-Propyl Boronic Acid-3-Alkylimidazolium Bromide and 1-Propenyl-3-alkylimidazolium Bromide Using Inverse Gas Chromatography
- Solubilities of Benzene, Toluene, and Xylene Isomers in 1-Butyl-3-methylimidazolium Tetrafluoroborate
- Activity Coefficients at Infinite Dilution of Alkanes, Alkenes, and Alkyl Benzenes in 1-Butyl-3-methylimidazolium Tetrafluoroborate Using Gas-Liquid Chromatography
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene with Anisole at (288.15, 293.15, 298.15, and 303.15) K
- Ternary Liquid-Liquid Equilibria for Mixtures of an Aromatic + an Aliphatic Hydrocarbon + 4-Methyl-N-butylpyridinium Tetrafluoroborate
- Ternary and Quaternary Liquid + Liquid Equilibria for Systems of (Water + Toluene + m-Xylene + Phenol)
- Surface Tension of o-Xylene + Acetic Acid and m-Xylene + Acetic Acid Binary Mixtures from 303.15 K to 343.15 K
- Henry's Law Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, 2-Methylpropane, 1-Butene, 2-Methylpropene, trans-2-Butene, cis-2-Butene, 1,3-Butadiene, Dimethyl Ether, Chloroethane, and 1,1-Difluoroethane in Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Styrene
- Densities and Surface Tensions of Propyl Acetate + Xylenes or + Ethylbenzene from (298.15 to 308.15) K
- Activity Coefficients at Infinite Dilution Measurements for Organic Solutes and Water in the Ionic Liquid 1-Butyl-3-methyl-pyridinium Trifluoromethanesulfonate
- Determination of Activity Coefficients at Infinite Dilution of 35 Solutes in the Ionic Liquid, 1-Butyl-3-methylimidazolium Tosylate, Using Gas-Liquid Chromatography
- Vapor-Liquid Equilibria and Density Measurement for Binary Mixtures of Benzene + Nonane, Methylbenzene + 1,2-Dimethylbenzene, 1,3-Dimethylbenzene + 2,3,4,5-Tetrahydrothiophene-1,1-dioxide (Sulfolane), 1,2-Dimethylbenzene + Sulfolane, 1,2-Dimethylbenzene + N-Methylformamide (NMF), 1,3-Dimethylbenzene + NMF, and 1,4-Dimethylbenzene + NMF from (333.15 to 353.15) K at Vacuum Conditions
- Densities, Speeds of Sound, and Isentropic Compressibilities of Binary Mixtures of {Alkan-1-ols + 1,2-Dimethylbenzene, or 1,3-Dimethylbenzene, or 1,4-Dimethylbenzene, or Ethylbenzene} at (293.15, 303.15, and 313.15) K
- Density and Viscosity of the Binary Mixtures of Hexan-1-ol with Isomeric Xylenes at T = (308.15 and 318.15) K and Atmospheric Pressure
- Activity Coefficients at Infinite Dilution of Organic Solutes in 1-Decyl-3-methylimidazolium Tetrafluoroborate Using Gas-Liquid Chromatography
- Measurements of Activity Coefficients at Infinite Dilution for Organic Solutes and Water in the Ionic Liquid 1-Butyl-1-methylpiperydinium Thiocyanate
- Activity Coefficients at Infinite Dilution of Organic Solutes in 1-Butyl-3-methylimidazolium Nitrate Using Gas-Liquid Chromatography
- Solubilities of 1-Hexyl-3-methylimidazole Nitrate and 1-Octyl-3-methylimidazole Nitrate in Selected Solvents
- Activity Coefficients at Infinite Dilution of Organic Compounds in Four New Imidazolium-Based Ionic Liquids
- Activity Coefficients at Infinite Dilution of Alkanes, Alkenes, and Alkyl Benzenes in 1-Ethyl-3-methylimidazolium Diethylphosphate Using Gas Liquid Chromatography
- Partition Coefficients of Organic Compounds in Four New Tetraalkylammonium Bis(trifluoromethylsulfonyl)imide Ionic Liquids Using Inverse Gas Chromatography
- Interactions of Volatile Organic Compounds with the Ionic Liquid 1-Butyl-1-methylpyrrolidinium Dicyanamide
- Excess Molar Volumes of 2,4,6,8-Tetramethylcyclotetrasiloxane with Benzene, Toluene, and Xylene at T = (288.15, 298.15, and 308.15) K
- Isobaric Vapor-Liquid Equilibium for the Binary Systems of Methyl Formate with o-Xylene, m-Xylene, p-Xylene, and Ethylbenzene at 101.33 kPa
- Isobaric vapor liquid equilibium for the binary systerms of 1-butanol with o-xylene, m-xylene, p-xylene, and ethylbenzene at 101.33 kPa
- Evaluation of the Performance of Trigeminal Tricationic Ionic Liquids for Separation Problems
- Densities, Excess Molar Volumes, Viscosity, and Refractive Indices of Binary Mixtures of Ethanoic Acid and Trichloroethylene with Dimethylbenzenes at Different Temperatures
- Activity Coefficients at Infinite Dilution of Alkanes, Alkenes, and Alkyl Benzenes in 1-Butyl-3-methylimidazolium Dibutylphosphate Using Gas Liquid Chromatography
- Isobaric Vapor Liquid Equilibrium of Binary Systems of Hexane or Octane with 1,2-Dimethylbenzene or 1,3-Dimethylbenzene at 101.3 kPa
- Activity Coefficients at Infinite Dilution for Organic Compounds Dissolved in 1-Alkyl-1-methylpyrrolidinium Bis(trifluoromethylsulfonyl)imide Ionic Liquids Having Six-, Eight-, and Ten-Carbon Alkyl Chains
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Vapor Liquid Equilibrium for 2-Methyl-1-butanol + Ethylbenzene + Xylene Isomers at 101.33 kPa
- Activity Coefficients at Infinite Dilution for Organic Solutes Dissolved in Three 1-Alkyl-1-methylpyrrolidinium Bis(trifluoromethylsulfonyl)imide Ionic Liquids Bearing Short Linear Alkyl Side Chains of Three to Five Carbons
- Isobaric Vapor Liquid Equilibrium for Binary Systems of 2,2,4-Trimethylpentane with o-Xylene, m-Xylene, p-Xylene, and Ethylbenzene at 250 kPa
- Infinite Dilution Activity Coefficients of Solutes Dissolved in Two Trihexyl(tetradecyl)phosphonium Ionic Liquids
- Deduction of Physicochemical Properties from Solubilities: 2,4-Dihydroxybenzophenone, Biotin, and Caprolactam as Examples
- Activity Coefficients at Infinite Dilution of Alkanes, Alkenes, and Alkyl Benzenes in 1-Propyl-2,3-dimethylimidazolium Tetrafluoroborate Using Gas-Liquid Chromatography
- Measurement of Activity Coefficient at Infinite Dilution of Hydrocarbons in Sulfolane Using Gas-Liquid Chromatography
- Densities and Viscosities of N-Formylmorpholine (NFM) + p-Xylene, + o-Xylene, + m-Xylene at Different Temperatures and Atmospheric Pressure
- Activity Coefficients at Infinite Dilution of Alkanes, Alkenes, and Alkyl Benzenes in 1-Butyl-3-methylimidazolium Trifluoromethanesulfonate Using Gas-Liquid Chromatography
- Molar Excess Volume of sec- and tert-Butyl Chloride with Aromatic Hydrocarbons at T = 298.15 K
- Solubilities of Vitamin K3 in Benzene, Toluene, Ethylbenzene, o-Xylene, m-Xylene, and p-Xylene between (299.44 and 344.24) K
- Refractive Indices of Binary Mixtures of Tetrahydrofuran with Aromatic Hydrocarbon at Temperatures from (288.15 to 318.15) K
- Vapor Liquid Equilibrium of N-Formylmorpholine with Toluene and Xylene at 101.33 kPa
- Measuring Surface Tension of Liquids at High Temperature and Elevated Pressure
- Influence of the Temperature on the Liquid Liquid Equilibria of Heptane + Toluene + Sulfolane and Heptane + m-Xylene + Sulfolane
- Densities and Viscosities of Binary Mixtures of Vitamin K3 with Benzene, Toluene, Ethylbenzene, o-Xylene, m-Xylene, and p-Xylene from (303.15 to 333.15) K
- Activity Coefficients at Infinite Dilution of Alkanes, Alkenes, and Alkyl Benzenes in 1-Hexyl-3-methylimidazolium Trifluoromethanesulfonate Using Gas-Liquid Chromatography
- Activity Coefficients at Infinite Dilution of Organic Solutes in 1-Ethyl-3-methylimidazolium Tetrafluoroborate Using Gas-Liquid Chromatography
- Measurement of Infinite Dilution Activity Coefficients of Alcohols, Ketones, and Aromatic Hydrocarbons in 4-Methyl-N-butylpyridinium Tetrafluoroborate and 1-Butyl-3-methylimidazolium Hexafluorophosphate by Gas-Liquid Chromatography
- Thermophysical Properties of Isoamyl Acetate or Methyl Benzoate + Hydrocarbon Binary Mixtures, at (303.15 and 313.15) K
- Viscosity and Density of Five Hydrocarbon Liquids at Pressures up to 200 MPa and Temperatures up to 473 K
- Densities, Refractive Indices, and Excess Properties of Binary Mixtures of 1,4-Dioxane with Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene at Temperatures from (288.15 to 318.15) K
- Activity Coefficients at Infinite Dilution of Organic Compounds in 1-Butyl-3-methylimidazolium Tetrafluoroborate Using Inverse Gas Chromatography
- Solubility of Acenaphthene in Different Solvents from (283.00 to 323.00) K
- Densities and Viscosities of Binary Mixtures of Methyl 4-Chlorobutyrate with Aromatic Hydrocarbons at T ) (298.15 to 318.15) K
- Thermodynamic Properties of the Binary Mixture of Hexan-1-ol with m-Xylene at T = (303.15, 313.15, and 323.15) K
- Activity Coefficients at Infinite Dilution of Alkanes, Alkenes, and Alkyl Benzenes in 1-(2-Hydroxyethyl)-3-methylimidazolium Tetrafluoroborate Using Gas-Liquid Chromatography
- Solubilities of Methyldiphenylphosphine Oxide in Selected Solvents
- Partition Coefficients of Organic Compounds in New Imidazolium and Tetralkylammonium Based Ionic Liquids Using Inverse Gas Chromatography
- Activity Coefficients at Infinite Dilution of Alkanes, Alkenes, and Alkyl Benzenes in Glycerol Using Gas-Liquid Chromatography
- Study of Ether-, Alcohol-, or Cyano-Functionalized Ionic Liquids Using Inverse Gas Chromatography
- Activity Coefficients at Infinite Dilution of Organic Solutes in 1-Ethyl-3-methylimidazolium Tris(pentafluoroethyl)trifluorophosphate [EMIM][FAP] Using Gas-Liquid Chromatography
- Activity Coefficients at Infinite Dilution Measurements for Organic Solutes and Water in the Ionic Liquid 1-Hexyl-3-methylimidazolium Thiocyanate
- Density, Speed of Sound, and Refractive Index for Binary Mixtures Containing Cycloalkanes with o-Xylene, m-Xylene, p-Xylene, and Mesitylene at T = (298.15 and 313.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- NCMS SOLV-DB
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
Calculated This icon marks a calculated value or equation: a prediction, not a measurement.
Compiled This icon marks a compiled value or equation: taken from a data compilation such as ChemSep, not from an original measurement report.
These property values are available through the Cheméo API. A free account gives you an access key.