- InChI
- InChI=1S/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3
- InChI Key
- GWHJZXXIDMPWGX-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- Cc1ccc(C)c(C)c1
- Molecular Weight1
- 120.19
- CAS
- 95-36-3
- Other Names
-
- 1,2,4-trimethylbenzene (pseudocumene)
- 1,2,5-Trimethylbenzene
- 1,3,4-Trimethylbenzene
- AS-TRIMETHYBENZENE
- Asymmetrical trimethylbenzene
- Benzene, 1,2,5-trimethyl-
- NSC 65600
- Pseudocumol
- Psi-cumene
- as-Trimethylbenzene
- benzene, 1,2,4-trimethyl-
- pseudocumene
- «psi»-Cumene
- ω : Acentric Factor.
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Δc,grossH : Heat of Combustion, Gross form (kJ/mol).
- Δc,netH : Heat of Combustion, Net Form (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λgas : Gas thermal conductivity (W/m×K).
- λliquid : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- UQi : UNIQUAC Qi Parameter.
- URi : UNIQUAC Ri Parameter.
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
Temperature Dependent Properties
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 100.00 | 0.0009 |
| 293.15 | 1000.00 | 0.0009 |
| 293.15 | 5000.00 | 0.0009 |
| 293.15 | 10000.00 | 0.0010 |
| 293.15 | 20000.00 | 0.0011 |
| 293.15 | 30000.00 | 0.0011 |
| 293.15 | 40000.00 | 0.0012 |
| 293.15 | 50000.00 | 0.0013 |
| 293.15 | 60000.00 | 0.0014 |
| 293.15 | 70000.00 | 0.0016 |
| 293.15 | 80000.00 | 0.0017 |
| 293.15 | 100000.00 | 0.0020 |
| 293.15 | 120000.00 | 0.0023 |
| 293.15 | 140000.00 | 0.0027 |
| 313.15 | 100.00 | 0.0007 |
| 313.15 | 1000.00 | 0.0007 |
| 313.15 | 5000.00 | 0.0007 |
| 313.15 | 10000.00 | 0.0008 |
| 313.15 | 20000.00 | 0.0008 |
| 313.15 | 30000.00 | 0.0009 |
| 313.15 | 40000.00 | 0.0010 |
| 313.15 | 50000.00 | 0.0010 |
| 313.15 | 60000.00 | 0.0011 |
| 313.15 | 70000.00 | 0.0012 |
| 313.15 | 80000.00 | 0.0012 |
| 313.15 | 100000.00 | 0.0014 |
| 313.15 | 120000.00 | 0.0016 |
| 313.15 | 140000.00 | 0.0018 |
| 333.15 | 100.00 | 0.0006 |
| 333.15 | 1000.00 | 0.0006 |
| 333.15 | 5000.00 | 0.0006 |
| 333.15 | 10000.00 | 0.0006 |
| 333.15 | 20000.00 | 0.0006 |
| 333.15 | 30000.00 | 0.0007 |
| 333.15 | 40000.00 | 0.0007 |
| 333.15 | 50000.00 | 0.0008 |
| 333.15 | 60000.00 | 0.0008 |
| 333.15 | 70000.00 | 0.0009 |
| 333.15 | 80000.00 | 0.0010 |
| 333.15 | 100000.00 | 0.0011 |
| 333.15 | 120000.00 | 0.0012 |
| 333.15 | 140000.00 | 0.0013 |
| 353.15 | 100.00 | 0.0005 |
| 353.15 | 1000.00 | 0.0005 |
| 353.15 | 5000.00 | 0.0005 |
| 353.15 | 10000.00 | 0.0005 |
| 353.15 | 20000.00 | 0.0005 |
| 353.15 | 30000.00 | 0.0006 |
| 353.15 | 40000.00 | 0.0006 |
| 353.15 | 50000.00 | 0.0006 |
| 353.15 | 60000.00 | 0.0007 |
| 353.15 | 70000.00 | 0.0007 |
| 353.15 | 80000.00 | 0.0008 |
| 353.15 | 100000.00 | 0.0009 |
| 353.15 | 120000.00 | 0.0010 |
| 353.15 | 140000.00 | 0.0011 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 273.15 | 100.00 | 891.7 |
| 273.15 | 1000.00 | 892.3 |
| 273.15 | 2000.00 | 892.9 |
| 273.15 | 5000.00 | 894.6 |
| 273.15 | 10000.00 | 897.4 |
| 273.15 | 15000.00 | 900.2 |
| 273.15 | 20000.00 | 902.8 |
| 273.15 | 30000.00 | 908.0 |
| 273.15 | 40000.00 | 912.9 |
| 273.15 | 50000.00 | 917.5 |
| 273.15 | 60000.00 | 921.9 |
| 273.15 | 70000.00 | 926.2 |
| 273.15 | 80000.00 | 930.3 |
| 273.15 | 90000.00 | 934.2 |
| 273.15 | 100000.00 | 938.0 |
| 273.15 | 110000.00 | 941.7 |
| 273.15 | 120000.00 | 945.2 |
| 273.15 | 130000.00 | 948.6 |
| 273.15 | 140000.00 | 952.0 |
| 283.15 | 100.00 | 883.3 |
| 283.15 | 1000.00 | 883.9 |
| 283.15 | 2000.00 | 884.5 |
| 283.15 | 5000.00 | 886.3 |
| 283.15 | 10000.00 | 889.3 |
| 283.15 | 15000.00 | 892.2 |
| 283.15 | 20000.00 | 895.0 |
| 283.15 | 30000.00 | 900.3 |
| 283.15 | 40000.00 | 905.4 |
| 283.15 | 50000.00 | 910.2 |
| 283.15 | 60000.00 | 914.8 |
| 283.15 | 70000.00 | 919.3 |
| 283.15 | 80000.00 | 923.5 |
| 283.15 | 90000.00 | 927.5 |
| 283.15 | 100000.00 | 931.4 |
| 283.15 | 110000.00 | 935.2 |
| 283.15 | 120000.00 | 938.9 |
| 283.15 | 130000.00 | 942.4 |
| 283.15 | 140000.00 | 945.8 |
| 293.15 | 100.00 | 875.1 |
| 293.15 | 1000.00 | 875.7 |
| 293.15 | 2000.00 | 876.3 |
| 293.15 | 5000.00 | 878.2 |
| 293.15 | 10000.00 | 881.4 |
| 293.15 | 15000.00 | 884.4 |
| 293.15 | 20000.00 | 887.3 |
| 293.15 | 30000.00 | 892.9 |
| 293.15 | 40000.00 | 898.2 |
| 293.15 | 50000.00 | 903.2 |
| 293.15 | 60000.00 | 908.0 |
| 293.15 | 70000.00 | 912.6 |
| 293.15 | 80000.00 | 916.9 |
| 293.15 | 90000.00 | 921.1 |
| 293.15 | 100000.00 | 925.1 |
| 293.15 | 110000.00 | 929.0 |
| 293.15 | 120000.00 | 932.8 |
| 293.15 | 130000.00 | 936.4 |
| 293.15 | 140000.00 | 939.9 |
| 303.15 | 100.00 | 867.0 |
| 303.15 | 1000.00 | 867.6 |
| 303.15 | 2000.00 | 868.3 |
| 303.15 | 5000.00 | 870.3 |
| 303.15 | 10000.00 | 873.6 |
| 303.15 | 15000.00 | 876.8 |
| 303.15 | 20000.00 | 879.8 |
| 303.15 | 30000.00 | 885.7 |
| 303.15 | 40000.00 | 891.2 |
| 303.15 | 50000.00 | 896.4 |
| 303.15 | 60000.00 | 901.4 |
| 303.15 | 70000.00 | 906.1 |
| 303.15 | 80000.00 | 910.6 |
| 303.15 | 90000.00 | 914.9 |
| 303.15 | 100000.00 | 919.1 |
| 303.15 | 110000.00 | 923.1 |
| 303.15 | 120000.00 | 927.0 |
| 303.15 | 130000.00 | 930.7 |
| 303.15 | 140000.00 | 934.3 |
| 313.15 | 100.00 | 859.0 |
| 313.15 | 1000.00 | 859.7 |
| 313.15 | 2000.00 | 860.4 |
| 313.15 | 5000.00 | 862.6 |
| 313.15 | 10000.00 | 866.0 |
| 313.15 | 15000.00 | 869.3 |
| 313.15 | 20000.00 | 872.6 |
| 313.15 | 30000.00 | 878.7 |
| 313.15 | 40000.00 | 884.5 |
| 313.15 | 50000.00 | 889.9 |
| 313.15 | 60000.00 | 895.0 |
| 313.15 | 70000.00 | 899.9 |
| 313.15 | 80000.00 | 904.6 |
| 313.15 | 90000.00 | 909.0 |
| 313.15 | 100000.00 | 913.3 |
| 313.15 | 110000.00 | 917.4 |
| 313.15 | 120000.00 | 921.4 |
| 313.15 | 130000.00 | 925.2 |
| 313.15 | 140000.00 | 928.9 |
| 323.15 | 100.00 | 851.3 |
| 323.15 | 1000.00 | 852.0 |
| 323.15 | 2000.00 | 852.7 |
| 323.15 | 5000.00 | 855.0 |
| 323.15 | 10000.00 | 858.6 |
| 323.15 | 15000.00 | 862.1 |
| 323.15 | 20000.00 | 865.5 |
| 323.15 | 30000.00 | 871.9 |
| 323.15 | 40000.00 | 877.9 |
| 323.15 | 50000.00 | 883.5 |
| 323.15 | 60000.00 | 888.9 |
| 323.15 | 70000.00 | 894.0 |
| 323.15 | 80000.00 | 898.8 |
| 323.15 | 90000.00 | 903.4 |
| 323.15 | 100000.00 | 907.8 |
| 323.15 | 110000.00 | 912.0 |
| 323.15 | 120000.00 | 916.1 |
| 323.15 | 130000.00 | 920.0 |
| 323.15 | 140000.00 | 923.8 |
| 333.15 | 100.00 | 843.6 |
| 333.15 | 1000.00 | 844.4 |
| 333.15 | 2000.00 | 845.2 |
| 333.15 | 5000.00 | 847.6 |
| 333.15 | 10000.00 | 851.4 |
| 333.15 | 15000.00 | 855.1 |
| 333.15 | 20000.00 | 858.6 |
| 333.15 | 30000.00 | 865.3 |
| 333.15 | 40000.00 | 871.6 |
| 333.15 | 50000.00 | 877.4 |
| 333.15 | 60000.00 | 883.0 |
| 333.15 | 70000.00 | 888.2 |
| 333.15 | 80000.00 | 893.2 |
| 333.15 | 90000.00 | 898.0 |
| 333.15 | 100000.00 | 902.5 |
| 333.15 | 110000.00 | 906.9 |
| 333.15 | 120000.00 | 911.1 |
| 333.15 | 130000.00 | 915.1 |
| 333.15 | 140000.00 | 919.0 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [111.35; 418.34] | J/mol×K | [200.00; 1500.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 8.62200e+01 | |||
| Coefficient B | -5.88220e+02 | |||
| Coefficient C | 6.14124e+00 | |||
| Coefficient D | 1.32170e-04 | |||
| Coefficient E | -6.30420e-08 | |||
| Temperature range, min. | 200.00 | |||
| Temperature range, max. | 1500.00 | |||
| Cp,gas | 111.35 | J/mol×K | 200.00 | Calculated Property |
| Cp,gas | 173.71 | J/mol×K | 344.44 | Calculated Property |
| Cp,gas | 232.81 | J/mol×K | 488.89 | Calculated Property |
| Cp,gas | 280.81 | J/mol×K | 633.33 | Calculated Property |
| Cp,gas | 318.89 | J/mol×K | 777.78 | Calculated Property |
| Cp,gas | 349.10 | J/mol×K | 922.22 | Calculated Property |
| Cp,gas | 373.09 | J/mol×K | 1066.67 | Calculated Property |
| Cp,gas | 392.09 | J/mol×K | 1211.11 | Calculated Property |
| Cp,gas | 406.96 | J/mol×K | 1355.56 | Calculated Property |
| Cp,gas | 418.34 | J/mol×K | 1500.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | [193.57; 242.16] | J/mol×K | [229.33; 377.59] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,liquid in J/mol×K, T in K | |||
| Coefficient A | 1.59260e+02 | |||
| Coefficient B | 1.00480e+02 | |||
| Coefficient C | 2.68245e-01 | |||
| Coefficient D | 1.55110e-02 | |||
| Coefficient E | -1.38420e-05 | |||
| Temperature range, min. | 229.33 | |||
| Temperature range, max. | 377.59 | |||
| Cp,liquid | 193.57 | J/mol×K | 229.33 | Calculated Property |
| Cp,liquid | 197.86 | J/mol×K | 245.80 | Calculated Property |
| Cp,liquid | 202.53 | J/mol×K | 262.28 | Calculated Property |
| Cp,liquid | 207.53 | J/mol×K | 278.75 | Calculated Property |
| Cp,liquid | 212.85 | J/mol×K | 295.22 | Calculated Property |
| Cp,liquid | 218.44 | J/mol×K | 311.70 | Calculated Property |
| Cp,liquid | 224.23 | J/mol×K | 328.17 | Calculated Property |
| Cp,liquid | 230.17 | J/mol×K | 344.64 | Calculated Property |
| Cp,liquid | 236.18 | J/mol×K | 361.12 | Calculated Property |
| Cp,liquid | 242.16 | J/mol×K | 377.59 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | [0.0034713; 0.0000866] | Pa×s | [229.33; 550.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is η in Pa×s, T in K | |||
| Coefficient A | -2.26550e+01 | |||
| Coefficient B | 1.67690e+03 | |||
| Coefficient C | 1.82040e+00 | |||
| Coefficient D | -4.07990e-06 | |||
| Coefficient E | 2.00000e+00 | |||
| Temperature range, min. | 229.33 | |||
| Temperature range, max. | 550.00 | |||
| η | 0.0034713 | Pa×s | 229.33 | Calculated Property |
| η | 0.0015719 | Pa×s | 264.96 | Calculated Property |
| η | 0.0008603 | Pa×s | 300.59 | Calculated Property |
| η | 0.0005324 | Pa×s | 336.22 | Calculated Property |
| η | 0.0003578 | Pa×s | 371.85 | Calculated Property |
| η | 0.0002544 | Pa×s | 407.48 | Calculated Property |
| η | 0.0001881 | Pa×s | 443.11 | Calculated Property |
| η | 0.0001429 | Pa×s | 478.74 | Calculated Property |
| η | 0.0001106 | Pa×s | 514.37 | Calculated Property |
| η | 0.0000866 | Pa×s | 550.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [51.65; 16.70] | kJ/mol | [229.33; 627.01] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is ΔvapH in kJ/mol, T in K | |||
| Coefficient A | 6.62120e+01 | |||
| Coefficient B | 6.12793e-01 | |||
| Coefficient C | 1.57992e-01 | |||
| Coefficient D | -1.02446e+00 | |||
| Coefficient E | 6.63520e-01 | |||
| Critical temperature, Tc (K) | 6.49100e+02 | |||
| Temperature range, min. | 229.33 | |||
| Temperature range, max. | 627.01 | |||
| ΔvapH | 51.65 | kJ/mol | 229.33 | Calculated Property |
| ΔvapH | 49.08 | kJ/mol | 273.52 | Calculated Property |
| ΔvapH | 46.60 | kJ/mol | 317.70 | Calculated Property |
| ΔvapH | 44.14 | kJ/mol | 361.89 | Calculated Property |
| ΔvapH | 41.60 | kJ/mol | 406.08 | Calculated Property |
| ΔvapH | 38.84 | kJ/mol | 450.26 | Calculated Property |
| ΔvapH | 35.63 | kJ/mol | 494.45 | Calculated Property |
| ΔvapH | 31.61 | kJ/mol | 538.64 | Calculated Property |
| ΔvapH | 26.04 | kJ/mol | 582.82 | Calculated Property |
| ΔvapH | 16.70 | kJ/mol | 627.01 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [323.10; 471.79] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.47784e+01 | |||
| Coefficient B | -4.06027e+03 | |||
| Coefficient C | -4.29020e+01 | |||
| Temperature range, min. | 323.10 | |||
| Temperature range, max. | 471.79 | |||
| Pvap | 1.33 | kPa | 323.10 | Calculated Property |
| Pvap | 2.99 | kPa | 339.62 | Calculated Property |
| Pvap | 6.15 | kPa | 356.14 | Calculated Property |
| Pvap | 11.77 | kPa | 372.66 | Calculated Property |
| Pvap | 21.18 | kPa | 389.18 | Calculated Property |
| Pvap | 36.13 | kPa | 405.71 | Calculated Property |
| Pvap | 58.82 | kPa | 422.23 | Calculated Property |
| Pvap | 91.95 | kPa | 438.75 | Calculated Property |
| Pvap | 138.68 | kPa | 455.27 | Calculated Property |
| Pvap | 202.65 | kPa | 471.79 | Calculated Property |
| Pvap | [9.05e-04; 3067.13] | kPa | [229.33; 649.17] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is Pvap in kPa, T in K | |||
| Coefficient A | 5.33227e+01 | |||
| Coefficient B | -7.11321e+03 | |||
| Coefficient C | -5.40897e+00 | |||
| Coefficient D | 1.63745e-06 | |||
| Coefficient E | 2.00000e+00 | |||
| Temperature range, min. | 229.33 | |||
| Temperature range, max. | 649.17 | |||
| Pvap | 9.05e-04 | kPa | 229.33 | Calculated Property |
| Pvap | 0.07 | kPa | 275.98 | Calculated Property |
| Pvap | 1.22 | kPa | 322.63 | Calculated Property |
| Pvap | 10.05 | kPa | 369.28 | Calculated Property |
| Pvap | 48.67 | kPa | 415.93 | Calculated Property |
| Pvap | 164.32 | kPa | 462.57 | Calculated Property |
| Pvap | 430.54 | kPa | 509.22 | Calculated Property |
| Pvap | 938.75 | kPa | 555.87 | Calculated Property |
| Pvap | 1786.28 | kPa | 602.52 | Calculated Property |
| Pvap | 3067.13 | kPa | 649.17 | Calculated Property |
| Pvap | [8.99e-04; 3155.22] | kPa | [229.38; 649.13] |
KDB Vapor Pressure Data
|
| Equation | ln(Y) = A + B/T + C·ln(T) + D·T² + E/T² Y is Pvap in kPa, T in K | |||
| Coefficient A | 6.15931e+01 | |||
| Coefficient B | -7.42775e+03 | |||
| Coefficient C | -6.69353e+00 | |||
| Coefficient D | 2.96938e-06 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 229.38 | |||
| Temperature range, max. | 649.13 | |||
| Pvap | 8.99e-04 | kPa | 229.38 | Calculated Property |
| Pvap | 0.07 | kPa | 276.02 | Calculated Property |
| Pvap | 1.24 | kPa | 322.66 | Calculated Property |
| Pvap | 10.13 | kPa | 369.30 | Calculated Property |
| Pvap | 48.58 | kPa | 415.94 | Calculated Property |
| Pvap | 163.06 | kPa | 462.57 | Calculated Property |
| Pvap | 426.85 | kPa | 509.21 | Calculated Property |
| Pvap | 935.65 | kPa | 555.85 | Calculated Property |
| Pvap | 1802.22 | kPa | 602.49 | Calculated Property |
| Pvap | 3155.22 | kPa | 649.13 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ρl | [924.36; 475.11] | kg/m3 | [229.33; 627.01] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A / B^(1 + (1 − T/C)^D) Y is ρl in kg/m3, T in K | |||
| Coefficient A | 7.42568e+01 | |||
| Coefficient B | 2.62430e-01 | |||
| Coefficient C | 6.49100e+02 | |||
| Coefficient D | 2.80530e-01 | |||
| Temperature range, min. | 229.33 | |||
| Temperature range, max. | 627.01 | |||
| ρl | 924.36 | kg/m3 | 229.33 | Calculated Property |
| ρl | 891.34 | kg/m3 | 273.52 | Calculated Property |
| ρl | 856.75 | kg/m3 | 317.70 | Calculated Property |
| ρl | 820.20 | kg/m3 | 361.89 | Calculated Property |
| ρl | 781.19 | kg/m3 | 406.08 | Calculated Property |
| ρl | 738.95 | kg/m3 | 450.26 | Calculated Property |
| ρl | 692.21 | kg/m3 | 494.45 | Calculated Property |
| ρl | 638.62 | kg/m3 | 538.64 | Calculated Property |
| ρl | 572.85 | kg/m3 | 582.82 | Calculated Property |
| ρl | 475.11 | kg/m3 | 627.01 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| γ | [0.04; 0.01] | N/m | [229.25; 442.15] |
Jasper (1972), surface tension of pure liquid compounds Compiled value
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is γ in N/m, T in K | |||
| Coefficient A | 5.97579e-02 | |||
| Coefficient B | -1.02500e-04 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 229.25 | |||
| Temperature range, max. | 442.15 | |||
| γ | 0.04 | N/m | 229.25 | Calculated Property |
| γ | 0.03 | N/m | 252.91 | Calculated Property |
| γ | 0.03 | N/m | 276.56 | Calculated Property |
| γ | 0.03 | N/m | 300.22 | Calculated Property |
| γ | 0.03 | N/m | 323.87 | Calculated Property |
| γ | 0.02 | N/m | 347.53 | Calculated Property |
| γ | 0.02 | N/m | 371.18 | Calculated Property |
| γ | 0.02 | N/m | 394.84 | Calculated Property |
| γ | 0.02 | N/m | 418.49 | Calculated Property |
| γ | 0.01 | N/m | 442.15 | Calculated Property |
| γ | [0.04; 8.31e-04] | N/m | [229.33; 627.01] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is γ in N/m, T in K | |||
| Coefficient A | -1.15140e-02 | |||
| Coefficient B | 3.87820e+01 | |||
| Coefficient C | -3.05160e+00 | |||
| Coefficient D | 2.41830e-04 | |||
| Coefficient E | -3.95880e-06 | |||
| Temperature range, min. | 229.33 | |||
| Temperature range, max. | 627.01 | |||
| γ | 0.04 | N/m | 229.33 | Calculated Property |
| γ | 0.03 | N/m | 273.52 | Calculated Property |
| γ | 0.03 | N/m | 317.70 | Calculated Property |
| γ | 0.02 | N/m | 361.89 | Calculated Property |
| γ | 0.02 | N/m | 406.08 | Calculated Property |
| γ | 0.01 | N/m | 450.26 | Calculated Property |
| γ | 0.01 | N/m | 494.45 | Calculated Property |
| γ | 0.01 | N/m | 538.64 | Calculated Property |
| γ | 0.00 | N/m | 582.82 | Calculated Property |
| γ | 8.31e-04 | N/m | 627.01 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λgas | [0.01; 0.08] | W/m×K | [229.33; 1000.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A·T^B / (1 + C/T + D/T²) Y is λgas in W/m×K, T in K | |||
| Coefficient A | 7.17340e-05 | |||
| Coefficient B | 1.07150e+00 | |||
| Coefficient C | 5.03120e+02 | |||
| Coefficient D | 4.83550e+04 | |||
| Temperature range, min. | 229.33 | |||
| Temperature range, max. | 1000.00 | |||
| λgas | 0.01 | W/m×K | 229.33 | Calculated Property |
| λgas | 0.01 | W/m×K | 314.96 | Calculated Property |
| λgas | 0.02 | W/m×K | 400.59 | Calculated Property |
| λgas | 0.02 | W/m×K | 486.22 | Calculated Property |
| λgas | 0.03 | W/m×K | 571.85 | Calculated Property |
| λgas | 0.04 | W/m×K | 657.48 | Calculated Property |
| λgas | 0.05 | W/m×K | 743.11 | Calculated Property |
| λgas | 0.06 | W/m×K | 828.74 | Calculated Property |
| λgas | 0.07 | W/m×K | 914.37 | Calculated Property |
| λgas | 0.08 | W/m×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λliquid | [0.14; 0.10] | W/m×K | [223.15; 442.53] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is λliquid in W/m×K, T in K | |||
| Coefficient A | -9.73110e-02 | |||
| Coefficient B | -7.93290e+00 | |||
| Coefficient C | -1.19330e+00 | |||
| Coefficient D | -7.57280e-04 | |||
| Coefficient E | -4.22910e-07 | |||
| Temperature range, min. | 223.15 | |||
| Temperature range, max. | 442.53 | |||
| λliquid | 0.14 | W/m×K | 223.15 | Calculated Property |
| λliquid | 0.14 | W/m×K | 247.53 | Calculated Property |
| λliquid | 0.14 | W/m×K | 271.90 | Calculated Property |
| λliquid | 0.13 | W/m×K | 296.28 | Calculated Property |
| λliquid | 0.12 | W/m×K | 320.65 | Calculated Property |
| λliquid | 0.12 | W/m×K | 345.03 | Calculated Property |
| λliquid | 0.11 | W/m×K | 369.40 | Calculated Property |
| λliquid | 0.11 | W/m×K | 393.78 | Calculated Property |
| λliquid | 0.10 | W/m×K | 418.15 | Calculated Property |
| λliquid | 0.10 | W/m×K | 442.53 | Calculated Property |
Similar Compounds
Find more compounds similar to 1,2,4-Trimethylbenzene.
Mixtures
- Acetic acid + 1,2,4-Trimethylbenzene + Water
- Acetic acid, propyl ester + 1,2,4-Trimethylbenzene
- Acetic acid, butyl ester + 1,2,4-Trimethylbenzene
- Benzonitrile + 1,2,4-Trimethylbenzene
- Thiophene, 3-methyl- + 1,2,4-Trimethylbenzene
- 1-Butanol + 1,2,4-Trimethylbenzene
- Benzene, 1-ethyl-3-methyl- + 1,2,4-Trimethylbenzene
- Benzene, 1-ethyl-4-methyl- + 1,2,4-Trimethylbenzene
- 1-Pentanol + 1,2,4-Trimethylbenzene
- 2-Pentanol + 1,2,4-Trimethylbenzene
- 1,2,4-Trimethylbenzene + N-Formylmorpholine
- Ethanol, 2-methoxy- + 1,2,4-Trimethylbenzene
- Ethane, 1,2-dimethoxy- + 1,2,4-Trimethylbenzene
- 1,2,4-Trimethylbenzene + Bis(2-ethylhexyl) phthalate
- 1,2,4-Trimethylbenzene + Water
- 1-Propanol, 2-methyl- + 1,2,4-Trimethylbenzene
- 2-Propanol, 2-methyl- + 1,2,4-Trimethylbenzene
- Benzene, 1-ethyl-2-methyl- + 1,2,4-Trimethylbenzene
- 1,2,4-Trimethylbenzene + Ethane, 1,1-diethoxy-
- Propane, 2,2-dimethoxy- + 1,2,4-Trimethylbenzene
Find more mixtures with 1,2,4-Trimethylbenzene.
Sources
- KDB Vapor Pressure Data
- Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) ChEDL chemicals 1.5.2, from Bradley, J.-C.; Williams, A.; Lang, A. Jean-Claude Bradley Open Melting Point Dataset. Figshare, 2014 (CC0).
- IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 3 ChEDL chemicals 1.5.2, from Tsonopoulos, C.; Ambrose, D. Vapor-Liquid Critical Properties of Elements and Compounds. 3. Aromatic Hydrocarbons. J. Chem. Eng. Data 1995, 40, 547-558.
- Jasper (1972), surface tension of pure liquid compounds ChEDL chemicals 1.5.2, from Jasper, J. J. The Surface Tension of Pure Liquid Compounds. J. Phys. Chem. Ref. Data 1972, 1, 841-1010 (as transcribed in Lange's Handbook).
- Passut and Danner (1973), critical constants and acentric factors ChEDL chemicals 1.5.2, from Passut, C. A.; Danner, R. P. Acentric Factor. A Valuable Correlating Parameter for the Properties of Hydrocarbons. Ind. Eng. Chem. Process Des. Dev. 1973, 12, 365-368.
- PSRK revision IV (2005), critical constants and acentric factors of 1000 components ChEDL chemicals 1.5.2, from Horstmann, S.; Jabłoniec, A.; Krafczyk, J.; Fischer, K.; Gmehling, J. PSRK Group Contribution Equation of State: Comprehensive Revision and Extension IV, Including Critical Constants and α-Function Parameters for 1000 Components. Fluid Phase Equilib. 2005, 227, 157-164.
- Cheméo Relay (1.0)
- ChemSep v8.3 pure component data Converted from ChemSep v8.3 pure component data, H. Kooijman and R. Taylor (2021, 2022), Artistic License 2.0; see how the values differ.
- Crippen Method
- Phase equilibria on five binary systems containing 1-butanethiol and 3-methylthiophene in hydrocarbons
- Liquid-liquid equilibria for ternary systems water + acetic acid + 1,2,4-trimethylbenzene and water + acetic acid + 1,3,5- trimethylbenzene at (303.2 - 343.2) K
- Vapor-liquid equilibria and excess enthalpies of the binary systems 1- pentanol or 2-pentanol and 1-hexene or 1,2,4-trimethylbenzene for the development of biofuels
- Densities, surface tensions, and derived surface thermodynamics properties of (trimethylbenzene + propyl acetate, or butyl acetate) from T = 298.15 K to 313.15 K
- Thermodynamics of mixtures involving some (benzene derivatives + benzonitrile)
- Isobaric (vapour + liquid) equilibria for N-formylmorpholine with ethylbenzene, n-butylbenzene, iso-propylbenzene and 1,2,4-trimethylbenzene at 101.33 kPa
- Isobaric VLE data for 1-methyl-3-ethylbenzene or 1-methyl-4-ethylbenzene + 1,2,4-trimethylbenzene at 20 kPa
- Modified solution calorimetry approach for determination of vaporization and sublimation enthalpies of branched-chain aliphatic and alkyl aromatic compounds at T = 298.15 K
- Contributing to accurate high pressure viscosity measurements: Vibrating wire viscometer and falling body viscometer techniques
- Viscosities of binary mixtures containing 1-butanol + 2,2,4-trimethylpentane or + 1,2,4-trimethylbenzene at high pressures for the thermophysical characterization of biofuels
- Thermophysical properties of 1,2,4-trimethylbenzene in admixtures with 1-butanol or 2-butanol at high pressures
- Viscosities of binary mixtures containing 2-butanol + hydrocarbons (2,2,4-trimethylpentane or 1,2,4-trimethylbenzene) at high pressures for the implementation of second generation biofuels
- Thermal Conductivity and Thermal Diffusivity of Twenty-Nine Liquids: Alkenes, Cyclic (Alkanes, Alkenes, Alkadienes, Aromatics), and Deuterated Hydrocarbons
- Excess Molar volumes and Surface Tensions of Trimethylbenzene with Tetrahydrofuran Tetrachloromethane and Dimethylsulfoxide at 298.15 K
- Excess Molar Volumes and Surface Tensions of 1,2,4-Trimethylbenzene and 1,3,5-Trimethylbenzene with 1-Butanol, 2-Methyl-1-propanol, 2-Butanol, and 2-Methyl-2-propanol at 298.15 K
- Determination of Partitioning Coefficients of Numerous Organic Solutes between a Long-Chain Aliphatic Alcohol and the Gas Phase as a Function of Temperature
- Excess Molar Volumes and Surface Tensions of Trimethylbenzene + Ethylene Glycol Ester at 298.15 K and 313.15 K
- Solubilities at High Dilution of Toluene, Ethylbenzene, 1,2,4-Trimethylbenzene, and Hexane in Di-2-ethylhexyl, Diisoheptyl, and Diisononyl Phthalates
- Densities and Surface Tensions of Trimethylbenzene + Dimethyl Carbonate or + Diethyl Carbonate at 298.15 K and 313.15 K
- Excess Molar Volumes and Surface Tensions of 1,2,4- Trimethylbenzene and 1,3,5- Trimethylbenzene with 1,1-Diethoxyethane and 2,2-Dimethoxypropane at (298.15, 308.15, and 313.15) K
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Isobaric Vapor Liquid Equilibrium Data for the System of 1-Methyl-2-Ethylbenzene + 1,2,4-Trimethylbenzene at 10 kPa
- Excess Molar Volumes and Surface Tensions of 1,2,4-Trimethylbenzene and 1,3,5-Trimethylbenzene with Isopropyl Acetate and Isobutyl Acetate at (298.15, 308.15, and 313.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
- Zabransky, M., Ruzicka, V., Majer, V. and Domalski, E. (1997), Heat Capacity of Liquids: Critical Review and Recommended Values - Monograph No. 6, J. Phys. & Chem. Ref. Data (JPCRD), National Institute of Standards and Technology, Gaithersburg, MD
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
Calculated This icon marks a calculated value or equation: a prediction, not a measurement.
Compiled This icon marks a compiled value or equation: taken from a data compilation such as ChemSep, not from an original measurement report.
These property values are available through the Cheméo API. A free account gives you an access key.