- Name
- Benzene, 1,3-dimethyl-
- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 108-38-3
- Name
- Anisole
- InChI
- InChI=1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- RDOXTESZEPMUJZ-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- COc1ccccc1
- Mol. Weight (g/mol)
- 108.14
- CAS
- 100-66-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (2)
Mole fraction of Benzene, 1,3-dimethyl- (1) [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of Benzene, 1,3-dimethyl- (1) - Liquid | Mole fraction of Benzene, 1,3-dimethyl- (1) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0490 | 0.0780 |
| 0.1180 | 0.1740 |
| 0.1900 | 0.2680 |
| 0.2980 | 0.3940 |
| 0.3920 | 0.4930 |
| 0.5270 | 0.6200 |
| 0.5990 | 0.6840 |
| 0.7000 | 0.7680 |
| 0.7960 | 0.8440 |
| 0.9090 | 0.9320 |
| 0.9530 | 0.9650 |
| 1.0000 | 1.0000 |
Mole fraction of Benzene, 1,3-dimethyl- (1) [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of Benzene, 1,3-dimethyl- (1) - Liquid | Mole fraction of Benzene, 1,3-dimethyl- (1) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0490 | 0.0780 |
| 0.1180 | 0.1740 |
| 0.1900 | 0.2680 |
| 0.2980 | 0.3940 |
| 0.3920 | 0.4930 |
| 0.5270 | 0.6200 |
| 0.5990 | 0.6840 |
| 0.7000 | 0.7680 |
| 0.7960 | 0.8440 |
| 0.9090 | 0.9320 |
| 0.9530 | 0.9650 |
| 1.0000 | 1.0000 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0000 | 0.0007 |
| 288.15 | 0.1144 | 0.0007 |
| 288.15 | 0.2566 | 0.0007 |
| 288.15 | 0.3821 | 0.0008 |
| 288.15 | 0.5034 | 0.0009 |
| 288.15 | 0.6546 | 0.0009 |
| 288.15 | 0.7535 | 0.0010 |
| 288.15 | 0.8432 | 0.0010 |
| 288.15 | 0.9133 | 0.0011 |
| 288.15 | 0.9576 | 0.0011 |
| 288.15 | 1.0000 | 0.0012 |
| 293.15 | 0.0000 | 0.0006 |
| 293.15 | 0.1144 | 0.0006 |
| 293.15 | 0.2566 | 0.0007 |
| 293.15 | 0.3821 | 0.0007 |
| 293.15 | 0.5034 | 0.0008 |
| 293.15 | 0.6546 | 0.0009 |
| 293.15 | 0.7535 | 0.0009 |
| 293.15 | 0.8432 | 0.0010 |
| 293.15 | 0.9133 | 0.0010 |
| 293.15 | 0.9576 | 0.0011 |
| 293.15 | 1.0000 | 0.0011 |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.1144 | 0.0006 |
| 298.15 | 0.2566 | 0.0006 |
| 298.15 | 0.3821 | 0.0007 |
| 298.15 | 0.5034 | 0.0007 |
| 298.15 | 0.6546 | 0.0008 |
| 298.15 | 0.7535 | 0.0009 |
| 298.15 | 0.8432 | 0.0009 |
| 298.15 | 0.9133 | 0.0009 |
| 298.15 | 0.9576 | 0.0010 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.1144 | 0.0006 |
| 303.15 | 0.2566 | 0.0006 |
| 303.15 | 0.3821 | 0.0006 |
| 303.15 | 0.5034 | 0.0007 |
| 303.15 | 0.6546 | 0.0007 |
| 303.15 | 0.7535 | 0.0008 |
| 303.15 | 0.8432 | 0.0008 |
| 303.15 | 0.9133 | 0.0009 |
| 303.15 | 0.9576 | 0.0009 |
| 303.15 | 1.0000 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0000 | 0.0007 |
| 288.15 | 0.1144 | 0.0007 |
| 288.15 | 0.2566 | 0.0007 |
| 288.15 | 0.3821 | 0.0008 |
| 288.15 | 0.5034 | 0.0009 |
| 288.15 | 0.6546 | 0.0009 |
| 288.15 | 0.7535 | 0.0010 |
| 288.15 | 0.8432 | 0.0010 |
| 288.15 | 0.9133 | 0.0011 |
| 288.15 | 0.9576 | 0.0011 |
| 288.15 | 1.0000 | 0.0012 |
| 293.15 | 0.0000 | 0.0006 |
| 293.15 | 0.1144 | 0.0006 |
| 293.15 | 0.2566 | 0.0007 |
| 293.15 | 0.3821 | 0.0007 |
| 293.15 | 0.5034 | 0.0008 |
| 293.15 | 0.6546 | 0.0009 |
| 293.15 | 0.7535 | 0.0009 |
| 293.15 | 0.8432 | 0.0010 |
| 293.15 | 0.9133 | 0.0010 |
| 293.15 | 0.9576 | 0.0011 |
| 293.15 | 1.0000 | 0.0011 |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.1144 | 0.0006 |
| 298.15 | 0.2566 | 0.0006 |
| 298.15 | 0.3821 | 0.0007 |
| 298.15 | 0.5034 | 0.0007 |
| 298.15 | 0.6546 | 0.0008 |
| 298.15 | 0.7535 | 0.0009 |
| 298.15 | 0.8432 | 0.0009 |
| 298.15 | 0.9133 | 0.0009 |
| 298.15 | 0.9576 | 0.0010 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.1144 | 0.0006 |
| 303.15 | 0.2566 | 0.0006 |
| 303.15 | 0.3821 | 0.0006 |
| 303.15 | 0.5034 | 0.0007 |
| 303.15 | 0.6546 | 0.0007 |
| 303.15 | 0.7535 | 0.0008 |
| 303.15 | 0.8432 | 0.0008 |
| 303.15 | 0.9133 | 0.0009 |
| 303.15 | 0.9576 | 0.0009 |
| 303.15 | 1.0000 | 0.0009 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.15 | 0.0000 | 1.4997 |
| 288.15 | 0.1006 | 1.5021 |
| 288.15 | 0.2463 | 1.5055 |
| 288.15 | 0.3753 | 1.5086 |
| 288.15 | 0.4960 | 1.5117 |
| 288.15 | 0.6398 | 1.5155 |
| 288.15 | 0.7468 | 1.5184 |
| 288.15 | 0.8284 | 1.5206 |
| 288.15 | 0.9034 | 1.5228 |
| 288.15 | 0.9613 | 1.5244 |
| 288.15 | 1.0000 | 1.5256 |
| 293.15 | 0.0000 | 1.4973 |
| 293.15 | 0.1006 | 1.4992 |
| 293.15 | 0.2463 | 1.5018 |
| 293.15 | 0.3753 | 1.5042 |
| 293.15 | 0.4960 | 1.5065 |
| 293.15 | 0.6398 | 1.5093 |
| 293.15 | 0.7468 | 1.5115 |
| 293.15 | 0.8284 | 1.5132 |
| 293.15 | 0.9034 | 1.5149 |
| 293.15 | 0.9613 | 1.5161 |
| 293.15 | 1.0000 | 1.5169 |
| 298.15 | 0.0000 | 1.4944 |
| 298.15 | 0.1006 | 1.4963 |
| 298.15 | 0.2463 | 1.499 |
| 298.15 | 0.3753 | 1.5013 |
| 298.15 | 0.4960 | 1.5037 |
| 298.15 | 0.6398 | 1.5065 |
| 298.15 | 0.7468 | 1.5088 |
| 298.15 | 0.8284 | 1.5104 |
| 298.15 | 0.9034 | 1.5121 |
| 298.15 | 0.9613 | 1.5133 |
| 298.15 | 1.0000 | 1.5141 |
| 303.15 | 0.0000 | 1.4925 |
| 303.15 | 0.1006 | 1.4944 |
| 303.15 | 0.2463 | 1.497 |
| 303.15 | 0.3753 | 1.4993 |
| 303.15 | 0.4960 | 1.5016 |
| 303.15 | 0.6398 | 1.5044 |
| 303.15 | 0.7468 | 1.5066 |
| 303.15 | 0.8284 | 1.5082 |
| 303.15 | 0.9034 | 1.5098 |
| 303.15 | 0.9613 | 1.511 |
| 303.15 | 1.0000 | 1.5117 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid)
- Pressure, kPa = 93.13 (Liquid)
| Mole fraction of Benzene, 1,3-dimethyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.517 |
| 0.0756 | 1.5154 |
| 0.1836 | 1.5131 |
| 0.2143 | 1.5125 |
| 0.2716 | 1.5113 |
| 0.3152 | 1.5104 |
| 0.4196 | 1.5082 |
| 0.4711 | 1.5072 |
| 0.5086 | 1.5064 |
| 0.6083 | 1.5045 |
| 0.6746 | 1.5031 |
| 0.7383 | 1.5019 |
| 0.8189 | 1.5002 |
| 0.8552 | 1.4997 |
| 0.9339 | 1.4982 |
| 1.0000 | 1.497 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.15 | 0.0000 | 1.4997 |
| 288.15 | 0.1006 | 1.5021 |
| 288.15 | 0.2463 | 1.5055 |
| 288.15 | 0.3753 | 1.5086 |
| 288.15 | 0.4960 | 1.5117 |
| 288.15 | 0.6398 | 1.5155 |
| 288.15 | 0.7468 | 1.5184 |
| 288.15 | 0.8284 | 1.5206 |
| 288.15 | 0.9034 | 1.5228 |
| 288.15 | 0.9613 | 1.5244 |
| 288.15 | 1.0000 | 1.5256 |
| 293.15 | 0.0000 | 1.4973 |
| 293.15 | 0.1006 | 1.4992 |
| 293.15 | 0.2463 | 1.5018 |
| 293.15 | 0.3753 | 1.5042 |
| 293.15 | 0.4960 | 1.5065 |
| 293.15 | 0.6398 | 1.5093 |
| 293.15 | 0.7468 | 1.5115 |
| 293.15 | 0.8284 | 1.5132 |
| 293.15 | 0.9034 | 1.5149 |
| 293.15 | 0.9613 | 1.5161 |
| 293.15 | 1.0000 | 1.5169 |
| 298.15 | 0.0000 | 1.4944 |
| 298.15 | 0.1006 | 1.4963 |
| 298.15 | 0.2463 | 1.499 |
| 298.15 | 0.3753 | 1.5013 |
| 298.15 | 0.4960 | 1.5037 |
| 298.15 | 0.6398 | 1.5065 |
| 298.15 | 0.7468 | 1.5088 |
| 298.15 | 0.8284 | 1.5104 |
| 298.15 | 0.9034 | 1.5121 |
| 298.15 | 0.9613 | 1.5133 |
| 298.15 | 1.0000 | 1.5141 |
| 303.15 | 0.0000 | 1.4925 |
| 303.15 | 0.1006 | 1.4944 |
| 303.15 | 0.2463 | 1.497 |
| 303.15 | 0.3753 | 1.4993 |
| 303.15 | 0.4960 | 1.5016 |
| 303.15 | 0.6398 | 1.5044 |
| 303.15 | 0.7468 | 1.5066 |
| 303.15 | 0.8284 | 1.5082 |
| 303.15 | 0.9034 | 1.5098 |
| 303.15 | 0.9613 | 1.511 |
| 303.15 | 1.0000 | 1.5117 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid)
- Pressure, kPa = 93.13 (Liquid)
| Mole fraction of Benzene, 1,3-dimethyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.517 |
| 0.0756 | 1.5154 |
| 0.1836 | 1.5131 |
| 0.2143 | 1.5125 |
| 0.2716 | 1.5113 |
| 0.3152 | 1.5104 |
| 0.4196 | 1.5082 |
| 0.4711 | 1.5072 |
| 0.5086 | 1.5064 |
| 0.6083 | 1.5045 |
| 0.6746 | 1.5031 |
| 0.7383 | 1.5019 |
| 0.8189 | 1.5002 |
| 0.8552 | 1.4997 |
| 0.9339 | 1.4982 |
| 1.0000 | 1.497 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 868.32 |
| 288.15 | 0.1006 | 880.54 |
| 288.15 | 0.2463 | 898.41 |
| 288.15 | 0.3753 | 914.55 |
| 288.15 | 0.4960 | 930.02 |
| 288.15 | 0.6398 | 948.95 |
| 288.15 | 0.7468 | 963.38 |
| 288.15 | 0.8284 | 974.53 |
| 288.15 | 0.9034 | 984.93 |
| 288.15 | 0.9613 | 993.02 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 864.05 |
| 293.15 | 0.1006 | 876.26 |
| 293.15 | 0.2463 | 894.1 |
| 293.15 | 0.3753 | 910.2 |
| 293.15 | 0.4960 | 925.62 |
| 293.15 | 0.6398 | 944.45 |
| 293.15 | 0.7468 | 958.8 |
| 293.15 | 0.8284 | 969.91 |
| 293.15 | 0.9034 | 980.26 |
| 293.15 | 0.9613 | 988.29 |
| 293.15 | 1.0000 | 993.65 |
| 298.15 | 0.0000 | 859.77 |
| 298.15 | 0.1006 | 872.02 |
| 298.15 | 0.2463 | 889.76 |
| 298.15 | 0.3753 | 905.8 |
| 298.15 | 0.4960 | 921.19 |
| 298.15 | 0.6398 | 940.02 |
| 298.15 | 0.7468 | 954.36 |
| 298.15 | 0.8284 | 965.45 |
| 298.15 | 0.9034 | 975.77 |
| 298.15 | 0.9613 | 983.78 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 855.47 |
| 303.15 | 0.1006 | 867.67 |
| 303.15 | 0.2463 | 885.42 |
| 303.15 | 0.3753 | 901.39 |
| 303.15 | 0.4960 | 916.71 |
| 303.15 | 0.6398 | 935.48 |
| 303.15 | 0.7468 | 949.8 |
| 303.15 | 0.8284 | 960.86 |
| 303.15 | 0.9034 | 971.13 |
| 303.15 | 0.9613 | 979.08 |
| 303.15 | 1.0000 | 984.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 868.317 |
| 288.15 | 0.1144 | 882.011 |
| 288.15 | 0.2566 | 899.519 |
| 288.15 | 0.3821 | 915.327 |
| 288.15 | 0.5034 | 930.924 |
| 288.15 | 0.6546 | 950.873 |
| 288.15 | 0.7535 | 964.193 |
| 288.15 | 0.8432 | 976.464 |
| 288.15 | 0.9133 | 986.213 |
| 288.15 | 0.9576 | 992.455 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 864.049 |
| 293.15 | 0.1144 | 877.742 |
| 293.15 | 0.2566 | 895.185 |
| 293.15 | 0.3821 | 910.905 |
| 293.15 | 0.5034 | 926.441 |
| 293.15 | 0.6546 | 946.321 |
| 293.15 | 0.7535 | 959.605 |
| 293.15 | 0.8432 | 971.843 |
| 293.15 | 0.9133 | 981.575 |
| 293.15 | 0.9576 | 987.755 |
| 293.15 | 1.0000 | 993.651 |
| 298.15 | 0.0000 | 859.767 |
| 298.15 | 0.1144 | 873.473 |
| 298.15 | 0.2566 | 890.874 |
| 298.15 | 0.3821 | 906.561 |
| 298.15 | 0.5034 | 922.056 |
| 298.15 | 0.6546 | 941.9 |
| 298.15 | 0.7535 | 955.192 |
| 298.15 | 0.8432 | 967.423 |
| 298.15 | 0.9133 | 977.136 |
| 298.15 | 0.9576 | 983.283 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 855.469 |
| 303.15 | 0.1144 | 869.172 |
| 303.15 | 0.2566 | 886.499 |
| 303.15 | 0.3821 | 902.126 |
| 303.15 | 0.5034 | 917.578 |
| 303.15 | 0.6546 | 937.368 |
| 303.15 | 0.7535 | 950.619 |
| 303.15 | 0.8432 | 962.844 |
| 303.15 | 0.9133 | 972.502 |
| 303.15 | 0.9576 | 978.641 |
| 303.15 | 1.0000 | 984.372 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 868.32 |
| 288.15 | 0.1006 | 880.54 |
| 288.15 | 0.2463 | 898.41 |
| 288.15 | 0.3753 | 914.55 |
| 288.15 | 0.4960 | 930.02 |
| 288.15 | 0.6398 | 948.95 |
| 288.15 | 0.7468 | 963.38 |
| 288.15 | 0.8284 | 974.53 |
| 288.15 | 0.9034 | 984.93 |
| 288.15 | 0.9613 | 993.02 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 864.05 |
| 293.15 | 0.1006 | 876.26 |
| 293.15 | 0.2463 | 894.1 |
| 293.15 | 0.3753 | 910.2 |
| 293.15 | 0.4960 | 925.62 |
| 293.15 | 0.6398 | 944.45 |
| 293.15 | 0.7468 | 958.8 |
| 293.15 | 0.8284 | 969.91 |
| 293.15 | 0.9034 | 980.26 |
| 293.15 | 0.9613 | 988.29 |
| 293.15 | 1.0000 | 993.65 |
| 298.15 | 0.0000 | 859.77 |
| 298.15 | 0.1006 | 872.02 |
| 298.15 | 0.2463 | 889.76 |
| 298.15 | 0.3753 | 905.8 |
| 298.15 | 0.4960 | 921.19 |
| 298.15 | 0.6398 | 940.02 |
| 298.15 | 0.7468 | 954.36 |
| 298.15 | 0.8284 | 965.45 |
| 298.15 | 0.9034 | 975.77 |
| 298.15 | 0.9613 | 983.78 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 855.47 |
| 303.15 | 0.1006 | 867.67 |
| 303.15 | 0.2463 | 885.42 |
| 303.15 | 0.3753 | 901.39 |
| 303.15 | 0.4960 | 916.71 |
| 303.15 | 0.6398 | 935.48 |
| 303.15 | 0.7468 | 949.8 |
| 303.15 | 0.8284 | 960.86 |
| 303.15 | 0.9034 | 971.13 |
| 303.15 | 0.9613 | 979.08 |
| 303.15 | 1.0000 | 984.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 868.317 |
| 288.15 | 0.1144 | 882.011 |
| 288.15 | 0.2566 | 899.519 |
| 288.15 | 0.3821 | 915.327 |
| 288.15 | 0.5034 | 930.924 |
| 288.15 | 0.6546 | 950.873 |
| 288.15 | 0.7535 | 964.193 |
| 288.15 | 0.8432 | 976.464 |
| 288.15 | 0.9133 | 986.213 |
| 288.15 | 0.9576 | 992.455 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 864.049 |
| 293.15 | 0.1144 | 877.742 |
| 293.15 | 0.2566 | 895.185 |
| 293.15 | 0.3821 | 910.905 |
| 293.15 | 0.5034 | 926.441 |
| 293.15 | 0.6546 | 946.321 |
| 293.15 | 0.7535 | 959.605 |
| 293.15 | 0.8432 | 971.843 |
| 293.15 | 0.9133 | 981.575 |
| 293.15 | 0.9576 | 987.755 |
| 293.15 | 1.0000 | 993.651 |
| 298.15 | 0.0000 | 859.767 |
| 298.15 | 0.1144 | 873.473 |
| 298.15 | 0.2566 | 890.874 |
| 298.15 | 0.3821 | 906.561 |
| 298.15 | 0.5034 | 922.056 |
| 298.15 | 0.6546 | 941.9 |
| 298.15 | 0.7535 | 955.192 |
| 298.15 | 0.8432 | 967.423 |
| 298.15 | 0.9133 | 977.136 |
| 298.15 | 0.9576 | 983.283 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 855.469 |
| 303.15 | 0.1144 | 869.172 |
| 303.15 | 0.2566 | 886.499 |
| 303.15 | 0.3821 | 902.126 |
| 303.15 | 0.5034 | 917.578 |
| 303.15 | 0.6546 | 937.368 |
| 303.15 | 0.7535 | 950.619 |
| 303.15 | 0.8432 | 962.844 |
| 303.15 | 0.9133 | 972.502 |
| 303.15 | 0.9576 | 978.641 |
| 303.15 | 1.0000 | 984.372 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1362.61 |
| 288.15 | 0.1144 | 1369.25 |
| 288.15 | 0.2566 | 1380.52 |
| 288.15 | 0.3821 | 1390.89 |
| 288.15 | 0.5034 | 1401.01 |
| 288.15 | 0.6546 | 1414.06 |
| 288.15 | 0.7535 | 1424.03 |
| 288.15 | 0.8432 | 1431.95 |
| 288.15 | 0.9133 | 1439.34 |
| 288.15 | 0.9576 | 1445.22 |
| 288.15 | 1.0000 | 1449.09 |
| 293.15 | 0.0000 | 1343.4 |
| 293.15 | 0.1144 | 1351.03 |
| 293.15 | 0.2566 | 1362.19 |
| 293.15 | 0.3821 | 1372.11 |
| 293.15 | 0.5034 | 1381.41 |
| 293.15 | 0.6546 | 1393.9 |
| 293.15 | 0.7535 | 1402.8 |
| 293.15 | 0.8432 | 1411.12 |
| 293.15 | 0.9133 | 1418.43 |
| 293.15 | 0.9576 | 1423.6 |
| 293.15 | 1.0000 | 1428.45 |
| 298.15 | 0.0000 | 1320.97 |
| 298.15 | 0.1144 | 1328.53 |
| 298.15 | 0.2566 | 1339.22 |
| 298.15 | 0.3821 | 1349.8 |
| 298.15 | 0.5034 | 1360.06 |
| 298.15 | 0.6546 | 1373.48 |
| 298.15 | 0.7535 | 1382.55 |
| 298.15 | 0.8432 | 1390.95 |
| 298.15 | 0.9133 | 1398.13 |
| 298.15 | 0.9576 | 1403.14 |
| 298.15 | 1.0000 | 1408.02 |
| 303.15 | 0.0000 | 1300.34 |
| 303.15 | 0.1144 | 1308.0 |
| 303.15 | 0.2566 | 1318.65 |
| 303.15 | 0.3821 | 1328.78 |
| 303.15 | 0.5034 | 1339.08 |
| 303.15 | 0.6546 | 1352.59 |
| 303.15 | 0.7535 | 1362.03 |
| 303.15 | 0.8432 | 1370.97 |
| 303.15 | 0.9133 | 1378.31 |
| 303.15 | 0.9576 | 1383.07 |
| 303.15 | 1.0000 | 1387.66 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1362.61 |
| 288.15 | 0.1144 | 1369.25 |
| 288.15 | 0.2566 | 1380.52 |
| 288.15 | 0.3821 | 1390.89 |
| 288.15 | 0.5034 | 1401.01 |
| 288.15 | 0.6546 | 1414.06 |
| 288.15 | 0.7535 | 1424.03 |
| 288.15 | 0.8432 | 1431.95 |
| 288.15 | 0.9133 | 1439.34 |
| 288.15 | 0.9576 | 1445.22 |
| 288.15 | 1.0000 | 1449.09 |
| 293.15 | 0.0000 | 1343.4 |
| 293.15 | 0.1144 | 1351.03 |
| 293.15 | 0.2566 | 1362.19 |
| 293.15 | 0.3821 | 1372.11 |
| 293.15 | 0.5034 | 1381.41 |
| 293.15 | 0.6546 | 1393.9 |
| 293.15 | 0.7535 | 1402.8 |
| 293.15 | 0.8432 | 1411.12 |
| 293.15 | 0.9133 | 1418.43 |
| 293.15 | 0.9576 | 1423.6 |
| 293.15 | 1.0000 | 1428.45 |
| 298.15 | 0.0000 | 1320.97 |
| 298.15 | 0.1144 | 1328.53 |
| 298.15 | 0.2566 | 1339.22 |
| 298.15 | 0.3821 | 1349.8 |
| 298.15 | 0.5034 | 1360.06 |
| 298.15 | 0.6546 | 1373.48 |
| 298.15 | 0.7535 | 1382.55 |
| 298.15 | 0.8432 | 1390.95 |
| 298.15 | 0.9133 | 1398.13 |
| 298.15 | 0.9576 | 1403.14 |
| 298.15 | 1.0000 | 1408.02 |
| 303.15 | 0.0000 | 1300.34 |
| 303.15 | 0.1144 | 1308.0 |
| 303.15 | 0.2566 | 1318.65 |
| 303.15 | 0.3821 | 1328.78 |
| 303.15 | 0.5034 | 1339.08 |
| 303.15 | 0.6546 | 1352.59 |
| 303.15 | 0.7535 | 1362.03 |
| 303.15 | 0.8432 | 1370.97 |
| 303.15 | 0.9133 | 1378.31 |
| 303.15 | 0.9576 | 1383.07 |
| 303.15 | 1.0000 | 1387.66 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of Benzene, 1,3-dimethyl- (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 423.38 |
| 0.0490 | 422.30 |
| 0.1180 | 420.93 |
| 0.1900 | 419.58 |
| 0.2980 | 417.71 |
| 0.3920 | 416.24 |
| 0.5270 | 414.34 |
| 0.5990 | 413.41 |
| 0.7000 | 412.19 |
| 0.7960 | 411.13 |
| 0.9090 | 409.98 |
| 0.9530 | 409.56 |
| 1.0000 | 409.13 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of Benzene, 1,3-dimethyl- (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 423.38 |
| 0.0490 | 422.30 |
| 0.1180 | 420.93 |
| 0.1900 | 419.58 |
| 0.2980 | 417.71 |
| 0.3920 | 416.24 |
| 0.5270 | 414.34 |
| 0.5990 | 413.41 |
| 0.7000 | 412.19 |
| 0.7960 | 411.13 |
| 0.9090 | 409.98 |
| 0.9530 | 409.56 |
| 1.0000 | 409.13 |
Sources
- Excess molar volumes and refractive indices of (methoxybenzene + benzene, or toluene, or o-xylene, or m-xylene, or p-xylene, or mesitylene) binary mixtures between T = (288.15 to 303.15) K
- Refractive Index and Vapor-Liquid Equilibrium Data for the Binary Systems of Anisole with Xylene Isomers at 93.13 kPa
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene with Anisole at (288.15, 293.15, 298.15, and 303.15) K