- Name
- Pentoxifylline
- InChI
- InChI=1S/C13H18N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8H,4-7H2,1-3H3
- InChI Key
- BYPFEZZEUUWMEJ-UHFFFAOYSA-N
- Formula
- C13H18N4O3
- SMILES
-
CC(=O)CCCCn1c(=O)c2c(ncn2C)n(C
)c1=O - Mol. Weight (g/mol)
- 278.31
- CAS
- 6493-05-6
- Name
- D-Valine
- InChI
- InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1
- InChI Key
- KZSNJWFQEVHDMF-BYPYZUCNSA-N
- Formula
- C5H11NO2
- SMILES
- CC(C)C(N)C(=O)O
- Mol. Weight (g/mol)
- 117.15
- CAS
- 640-68-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Molality, mol/kg = 0.0976 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1003.775 |
| 293.15 | 0.0490 | 1005.074 |
| 293.15 | 0.0936 | 1006.244 |
| 293.15 | 0.1454 | 1007.586 |
| 293.15 | 0.2010 | 1009.002 |
| 293.15 | 0.2506 | 1010.252 |
| 293.15 | 0.2711 | 1010.762 |
| 298.15 | 0.0000 | 1002.513 |
| 298.15 | 0.0490 | 1003.798 |
| 298.15 | 0.0936 | 1004.956 |
| 298.15 | 0.1454 | 1006.282 |
| 298.15 | 0.2010 | 1007.688 |
| 298.15 | 0.2506 | 1008.925 |
| 298.15 | 0.2711 | 1009.428 |
| 303.15 | 0.0000 | 1001.021 |
| 303.15 | 0.0490 | 1002.295 |
| 303.15 | 0.0936 | 1003.443 |
| 303.15 | 0.1454 | 1004.759 |
| 303.15 | 0.2010 | 1006.146 |
| 303.15 | 0.2506 | 1007.372 |
| 303.15 | 0.2711 | 1007.873 |
| 308.15 | 0.0000 | 999.32 |
| 308.15 | 0.0490 | 1000.585 |
| 308.15 | 0.0936 | 1001.725 |
| 308.15 | 0.1454 | 1003.031 |
| 308.15 | 0.2010 | 1004.41 |
| 308.15 | 0.2506 | 1005.626 |
| 308.15 | 0.2711 | 1006.125 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Molality, mol/kg = 0.0976 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1003.775 |
| 293.15 | 0.0490 | 1005.074 |
| 293.15 | 0.0936 | 1006.244 |
| 293.15 | 0.1454 | 1007.586 |
| 293.15 | 0.2010 | 1009.002 |
| 293.15 | 0.2506 | 1010.252 |
| 293.15 | 0.2711 | 1010.762 |
| 298.15 | 0.0000 | 1002.513 |
| 298.15 | 0.0490 | 1003.798 |
| 298.15 | 0.0936 | 1004.956 |
| 298.15 | 0.1454 | 1006.282 |
| 298.15 | 0.2010 | 1007.688 |
| 298.15 | 0.2506 | 1008.925 |
| 298.15 | 0.2711 | 1009.428 |
| 303.15 | 0.0000 | 1001.021 |
| 303.15 | 0.0490 | 1002.295 |
| 303.15 | 0.0936 | 1003.443 |
| 303.15 | 0.1454 | 1004.759 |
| 303.15 | 0.2010 | 1006.146 |
| 303.15 | 0.2506 | 1007.372 |
| 303.15 | 0.2711 | 1007.873 |
| 308.15 | 0.0000 | 999.32 |
| 308.15 | 0.0490 | 1000.585 |
| 308.15 | 0.0936 | 1001.725 |
| 308.15 | 0.1454 | 1003.031 |
| 308.15 | 0.2010 | 1004.41 |
| 308.15 | 0.2506 | 1005.626 |
| 308.15 | 0.2711 | 1006.125 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.