- Name
- 1-Butanol, 3-methyl-
- InChI
- InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3
- InChI Key
- PHTQWCKDNZKARW-UHFFFAOYSA-N
- Formula
- C5H12O
- SMILES
- CC(C)CCO
- Mol. Weight (g/mol)
- 88.15
- CAS
- 123-51-3
- Name
- n-Butyl ether
- InChI
- InChI=1S/C8H18O/c1-3-5-7-9-8-6-4-2/h3-8H2,1-2H3
- InChI Key
- DURPTKYDGMDSBL-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCOCCCC
- Mol. Weight (g/mol)
- 130.23
- CAS
- 142-96-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Butyl ether (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 298.15 | 0.0920 | 0.2310 |
| 298.15 | 0.1608 | 0.3900 |
| 298.15 | 0.2389 | 0.5510 |
| 298.15 | 0.3161 | 0.6700 |
| 298.15 | 0.3993 | 0.7830 |
| 298.15 | 0.4694 | 0.8520 |
| 298.15 | 0.5458 | 0.9050 |
| 298.15 | 0.6389 | 0.9250 |
| 298.15 | 0.7088 | 0.8840 |
| 298.15 | 0.7760 | 0.8120 |
| 298.15 | 0.8626 | 0.6450 |
| 298.15 | 0.9423 | 0.3500 |
| 308.15 | 0.0836 | 0.2260 |
| 308.15 | 0.1547 | 0.3980 |
| 308.15 | 0.2348 | 0.5760 |
| 308.15 | 0.3248 | 0.7350 |
| 308.15 | 0.4249 | 0.8460 |
| 308.15 | 0.4894 | 0.9200 |
| 308.15 | 0.5775 | 0.9520 |
| 308.15 | 0.6519 | 0.9440 |
| 308.15 | 0.7302 | 0.8950 |
| 308.15 | 0.7870 | 0.8110 |
| 308.15 | 0.8553 | 0.6740 |
| 308.15 | 0.9681 | 0.2360 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Butyl ether (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 298.15 | 0.0920 | 0.2310 |
| 298.15 | 0.1608 | 0.3900 |
| 298.15 | 0.2389 | 0.5510 |
| 298.15 | 0.3161 | 0.6700 |
| 298.15 | 0.3993 | 0.7830 |
| 298.15 | 0.4694 | 0.8520 |
| 298.15 | 0.5458 | 0.9050 |
| 298.15 | 0.6389 | 0.9250 |
| 298.15 | 0.7088 | 0.8840 |
| 298.15 | 0.7760 | 0.8120 |
| 298.15 | 0.8626 | 0.6450 |
| 298.15 | 0.9423 | 0.3500 |
| 308.15 | 0.0836 | 0.2260 |
| 308.15 | 0.1547 | 0.3980 |
| 308.15 | 0.2348 | 0.5760 |
| 308.15 | 0.3248 | 0.7350 |
| 308.15 | 0.4249 | 0.8460 |
| 308.15 | 0.4894 | 0.9200 |
| 308.15 | 0.5775 | 0.9520 |
| 308.15 | 0.6519 | 0.9440 |
| 308.15 | 0.7302 | 0.8950 |
| 308.15 | 0.7870 | 0.8110 |
| 308.15 | 0.8553 | 0.6740 |
| 308.15 | 0.9681 | 0.2360 |