- InChI
- InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3
- InChI Key
- PHTQWCKDNZKARW-UHFFFAOYSA-N
- Formula
- C5H12O
- SMILES
- CC(C)CCO
- Molecular Weight1
- 88.15
- CAS
- 123-51-3
- Other Names
-
- 2-Methyl-4-butanol
- 3-Methylbutanol
- 3-Metil-butanolo
- 3-methyl-1-butanol
- 3-methylbutan-1-ol
- 3-methylbutanoI
- Alcool amilico
- Alcool isoamylique
- Amylowy alkohol
- Butan-1-ol, 3-methyl
- Butanol, 3-methyl-
- Fermentation amyl alcohol
- Fusel Oil
- Isoamyl alcohol (3-methyl butanol)
- Isoamyl alcohol, primary
- Isoamylol
- Isobutyl carbinol
- Isopentan-1-ol
- Methyl-3-butan-1-ol
- NSC 1029
- i-Amyl alcohol
- iso-amylalkohol
- isoamyl alcohol
- isopentanol
- isopentyl alcohol
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- ν : Kinematic viscosity (m2/s).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.5746 | Relay (1.0) Calculated Property | |
| ΔcH°liquid | [-3326.60; -3326.20] | kJ/mol |
|
| ΔcH°liquid | -3326.60 ± 1.60 | kJ/mol | NIST |
| ΔcH°liquid | -3326.20 ± 0.50 | kJ/mol | NIST |
| Cp,liquid | 209.30 | J/mol×K | Partial Molar Heat Capacities and Partial Molar Volumes of All of the Isomeric (C3 to C5) Alkanols at Infinite Dilution in Water at 298.15 K |
| μ | 1.80 | debye | KDB |
| ΔfG° | -148.04 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | [-302.30; -300.80] | kJ/mol |
|
| ΔfH°gas | -302.30 | kJ/mol | KDB |
| ΔfH°gas | -300.80 | kJ/mol | NIST |
| ΔfH°gas | -301.30 ± 1.50 | kJ/mol | NIST |
| ΔfH°liquid | [-356.40; -355.90] | kJ/mol |
|
| ΔfH°liquid | -355.90 ± 1.60 | kJ/mol | NIST |
| ΔfH°liquid | -356.40 ± 0.59 | kJ/mol | NIST |
| ΔfusH° | 9.27 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [44.18; 55.63] | kJ/mol |
|
| ΔvapH° | 55.63 | kJ/mol | NIST |
| ΔvapH° | 55.30 | kJ/mol | NIST |
| ΔvapH° | 55.00 ± 1.30 | kJ/mol | NIST |
| ΔvapH° | 55.10 | kJ/mol | NIST |
| ΔvapH° | 54.30 | kJ/mol | NIST |
| ΔvapH° | Outlier 44.18 ± 0.02 | kJ/mol | NIST |
| IE | 9.99 | eV | Relay (1.0) Calculated Property |
| log10WS | [-0.52; -0.51] |
|
|
| log10WS | -0.52 | Aq. Solubility Prediction | |
| log10WS | -0.51 | Estimated Solubility | |
| logPoct/wat | 1.025 | Crippen Calculated Property | |
| McVol | 87.180 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 1 | KDB | |
| Pc | [3930.00; 4559.63] | kPa |
|
| Pc | 3930.00 | kPa | KDB |
| Pc | 3930.00 ± 20.00 | kPa | NIST |
| Pc | 3930.00 ± 40.00 | kPa | NIST |
| Pc | 4559.63 ± 202.65 | kPa | NIST |
| Inp | [700.00; 773.00] |
|
|
| Inp | 723.00 | NIST | |
| Inp | 733.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 738.00 | NIST | |
| Inp | 733.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 738.00 | NIST | |
| Inp | 733.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 730.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 744.00 | NIST | |
| Inp | 747.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 738.20 | NIST | |
| Inp | 756.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 740.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 730.00 | NIST | |
| Inp | 754.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 708.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | Outlier 700.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 740.00 | NIST | |
| Inp | 743.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | Outlier 700.00 | NIST | |
| Inp | 740.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | Outlier 700.00 | NIST | |
| Inp | Outlier 700.00 | NIST | |
| Inp | 743.00 | NIST | |
| Inp | 704.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 740.00 | NIST | |
| Inp | 742.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 722.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 743.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 715.00 | NIST | |
| Inp | 728.00 | NIST | |
| Inp | 722.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | Outlier 760.00 | NIST | |
| Inp | 747.00 | NIST | |
| Inp | 734.10 | NIST | |
| Inp | 747.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 740.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 733.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | 729.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 739.00 | NIST | |
| Inp | Outlier 773.00 | NIST | |
| Inp | 739.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 709.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 742.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 730.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 749.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 739.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 745.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | Outlier 759.30 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 715.00 | NIST | |
| Inp | 729.00 | NIST | |
| Inp | 746.00 | NIST | |
| Inp | Outlier 773.00 | NIST | |
| Inp | 749.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 738.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 730.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 721.81 | NIST | |
| Inp | 753.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 753.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 739.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 713.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 743.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | 728.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 743.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 755.00 | NIST | |
| Inp | 729.00 | NIST | |
| Inp | 755.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | Outlier 768.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 715.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 744.00 | NIST | |
| Inp | 745.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 713.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | 738.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 742.00 | NIST | |
| Inp | 715.00 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 739.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 738.00 | NIST | |
| Inp | 738.00 | NIST | |
| Inp | Outlier 758.00 | NIST | |
| Inp | Outlier 767.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | 744.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | 742.00 | NIST | |
| Inp | 737.00 | NIST | |
| Inp | 742.00 | NIST | |
| Inp | Outlier 772.00 | NIST | |
| Inp | 711.00 | NIST | |
| Inp | 713.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 736.00 | NIST | |
| Inp | 738.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 730.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 749.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 738.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 730.00 | NIST | |
| Inp | 709.00 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 745.00 | NIST | |
| Inp | 734.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | 746.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 753.00 | NIST | |
| Inp | 739.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 737.00 | NIST | |
| I | [1159.00; 1255.00] |
|
|
| I | 1208.00 | NIST | |
| I | 1238.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1238.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1203.00 | NIST | |
| I | Outlier 1240.00 | NIST | |
| I | 1190.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1195.00 | NIST | |
| I | 1195.00 | NIST | |
| I | 1190.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1180.00 | NIST | |
| I | 1218.00 | NIST | |
| I | 1180.00 | NIST | |
| I | Outlier 1174.00 | NIST | |
| I | Outlier 1174.00 | NIST | |
| I | 1187.00 | NIST | |
| I | 1185.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1218.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1202.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1223.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1194.00 | NIST | |
| I | 1199.00 | NIST | |
| I | Outlier 1163.00 | NIST | |
| I | Outlier 1165.00 | NIST | |
| I | 1213.00 | NIST | |
| I | 1214.00 | NIST | |
| I | 1223.00 | NIST | |
| I | 1194.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1206.00 | NIST | |
| I | Outlier 1163.00 | NIST | |
| I | 1195.00 | NIST | |
| I | 1190.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1187.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1187.00 | NIST | |
| I | 1187.00 | NIST | |
| I | 1194.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1207.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1191.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1197.00 | NIST | |
| I | Outlier 1255.00 | NIST | |
| I | 1204.00 | NIST | |
| I | 1198.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1207.00 | NIST | |
| I | 1182.00 | NIST | |
| I | 1213.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1183.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1198.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1222.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1218.00 | NIST | |
| I | 1196.00 | NIST | |
| I | 1194.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1222.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1225.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1182.00 | NIST | |
| I | 1225.00 | NIST | |
| I | 1204.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1191.00 | NIST | |
| I | 1218.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1193.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1198.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1204.00 | NIST | |
| I | 1221.00 | NIST | |
| I | Outlier 1250.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1213.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1214.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1229.60 | NIST | |
| I | 1199.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1232.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1225.00 | NIST | |
| I | 1189.00 | NIST | |
| I | 1214.00 | NIST | |
| I | 1204.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1225.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1207.00 | NIST | |
| I | 1207.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1219.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1195.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1227.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1212.00 | NIST | |
| I | Outlier 1172.00 | NIST | |
| I | 1175.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1194.00 | NIST | |
| I | 1195.00 | NIST | |
| I | 1199.00 | NIST | |
| I | 1194.00 | NIST | |
| I | 1204.00 | NIST | |
| I | Outlier 1247.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1214.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1204.00 | NIST | |
| I | 1225.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1204.00 | NIST | |
| I | Outlier 1168.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1218.00 | NIST | |
| I | Outlier 1169.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1226.00 | NIST | |
| I | 1190.00 | NIST | |
| I | 1192.00 | NIST | |
| I | 1192.00 | NIST | |
| I | 1202.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1196.00 | NIST | |
| I | 1199.00 | NIST | |
| I | 1214.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1219.00 | NIST | |
| I | 1176.00 | NIST | |
| I | 1207.00 | NIST | |
| I | 1219.00 | NIST | |
| I | 1219.00 | NIST | |
| I | 1219.00 | NIST | |
| I | 1196.00 | NIST | |
| I | 1204.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1236.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1213.00 | NIST | |
| I | Outlier 1174.00 | NIST | |
| I | 1177.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1179.00 | NIST | |
| I | 1180.00 | NIST | |
| I | 1179.00 | NIST | |
| I | 1180.00 | NIST | |
| I | 1231.00 | NIST | |
| I | 1180.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1180.00 | NIST | |
| I | 1192.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1180.00 | NIST | |
| I | 1207.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1208.00 | NIST | |
| I | Outlier 1164.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1226.00 | NIST | |
| I | 1213.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1190.00 | NIST | |
| I | 1185.00 | NIST | |
| I | 1191.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1222.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1213.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1212.00 | NIST | |
| I | Outlier 1250.00 | NIST | |
| I | 1223.00 | NIST | |
| I | 1213.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1216.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1194.00 | NIST | |
| I | 1196.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1229.00 | NIST | |
| I | Outlier 1169.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1203.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1201.00 | NIST | |
| I | 1182.00 | NIST | |
| I | 1226.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1204.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1199.00 | NIST | |
| I | 1223.00 | NIST | |
| I | 1180.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1222.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1195.00 | NIST | |
| I | 1209.00 | NIST | |
| I | 1231.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1190.00 | NIST | |
| I | 1184.00 | NIST | |
| I | Outlier 1174.00 | NIST | |
| I | Outlier 1240.00 | NIST | |
| I | 1189.00 | NIST | |
| I | 1218.00 | NIST | |
| I | Outlier 1159.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1232.00 | NIST | |
| I | 1207.00 | NIST | |
| I | 1208.00 | NIST | |
| I | 1217.00 | NIST | |
| I | 1185.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1212.00 | NIST | |
| I | 1215.00 | NIST | |
| I | 1211.00 | NIST | |
| I | 1203.00 | NIST | |
| I | Outlier 1169.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1231.00 | NIST | |
| I | Outlier 1240.00 | NIST | |
| I | 1224.00 | NIST | |
| I | 1214.00 | NIST | |
| I | 1206.00 | NIST | |
| I | 1201.00 | NIST | |
| I | Outlier 1172.00 | NIST | |
| I | 1199.00 | NIST | |
| I | 1230.00 | NIST | |
| I | 1204.00 | NIST | |
| I | 1190.00 | NIST | |
| I | 1196.00 | NIST | |
| I | 1176.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1180.00 | NIST | |
| I | 1184.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1225.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1197.00 | NIST | |
| Tboil | [401.15; 433.30] | K |
|
| Tboil | 404.50 | K | Phase equilibria of (water + levunilic acid + alcohol) ternary systems |
| Tboil | 404.90 | K | Vapor liquid equilibrium of the ethanol + 3-methyl-1-butanol system at 50.66, 101.33 and 151.99 kPa |
| Tboil | 404.55 | K | (Liquid + liquid) equilibria of (water + butyric acid + isoamyl alcohol) ternary system |
| Tboil | 404.45 | K | Effect of Pressure on the Azeotrope of the Mixture Isoamyl Acetate Isoamyl Alcohol at 50.00, 101.32, 250.00, and 350.00 kPa |
| Tboil | 404.27 | K | Vapor-Liquid Equilibria at 101.3 kPa for Binary Mixtures Containing 2-Methyl-1-propanol + 2-Methyl-1-butanol, 2-Methyl-1-propanol + 3-Methyl-1-butanol, and 2-Methyl-1-propanol + 1-Pentanol |
| Tboil | 404.20 | K | KDB |
| Tboil | 403.53 ± 0.25 | K | NIST |
| Tboil | 403.20 | K | NIST |
| Tboil | 403.91 ± 0.03 | K | NIST |
| Tboil | Outlier 433.30 ± 0.20 | K | NIST |
| Tboil | 404.20 | K | NIST |
| Tboil | 403.75 ± 0.30 | K | NIST |
| Tboil | 404.35 ± 0.30 | K | NIST |
| Tboil | 404.90 ± 0.50 | K | NIST |
| Tboil | 402.70 ± 0.40 | K | NIST |
| Tboil | 405.20 ± 0.50 | K | NIST |
| Tboil | 405.20 ± 0.50 | K | NIST |
| Tboil | 405.00 ± 1.00 | K | NIST |
| Tboil | 405.15 ± 1.50 | K | NIST |
| Tboil | 403.95 | K | NIST |
| Tboil | 405.15 ± 0.30 | K | NIST |
| Tboil | 405.20 ± 0.40 | K | NIST |
| Tboil | 405.00 ± 0.50 | K | NIST |
| Tboil | 404.49 ± 0.15 | K | NIST |
| Tboil | 405.05 ± 0.50 | K | NIST |
| Tboil | 403.15 ± 2.00 | K | NIST |
| Tboil | 405.15 ± 0.50 | K | NIST |
| Tboil | 405.05 ± 0.30 | K | NIST |
| Tboil | 404.95 ± 0.50 | K | NIST |
| Tboil | 404.85 ± 0.50 | K | NIST |
| Tboil | 404.65 ± 1.00 | K | NIST |
| Tboil | 404.75 ± 0.50 | K | NIST |
| Tboil | 405.05 ± 0.50 | K | NIST |
| Tboil | 403.65 ± 2.00 | K | NIST |
| Tboil | 405.10 ± 0.50 | K | NIST |
| Tboil | 405.10 ± 0.60 | K | NIST |
| Tboil | 404.65 ± 0.50 | K | NIST |
| Tboil | 402.00 ± 3.00 | K | NIST |
| Tboil | 405.15 ± 2.00 | K | NIST |
| Tboil | 403.15 ± 2.00 | K | NIST |
| Tboil | 403.15 ± 2.00 | K | NIST |
| Tboil | 402.65 ± 2.00 | K | NIST |
| Tboil | 404.15 ± 2.00 | K | NIST |
| Tboil | 404.75 ± 0.70 | K | NIST |
| Tboil | 403.65 ± 1.00 | K | NIST |
| Tboil | 403.65 ± 1.00 | K | NIST |
| Tboil | 403.85 ± 0.50 | K | NIST |
| Tboil | 404.05 ± 0.50 | K | NIST |
| Tboil | 401.15 ± 3.00 | K | NIST |
| Tboil | 401.15 ± 3.00 | K | NIST |
| Tboil | 403.40 ± 1.00 | K | NIST |
| Tboil | 403.70 ± 2.00 | K | NIST |
| Tboil | 405.15 ± 0.40 | K | NIST |
| Tboil | 404.15 ± 2.00 | K | NIST |
| Tboil | 405.15 ± 0.20 | K | NIST |
| Tboil | 404.00 ± 0.40 | K | NIST |
| Tboil | 404.15 ± 1.00 | K | NIST |
| Tboil | 404.60 ± 0.50 | K | NIST |
| Tboil | 404.50 ± 0.50 | K | NIST |
| Tboil | 404.50 ± 0.50 | K | NIST |
| Tboil | 405.20 ± 0.30 | K | NIST |
| Tboil | 405.20 ± 0.50 | K | NIST |
| Tboil | 404.40 ± 1.00 | K | NIST |
| Tboil | 404.70 ± 0.50 | K | NIST |
| Tboil | 404.50 ± 0.50 | K | NIST |
| Tboil | 404.45 ± 0.30 | K | NIST |
| Tboil | 404.50 ± 0.20 | K | NIST |
| Tboil | 403.15 ± 1.00 | K | NIST |
| Tboil | 406.00 ± 5.00 | K | NIST |
| Tboil | 404.00 ± 0.50 | K | NIST |
| Tboil | 404.30 ± 0.50 | K | NIST |
| Tboil | 404.65 ± 1.00 | K | NIST |
| Tboil | 404.35 ± 0.50 | K | NIST |
| Tboil | 404.75 ± 0.50 | K | NIST |
| Tboil | 403.90 ± 1.50 | K | NIST |
| Tboil | 404.65 ± 2.00 | K | NIST |
| Tboil | 401.65 ± 3.00 | K | NIST |
| Tboil | 404.55 ± 0.50 | K | NIST |
| Tboil | 401.15 ± 3.00 | K | NIST |
| Tboil | 404.75 ± 0.20 | K | NIST |
| Tboil | 402.65 ± 2.00 | K | NIST |
| Tboil | 404.65 ± 2.00 | K | NIST |
| Tboil | 404.15 ± 2.00 | K | NIST |
| Tboil | 404.00 ± 2.00 | K | NIST |
| Tboil | 404.65 ± 1.00 | K | NIST |
| Tboil | 405.20 ± 2.00 | K | NIST |
| Tboil | 403.26 ± 1.00 | K | NIST |
| Tboil | 402.85 ± 1.50 | K | NIST |
| Tboil | 404.65 ± 2.00 | K | NIST |
| Tboil | 405.65 ± 3.00 | K | NIST |
| Tboil | 402.15 ± 3.00 | K | NIST |
| Tc | [577.20; 582.90] | K |
|
| Tc | 577.20 | K | KDB |
| Tc | 577.20 ± 0.50 | K | NIST |
| Tc | 577.20 ± 0.70 | K | NIST |
| Tc | 579.40 | K | NIST |
| Tc | 580.15 ± 1.00 | K | NIST |
| Tc | 579.20 ± 0.35 | K | NIST |
| Tc | 580.40 | K | NIST |
| Tc | Outlier 582.90 | K | NIST |
| Tc | 579.20 | K | NIST |
| Tc | 579.80 | K | NIST |
| Tfus | [155.90; 156.08] | K |
|
| Tfus | 155.90 | K | KDB |
| Tfus | 156.08 | K | Aq. Solubility Prediction |
| Ttriple | 118.00 | K | Heat Capacities in the Solid and in the Liquid Phase of Isomeric Pentanols |
| Vc | 0.304 | m3/kmol | Relay (1.0) Calculated Property |
Temperature Dependent Properties
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [317.06; 425.73] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.42576e+01 | |||
| Coefficient B | -2.70339e+03 | |||
| Coefficient C | -1.23544e+02 | |||
| Temperature range, min. | 317.06 | |||
| Temperature range, max. | 425.73 | |||
| Pvap | 1.33 | kPa | 317.06 | Calculated Property |
| Pvap | 3.03 | kPa | 329.13 | Calculated Property |
| Pvap | 6.28 | kPa | 341.21 | Calculated Property |
| Pvap | 12.07 | kPa | 353.28 | Calculated Property |
| Pvap | 21.71 | kPa | 365.36 | Calculated Property |
| Pvap | 36.95 | kPa | 377.43 | Calculated Property |
| Pvap | 59.92 | kPa | 389.51 | Calculated Property |
| Pvap | 93.17 | kPa | 401.58 | Calculated Property |
| Pvap | 139.65 | kPa | 413.66 | Calculated Property |
| Pvap | 202.65 | kPa | 425.73 | Calculated Property |
| Pvap | [8.90e-11; 3843.71] | kPa | [161.00; 579.45] |
KDB Vapor Pressure Data
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.12297e+02 | |||
| Coefficient B | -1.06664e+04 | |||
| Coefficient C | -1.36325e+01 | |||
| Coefficient D | 3.26511e-06 | |||
| Temperature range, min. | 161.00 | |||
| Temperature range, max. | 579.45 | |||
| Pvap | 8.90e-11 | kPa | 161.00 | Calculated Property |
| Pvap | 8.30e-06 | kPa | 207.49 | Calculated Property |
| Pvap | 6.91e-03 | kPa | 253.99 | Calculated Property |
| Pvap | 0.50 | kPa | 300.48 | Calculated Property |
| Pvap | 9.11 | kPa | 346.98 | Calculated Property |
| Pvap | 69.37 | kPa | 393.47 | Calculated Property |
| Pvap | 301.32 | kPa | 439.97 | Calculated Property |
| Pvap | 894.68 | kPa | 486.46 | Calculated Property |
| Pvap | 2037.91 | kPa | 532.96 | Calculated Property |
| Pvap | 3843.71 | kPa | 579.45 | Calculated Property |
Similar Compounds
Find more compounds similar to 1-Butanol, 3-methyl-.
Mixtures
- 1-Butanol, 3-methyl- + Formic acid + Water
- 1-Butanol, 3-methyl-, propanoate + 1-Butanol, 3-methyl-
- 1-Butanol, 3-methyl- + 1-Butanol + Water
- 1-Butanol, 3-methyl- + Anisole
- 1-Butanol, 3-methyl- + 1-Butanol
- 1-Butanol, 3-methyl- + Acetic acid, butyl ester
- 1-Butanol, 3-methyl- + 1-Hexanol
- Ethanol + 1-Butanol, 3-methyl-
- 1-Butanol, 3-methyl- + Butanedioic acid, diethyl ester
- 1-Butanol, 3-methyl- + Octanoic acid, ethyl ester
- 1-Butanol, 3-methyl- + Heptane
- 1-Butanol, 3-methyl- + Water
- 1-Butanol, 3-methyl- + (1S,2S)-(+)-1,2-Diaminocyclohexane + Water
- 1,3-Dioxolane + 1-Butanol, 3-methyl- + Water
- 1-Butanol, 3-methyl- + Butanoic acid + Water
- 1-Butanol, 3-methyl- + Dimethyl Sulfoxide
- Pentanoic acid, 4-oxo- + 1-Butanol, 3-methyl- + Water
- 1-Butanol, 3-methyl- + Abietic acid
- 1-Butanol, 3-methyl- + Ethyl Acetate
- 1-Butanol, 3-methyl- + 2-Butene, (Z)-
Find more mixtures with 1-Butanol, 3-methyl-.
Sources
- KDB Vapor Pressure Data
- Cheméo Relay (1.0)
- Crippen Method
- Densities, Viscosities, Sound Speeds, Refractive Indices, and Excess Properties of Binary Mixtures of Isoamyl Alcohol with Some Alkoxyethanols
- Viscous synergy and antagonism and isentropic compressibility of ternary mixtures containing 1,3-dioxolane, water and monoalkanols at 303.15K
- Excess volumes and excess enthalpies of N-methyl-2-pyrrolidone with branched alcohols
- Isothermal vapor liquid equilibria for different binary mixtures involved in the alcoholic distillation
- Phase equilibria of (water + levunilic acid + alcohol) ternary systems
- Vapor pressure of selected aliphatic alcohols by ebulliometry. Part 2
- Liquid-liquid equilibrium for the ternary system of 1-butanol + 3-methyl-1-butanol + water at different temperatures
- Vapor liquid equilibrium of the ethanol + 3-methyl-1-butanol system at 50.66, 101.33 and 151.99 kPa
- Vapor-liquid equilibrium of isoamyl alcohol + isoamyl propionate andpropionic acid + isoamyl propionate systems at 50.00, 101.33 and 150.00 kPa
- Measurement and correlation of solid-liquid equilibrium for abietic acid + alcohol systems at atmospheric pressure
- Liquid-liquid equilibrium data for water + formic acid + solvent (butyl acetate, ethyl acetate, and isoamyl alcohol) at T = 291.15 K
- Modeling phase equilibria of ternary systems (water + formic acid + ester or alcohol) through UNIFAC-original, SERLAS, NRTL, NRTL-modified, and three-suffix Margules: Parameter estimation using genetic algorithm
- Isothermal vapor-liquid equilibria, excess molar volume and the deviation of refractive indices for binary mixtures of 1-butanol, 1- hexanol, 3-methyl-1-butanol and butyl acetate
- Determination and correlation of solubility of N-methyl-3,4,5- trinitropyrazole (MTNP) in ten pure solvents from 283.15 K to 323.15 K
- Solubility and dissolution characteristics of capecitabine in pure lower alcohols and water with methanol mixture solvents at atmospheric pressure and different temperatures
- Solubility determination and correlation of cyromazine in sixteen pure solvents and mixing properties of solutions
- Liquid-liquid equilibrium data and thermophysical properties for ternary systems composed of water, acetic acid and different solvents
- (Liquid + liquid) equilibria of (water + butyric acid + isoamyl alcohol) ternary system
- Physico-chemical and excess properties of the binary mixtures of methylcyclohexane + ethanol, + propan-1-ol, + propan-2-ol, + butan-1-ol, + 2-methyl-1-propanol, or 3-methyl-1-butanol at T = (298.15, 303.15, and 308.15) K
- Henry's law constants and infinite dilution activity coefficients of cis-2-butene, dimethylether, chloroethane, and 1,1-difluoroethane in methanol, 1-propanol, 2-propanol, 1-butanol, 2-butanol, isobutanol, tert-butanol, 1-pentanol, 2-pentanol, 3-pentanol, 2-methyl-1-butanol, 3-methyl-1-butanol, and 2-methyl-2-butanol
- Thermodynamic properties of (tetradecane + benzene, + toluene, + chlorobenzene, + bromobenzene, + anisole) binary mixtures at T = (298.15, 303.15, and 308.15) K
- Thermodynamic interactions in binary mixtures of anisole with ethanol, propan-1-ol, propan-2-ol, butan-1-ol, pentan-1-ol, and 3-methylbutan-1-ol at T = (298.15, 303.15, and 308.15) K
- Isobaric (vapour + liquid) equilibrium for N-methyl-2-pyrrolidone with branched alcohols
- Complementary vapor pressure data for 2-methyl-1-propanol and 3-methyl-1-butanol at a pressure range of (15 to 177) kPa
- Measurement and modeling of high-pressure (vapour + liquid) equilibria of (CO2 + alcohol) binary systems
- Tie line data for the (water + butyric acid + n-butyl alcohol or amyl alcohol) at T = (298.2, 308.2, and 318.2) K and (water + butyric acid + isoamyl alcohol) at T = 298.2 K
- Equilibrium surface tension and the interaction energy of DMSO with tert-butyl alcohol or iso-amyl alcohol at various temperatures
- Excess molar enthalpies of the binary systems: (Dibutyl ether + isomers of pentanol) at T = (298.15 and 308.15) K
- Study of intermolecular interactions through dielectric properties of the mixtures consisting of 1,4-butanediol, primary amyl alcohols and 1,4-dioxane at various temperatures
- Solubility determination and thermodynamic modelling of terephthaldialdehyde in ten organic solvents from T = (273.15 to 318.15) K and mixing properties of solutions
- Measurement and modelling of econazole nitrate in twelve pure organic solvents at temperatures from 278.15 K to 318.15 K
- Solubility determination and thermodynamic modelling of 2,4-dihydro-5-methyl-2-(4-methylphenyl)-3H-pyrazol-3-one in twelve organic solvents from T = (278.15 to 313.15) K and mixing properties of solutions
- Volumetric, viscometric, spectral studies and viscosity modelling of binary mixtures of esters and alcohols (diethyl succinate, or ethyl octanoate + isobutanol, or isopentanol) at varying temperatures
- Determination and correlation of terephthaldialdehyde solubility in (ethanol, isopropanol, ethyl acetate, isopentanol) + N,Ndimethylformamide mixed solvents at temperatures from 273.15 K to 318.15 K
- Solubility and thermodynamic properties of vanillyl alcohol in some pure solvents
- Dielectric study of H-bonded interactions in amyl alcohols with ketones and DMSO at T = 298.15 K
- Thermodynamics and activity coefficients at infinite dilution for organic compounds and water in the ionic liquid 1-butyl-3-methylimidazolium perchlorate
- Separation of binary mixtures based on gamma infinity data using [OMMIM][NTf2] ionic liquid and modelling of thermodynamic functions
- Measurement and thermodynamic modelling of ternary liquid-liquid equilibrium for extraction of (1R,2R)-(-)-1,2-Diaminocyclohexane from aqueous solution with C4-C5 alcohols at different temperatures
- Thermodynamics and activity coefficients at infinite dilution for organic compounds in the ionic liquid 1-hexyl-3-methylimidazolium chloride
- Determination of the thermodynamic parameters of ionic liquid 1-propyl-3-methylimidazolium bromide by gas-liquid chromatography
- Mutual diffusion coefficients of 3-methyl-1-butanol + n-heptane and 2-methyl-1-butanol + n-heptane from 288.15 K to 318.15 K
- Solubility and mixing thermodynamic properties of levamisole hydrochloride in twelve pure solvents at various temperatures
- Solution enthalpies of 1-bromoadamantane in monoalcohols at 298.15K
- Solubility of Ethyl p-Aminobenzoate in Six Alcohols within (283.15 to 327.15) K
- Isobaric Vapor Liquid Equilibrium for Two Binary Systems, (3-Methyl-1-butanol + 1,4-Butanediol) and (Hexylene Glycol + 1,4-Butanediol), at p = 40.0, 60.0, and 80.0 kPa
- Effect of Pressure on the Azeotrope of the Mixture Isoamyl Acetate Isoamyl Alcohol at 50.00, 101.32, 250.00, and 350.00 kPa
- Solubility and Thermodynamic Behavior of Veramoss in Different Pure Solvents and {Ethanol + Water} Mixtures from T = 283.15 to 333.15 K
- Isobaric Vapor Liquid Equilibrium for Binary and Ternary Systems of Isoamyl Alcohol + Isoamyl Acetate + Dimethyl Sulfoxide at 101.33 kPa
- Thermodynamic Functions for Solubility of 1-Hydroxybenzotriazole in Sixteen Solvents at Temperatures from (278.15 to 313.15) K and Mixing Property of Mixtures
- Extraction of Citric Acid and Maleic Acid from Their Aqueous Solutions Using a Phosphorus-Bonded Extractant, Tri-n-octylphosphineoxide, and a Secondary Amine, Dioctylamine
- Experimental Binary VLE Data of Morpholine with 1-Butanol and 3-Methyl-1-butanol Systems
- Measurement and Correlation of the Solubility of Florfenicol Form A in Several Pure and Binary Solvents
- Study of the LLE, VLE, and VLLE of the Ternary System Water + 1-Butanol + Isoamyl Alcohol at 101.3 kPa
- Effect of Ethanol and Temperature on Partition Coefficients of Ethyl Acetate, Isoamyl Acetate, and Isoamyl Alcohol: Instrumental and Predictive Investigation
- Solubility Measurement and Phase Equilibrium Modeling of 2-Aminobenzamide in 15 Pure Solvents
- Solubility Determination, Modeling, and Thermodynamic Dissolution Properties of Benzenesulfonamide in 16 Neat Solvents from 273.15 to 324.45 K
- Solubility Measurement and Thermodynamic Modeling for o-Toluenesulfonamide in 16 Solvents from T = 273.15 to 323.85 K
- Solubility of Anthracene in Binary Alcohol + Acetonitrile Solvent Mixtures at 298.2 K
- Solubility in Binary Solvent Mixtures: Pyrene Dissolved in Alcohol + Acetonitrile Mixtures at 299.2 K
- High Pressure Phase Equilibrium of CO2 + 2-Phenylethanol and CO2 + 3-Methyl-1-butanol
- Solubility in Binary Solvent Mixtures: Anthracene Dissolved in Alcohol + 2-Methyl-1-butanol Mixtures at 298.2 K
- Solubility in Binary Solvent Mixtures: Anthracene Dissolved in Alcohol + Carbon Tetrachloride Mixtures at 298.2 K
- Isobaric Vapor - Liquid Equilibria for the Ternary System of 2-Methyl-1-butanol, 3-Methyl-1-butanol, and Ethylene Glycol at 101.3 kPa
- Henry's law constants and infinite dilution activity coefficients of propane, propene, butane, isobutane, 1-butene, isobutene, trans-2-butene, and 1,3-butadiene in 2-methyl-1-butanol, 3-methyl-1-butanol, and 2-methyl-2-butanol
- Partial Molar Heat Capacities and Partial Molar Volumes of All of the Isomeric (C3 to C5) Alkanols at Infinite Dilution in Water at 298.15 K
- Density, Refractive Index, Speed of Sound at 298.15 K, and Vapor-Liquid Equilibria at 101.3 kPa for Binary Mixtures of Propanol + 2-Methyl-1-butanol and Propanol + 3-Methyl-1-butanol
- Density, Viscosity, Excess Molar Volume, and Viscosity Deviation of Three Amyl Alcohols + Ethanol Binary Mixtures from 293.15 to 323.15 K
- Distribution of Butyric Acid between Water and Several Solvents
- Vapor-Liquid Equilibria at 101.3 kPa for Binary Mixtures Containing 2-Methyl-1-propanol + 2-Methyl-1-butanol, 2-Methyl-1-propanol + 3-Methyl-1-butanol, and 2-Methyl-1-propanol + 1-Pentanol
- Activity Coefficients at Infinite Dilution of Polar Solutes in 1-Butyl-3-methylimidazolium Tetrafluoroborate Using Gas-Liquid Chromatography
- Heat Capacities in the Solid and in the Liquid Phase of Isomeric Pentanols
- Liquid Phase Equilibria for Mixtures of (Water + Morpholine + Ethyl Nonanoate, Dimethyl Phthalate, or Isoamyl Alcohol) at 298.15 K
- Solubilities of Ibuprofen in Different Pure Solvents
- Isobaric Vapor Liquid Equilibrium of 3-Methyl-1-butanol + Ethyl Lactate and 1-Pentanol + Ethyl Lactate at (13.0 and 101.3) kPa
- Surface Tensions of Three Amyl Alcohol + Ethanol Binary Mixtures from (293.15 to 323.15) K
- Liquid Liquid Equilibrium for the Ternary System 2-Methyl-1-propanol + 3-Methyl-1-butanol + Water at (298.15, 323.15, and 348.15) K
- Vapor Liquid Equilibrium of Mixtures Containing the Following Higher Alcohols: 2-Propanol, 2-Methyl-1-propanol, and 3-Methyl-1-butanol
- Isobaric Vapor Liquid Equilibria of Binary Systems (Propyl Acetate + n-Pentanol), (Propyl Acetate + 1-Methyl-1-butanol), and (Propyl Acetate + 3-Methyl-1-butanol) at 101.3 kPa
- Determination and Correlation of Solubilities of Lauric Acid in Eight Alcohols
- Volumetric and Viscometric Study of Binary Systems of Ethyl Butyrate with Alcohols
- Solubility of Anthracene in Binary Diisopropyl Ether + Alcohol Solvent Mixtures at 298.15 K
- Refined Flow Microcalorimetric Setup for Measurement of Mixing Enthalpies at High Dilutions: Determination of Infinite Dilution Dissolution Enthalpies of Some Alkanol and Ether Solutes in Water
- Solubility of Anthracene in Binary Propyl Acetate + Alcohol Solvent Mixtures at 298.15 K
- Liquid Liquid Equilibria of the Ternary Systems 3-Methyl-1-butanol + Ethanol + Water and 2-Methyl-1-propanol + Ethanol + Water at 293.15 K
- Activity Coefficients at Infinite Dilution of Polar Solutes in 1-Butyl-3-methylimidazolium Trifluoromethanesulfonate Using Gas Liquid Chromatography
- Activity Coefficients at Infinite Dilution of Polar Solutes in 1-Propyl-2,3-dimethylimidazolium Tetrafluoroborate Using Gas Liquid Chromatography
- Measurement of Infinite Dilution Activity Coefficients of Alcohols, Ketones, and Aromatic Hydrocarbons in 4-Methyl-N-butylpyridinium Tetrafluoroborate and 1-Butyl-3-methylimidazolium Hexafluorophosphate by Gas-Liquid Chromatography
- Isobaric Vapor-Liquid Equilibria for Binary and Ternary Mixtures of Diisopropyl Ether, 2-Propyl Alcohol, and 3-Methyl-1-Butanol
- Solubilities of Dodecanoic and Tetradecanoic Acids in Supercritical CO2 with and without Entrainers
- Solubilities of Hexadecanoic and Octadecanoic Acids in Supercritical CO2 With and Without Cosolvents
- Activity Coefficients at Infinite Dilution of Polar Solutes in 1-(2-Hydroxyethyl)-3-methylimidazolium Tetrafluoroborate Using Gas-Liquid Chromatography
- Solubilities of (?,Z)-2-Amino-?-(methoxyimino)-4-thiazole-ethanethioic Acid S-2-Benzothiazolyl Ester in Pure Solvents and a Mixture of Acetonitrile and Dichloromethane
- Isobaric Vapor-Liquid Equilibrium for Binary Mixtures of 3-Methyl-1-butanol + 3-Methyl-1-butyl Ethanoate and 1-Pentanol + Pentyl Ethanoate at 101.3 kPa
- Isobaric Vapor-Liquid Equilibria for 2-Methyl-butan-1-ol + 3-Methyl-butan-1-ol + CuCl2, ZnCl2, and FeCl3 Systems at 101.3 kPa
- Temperature Dependence of Limiting Activity Coefficients, Henry s Law Constants, and Related Infinite Dilution Properties of Branched Pentanols in Water. Measurement, Critical Compilation, Correlation, and Recommended Data
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
These property values are available through the Cheméo API. A free account gives you an access key.