- Name
- D-cellobiose
- InChI
- InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11-,12+/m0/s1
- InChI Key
- GUBGYTABKSRVRQ-BPUYHBCVSA-N
- Formula
- C12H22O11
- SMILES
-
OCC1OC(OC2C(CO)OC(O)C(O)C2O)C(
O)C(O)C1O - Mol. Weight (g/mol)
- 342.30
- CAS
- 528-50-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (4)
- Apparent molar heat capacity, J/K/mol (2)
- ρl - Mass density, kg/m3 (6)
- csound,fluid - Speed of Sound, m/s (4)
- Apparent molar volume, m3/mol (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0529 | 0.0012 |
| 288.15 | 0.0639 | 0.0012 |
| 288.15 | 0.0903 | 0.0012 |
| 288.15 | 0.1292 | 0.0013 |
| 288.15 | 0.1479 | 0.0013 |
| 288.15 | 0.1603 | 0.0013 |
| 298.15 | 0.0529 | 0.0009 |
| 298.15 | 0.0639 | 0.0009 |
| 298.15 | 0.0903 | 0.0010 |
| 298.15 | 0.1292 | 0.0010 |
| 298.15 | 0.1479 | 0.0010 |
| 298.15 | 0.1603 | 0.0010 |
| 308.15 | 0.0529 | 0.0007 |
| 308.15 | 0.0639 | 0.0008 |
| 308.15 | 0.0903 | 0.0008 |
| 308.15 | 0.1292 | 0.0008 |
| 308.15 | 0.1479 | 0.0008 |
| 308.15 | 0.1603 | 0.0008 |
| 318.15 | 0.0529 | 0.0006 |
| 318.15 | 0.0639 | 0.0006 |
| 318.15 | 0.0903 | 0.0006 |
| 318.15 | 0.1292 | 0.0007 |
| 318.15 | 0.1479 | 0.0007 |
| 318.15 | 0.1603 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0502 | 0.0012 |
| 288.15 | 0.0622 | 0.0012 |
| 288.15 | 0.0723 | 0.0012 |
| 288.15 | 0.0823 | 0.0012 |
| 288.15 | 0.0927 | 0.0012 |
| 288.15 | 0.1031 | 0.0012 |
| 288.15 | 0.1292 | 0.0013 |
| 288.15 | 0.1520 | 0.0013 |
| 298.15 | 0.0502 | 0.0009 |
| 298.15 | 0.0622 | 0.0009 |
| 298.15 | 0.0723 | 0.0009 |
| 298.15 | 0.0823 | 0.0010 |
| 298.15 | 0.0927 | 0.0010 |
| 298.15 | 0.1031 | 0.0010 |
| 298.15 | 0.1292 | 0.0010 |
| 298.15 | 0.1520 | 0.0010 |
| 308.15 | 0.0502 | 0.0007 |
| 308.15 | 0.0622 | 0.0008 |
| 308.15 | 0.0723 | 0.0008 |
| 308.15 | 0.0823 | 0.0008 |
| 308.15 | 0.0927 | 0.0008 |
| 308.15 | 0.1031 | 0.0008 |
| 308.15 | 0.1292 | 0.0008 |
| 308.15 | 0.1520 | 0.0008 |
| 318.15 | 0.0502 | 0.0006 |
| 318.15 | 0.0622 | 0.0006 |
| 318.15 | 0.0723 | 0.0006 |
| 318.15 | 0.0823 | 0.0006 |
| 318.15 | 0.0927 | 0.0006 |
| 318.15 | 0.1031 | 0.0006 |
| 318.15 | 0.1292 | 0.0007 |
| 318.15 | 0.1520 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0529 | 0.0012 |
| 288.15 | 0.0639 | 0.0012 |
| 288.15 | 0.0903 | 0.0012 |
| 288.15 | 0.1292 | 0.0013 |
| 288.15 | 0.1479 | 0.0013 |
| 288.15 | 0.1603 | 0.0013 |
| 298.15 | 0.0529 | 0.0009 |
| 298.15 | 0.0639 | 0.0009 |
| 298.15 | 0.0903 | 0.0010 |
| 298.15 | 0.1292 | 0.0010 |
| 298.15 | 0.1479 | 0.0010 |
| 298.15 | 0.1603 | 0.0010 |
| 308.15 | 0.0529 | 0.0007 |
| 308.15 | 0.0639 | 0.0008 |
| 308.15 | 0.0903 | 0.0008 |
| 308.15 | 0.1292 | 0.0008 |
| 308.15 | 0.1479 | 0.0008 |
| 308.15 | 0.1603 | 0.0008 |
| 318.15 | 0.0529 | 0.0006 |
| 318.15 | 0.0639 | 0.0006 |
| 318.15 | 0.0903 | 0.0006 |
| 318.15 | 0.1292 | 0.0007 |
| 318.15 | 0.1479 | 0.0007 |
| 318.15 | 0.1603 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0502 | 0.0012 |
| 288.15 | 0.0622 | 0.0012 |
| 288.15 | 0.0723 | 0.0012 |
| 288.15 | 0.0823 | 0.0012 |
| 288.15 | 0.0927 | 0.0012 |
| 288.15 | 0.1031 | 0.0012 |
| 288.15 | 0.1292 | 0.0013 |
| 288.15 | 0.1520 | 0.0013 |
| 298.15 | 0.0502 | 0.0009 |
| 298.15 | 0.0622 | 0.0009 |
| 298.15 | 0.0723 | 0.0009 |
| 298.15 | 0.0823 | 0.0010 |
| 298.15 | 0.0927 | 0.0010 |
| 298.15 | 0.1031 | 0.0010 |
| 298.15 | 0.1292 | 0.0010 |
| 298.15 | 0.1520 | 0.0010 |
| 308.15 | 0.0502 | 0.0007 |
| 308.15 | 0.0622 | 0.0008 |
| 308.15 | 0.0723 | 0.0008 |
| 308.15 | 0.0823 | 0.0008 |
| 308.15 | 0.0927 | 0.0008 |
| 308.15 | 0.1031 | 0.0008 |
| 308.15 | 0.1292 | 0.0008 |
| 308.15 | 0.1520 | 0.0008 |
| 318.15 | 0.0502 | 0.0006 |
| 318.15 | 0.0622 | 0.0006 |
| 318.15 | 0.0723 | 0.0006 |
| 318.15 | 0.0823 | 0.0006 |
| 318.15 | 0.0927 | 0.0006 |
| 318.15 | 0.1031 | 0.0006 |
| 318.15 | 0.1292 | 0.0007 |
| 318.15 | 0.1520 | 0.0007 |
Apparent molar heat capacity, J/K/mol [ref]
Operational condition: Pressure, kPa = 350 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
| 278.15 | 0.0322 | 562.9 |
| 278.15 | 0.0517 | 563.0 |
| 278.15 | 0.0799 | 562.0 |
| 278.15 | 0.1000 | 561.2 |
| 278.15 | 0.1501 | 563.0 |
| 278.15 | 0.3084 | 566.4 |
| 283.15 | 0.0322 | 593.0 |
| 283.15 | 0.0517 | 592.8 |
| 283.15 | 0.0799 | 591.5 |
| 283.15 | 0.1000 | 590.9 |
| 283.15 | 0.1501 | 592.0 |
| 283.15 | 0.3084 | 594.5 |
| 288.15 | 0.0322 | 619.4 |
| 288.15 | 0.0517 | 618.8 |
| 288.15 | 0.0799 | 617.3 |
| 288.15 | 0.1000 | 616.9 |
| 288.15 | 0.1501 | 617.5 |
| 288.15 | 0.3084 | 619.6 |
| 293.15 | 0.0322 | 641.7 |
| 293.15 | 0.0517 | 641.1 |
| 293.15 | 0.0799 | 639.4 |
| 293.15 | 0.1000 | 639.2 |
| 293.15 | 0.1501 | 639.5 |
| 293.15 | 0.3084 | 641.1 |
| 298.15 | 0.0322 | 661.3 |
| 298.15 | 0.0517 | 660.7 |
| 298.15 | 0.0799 | 658.6 |
| 298.15 | 0.1000 | 658.8 |
| 298.15 | 0.1501 | 658.7 |
| 298.15 | 0.3084 | 660.1 |
| 303.15 | 0.0322 | 678.3 |
| 303.15 | 0.0517 | 677.8 |
| 303.15 | 0.0799 | 675.4 |
| 303.15 | 0.1000 | 676.2 |
| 303.15 | 0.1501 | 675.7 |
| 303.15 | 0.3084 | 676.9 |
| 308.15 | 0.0322 | 693.2 |
| 308.15 | 0.0517 | 692.9 |
| 308.15 | 0.0799 | 690.6 |
| 308.15 | 0.1000 | 691.5 |
| 308.15 | 0.1501 | 690.9 |
| 308.15 | 0.3084 | 691.8 |
| 313.15 | 0.0322 | 706.5 |
| 313.15 | 0.0517 | 706.5 |
| 313.15 | 0.0799 | 704.1 |
| 313.15 | 0.1000 | 705.0 |
| 313.15 | 0.1501 | 704.3 |
| 313.15 | 0.3084 | 705.1 |
| 318.15 | 0.0322 | 718.8 |
| 318.15 | 0.0517 | 718.9 |
| 318.15 | 0.0799 | 716.6 |
| 318.15 | 0.1000 | 717.5 |
| 318.15 | 0.1501 | 716.7 |
| 318.15 | 0.3084 | 717.3 |
| 323.15 | 0.0322 | 730.0 |
| 323.15 | 0.0517 | 730.1 |
| 323.15 | 0.0799 | 728.0 |
| 323.15 | 0.1000 | 728.9 |
| 323.15 | 0.1501 | 728.1 |
| 323.15 | 0.3084 | 728.5 |
| 328.15 | 0.0322 | 740.4 |
| 328.15 | 0.0517 | 740.7 |
| 328.15 | 0.0799 | 738.6 |
| 328.15 | 0.1000 | 739.5 |
| 328.15 | 0.1501 | 738.7 |
| 328.15 | 0.3084 | 739.0 |
| 333.15 | 0.0322 | 750.3 |
| 333.15 | 0.0517 | 750.6 |
| 333.15 | 0.0799 | 748.6 |
| 333.15 | 0.1000 | 749.5 |
| 333.15 | 0.1501 | 748.7 |
| 333.15 | 0.3084 | 748.9 |
| 338.15 | 0.0322 | 759.6 |
| 338.15 | 0.0517 | 759.9 |
| 338.15 | 0.0799 | 758.0 |
| 338.15 | 0.1000 | 758.9 |
| 338.15 | 0.1501 | 758.1 |
| 338.15 | 0.3084 | 758.3 |
| 343.15 | 0.0322 | 768.2 |
| 343.15 | 0.0517 | 768.6 |
| 343.15 | 0.0799 | 766.7 |
| 343.15 | 0.1000 | 767.6 |
| 343.15 | 0.1501 | 766.7 |
| 343.15 | 0.3084 | 766.9 |
| 348.15 | 0.0322 | 776.4 |
| 348.15 | 0.0517 | 776.6 |
| 348.15 | 0.0799 | 774.8 |
| 348.15 | 0.1000 | 775.8 |
| 348.15 | 0.1501 | 774.9 |
| 348.15 | 0.3084 | 775.0 |
| 353.15 | 0.0322 | 783.8 |
| 353.15 | 0.0517 | 784.2 |
| 353.15 | 0.0799 | 782.5 |
| 353.15 | 0.1000 | 783.5 |
| 353.15 | 0.1501 | 782.6 |
| 353.15 | 0.3084 | 782.7 |
| 358.15 | 0.0322 | 791.1 |
| 358.15 | 0.0517 | 791.5 |
| 358.15 | 0.0799 | 789.8 |
| 358.15 | 0.1000 | 790.8 |
| 358.15 | 0.1501 | 789.9 |
| 358.15 | 0.3084 | 789.9 |
| 363.15 | 0.0322 | 797.8 |
| 363.15 | 0.0517 | 798.3 |
| 363.15 | 0.0799 | 796.7 |
| 363.15 | 0.1000 | 797.8 |
| 363.15 | 0.1501 | 796.8 |
| 363.15 | 0.3084 | 796.8 |
| 368.15 | 0.0322 | 803.8 |
| 368.15 | 0.0517 | 804.6 |
| 368.15 | 0.0799 | 803.0 |
| 368.15 | 0.1000 | 804.1 |
| 368.15 | 0.1501 | 803.1 |
| 368.15 | 0.3084 | 803.1 |
| 373.15 | 0.0322 | 809.8 |
| 373.15 | 0.0517 | 810.7 |
| 373.15 | 0.0799 | 809.0 |
| 373.15 | 0.1000 | 810.1 |
| 373.15 | 0.1501 | 809.2 |
| 373.15 | 0.3084 | 809.1 |
| 378.15 | 0.0322 | 815.0 |
| 378.15 | 0.0517 | 816.2 |
| 378.15 | 0.0799 | 814.6 |
| 378.15 | 0.1000 | 815.8 |
| 378.15 | 0.1501 | 814.7 |
| 378.15 | 0.3084 | 814.7 |
| 383.15 | 0.0322 | 819.8 |
| 383.15 | 0.0517 | 821.3 |
| 383.15 | 0.0799 | 819.7 |
| 383.15 | 0.1000 | 821.4 |
| 383.15 | 0.1501 | 820.0 |
| 383.15 | 0.3084 | 819.9 |
| 388.15 | 0.0322 | 823.0 |
| 388.15 | 0.0517 | 825.3 |
| 388.15 | 0.0799 | 824.1 |
| 388.15 | 0.1000 | 827.6 |
| 388.15 | 0.1501 | 824.9 |
| 388.15 | 0.3084 | 824.8 |
| 393.15 | 0.0322 | 826.1 |
| 393.15 | 0.0517 | 828.7 |
| 393.15 | 0.0799 | 827.9 |
| 393.15 | 0.1000 | 833.0 |
| 393.15 | 0.1501 | 829.1 |
| 393.15 | 0.3084 | 829.2 |
Apparent molar heat capacity, J/K/mol [ref]
Operational condition: Pressure, kPa = 350 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
| 278.15 | 0.0322 | 562.9 |
| 278.15 | 0.0517 | 563.0 |
| 278.15 | 0.0799 | 562.0 |
| 278.15 | 0.1000 | 561.2 |
| 278.15 | 0.1501 | 563.0 |
| 278.15 | 0.3084 | 566.4 |
| 283.15 | 0.0322 | 593.0 |
| 283.15 | 0.0517 | 592.8 |
| 283.15 | 0.0799 | 591.5 |
| 283.15 | 0.1000 | 590.9 |
| 283.15 | 0.1501 | 592.0 |
| 283.15 | 0.3084 | 594.5 |
| 288.15 | 0.0322 | 619.4 |
| 288.15 | 0.0517 | 618.8 |
| 288.15 | 0.0799 | 617.3 |
| 288.15 | 0.1000 | 616.9 |
| 288.15 | 0.1501 | 617.5 |
| 288.15 | 0.3084 | 619.6 |
| 293.15 | 0.0322 | 641.7 |
| 293.15 | 0.0517 | 641.1 |
| 293.15 | 0.0799 | 639.4 |
| 293.15 | 0.1000 | 639.2 |
| 293.15 | 0.1501 | 639.5 |
| 293.15 | 0.3084 | 641.1 |
| 298.15 | 0.0322 | 661.3 |
| 298.15 | 0.0517 | 660.7 |
| 298.15 | 0.0799 | 658.6 |
| 298.15 | 0.1000 | 658.8 |
| 298.15 | 0.1501 | 658.7 |
| 298.15 | 0.3084 | 660.1 |
| 303.15 | 0.0322 | 678.3 |
| 303.15 | 0.0517 | 677.8 |
| 303.15 | 0.0799 | 675.4 |
| 303.15 | 0.1000 | 676.2 |
| 303.15 | 0.1501 | 675.7 |
| 303.15 | 0.3084 | 676.9 |
| 308.15 | 0.0322 | 693.2 |
| 308.15 | 0.0517 | 692.9 |
| 308.15 | 0.0799 | 690.6 |
| 308.15 | 0.1000 | 691.5 |
| 308.15 | 0.1501 | 690.9 |
| 308.15 | 0.3084 | 691.8 |
| 313.15 | 0.0322 | 706.5 |
| 313.15 | 0.0517 | 706.5 |
| 313.15 | 0.0799 | 704.1 |
| 313.15 | 0.1000 | 705.0 |
| 313.15 | 0.1501 | 704.3 |
| 313.15 | 0.3084 | 705.1 |
| 318.15 | 0.0322 | 718.8 |
| 318.15 | 0.0517 | 718.9 |
| 318.15 | 0.0799 | 716.6 |
| 318.15 | 0.1000 | 717.5 |
| 318.15 | 0.1501 | 716.7 |
| 318.15 | 0.3084 | 717.3 |
| 323.15 | 0.0322 | 730.0 |
| 323.15 | 0.0517 | 730.1 |
| 323.15 | 0.0799 | 728.0 |
| 323.15 | 0.1000 | 728.9 |
| 323.15 | 0.1501 | 728.1 |
| 323.15 | 0.3084 | 728.5 |
| 328.15 | 0.0322 | 740.4 |
| 328.15 | 0.0517 | 740.7 |
| 328.15 | 0.0799 | 738.6 |
| 328.15 | 0.1000 | 739.5 |
| 328.15 | 0.1501 | 738.7 |
| 328.15 | 0.3084 | 739.0 |
| 333.15 | 0.0322 | 750.3 |
| 333.15 | 0.0517 | 750.6 |
| 333.15 | 0.0799 | 748.6 |
| 333.15 | 0.1000 | 749.5 |
| 333.15 | 0.1501 | 748.7 |
| 333.15 | 0.3084 | 748.9 |
| 338.15 | 0.0322 | 759.6 |
| 338.15 | 0.0517 | 759.9 |
| 338.15 | 0.0799 | 758.0 |
| 338.15 | 0.1000 | 758.9 |
| 338.15 | 0.1501 | 758.1 |
| 338.15 | 0.3084 | 758.3 |
| 343.15 | 0.0322 | 768.2 |
| 343.15 | 0.0517 | 768.6 |
| 343.15 | 0.0799 | 766.7 |
| 343.15 | 0.1000 | 767.6 |
| 343.15 | 0.1501 | 766.7 |
| 343.15 | 0.3084 | 766.9 |
| 348.15 | 0.0322 | 776.4 |
| 348.15 | 0.0517 | 776.6 |
| 348.15 | 0.0799 | 774.8 |
| 348.15 | 0.1000 | 775.8 |
| 348.15 | 0.1501 | 774.9 |
| 348.15 | 0.3084 | 775.0 |
| 353.15 | 0.0322 | 783.8 |
| 353.15 | 0.0517 | 784.2 |
| 353.15 | 0.0799 | 782.5 |
| 353.15 | 0.1000 | 783.5 |
| 353.15 | 0.1501 | 782.6 |
| 353.15 | 0.3084 | 782.7 |
| 358.15 | 0.0322 | 791.1 |
| 358.15 | 0.0517 | 791.5 |
| 358.15 | 0.0799 | 789.8 |
| 358.15 | 0.1000 | 790.8 |
| 358.15 | 0.1501 | 789.9 |
| 358.15 | 0.3084 | 789.9 |
| 363.15 | 0.0322 | 797.8 |
| 363.15 | 0.0517 | 798.3 |
| 363.15 | 0.0799 | 796.7 |
| 363.15 | 0.1000 | 797.8 |
| 363.15 | 0.1501 | 796.8 |
| 363.15 | 0.3084 | 796.8 |
| 368.15 | 0.0322 | 803.8 |
| 368.15 | 0.0517 | 804.6 |
| 368.15 | 0.0799 | 803.0 |
| 368.15 | 0.1000 | 804.1 |
| 368.15 | 0.1501 | 803.1 |
| 368.15 | 0.3084 | 803.1 |
| 373.15 | 0.0322 | 809.8 |
| 373.15 | 0.0517 | 810.7 |
| 373.15 | 0.0799 | 809.0 |
| 373.15 | 0.1000 | 810.1 |
| 373.15 | 0.1501 | 809.2 |
| 373.15 | 0.3084 | 809.1 |
| 378.15 | 0.0322 | 815.0 |
| 378.15 | 0.0517 | 816.2 |
| 378.15 | 0.0799 | 814.6 |
| 378.15 | 0.1000 | 815.8 |
| 378.15 | 0.1501 | 814.7 |
| 378.15 | 0.3084 | 814.7 |
| 383.15 | 0.0322 | 819.8 |
| 383.15 | 0.0517 | 821.3 |
| 383.15 | 0.0799 | 819.7 |
| 383.15 | 0.1000 | 821.4 |
| 383.15 | 0.1501 | 820.0 |
| 383.15 | 0.3084 | 819.9 |
| 388.15 | 0.0322 | 823.0 |
| 388.15 | 0.0517 | 825.3 |
| 388.15 | 0.0799 | 824.1 |
| 388.15 | 0.1000 | 827.6 |
| 388.15 | 0.1501 | 824.9 |
| 388.15 | 0.3084 | 824.8 |
| 393.15 | 0.0322 | 826.1 |
| 393.15 | 0.0517 | 828.7 |
| 393.15 | 0.0799 | 827.9 |
| 393.15 | 0.1000 | 833.0 |
| 393.15 | 0.1501 | 829.1 |
| 393.15 | 0.3084 | 829.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0504 | 1005.71 |
| 288.15 | 0.0824 | 1009.777 |
| 288.15 | 0.1039 | 1012.491 |
| 288.15 | 0.2052 | 1024.827 |
| 298.15 | 0.0499 | 1003.512 |
| 298.15 | 0.0692 | 1005.962 |
| 298.15 | 0.1280 | 1013.311 |
| 298.15 | 0.2006 | 1022.053 |
| 308.15 | 0.0500 | 1000.475 |
| 308.15 | 0.0674 | 1002.697 |
| 308.15 | 0.0882 | 1005.318 |
| 308.15 | 0.0999 | 1006.777 |
| 318.15 | 0.0500 | 996.647 |
| 318.15 | 0.0674 | 998.856 |
| 318.15 | 0.0882 | 1001.46 |
| 318.15 | 0.0999 | 1002.91 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0982 | 1011.187 |
| 298.15 | 0.0982 | 1009.944 |
| 303.15 | 0.0982 | 1008.473 |
| 308.15 | 0.0982 | 1006.794 |
| 293.15 | 0.1003 | 1011.123 |
| 298.15 | 0.1003 | 1009.878 |
| 303.15 | 0.1003 | 1008.405 |
| 308.15 | 0.1003 | 1006.725 |
| 293.15 | 0.1006 | 1011.139 |
| 298.15 | 0.1006 | 1009.895 |
| 303.15 | 0.1006 | 1008.424 |
| 308.15 | 0.1006 | 1006.744 |
| 293.15 | 0.0998 | 1011.065 |
| 298.15 | 0.0998 | 1009.822 |
| 303.15 | 0.0998 | 1008.35 |
| 308.15 | 0.0998 | 1006.669 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0457 | 1005.093 |
| 288.15 | 0.0722 | 1008.495 |
| 288.15 | 0.0809 | 1009.611 |
| 288.15 | 0.1005 | 1012.083 |
| 288.15 | 0.1191 | 1014.407 |
| 288.15 | 0.1400 | 1016.995 |
| 298.15 | 0.0457 | 1002.978 |
| 298.15 | 0.0722 | 1006.365 |
| 298.15 | 0.0809 | 1007.477 |
| 298.15 | 0.1005 | 1009.94 |
| 298.15 | 0.1191 | 1012.259 |
| 298.15 | 0.1400 | 1014.841 |
| 308.15 | 0.0457 | 999.945 |
| 308.15 | 0.0722 | 1003.299 |
| 308.15 | 0.0809 | 1004.399 |
| 308.15 | 0.1005 | 1006.834 |
| 308.15 | 0.1191 | 1009.13 |
| 308.15 | 0.1400 | 1011.68 |
| 318.15 | 0.0457 | 996.094 |
| 318.15 | 0.0722 | 999.428 |
| 318.15 | 0.0809 | 1000.522 |
| 318.15 | 0.1005 | 1002.942 |
| 318.15 | 0.1191 | 1005.221 |
| 318.15 | 0.1400 | 1007.752 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0504 | 1005.71 |
| 288.15 | 0.0824 | 1009.777 |
| 288.15 | 0.1039 | 1012.491 |
| 288.15 | 0.2052 | 1024.827 |
| 298.15 | 0.0499 | 1003.512 |
| 298.15 | 0.0692 | 1005.962 |
| 298.15 | 0.1280 | 1013.311 |
| 298.15 | 0.2006 | 1022.053 |
| 308.15 | 0.0500 | 1000.475 |
| 308.15 | 0.0674 | 1002.697 |
| 308.15 | 0.0882 | 1005.318 |
| 308.15 | 0.0999 | 1006.777 |
| 318.15 | 0.0500 | 996.647 |
| 318.15 | 0.0674 | 998.856 |
| 318.15 | 0.0882 | 1001.46 |
| 318.15 | 0.0999 | 1002.91 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0982 | 1011.187 |
| 298.15 | 0.0982 | 1009.944 |
| 303.15 | 0.0982 | 1008.473 |
| 308.15 | 0.0982 | 1006.794 |
| 293.15 | 0.1003 | 1011.123 |
| 298.15 | 0.1003 | 1009.878 |
| 303.15 | 0.1003 | 1008.405 |
| 308.15 | 0.1003 | 1006.725 |
| 293.15 | 0.1006 | 1011.139 |
| 298.15 | 0.1006 | 1009.895 |
| 303.15 | 0.1006 | 1008.424 |
| 308.15 | 0.1006 | 1006.744 |
| 293.15 | 0.0998 | 1011.065 |
| 298.15 | 0.0998 | 1009.822 |
| 303.15 | 0.0998 | 1008.35 |
| 308.15 | 0.0998 | 1006.669 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0457 | 1005.093 |
| 288.15 | 0.0722 | 1008.495 |
| 288.15 | 0.0809 | 1009.611 |
| 288.15 | 0.1005 | 1012.083 |
| 288.15 | 0.1191 | 1014.407 |
| 288.15 | 0.1400 | 1016.995 |
| 298.15 | 0.0457 | 1002.978 |
| 298.15 | 0.0722 | 1006.365 |
| 298.15 | 0.0809 | 1007.477 |
| 298.15 | 0.1005 | 1009.94 |
| 298.15 | 0.1191 | 1012.259 |
| 298.15 | 0.1400 | 1014.841 |
| 308.15 | 0.0457 | 999.945 |
| 308.15 | 0.0722 | 1003.299 |
| 308.15 | 0.0809 | 1004.399 |
| 308.15 | 0.1005 | 1006.834 |
| 308.15 | 0.1191 | 1009.13 |
| 308.15 | 0.1400 | 1011.68 |
| 318.15 | 0.0457 | 996.094 |
| 318.15 | 0.0722 | 999.428 |
| 318.15 | 0.0809 | 1000.522 |
| 318.15 | 0.1005 | 1002.942 |
| 318.15 | 0.1191 | 1005.221 |
| 318.15 | 0.1400 | 1007.752 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0982 | 1493.51 |
| 298.15 | 0.0982 | 1507.16 |
| 303.15 | 0.0982 | 1518.87 |
| 308.15 | 0.0982 | 1528.78 |
| 293.15 | 0.1003 | 1495.34 |
| 298.15 | 0.1003 | 1508.91 |
| 303.15 | 0.1003 | 1520.18 |
| 308.15 | 0.1003 | 1529.29 |
| 293.15 | 0.1006 | 1493.85 |
| 298.15 | 0.1006 | 1507.64 |
| 303.15 | 0.1006 | 1519.49 |
| 308.15 | 0.1006 | 1529.54 |
| 293.15 | 0.0998 | 1495.24 |
| 298.15 | 0.0998 | 1508.89 |
| 303.15 | 0.0998 | 1520.78 |
| 308.15 | 0.0998 | 1530.87 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Speed of sound, m/s - Liquid |
| 318.15 | 0.0457 | 1540.19 |
| 288.15 | 0.0457 | 1470.63 |
| 298.15 | 0.0457 | 1500.93 |
| 308.15 | 0.0457 | 1525.1 |
| 298.15 | 0.0722 | 1503.68 |
| 318.15 | 0.0722 | 1542.63 |
| 288.15 | 0.0722 | 1473.62 |
| 308.15 | 0.0722 | 1527.68 |
| 298.15 | 0.0809 | 1504.59 |
| 318.15 | 0.0809 | 1543.44 |
| 288.15 | 0.0809 | 1474.62 |
| 308.15 | 0.0809 | 1528.54 |
| 288.15 | 0.1005 | 1476.85 |
| 298.15 | 0.1005 | 1506.63 |
| 318.15 | 0.1005 | 1545.26 |
| 308.15 | 0.1005 | 1530.47 |
| 298.15 | 0.1191 | 1508.59 |
| 288.15 | 0.1191 | 1478.98 |
| 318.15 | 0.1191 | 1547.0 |
| 308.15 | 0.1191 | 1532.31 |
| 318.15 | 0.1400 | 1548.98 |
| 288.15 | 0.1400 | 1481.4 |
| 298.15 | 0.1400 | 1510.8 |
| 308.15 | 0.1400 | 1534.38 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0982 | 1493.51 |
| 298.15 | 0.0982 | 1507.16 |
| 303.15 | 0.0982 | 1518.87 |
| 308.15 | 0.0982 | 1528.78 |
| 293.15 | 0.1003 | 1495.34 |
| 298.15 | 0.1003 | 1508.91 |
| 303.15 | 0.1003 | 1520.18 |
| 308.15 | 0.1003 | 1529.29 |
| 293.15 | 0.1006 | 1493.85 |
| 298.15 | 0.1006 | 1507.64 |
| 303.15 | 0.1006 | 1519.49 |
| 308.15 | 0.1006 | 1529.54 |
| 293.15 | 0.0998 | 1495.24 |
| 298.15 | 0.0998 | 1508.89 |
| 303.15 | 0.0998 | 1520.78 |
| 308.15 | 0.0998 | 1530.87 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Speed of sound, m/s - Liquid |
| 318.15 | 0.0457 | 1540.19 |
| 288.15 | 0.0457 | 1470.63 |
| 298.15 | 0.0457 | 1500.93 |
| 308.15 | 0.0457 | 1525.1 |
| 298.15 | 0.0722 | 1503.68 |
| 318.15 | 0.0722 | 1542.63 |
| 288.15 | 0.0722 | 1473.62 |
| 308.15 | 0.0722 | 1527.68 |
| 298.15 | 0.0809 | 1504.59 |
| 318.15 | 0.0809 | 1543.44 |
| 288.15 | 0.0809 | 1474.62 |
| 308.15 | 0.0809 | 1528.54 |
| 288.15 | 0.1005 | 1476.85 |
| 298.15 | 0.1005 | 1506.63 |
| 318.15 | 0.1005 | 1545.26 |
| 308.15 | 0.1005 | 1530.47 |
| 298.15 | 0.1191 | 1508.59 |
| 288.15 | 0.1191 | 1478.98 |
| 318.15 | 0.1191 | 1547.0 |
| 308.15 | 0.1191 | 1532.31 |
| 318.15 | 0.1400 | 1548.98 |
| 288.15 | 0.1400 | 1481.4 |
| 298.15 | 0.1400 | 1510.8 |
| 308.15 | 0.1400 | 1534.38 |
Apparent molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 350 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Apparent molar volume, m3/mol - Liquid |
| 278.15 | 0.0322 | 0.0002 |
| 278.15 | 0.0517 | 0.0002 |
| 278.15 | 0.0799 | 0.0002 |
| 278.15 | 0.1000 | 0.0002 |
| 278.15 | 0.1501 | 0.0002 |
| 278.15 | 0.2015 | 0.0002 |
| 278.15 | 0.3084 | 0.0002 |
| 283.15 | 0.0322 | 0.0002 |
| 283.15 | 0.0517 | 0.0002 |
| 283.15 | 0.0799 | 0.0002 |
| 283.15 | 0.1000 | 0.0002 |
| 283.15 | 0.1501 | 0.0002 |
| 283.15 | 0.2015 | 0.0002 |
| 283.15 | 0.3084 | 0.0002 |
| 288.15 | 0.0322 | 0.0002 |
| 288.15 | 0.0517 | 0.0002 |
| 288.15 | 0.0799 | 0.0002 |
| 288.15 | 0.1000 | 0.0002 |
| 288.15 | 0.1501 | 0.0002 |
| 288.15 | 0.2015 | 0.0002 |
| 288.15 | 0.3084 | 0.0002 |
| 298.15 | 0.0322 | 0.0002 |
| 298.15 | 0.0517 | 0.0002 |
| 298.15 | 0.0799 | 0.0002 |
| 298.15 | 0.1000 | 0.0002 |
| 298.15 | 0.1501 | 0.0002 |
| 298.15 | 0.2015 | 0.0002 |
| 298.15 | 0.3084 | 0.0002 |
| 308.15 | 0.0322 | 0.0002 |
| 308.15 | 0.0517 | 0.0002 |
| 308.15 | 0.0799 | 0.0002 |
| 308.15 | 0.1000 | 0.0002 |
| 308.15 | 0.1501 | 0.0002 |
| 308.15 | 0.2015 | 0.0002 |
| 308.15 | 0.3084 | 0.0002 |
| 318.15 | 0.0322 | 0.0002 |
| 318.15 | 0.0517 | 0.0002 |
| 318.15 | 0.0799 | 0.0002 |
| 318.15 | 0.1000 | 0.0002 |
| 318.15 | 0.1501 | 0.0002 |
| 318.15 | 0.2015 | 0.0002 |
| 318.15 | 0.3084 | 0.0002 |
| 328.15 | 0.0322 | 0.0002 |
| 328.15 | 0.0517 | 0.0002 |
| 328.15 | 0.0799 | 0.0002 |
| 328.15 | 0.1000 | 0.0002 |
| 328.15 | 0.1501 | 0.0002 |
| 328.15 | 0.2015 | 0.0002 |
| 328.15 | 0.3084 | 0.0002 |
| 338.15 | 0.0322 | 0.0002 |
| 338.15 | 0.0517 | 0.0002 |
| 338.15 | 0.0799 | 0.0002 |
| 338.15 | 0.1000 | 0.0002 |
| 338.15 | 0.1501 | 0.0002 |
| 338.15 | 0.2015 | 0.0002 |
| 338.15 | 0.3084 | 0.0002 |
| 348.15 | 0.0322 | 0.0002 |
| 348.15 | 0.0517 | 0.0002 |
| 348.15 | 0.0799 | 0.0002 |
| 348.15 | 0.1000 | 0.0002 |
| 348.15 | 0.1501 | 0.0002 |
| 348.15 | 0.2015 | 0.0002 |
| 348.15 | 0.3084 | 0.0002 |
| 358.15 | 0.0322 | 0.0002 |
| 358.15 | 0.0517 | 0.0002 |
| 358.15 | 0.0799 | 0.0002 |
| 358.15 | 0.1000 | 0.0002 |
| 358.15 | 0.1501 | 0.0002 |
| 358.15 | 0.2015 | 0.0002 |
| 358.15 | 0.3084 | 0.0002 |
| 368.15 | 0.0322 | 0.0002 |
| 368.15 | 0.0517 | 0.0002 |
| 368.15 | 0.0799 | 0.0002 |
| 368.15 | 0.1000 | 0.0002 |
| 368.15 | 0.1501 | 0.0002 |
| 368.15 | 0.2015 | 0.0002 |
| 368.15 | 0.3084 | 0.0002 |
Apparent molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 350 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-cellobiose (1) - Liquid | Apparent molar volume, m3/mol - Liquid |
| 278.15 | 0.0322 | 0.0002 |
| 278.15 | 0.0517 | 0.0002 |
| 278.15 | 0.0799 | 0.0002 |
| 278.15 | 0.1000 | 0.0002 |
| 278.15 | 0.1501 | 0.0002 |
| 278.15 | 0.2015 | 0.0002 |
| 278.15 | 0.3084 | 0.0002 |
| 283.15 | 0.0322 | 0.0002 |
| 283.15 | 0.0517 | 0.0002 |
| 283.15 | 0.0799 | 0.0002 |
| 283.15 | 0.1000 | 0.0002 |
| 283.15 | 0.1501 | 0.0002 |
| 283.15 | 0.2015 | 0.0002 |
| 283.15 | 0.3084 | 0.0002 |
| 288.15 | 0.0322 | 0.0002 |
| 288.15 | 0.0517 | 0.0002 |
| 288.15 | 0.0799 | 0.0002 |
| 288.15 | 0.1000 | 0.0002 |
| 288.15 | 0.1501 | 0.0002 |
| 288.15 | 0.2015 | 0.0002 |
| 288.15 | 0.3084 | 0.0002 |
| 298.15 | 0.0322 | 0.0002 |
| 298.15 | 0.0517 | 0.0002 |
| 298.15 | 0.0799 | 0.0002 |
| 298.15 | 0.1000 | 0.0002 |
| 298.15 | 0.1501 | 0.0002 |
| 298.15 | 0.2015 | 0.0002 |
| 298.15 | 0.3084 | 0.0002 |
| 308.15 | 0.0322 | 0.0002 |
| 308.15 | 0.0517 | 0.0002 |
| 308.15 | 0.0799 | 0.0002 |
| 308.15 | 0.1000 | 0.0002 |
| 308.15 | 0.1501 | 0.0002 |
| 308.15 | 0.2015 | 0.0002 |
| 308.15 | 0.3084 | 0.0002 |
| 318.15 | 0.0322 | 0.0002 |
| 318.15 | 0.0517 | 0.0002 |
| 318.15 | 0.0799 | 0.0002 |
| 318.15 | 0.1000 | 0.0002 |
| 318.15 | 0.1501 | 0.0002 |
| 318.15 | 0.2015 | 0.0002 |
| 318.15 | 0.3084 | 0.0002 |
| 328.15 | 0.0322 | 0.0002 |
| 328.15 | 0.0517 | 0.0002 |
| 328.15 | 0.0799 | 0.0002 |
| 328.15 | 0.1000 | 0.0002 |
| 328.15 | 0.1501 | 0.0002 |
| 328.15 | 0.2015 | 0.0002 |
| 328.15 | 0.3084 | 0.0002 |
| 338.15 | 0.0322 | 0.0002 |
| 338.15 | 0.0517 | 0.0002 |
| 338.15 | 0.0799 | 0.0002 |
| 338.15 | 0.1000 | 0.0002 |
| 338.15 | 0.1501 | 0.0002 |
| 338.15 | 0.2015 | 0.0002 |
| 338.15 | 0.3084 | 0.0002 |
| 348.15 | 0.0322 | 0.0002 |
| 348.15 | 0.0517 | 0.0002 |
| 348.15 | 0.0799 | 0.0002 |
| 348.15 | 0.1000 | 0.0002 |
| 348.15 | 0.1501 | 0.0002 |
| 348.15 | 0.2015 | 0.0002 |
| 348.15 | 0.3084 | 0.0002 |
| 358.15 | 0.0322 | 0.0002 |
| 358.15 | 0.0517 | 0.0002 |
| 358.15 | 0.0799 | 0.0002 |
| 358.15 | 0.1000 | 0.0002 |
| 358.15 | 0.1501 | 0.0002 |
| 358.15 | 0.2015 | 0.0002 |
| 358.15 | 0.3084 | 0.0002 |
| 368.15 | 0.0322 | 0.0002 |
| 368.15 | 0.0517 | 0.0002 |
| 368.15 | 0.0799 | 0.0002 |
| 368.15 | 0.1000 | 0.0002 |
| 368.15 | 0.1501 | 0.0002 |
| 368.15 | 0.2015 | 0.0002 |
| 368.15 | 0.3084 | 0.0002 |
Sources
- Apparent molar volumes and apparent molar heat capacities of aqueous D(+)-cellobiose, D(+)-maltose, and sucrose at temperatures from 278.15 K to 393.15 K and at the pressure 0.35 MPa
- Studies on volumetric properties of some saccharides in aqueous potassium chloride solutions over temperature range (288.15 to 318.15) K
- Rheological and time domain 1H NMR relaxation studies of some polyhydroxy solutes in presence of L-glycine
- Viscosities of Some Saccharides in Aqueous Solutions of Phosphate-Based Inorganic Salts
- Thermodynamic Study of Some Amino Acids, 2-Aminopropanoic Acid, 2-Amino-3-methylbutanoic Acid, 2-Amino-4-methylpentanoic Acid, and 2-Amino-3-phenylpropanoic Acid in Aqueous Saccharide Solutions at Different Temperatures: Volumetric and Ultrasonic Study
- Volumetric Properties of Disaccharides in Aqueous Solutions of Benzyldimethylammonium Acetate as a Function of Temperature