- Name
- Methyl propionate
- InChI
- InChI=1S/C4H8O2/c1-3-4(5)6-2/h3H2,1-2H3
- InChI Key
- RJUFJBKOKNCXHH-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCC(=O)OC
- Mol. Weight (g/mol)
- 88.11
- CAS
- 554-12-1
- Name
- Methyl Alcohol
- InChI
- InChI=1S/CH4O/c1-2/h2H,1H3
- InChI Key
- OKKJLVBELUTLKV-UHFFFAOYSA-N
- Formula
- CH4O
- SMILES
- CO
- Mol. Weight (g/mol)
- 32.04
- CAS
- 67-56-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Pvap - Vapor or sublimation pressure, kPa (2)
- Tboil - Boiling temperature at pressure P, K (2)
Mole fraction of Methyl Alcohol (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Methyl Alcohol (2) - Liquid | Mole fraction of Methyl Alcohol (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0450 | 0.1600 |
| 0.0960 | 0.2910 |
| 0.1900 | 0.4300 |
| 0.2900 | 0.5190 |
| 0.3950 | 0.5830 |
| 0.5000 | 0.6330 |
| 0.6050 | 0.6780 |
| 0.7110 | 0.7280 |
| 0.8140 | 0.7890 |
| 0.9150 | 0.8770 |
| 0.9660 | 0.9390 |
| 1.0000 | 1.0000 |
Mole fraction of Methyl Alcohol (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Methyl Alcohol (2) - Liquid | Mole fraction of Methyl Alcohol (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0450 | 0.1600 |
| 0.0960 | 0.2910 |
| 0.1900 | 0.4300 |
| 0.2900 | 0.5190 |
| 0.3950 | 0.5830 |
| 0.5000 | 0.6330 |
| 0.6050 | 0.6780 |
| 0.7110 | 0.7280 |
| 0.8140 | 0.7890 |
| 0.9150 | 0.8770 |
| 0.9660 | 0.9390 |
| 1.0000 | 1.0000 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Alcohol (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 402.94 | 0.0000 | 437.00 |
| 408.11 | 0.0000 | 495.00 |
| 413.27 | 0.0000 | 555.00 |
| 418.68 | 0.0000 | 628.00 |
| 423.61 | 0.0000 | 698.00 |
| 433.97 | 0.0000 | 863.00 |
| 444.51 | 0.0000 | 1064.00 |
| 392.62 | 0.1648 | 457.00 |
| 397.61 | 0.1648 | 517.00 |
| 402.75 | 0.1648 | 585.00 |
| 413.19 | 0.1648 | 740.00 |
| 423.74 | 0.1648 | 928.00 |
| 434.27 | 0.1648 | 1149.00 |
| 444.60 | 0.1648 | 1402.00 |
| 387.47 | 0.2927 | 457.00 |
| 392.59 | 0.2927 | 522.00 |
| 402.81 | 0.2927 | 670.00 |
| 413.73 | 0.2927 | 862.00 |
| 423.88 | 0.2927 | 1073.00 |
| 434.14 | 0.2927 | 1328.00 |
| 444.76 | 0.2927 | 1631.00 |
| 382.41 | 0.5047 | 449.00 |
| 392.95 | 0.5047 | 597.00 |
| 402.88 | 0.5047 | 767.00 |
| 413.69 | 0.5047 | 993.00 |
| 423.89 | 0.5047 | 1251.00 |
| 434.29 | 0.5047 | 1551.00 |
| 444.69 | 0.5047 | 1929.00 |
| 382.15 | 0.6988 | 475.00 |
| 392.69 | 0.6988 | 633.00 |
| 403.08 | 0.6988 | 831.00 |
| 413.82 | 0.6988 | 1079.00 |
| 424.14 | 0.6988 | 1369.00 |
| 434.62 | 0.6988 | 1727.00 |
| 444.77 | 0.6988 | 2133.00 |
| 381.67 | 0.8571 | 475.00 |
| 391.99 | 0.8571 | 635.00 |
| 402.36 | 0.8571 | 836.00 |
| 412.76 | 0.8571 | 1087.00 |
| 423.27 | 0.8571 | 1394.00 |
| 433.72 | 0.8571 | 1767.00 |
| 444.13 | 0.8571 | 2228.00 |
| 382.39 | 0.9547 | 480.00 |
| 392.68 | 0.9547 | 640.00 |
| 402.95 | 0.9547 | 845.00 |
| 413.50 | 0.9547 | 1109.00 |
| 424.22 | 0.9547 | 1436.00 |
| 434.70 | 0.9547 | 1827.00 |
| 444.88 | 0.9547 | 2285.00 |
| 391.86 | 1.0000 | 619.00 |
| 402.26 | 1.0000 | 824.00 |
| 413.05 | 1.0000 | 1089.00 |
| 423.45 | 1.0000 | 1407.00 |
| 434.11 | 1.0000 | 1802.00 |
| 444.52 | 1.0000 | 2270.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Alcohol (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 402.94 | 0.0000 | 437.00 |
| 408.11 | 0.0000 | 495.00 |
| 413.27 | 0.0000 | 555.00 |
| 418.68 | 0.0000 | 628.00 |
| 423.61 | 0.0000 | 698.00 |
| 433.97 | 0.0000 | 863.00 |
| 444.51 | 0.0000 | 1064.00 |
| 392.62 | 0.1648 | 457.00 |
| 397.61 | 0.1648 | 517.00 |
| 402.75 | 0.1648 | 585.00 |
| 413.19 | 0.1648 | 740.00 |
| 423.74 | 0.1648 | 928.00 |
| 434.27 | 0.1648 | 1149.00 |
| 444.60 | 0.1648 | 1402.00 |
| 387.47 | 0.2927 | 457.00 |
| 392.59 | 0.2927 | 522.00 |
| 402.81 | 0.2927 | 670.00 |
| 413.73 | 0.2927 | 862.00 |
| 423.88 | 0.2927 | 1073.00 |
| 434.14 | 0.2927 | 1328.00 |
| 444.76 | 0.2927 | 1631.00 |
| 382.41 | 0.5047 | 449.00 |
| 392.95 | 0.5047 | 597.00 |
| 402.88 | 0.5047 | 767.00 |
| 413.69 | 0.5047 | 993.00 |
| 423.89 | 0.5047 | 1251.00 |
| 434.29 | 0.5047 | 1551.00 |
| 444.69 | 0.5047 | 1929.00 |
| 382.15 | 0.6988 | 475.00 |
| 392.69 | 0.6988 | 633.00 |
| 403.08 | 0.6988 | 831.00 |
| 413.82 | 0.6988 | 1079.00 |
| 424.14 | 0.6988 | 1369.00 |
| 434.62 | 0.6988 | 1727.00 |
| 444.77 | 0.6988 | 2133.00 |
| 381.67 | 0.8571 | 475.00 |
| 391.99 | 0.8571 | 635.00 |
| 402.36 | 0.8571 | 836.00 |
| 412.76 | 0.8571 | 1087.00 |
| 423.27 | 0.8571 | 1394.00 |
| 433.72 | 0.8571 | 1767.00 |
| 444.13 | 0.8571 | 2228.00 |
| 382.39 | 0.9547 | 480.00 |
| 392.68 | 0.9547 | 640.00 |
| 402.95 | 0.9547 | 845.00 |
| 413.50 | 0.9547 | 1109.00 |
| 424.22 | 0.9547 | 1436.00 |
| 434.70 | 0.9547 | 1827.00 |
| 444.88 | 0.9547 | 2285.00 |
| 391.86 | 1.0000 | 619.00 |
| 402.26 | 1.0000 | 824.00 |
| 413.05 | 1.0000 | 1089.00 |
| 423.45 | 1.0000 | 1407.00 |
| 434.11 | 1.0000 | 1802.00 |
| 444.52 | 1.0000 | 2270.00 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Methyl Alcohol (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 352.62 |
| 0.0450 | 348.55 |
| 0.0960 | 345.70 |
| 0.1900 | 341.66 |
| 0.2900 | 339.16 |
| 0.3950 | 337.57 |
| 0.5000 | 336.57 |
| 0.6050 | 336.01 |
| 0.7110 | 335.68 |
| 0.8140 | 335.71 |
| 0.9150 | 336.34 |
| 0.9660 | 337.04 |
| 1.0000 | 337.68 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Methyl Alcohol (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 352.62 |
| 0.0450 | 348.55 |
| 0.0960 | 345.70 |
| 0.1900 | 341.66 |
| 0.2900 | 339.16 |
| 0.3950 | 337.57 |
| 0.5000 | 336.57 |
| 0.6050 | 336.01 |
| 0.7110 | 335.68 |
| 0.8140 | 335.71 |
| 0.9150 | 336.34 |
| 0.9660 | 337.04 |
| 1.0000 | 337.68 |